{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "7eb4d562-881e-4157-aa98-a97948b989b2", "code": "C03BA11", "comments": "ATC|CARDIOVASCULAR SYSTEM|DIURETICS|LOW-CEILING DIURETICS, EXCL. THIAZIDES|Sulfonamides, plain|indapamide", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=C03BA11&showdescription=yes", "code_system": "WHO-ATC", "references": [ "966ba373-d73f-46f9-8318-11c7c03dd515" ] }, { "uuid": "3d700f52-2b5f-44a0-b07d-1a6c0519ebde", "code": "N0000175420", "comments": "Established Pharmacologic Class [EPC]|Thiazide-like Diuretic [EPC]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175420", "code_system": "NDF-RT", "references": [ "966ba373-d73f-46f9-8318-11c7c03dd515" ] }, { "uuid": "88dd6eda-ff86-458d-8721-973d1071aa26", "code": "N0000175359", "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Renal/Urological Activity Alteration [PE]|Diuresis Alteration [PE]|Increased Diuresis [PE]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175359", "code_system": "NDF-RT", "references": [ "966ba373-d73f-46f9-8318-11c7c03dd515" ] }, { "uuid": "eeb52c54-6e80-4f04-9ce7-a71b6a7d659f", "code": "QC09BX01", "comments": "VATC|AGENTS ACTING ON THE RENIN-ANGIOTENSIN SYSTEM|ACE INHIBITORS, COMBINATIONS|ACE inhibitors, other combinations|perindopril, amlodipine and indapamide", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC09BX01&showdescription=yes", "code_system": "WHO-VATC", "references": [ "966ba373-d73f-46f9-8318-11c7c03dd515" ] }, { "uuid": "7aa670f4-214f-4b3d-8ee8-607c7af80f76", "code": "QC03BA11", "comments": "VATC|DIURETICS|LOW-CEILING DIURETICS, EXCL. THIAZIDES|Sulfonamides, plain|indapamide", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC03BA11&showdescription=yes", "code_system": "WHO-VATC", "references": [ "966ba373-d73f-46f9-8318-11c7c03dd515" ] }, { "uuid": "aaddd0f9-a5b9-4712-a233-8d7048df9ec6", "code": "26807-65-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=26807-65-8", "code_system": "CAS", "references": [ "966ba373-d73f-46f9-8318-11c7c03dd515", "fa9af959-7437-440a-981b-86c82ce5c3f9" ] }, { "uuid": "a875795b-2351-42a0-ad2e-013b4f76c3f4", "code": "C29119", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29119", "code_system": "NCI_THESAURUS", "references": [ "966ba373-d73f-46f9-8318-11c7c03dd515" ] }, { "uuid": "60228751-a5ce-4617-a58e-fd5e4f2212d5", "code": "D007190", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68007190", "code_system": "MESH", "references": [ "966ba373-d73f-46f9-8318-11c7c03dd515" ] }, { "uuid": "9fb9be49-175c-4d47-b9e2-bf678a9887d4", "code": "503", "comments": "LiverTox|Cardiac|Diuretic|Thiazide", "type": "PRIMARY", "url": "https://livertox.nlm.nih.gov/ThiazideDiuretics.htm", "code_system": "LIVERTOX", "references": [ "966ba373-d73f-46f9-8318-11c7c03dd515" ] }, { "uuid": "59aab9bb-e74b-436a-8556-9b08fadc5e1e", "code": "INDAPAMIDE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Indapamide", "code_system": "WIKIPEDIA", "references": [ "966ba373-d73f-46f9-8318-11c7c03dd515" ] }, { "uuid": "ccbc1f22-62d4-4a95-9715-46bb81de38fc", "code": "C09BX01", "comments": "ATC|CARDIOVASCULAR SYSTEM|AGENTS ACTING ON THE RENIN-ANGIOTENSIN SYSTEM|ACE INHIBITORS, COMBINATIONS|ACE inhibitors, other combinations|perindopril, amlodipine and indapamide", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=C09BX01&showdescription=yes", "code_system": "WHO-ATC", "references": [ "966ba373-d73f-46f9-8318-11c7c03dd515" ] }, { "uuid": "a6f4d07a-e5fa-43ca-aa39-2065dcb4b45c", "code": "SUB08169MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "966ba373-d73f-46f9-8318-11c7c03dd515" ] }, { "uuid": "aea0af43-ab9c-4533-85e4-9e438fe958ac", "code": "3333", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3333", "code_system": "INN", "references": [ "966ba373-d73f-46f9-8318-11c7c03dd515" ] }, { "uuid": "4b8173d4-45fd-48f4-9375-7a1e9f13409a", "code": "248-012-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.043.633", "code_system": "ECHA (EC/EINECS)", "references": [ "966ba373-d73f-46f9-8318-11c7c03dd515" ] }, { "uuid": "6a32c4c9-e564-4bfd-aff7-d1152dba5050", "code": "7203", "type": "PRIMARY", "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7203", "code_system": "IUPHAR", "references": [ "966ba373-d73f-46f9-8318-11c7c03dd515" ] }, { "uuid": "b25561a0-a46c-418f-bad8-a4743d05ddd7", "code": "5764", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/5764/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "966ba373-d73f-46f9-8318-11c7c03dd515" ] }, { "uuid": "5b516320-4c7c-49a1-a10f-47a965359684", "code": "m6245", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m6245?q=authorize", "code_system": "MERCK INDEX", "references": [ "966ba373-d73f-46f9-8318-11c7c03dd515" ] }, { "uuid": "f6df715e-6857-4f96-aa7e-9348d6fca29f", "code": "DB00808", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB00808", "code_system": "DRUG BANK", "references": [ "966ba373-d73f-46f9-8318-11c7c03dd515" ] }, { "uuid": "94651ec8-c486-4539-adc5-faac4f39fdfb", "code": "CHEMBL406", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL406", "code_system": "ChEMBL", "references": [ "966ba373-d73f-46f9-8318-11c7c03dd515" ] }, { "uuid": "79d80e9b-46a5-4c81-8bff-becbe293f8ab", "code": "3702", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3702", "code_system": "PUBCHEM", "references": [ "966ba373-d73f-46f9-8318-11c7c03dd515" ] }, { "uuid": "8992ac30-bd33-7602-1337-f4070cfec240", "code": "DTXSID7044633", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7044633", "code_system": "EPA CompTox", "references": [ "f0e2f1fa-c4d7-64ae-d88c-71a813672d35" ] }, { "uuid": "27a072d9-b05d-c9e7-ec85-fcec4004ce19", "code": "C49185", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid[C78275]|Diuretic[C448]|Thiazide Diuretic", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C49185", "code_system": "NCI_THESAURUS", "references": [ "67a9e344-272f-2d62-9677-05a51fb9850a" ] }, { "uuid": "db728f84-f941-d079-5366-d48d87795463", "code": "C10BX13", "comments": "ATC|CARDIOVASCULAR SYSTEM|LIPID MODIFYING AGENTS|LIPID MODIFYING AGENTS, COMBINATIONS|HMG CoA reductase inhibitors, other combinations|rosuvastatin, perindopril and indapamide", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=C10BX13&showdescription=yes", "code_system": "WHO-ATC", "references": [ "67a9e344-272f-2d62-9677-05a51fb9850a" ] }, { "uuid": "84d36d21-1065-40d7-bdda-f7032892053d", "code": "F089I0511L", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "8da39767-c787-eba2-6719-9b7d09a0be8a", "code": "Indapamide", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM144/", "code_system": "LACTMED", "references": [ "67a9e344-272f-2d62-9677-05a51fb9850a" ] }, { "uuid": "12b18f15-19b4-72a2-8a41-c6c5c49eab66", "code": "1433", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/1433", "code_system": "DRUG CENTRAL", "references": [ "67a9e344-272f-2d62-9677-05a51fb9850a" ] }, { "uuid": "97076e40-cbc0-4d78-b1d7-b57ce01c9f09", "code": "1338801", "type": "PRIMARY", "url": "https://store.usp.org/product/1338801", "code_system": "RS_ITEM_NUM", "references": [ "67a9e344-272f-2d62-9677-05a51fb9850a" ] }, { "uuid": "a62eb769-dd26-1130-9670-6bc7be425c25", "code": "5893", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:5893", "code_system": "CHEBI", "references": [ "67a9e344-272f-2d62-9677-05a51fb9850a" ] }, { "uuid": "d7fd6c9d-1e69-8a89-ea05-38b7fb194315", "code": "100000092651", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "e1669e7b-3f38-98bb-2e38-d6fc5c0fb2f3" ] }, { "uuid": "89d45a69-c30b-af38-4e20-33a4f37b7e47", "code": "F089I0511L", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=F089I0511L", "code_system": "DAILYMED", "references": [ "87902fab-242f-00d3-5dba-ef44ce33a6ca" ] }, { "uuid": "9c6a2913-7837-cc7e-0d01-688b0c5e8c7f", "code": "757075", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=757075", "code_system": "NSC", "references": [ "e9fdbf18-d276-f1fd-e342-81a3f31a9b41" ] } ], "substance_class": "chemical", "references": [ { "uuid": "2f2f3156-2ef0-4872-8f49-cbf9f0f0e573", "citation": "USP Dictionary 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "40614086-8d6d-42da-b15d-90057b12f58b", "citation": "USP DICTIONARY 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "260c3096-8379-4f4b-9a41-52cd1887f26c", "citation": "INN Proposed List 29", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL29.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e799f8bd-38dc-4090-b6e9-fe6732ddbb53", "citation": "USP DICTIONARY 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3d8748bd-3532-4d4b-9e7b-51d707ae0cec", "citation": "EP 7.2", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "18c73619-708d-4a42-bb1c-0a98bdafa61c", "citation": "USP 33", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "87dee3bf-3dfb-464a-92bd-cbfad75cc540", "citation": "KEGG 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ce8b30b2-c747-4928-ad0e-cb223ab25ffd", "citation": "ORANGE BOOK 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ba91a53e-09eb-49fc-8de2-839eb8146dcb", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "cc3fdcb4-5b14-4a6a-a1aa-6d1c933ee1a0", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a1f47d4c-fa1b-45a4-9748-f182f21a7b86", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "96b1a8c6-f952-420e-87fe-15b5ad3658b5", "citation": "NDF-RT", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4489fac0-843b-414d-8bc7-7f4f416f1bfd", "citation": "https://mc.usp.org/sites/default/files/documents/ValidationReport/2012-05-24%20Indapamide%20Summary%", "url": "https://mc.usp.org/sites/default/files/documents/ValidationReport/2012-05-24%20Indapamide%20Summary%", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9e7d6a85-0a13-449e-91e2-cb5a160b1c9b", "citation": "SCIFINDER", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fd98895b-58be-4ed6-bc75-b92787064f54", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "966ba373-d73f-46f9-8318-11c7c03dd515", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390876000, "tags": [ "NOMEN" ] }, { "uuid": "070a44b0-21a7-428c-a8ef-cf041566209f", "citation": "EP 7.8 INDAPAMIDE MONOGRAPH", "doc_type": "EUROPEAN PHARMACOPEIA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "eccdb7db-20cb-4c84-bcbd-84fad52ce216", "citation": "USP 36 INDAPAMIDE MONOGRAPH", "doc_type": "USP", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4429a8dc-12c9-4027-b278-7f4da1bd5212", "citation": "USP-MC", "url": "https://mc.usp.org/monographs/indapamide-1-0", "doc_type": "USP-MC", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ed671e05-6cfb-4f13-9a5b-9217d8fac364", "citation": "SRS import [F089I0511L]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=F089I0511L", "doc_type": "SRS", "public_domain": true, "document_date": 1493390876000, "tags": [ "NOMEN" ] }, { "uuid": "6b6fd21e-d934-438e-81d1-12a5cbff5c30", "citation": "INDAPAMIDE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "23323bf4-f23e-469b-be78-6c4627be6066", "citation": "INDAPAMIDE [USAN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "70652fa1-b329-43c6-a50b-d9c98eec00f1", "citation": "INDAPAMIDE [EP]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "a27c86b7-96ec-4b9a-abbf-5d97624810fb", "citation": "INDAPAMIDE [USP]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "e6fbdf23-a8ea-4d05-82bd-ab8bdab138b4", "citation": "INDAPAMIDE [JAN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "d7ce54dd-16e4-4798-b160-bc4313ca02d0", "citation": "INDAPAMIDE [ORANGE BOOK]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "dd4e6a46-c20c-41f5-8b9a-d8c8eb3ab7eb", "citation": "INDAPAMIDE [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "6ae64939-362f-4cf1-b450-2e423f4878bf", "citation": "INDAPAMIDE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "3d0934cb-4be2-49da-823c-d5b54da754a2", "citation": "INDAPAMIDE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "dbedda71-ee4e-407d-857b-c4b0e90f28cd", "citation": "INDAPAMIDE [VANDF]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "6b26e9df-9c84-4f66-856f-844ea9c79162", "citation": "INDAPAMIDE [USP-RS]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "f0e2f1fa-c4d7-64ae-d88c-71a813672d35", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=26807-65-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d94a3b72-fac9-10c6-27b9-3985704b7a51", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+26807-65-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "67a9e344-272f-2d62-9677-05a51fb9850a", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "6ab704a7-7681-4c56-bd1d-1331fa54d3c1", "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/label/2021/018538s030lbl.pdf", "doc_type": "FDA APPROVED DRUG LABEL", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "fa9af959-7437-440a-981b-86c82ce5c3f9", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "111e0c69-d39b-770a-b5f5-06c169812716", "citation": "USP 10/2020", "doc_type": "USPNF", "public_domain": true }, { "uuid": "e9fdbf18-d276-f1fd-e342-81a3f31a9b41", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "8b855e07-02d0-4389-3e18-dd7f44af0bc2", "citation": "EP 10.5", "doc_type": "EP", "public_domain": true }, { "uuid": "dcf6bded-a035-4969-bf42-d867c86de854", "citation": "EP 10.5", "doc_type": "EP", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "3bd86085-69b4-404b-9d90-aee49aaddae2", "citation": "EP 10.5", "doc_type": "EP", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b51dd6bd-08aa-473a-9aae-5ae251dcfb68", "citation": "USP-MC", "url": "https://mc.usp.org/monographs/indapamide-1-0", "doc_type": "USP-MC", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "542943c4-cecc-4e6e-9749-0b73961b3f68", "citation": "EP 10.5", "doc_type": "EP", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "27aba621-ab9a-82fc-5ee9-8a901b6bd50f", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "87902fab-242f-00d3-5dba-ef44ce33a6ca", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "f111970d-b81c-49d7-880f-f68491b3a0a0", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "e1669e7b-3f38-98bb-2e38-d6fc5c0fb2f3", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "be04fc0e-12f1-4e09-b2a2-669afd2d058f", "citation": "Sassard, J., A. Bataillard, and H. McIntyre. \"An overview of the pharmacology and clinical efficacy of indapamide sustained release.\" Fundamental & clinical pharmacology 19.6 (2005): 637-645.", "url": "https://onlinelibrary.wiley.com/doi/10.1111/j.1472-8206.2005.00377.x", "doc_type": "JA", "public_domain": true }, { "uuid": "7d3f978c-07a4-46e7-8fca-34284145f9a1", "citation": "https://classic.clinicaltrials.gov/ct2/show/NCT05878561", "url": "https://classic.clinicaltrials.gov/ct2/show/NCT05878561", "doc_type": "CLINICAL_TRIALS.GOV", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "7ec594fc-c8d4-4229-a225-52b7cabe6c80", "id": "7ec594fc-c8d4-4229-a225-52b7cabe6c80", "molfile": "\n Marvin 03132309382D \n\n 24 26 0 0 0 0 999 V2000\n 14.0798 -1.8807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2548 -1.8807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7699 -1.2132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9852 -1.4682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9852 -2.2932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2709 -2.7057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5563 -2.2932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5563 -1.4682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2709 -1.0557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7699 -2.5481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0248 -3.3327 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4728 -3.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6659 -3.7743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7277 -4.7305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1757 -5.3435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4306 -6.1282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2376 -6.2997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4926 -7.0843 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7897 -5.6866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5348 -4.9020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5966 -5.8581 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7681 -5.0512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4251 -6.6651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4036 -6.0297 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 10 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 4 9 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 10 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 20 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 19 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 2 0 0 0 0\n 21 24 2 0 0 0 0\nM END", "smiles": "CC1Cc2ccccc2N1NC(=O)c3ccc(c(c3)S(=O)(=O)N)Cl", "formula": "C16H16ClN3O3S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c3c65514-d184-4673-8209-511262589b5b" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "365.8362", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "d80b6e5d-02b1-4997-965f-1b5700498d3d", "version": "43", "structure": { "id": "70277dc4-22c6-46e9-9bd8-8e952a970aed", "molfile": "\n JSDraw203132309382D\n\n 24 26 0 0 0 0 0 V2000\n 21.3354 -4.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.8703 -5.4959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.3922 -5.9948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4100 -7.5549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.8991 -8.0200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2408 -9.5420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0935 -10.5990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6044 -10.1339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2627 -8.6117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.8015 -6.7474 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 23.3614 -6.7296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 24.1568 -8.0716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.3923 -9.4315 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.7168 -8.0539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5120 -9.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0720 -9.3781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8365 -8.0183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.3964 -8.0005 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0411 -6.6763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.4813 -6.6940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8056 -5.3164 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4459 -4.5520 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1655 -6.0809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5703 -3.9566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 4 9 1 0 0 0 0\n 5 10 1 0 0 0 0\n 2 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 14 20 1 0 0 0 0\n 19 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 2 0 0 0 0\n 21 24 2 0 0 0 0\nM END", "smiles": "CC1Cc2ccccc2N1NC(=O)c3ccc(c(c3)S(=O)(=O)N)Cl", "formula": "C16H16ClN3O3S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "365.8362", "optical_activity": "( + / - )", "references": [ "ed671e05-6cfb-4f13-9a5b-9217d8fac364", "2f2f3156-2ef0-4872-8f49-cbf9f0f0e573", "260c3096-8379-4f4b-9a41-52cd1887f26c" ], "stereo_centers": 1 }, "unii": "F089I0511L", "relationships": [ { "uuid": "4a43628f-e0e2-4902-9803-6f7f7bdf7e03", "amount": { "uuid": "8954cd3a-f57d-46bd-8aa4-01963b489808" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "73c09295-79d1-45bd-86b3-e79d2c5f391f", "refuuid": "d80b6e5d-02b1-4997-965f-1b5700498d3d", "name": "INDAPAMIDE", "unii": "F089I0511L", "linking_id": "F089I0511L", "ref_pname": "INDAPAMIDE", "substance_class": "reference" } }, { "uuid": "6f4e0444-c339-4080-ab51-7c3a683e2b18", "amount": { "uuid": "03852005-6bff-4cc7-aeda-91cd8dfc6b5e" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "e1609583-154c-4be0-bca3-3d9665cb7ddd", "refuuid": "aca42f99-ac82-4d44-8a8d-627c14457b97", "name": "INDAPAMIDE HEMIHYDRATE", "unii": "W0LY35K007", "linking_id": "W0LY35K007", "ref_pname": "INDAPAMIDE HEMIHYDRATE", "substance_class": "reference" } }, { "uuid": "51c74d33-39e2-416f-b040-62f0faf6d580", "amount": { "uuid": "17d6b9a5-6bdb-49d6-a77f-d9c497dbdbe5", "type": "RELATIONSHIP_AMOUNT", "units": "WEIGHT PERCENT", "high_limit": 102, "low_limit": 98 }, "qualification": "EP", "type": "BASIS OF STRENGTH->SUBSTANCE", "interaction_type": "ASSAY (HPLC)", "references": [ "070a44b0-21a7-428c-a8ef-cf041566209f" ], "related_substance": { "uuid": "f52615fc-0236-4998-8b0e-56900f1aade7", "refuuid": "d80b6e5d-02b1-4997-965f-1b5700498d3d", "name": "INDAPAMIDE", "unii": "F089I0511L", "linking_id": "F089I0511L", "ref_pname": "INDAPAMIDE", "substance_class": "reference" } }, { "uuid": "df3ceac0-edf3-44f4-8ef1-4d8658ea85df", "amount": { "uuid": "97ef41ce-d7c9-4695-81c0-09b1fd0d3567", "type": "RELATIONSHIP_AMOUNT", "units": "WEIGHT PERCENT", "high_limit": 101, "low_limit": 98 }, "qualification": "USP", "type": "BASIS OF STRENGTH->SUBSTANCE", "interaction_type": "ASSAY (HPLC)", "references": [ "eccdb7db-20cb-4c84-bcbd-84fad52ce216" ], "related_substance": { "uuid": "721909a7-5fae-427c-a918-0a9eeff98d24", "refuuid": "d80b6e5d-02b1-4997-965f-1b5700498d3d", "name": "INDAPAMIDE", "unii": "F089I0511L", "linking_id": "F089I0511L", "ref_pname": "INDAPAMIDE", "substance_class": "reference" } }, { "uuid": "4161aae6-88e8-4903-81fe-ff2ef02b6a12", "amount": { "uuid": "e0136203-31da-416b-b052-58ed23695b21", "units": "PERCENT PEAK AREA", "high_limit": 0.3 }, "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "dcf6bded-a035-4969-bf42-d867c86de854" ], "related_substance": { "uuid": "bac2e081-7b47-4ccb-995f-7c833c8bed78", "refuuid": "731f8037-4cf0-491d-9b25-73c9c3723cfa", "name": "DEHYDROINDAPAMIDE", "unii": "AZ0ETT16DT", "linking_id": "AZ0ETT16DT", "ref_pname": "DEHYDROINDAPAMIDE", "substance_class": "reference" } }, { "uuid": "6eb3813a-6c5f-4cb6-b7bf-4fcf60f4ed3a", "amount": { "uuid": "0eafa931-00b3-413f-81ee-7488ebf165d7", "type": "RELATIONSHIP_AMOUNT", "units": "PERCENT PEAK AREA", "high_limit": 0.3 }, "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "070a44b0-21a7-428c-a8ef-cf041566209f" ], "related_substance": { "uuid": "87d5e152-ec64-4207-ad99-3f477a3eab19", "refuuid": "731f8037-4cf0-491d-9b25-73c9c3723cfa", "name": "DEHYDROINDAPAMIDE", "unii": "AZ0ETT16DT", "linking_id": "AZ0ETT16DT", "ref_pname": "DEHYDROINDAPAMIDE", "substance_class": "reference" } }, { "uuid": "44a25de4-131f-4577-b651-d5bb8768bffd", "amount": { "uuid": "c3a05624-fef1-4f27-af65-092324f71e4a" }, "type": "IMPURITY->PARENT", "references": [ "4429a8dc-12c9-4027-b278-7f4da1bd5212" ], "related_substance": { "uuid": "b8aee37c-4909-4d0b-b279-033e0a8f6d27", "refuuid": "7eed54f7-4811-4753-b732-ef3f9732abf9", "name": "2-METHYLINDOLINE", "unii": "5GAL2SM4VV", "linking_id": "5GAL2SM4VV", "ref_pname": "2-METHYLINDOLINE", "substance_class": "reference" } }, { "uuid": "71d409e2-2a85-470f-8242-2888ae45f4a5", "amount": { "uuid": "8ad36908-ab11-4137-822f-01b8e1c8c271", "units": "PPM", "high_limit": 5 }, "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "b51dd6bd-08aa-473a-9aae-5ae251dcfb68", "542943c4-cecc-4e6e-9749-0b73961b3f68" ], "related_substance": { "uuid": "027f8da1-c723-410c-aa78-1fa1d21499d9", "refuuid": "204931aa-856d-4174-be55-bdfad747d65b", "name": "2-METHYL-1-NITROSO-2,3-DIHYDRO-1H-INDOLE", "unii": "W2W4GKG0JX", "linking_id": "W2W4GKG0JX", "ref_pname": "2-METHYL-1-NITROSO-2,3-DIHYDRO-1H-INDOLE", "substance_class": "reference" } }, { "uuid": "e9b48059-4bc0-4d7d-9a07-d8aaaa23d58d", "amount": { "uuid": "8f2e3830-9a77-46c1-9080-463bd9dbd6a5", "type": "RELATIONSHIP_AMOUNT", "units": "PPM", "high_limit": 5 }, "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "070a44b0-21a7-428c-a8ef-cf041566209f" ], "related_substance": { "uuid": "f75dddfc-446a-4e65-8441-76431a9ea51f", "refuuid": "204931aa-856d-4174-be55-bdfad747d65b", "name": "2-METHYL-1-NITROSO-2,3-DIHYDRO-1H-INDOLE", "unii": "W2W4GKG0JX", "linking_id": "W2W4GKG0JX", "ref_pname": "2-METHYL-1-NITROSO-2,3-DIHYDRO-1H-INDOLE", "substance_class": "reference" } }, { "uuid": "1b138336-9f29-4842-9fa6-1ec23192a3d2", "amount": { "uuid": "c347398a-82fa-4315-ad33-4810423a116e" }, "type": "ENANTIOMER->RACEMATE", "related_substance": { "uuid": "149011e1-d49b-47f5-8c66-4acee3aa73f0", "refuuid": "57b3c5fc-4fd2-4385-bf97-c4eba35186fd", "name": "INDAPAMIDE, (R)-", "unii": "SGU94ZAH05", "linking_id": "SGU94ZAH05", "ref_pname": "INDAPAMIDE, (R)-", "substance_class": "reference" } }, { "uuid": "4a0ec25d-6c92-4149-a4e1-d0bd5c52fc0d", "amount": { "uuid": "587f4269-c167-40df-8f74-02ccef15f0d7" }, "type": "ENANTIOMER->RACEMATE", "related_substance": { "uuid": "75f0c1e3-63a9-485b-8e11-d1bce494f110", "refuuid": "3ef110d0-5ea8-4cbc-87b1-47ae12cfeb82", "name": "INDAPAMIDE, (S)-", "unii": "GDV888123I", "linking_id": "GDV888123I", "ref_pname": "INDAPAMIDE, (S)-", "substance_class": "reference" } }, { "uuid": "72161a76-41a0-49eb-944f-6fa5f6b7cf5d", "amount": { "uuid": "bf8fd9b1-9813-4f6e-a261-b586afc3729f" }, "type": "METABOLITE->PARENT", "related_substance": { "uuid": "3a749493-d739-4971-9859-fa3365b46f5d", "refuuid": "2f3fdcfa-7db6-4acf-9825-a4b23e8852c6", "name": "METHYL 4-CHLORO-3-SULFAMOYLBENZOATE", "unii": "U2RK5VGH48", "linking_id": "U2RK5VGH48", "ref_pname": "METHYL 4-CHLORO-3-SULFAMOYLBENZOATE" } }, { "uuid": "464385ce-9f81-42ea-b655-95a57ac9f407", "amount": { "uuid": "495f870d-ae63-430e-8953-3d111b68a24f", "units": "PPM", "high_limit": 600 }, "qualification": "EP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "3bd86085-69b4-404b-9d90-aee49aaddae2" ], "related_substance": { "uuid": "6a1f2d2a-507d-4852-acc7-86ee52401256", "refuuid": "bb096a2b-0714-4ca5-b669-d57ea2099fb6", "name": "1-Amino-2-methylindoline", "unii": "P2VAJ6432U", "linking_id": "P2VAJ6432U", "ref_pname": "1-Amino-2-methylindoline" } }, { "uuid": "dffbdd6b-7213-d39d-ac4f-acd6824e5e67", "amount": { "uuid": "420efda1-10e3-4cb7-a2c8-6d92c03532ec" }, "type": "SOLVATE->ANHYDROUS", "references": [ "fa9af959-7437-440a-981b-86c82ce5c3f9" ], "related_substance": { "uuid": "ba611a29-9b52-44c8-a59f-882305b62c75", "refuuid": "aca42f99-ac82-4d44-8a8d-627c14457b97", "name": "INDAPAMIDE HEMIHYDRATE", "unii": "W0LY35K007", "linking_id": "W0LY35K007", "ref_pname": "INDAPAMIDE HEMIHYDRATE" } }, { "uuid": "743618bd-4022-4e96-969a-e704cde4d245", "amount": { "uuid": "7a30c9f5-50fe-46f2-8ce9-9b4aca180125", "high": 79, "low": 71, "units": "%" }, "comments": "From 71 to 79% of the Lozol in plasma is reversibly bound to plasma\nproteins.", "type": "BINDER->LIGAND", "interaction_type": "REVERSIBLE", "references": [ "6ab704a7-7681-4c56-bd1d-1331fa54d3c1" ], "related_substance": { "uuid": "c959655f-87b6-42cb-a5b0-495a974ebf16", "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30", "name": "PLASMA PROTEIN FRACTION (HUMAN)", "unii": "6D53G0FD0Z", "linking_id": "6D53G0FD0Z", "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)", "substance_class": "reference" } }, { "uuid": "4f249339-5ec1-4288-955e-482eb19c6d16", "amount": { "uuid": "3ebd3447-162b-47e6-8090-181ef451ce6f", "average": 7, "units": "%", "non_numeric_value": "total dose administeres" }, "comments": "Lozol is an extensively metabolized drug, with only about 7% of the total dose administered,\nrecovered in the urine as unchanged drug during the first 48 hours after administration.", "type": "EXCRETED UNCHANGED", "references": [ "6ab704a7-7681-4c56-bd1d-1331fa54d3c1" ], "related_substance": { "uuid": "881962ff-332a-4d71-b770-4f03246f254b", "refuuid": "d80b6e5d-02b1-4997-965f-1b5700498d3d", "name": "INDAPAMIDE", "unii": "F089I0511L", "linking_id": "F089I0511L", "ref_pname": "INDAPAMIDE", "substance_class": "reference" } }, { "uuid": "e5dd9c89-becd-48a8-b5f6-521540eebff6", "amount": { "uuid": "50e44d1c-d861-49bc-9dd5-3fdc02b5b729" }, "comments": " indapamide has both diuretic and vasodilator properties. A low urinary excretion and specific accumulation into arterial smooth muscle of this lipophilic molecule may provide a rationale for this dual activity.", "type": "TARGET->INHIBITOR", "references": [ "be04fc0e-12f1-4e09-b2a2-669afd2d058f" ], "related_substance": { "uuid": "d4fb53b3-8a1e-4335-b9e4-cc2a798ba2d0", "refuuid": "8fa0b735-3029-4fdf-ac9b-8de18ac25e80", "name": "SOLUTE CARRIER FAMILY 12 MEMBER 3", "unii": "X8CS9QK0G8", "linking_id": "X8CS9QK0G8", "ref_pname": "SOLUTE CARRIER FAMILY 12 MEMBER 3", "substance_class": "reference" } } ], "names": [ { "uuid": "8fbc3ff8-1e44-4b2a-bb25-2a020b2e3eea", "name": "4-Chloro-N-(2-methyl-1-indolinyl)-3-sulfamoylbenzamide", "stdName": "4-CHLORO-N-(2-METHYL-1-INDOLINYL)-3-SULFAMOYLBENZAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "40614086-8d6d-42da-b15d-90057b12f58b" ], "display_name": false }, { "uuid": "9192bb66-df21-4bbb-b941-4924401d954f", "name": "ARIFON", "stdName": "ARIFON", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "fd98895b-58be-4ed6-bc75-b92787064f54" ], "display_name": false }, { "uuid": "6a67f66f-0592-41e5-9d7e-72c119a5fcc7", "name": "BAJATEN", "stdName": "BAJATEN", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "fd98895b-58be-4ed6-bc75-b92787064f54" ], "display_name": false }, { "uuid": "d1e99762-fd88-4050-a801-5797b1f491d9", "name": "BR-1015 component Indapamide", "stdName": "BR-1015 COMPONENT INDAPAMIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7d3f978c-07a4-46e7-8fca-34284145f9a1" ], "display_name": false }, { "uuid": "a14643b6-15ae-4e6b-8b1b-7e3306162977", "name": "DAMIDE", "stdName": "DAMIDE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "fd98895b-58be-4ed6-bc75-b92787064f54" ], "display_name": false }, { "uuid": "89607fc8-78af-494c-9955-961dd1345397", "name": "FLUBEST", "stdName": "FLUBEST", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "fd98895b-58be-4ed6-bc75-b92787064f54" ], "display_name": false }, { "uuid": "82af60b0-5456-4cb4-a4b4-f75178b5c1e0", "name": "FLUDEX", "stdName": "FLUDEX", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "fd98895b-58be-4ed6-bc75-b92787064f54" ], "display_name": false }, { "uuid": "b6611914-15ef-4ab7-a6b0-b26dbd3ae2c1", "name": "FLUDIN", "stdName": "FLUDIN", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "fd98895b-58be-4ed6-bc75-b92787064f54" ], "display_name": false }, { "uuid": "a13d7ce8-008c-44b1-a18d-f68d26c9f166", "name": "FLUPAMID", "stdName": "FLUPAMID", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "9e7d6a85-0a13-449e-91e2-cb5a160b1c9b" ], "display_name": false }, { "uuid": "99b259d6-432e-450d-a94c-9f7c411854db", "name": "INDAFLEX", "stdName": "INDAFLEX", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "fd98895b-58be-4ed6-bc75-b92787064f54" ], "display_name": false }, { "uuid": "ba4df2c9-d00d-471e-afe4-afd9f3f8cc26", "name": "INDAMIDE", "stdName": "INDAMIDE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "fd98895b-58be-4ed6-bc75-b92787064f54" ], "display_name": false }, { "uuid": "846adaaa-cbb0-4b5a-a6d4-54caaba03855", "name": "INDAMOL", "stdName": "INDAMOL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "fd98895b-58be-4ed6-bc75-b92787064f54" ], "display_name": false }, { "uuid": "29548d09-f95c-4577-b6f0-9a0e9e608dd2", "name": "INDAPAMIDE", "stdName": "INDAPAMIDE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "e799f8bd-38dc-4090-b6e9-fe6732ddbb53", "3d8748bd-3532-4d4b-9e7b-51d707ae0cec", "dbedda71-ee4e-407d-857b-c4b0e90f28cd", "260c3096-8379-4f4b-9a41-52cd1887f26c", "dd4e6a46-c20c-41f5-8b9a-d8c8eb3ab7eb", "18c73619-708d-4a42-bb1c-0a98bdafa61c", "4489fac0-843b-414d-8bc7-7f4f416f1bfd", "e6fbdf23-a8ea-4d05-82bd-ab8bdab138b4", "3d0934cb-4be2-49da-823c-d5b54da754a2", "23323bf4-f23e-469b-be78-6c4627be6066", "ce8b30b2-c747-4928-ad0e-cb223ab25ffd", "a1f47d4c-fa1b-45a4-9748-f182f21a7b86", "2f2f3156-2ef0-4872-8f49-cbf9f0f0e573", "87dee3bf-3dfb-464a-92bd-cbfad75cc540", "6ae64939-362f-4cf1-b450-2e423f4878bf", "d7ce54dd-16e4-4798-b160-bc4313ca02d0", "6b26e9df-9c84-4f66-856f-844ea9c79162", "6b6fd21e-d934-438e-81d1-12a5cbff5c30", "cc3fdcb4-5b14-4a6a-a1aa-6d1c933ee1a0", "ba91a53e-09eb-49fc-8de2-839eb8146dcb", "96b1a8c6-f952-420e-87fe-15b5ad3658b5", "70652fa1-b329-43c6-a50b-d9c98eec00f1", "a27c86b7-96ec-4b9a-abbf-5d97624810fb" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "ff26d3a3-d33b-4801-9bd3-4b6211219533", "name_org": "INN" }, { "uuid": "25640c42-7d2c-478f-a489-f1948dc05604", "name_org": "USAN" } ] }, { "uuid": "b4f6e507-03ff-f60d-ac62-1a572831946c", "name": "INDAPAMIDE [EP MONOGRAPH]", "stdName": "INDAPAMIDE [EP MONOGRAPH]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8b855e07-02d0-4389-3e18-dd7f44af0bc2" ], "display_name": false }, { "uuid": "2452734a-4834-422a-b47f-acd0b506a7e7", "name": "INDAPAMIDE [JAN]", "stdName": "INDAPAMIDE [JAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "87dee3bf-3dfb-464a-92bd-cbfad75cc540" ], "display_name": false }, { "uuid": "aac8b064-e06f-4c33-b4df-5e769b1e15cf", "name": "INDAPAMIDE [MART.]", "stdName": "INDAPAMIDE [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ba91a53e-09eb-49fc-8de2-839eb8146dcb" ], "display_name": false }, { "uuid": "408f5154-132f-4901-924f-5e585300444c", "name": "INDAPAMIDE [MI]", "stdName": "INDAPAMIDE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "cc3fdcb4-5b14-4a6a-a1aa-6d1c933ee1a0" ], "display_name": false }, { "uuid": "e7e58f77-7cd1-427d-a891-de2cdf4ca131", "name": "INDAPAMIDE [ORANGE BOOK]", "stdName": "INDAPAMIDE [ORANGE BOOK]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ce8b30b2-c747-4928-ad0e-cb223ab25ffd" ], "display_name": false }, { "uuid": "12535e59-b287-4de0-8e6a-b4c8d0a04eab", "name": "INDAPAMIDE [USAN]", "stdName": "INDAPAMIDE [USAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e799f8bd-38dc-4090-b6e9-fe6732ddbb53" ], "display_name": false }, { "uuid": "a0f89376-32b2-6108-2d5c-927ae8b2a339", "name": "INDAPAMIDE [USP MONOGRAPH]", "stdName": "INDAPAMIDE [USP MONOGRAPH]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "111e0c69-d39b-770a-b5f5-06c169812716" ], "display_name": false }, { "uuid": "c163bc29-a791-4c29-b85b-501dd40a7243", "name": "INDAPAMIDE [USP-RS]", "stdName": "INDAPAMIDE [USP-RS]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4489fac0-843b-414d-8bc7-7f4f416f1bfd" ], "display_name": false }, { "uuid": "7aae32d7-253e-4eb6-a6d8-6c10067acfc2", "name": "INDAPAMIDE [VANDF]", "stdName": "INDAPAMIDE [VANDF]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "96b1a8c6-f952-420e-87fe-15b5ad3658b5" ], "display_name": false }, { "uuid": "060c325a-eb11-4a9f-a9aa-551f1deec19a", "name": "IPAMIX", "stdName": "IPAMIX", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "fd98895b-58be-4ed6-bc75-b92787064f54" ], "display_name": false }, { "uuid": "5edd2ea7-2ba5-c7ff-5a2c-5cd15daefda0", "name": "Indapamide [WHO-DD]", "stdName": "INDAPAMIDE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "27aba621-ab9a-82fc-5ee9-8a901b6bd50f" ], "display_name": false }, { "uuid": "73e8cb6b-8d34-4fbc-98d0-37933c0b581b", "name": "KYD-041", "stdName": "KYD-041", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "9e7d6a85-0a13-449e-91e2-cb5a160b1c9b" ], "display_name": false }, { "uuid": "b5427702-9096-4381-927b-3a4cdd4ed6f6", "name": "LORVAS", "stdName": "LORVAS", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "fd98895b-58be-4ed6-bc75-b92787064f54" ], "display_name": false }, { "uuid": "a960aa1f-70ca-4c7a-9f59-c897b6aed9d4", "name": "LOZOL", "stdName": "LOZOL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "40614086-8d6d-42da-b15d-90057b12f58b" ], "display_name": false }, { "uuid": "6e009c53-91a2-48da-a1e8-432d84fe1faf", "name": "NATRILIX", "stdName": "NATRILIX", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "fd98895b-58be-4ed6-bc75-b92787064f54" ], "display_name": false }, { "uuid": "9dcb1082-ddcd-4db5-b927-341e75461aa6", "name": "NATRIX", "stdName": "NATRIX", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "fd98895b-58be-4ed6-bc75-b92787064f54" ], "display_name": false }, { "uuid": "3212d863-7371-4ba4-925a-21f42e96d6f2", "name": "NORANAT", "stdName": "NORANAT", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "9e7d6a85-0a13-449e-91e2-cb5a160b1c9b" ], "display_name": false }, { "uuid": "56ad3eb2-d7a7-4b77-8b80-0f03d4e2b080", "name": "NSC-757075", "stdName": "NSC-757075", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "e9fdbf18-d276-f1fd-e342-81a3f31a9b41" ], "display_name": false }, { "uuid": "ef0c4c26-301a-487b-aa52-ef7541a5dcbd", "name": "S-1520", "stdName": "S-1520", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "9e7d6a85-0a13-449e-91e2-cb5a160b1c9b" ], "display_name": false }, { "uuid": "4c76a682-ac67-4a14-918d-df7420d707d0", "name": "SE-1520", "stdName": "SE-1520", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "9e7d6a85-0a13-449e-91e2-cb5a160b1c9b" ], "display_name": false }, { "uuid": "7bd5c7dd-4b7d-49ba-b642-0db12ca2219d", "name": "TANDIX", "stdName": "TANDIX", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9e7d6a85-0a13-449e-91e2-cb5a160b1c9b" ], "display_name": false }, { "uuid": "910aeab3-f737-4c5c-9fd1-85eb5f79ad13", "name": "TERTENSIF", "stdName": "TERTENSIF", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "9e7d6a85-0a13-449e-91e2-cb5a160b1c9b" ], "display_name": false }, { "uuid": "f49471e1-1c7a-4be0-ac7a-d7e02726b1ea", "name": "VEROXIL", "stdName": "VEROXIL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "9e7d6a85-0a13-449e-91e2-cb5a160b1c9b" ], "display_name": false }, { "uuid": "619f6456-0399-48a3-bdfb-fc3dded12c97", "name": "indapamide [INN]", "stdName": "INDAPAMIDE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "260c3096-8379-4f4b-9a41-52cd1887f26c" ], "display_name": false } ], "properties": [ { "uuid": "7b7a118c-63b8-4bba-b51f-a4428b3bfea4", "name": "Biological Half-life", "value": { "uuid": "0adce03d-37c6-4b87-b262-6235d5035e8f", "high": 26, "low": 14, "units": "hours" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "6ab704a7-7681-4c56-bd1d-1331fa54d3c1" ] }, { "uuid": "e8ed062b-aa23-49f1-b448-e46e1c35fd9d", "name": "Tmax", "value": { "uuid": "cdef4a10-c188-4949-8523-845c093d2980", "average": 2, "units": "hours" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "6ab704a7-7681-4c56-bd1d-1331fa54d3c1" ] } ], "modifications": { "uuid": "13c817f8-ee55-4b2b-a4a7-68294ecc9f77" } } ] }