{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7bc9a559-1966-4c0c-a342-2e7ffe42763a",
          "code": "602-87-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=602-87-9",
          "code_system": "CAS",
          "references": [
            "69d6435c-24db-4f33-b875-cb274a6e6d7d",
            "d2c57715-2b5b-458b-aae1-985d2146e5c0"
          ]
        },
        {
          "uuid": "eba38c8a-fc03-462f-a049-3ba3800c2ef0",
          "code": "210-025-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.009.114",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "69d6435c-24db-4f33-b875-cb274a6e6d7d"
          ]
        },
        {
          "uuid": "0a89b0fc-1dab-4948-8461-0efcc7652778",
          "code": "11769",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11769",
          "code_system": "PUBCHEM",
          "references": [
            "69d6435c-24db-4f33-b875-cb274a6e6d7d"
          ]
        },
        {
          "uuid": "de05fbea-891e-099c-6665-5c0307b4db5d",
          "code": "4092",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/4092",
          "code_system": "HSDB",
          "references": [
            "efc6e916-8396-6fde-7791-a7e9adbf0488"
          ]
        },
        {
          "uuid": "1883b91b-eb62-c7a6-1d46-a90ba74c7556",
          "code": "DTXSID3020960",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3020960",
          "code_system": "EPA CompTox",
          "references": [
            "74c784e6-8ab5-cb62-8d1b-00d3870ff865"
          ]
        },
        {
          "uuid": "1b76af9e-3236-403f-b056-1e5af111eb74",
          "code": "F023F6C79X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c58e1b12-af81-caee-9615-709a950d6137",
          "code": "22421",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=22421",
          "code_system": "NSC",
          "references": [
            "f6fddfca-80c8-b8ce-4f31-0ea30170d099"
          ]
        },
        {
          "uuid": "0155e65c-8dd5-e9f5-249c-aac2c706c428",
          "code": "1312",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=1312",
          "code_system": "NSC",
          "references": [
            "f6fddfca-80c8-b8ce-4f31-0ea30170d099"
          ]
        },
        {
          "uuid": "9e81534d-b4a5-962f-707c-f389db351881",
          "code": "300000053053",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b746017a-9322-4961-81e4-ec19a7bcefb6"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f9dc7707-bd11-4796-9a6f-2da30a23477e",
          "name": "5-NITROACENAPHTHENE",
          "stdName": "5-NITROACENAPHTHENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9cd6e6f-9270-4b04-9231-c88595c7ee0e",
            "26f2b04c-dcdc-4203-9c62-2304ee81dcec",
            "75e3da7e-c5d0-4747-b63b-24572413acd0",
            "4b42e77b-bdc7-47ee-9142-71cde0560100"
          ],
          "display_name": true
        },
        {
          "uuid": "de7307d8-c21d-4f72-9e4a-2883b3edb088",
          "name": "5-NITROACENAPHTHENE [HSDB]",
          "stdName": "5-NITROACENAPHTHENE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26f2b04c-dcdc-4203-9c62-2304ee81dcec",
            "4b42e77b-bdc7-47ee-9142-71cde0560100"
          ],
          "display_name": false
        },
        {
          "uuid": "0717797b-4996-3559-2c9f-bb9755b54ba8",
          "name": "5-NITROACENAPHTHENE [IARC]",
          "stdName": "5-NITROACENAPHTHENE [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0626a68a-970c-9bf9-6c0c-ab43681ae02b"
          ],
          "display_name": false
        },
        {
          "uuid": "dc463a14-c33c-4a4b-853f-5f00f8d8dcf6",
          "name": "NSC-1312",
          "stdName": "NSC-1312",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5614d124-1989-4323-bf09-9c29c6f01688",
            "26f2b04c-dcdc-4203-9c62-2304ee81dcec"
          ],
          "display_name": false
        },
        {
          "uuid": "8178d472-9d7a-4faf-8067-039b3d88f598",
          "name": "NSC-22421",
          "stdName": "NSC-22421",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5614d124-1989-4323-bf09-9c29c6f01688",
            "26f2b04c-dcdc-4203-9c62-2304ee81dcec"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "75e3da7e-c5d0-4747-b63b-24572413acd0",
          "citation": "hsdb",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4b42e77b-bdc7-47ee-9142-71cde0560100",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26f2b04c-dcdc-4203-9c62-2304ee81dcec",
          "citation": "NLM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5614d124-1989-4323-bf09-9c29c6f01688",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69d6435c-24db-4f33-b875-cb274a6e6d7d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391004000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "070903b1-c868-43db-aebb-7d85b382e174",
          "citation": "SRS import [F023F6C79X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=F023F6C79X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391004000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d861fea-5bae-4885-adcb-08a3beab7afd",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9cd6e6f-9270-4b04-9231-c88595c7ee0e",
          "citation": "5-NITROACENAPHTHENE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "efc6e916-8396-6fde-7791-a7e9adbf0488",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+602-87-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "74c784e6-8ab5-cb62-8d1b-00d3870ff865",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=602-87-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0626a68a-970c-9bf9-6c0c-ab43681ae02b",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "d2c57715-2b5b-458b-aae1-985d2146e5c0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f6fddfca-80c8-b8ce-4f31-0ea30170d099",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b746017a-9322-4961-81e4-ec19a7bcefb6",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "37853a95-07b3-4fd9-918c-8ce60bb169b9",
          "id": "37853a95-07b3-4fd9-918c-8ce60bb169b9",
          "molfile": "\n  Marvin  01132102572D          \n\n 15 17  0  0  0  0            999 V2000\n    4.3893   -5.5729    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.1024   -5.1534    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    5.8016   -5.5729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1024   -4.3284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8249   -3.9135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8249   -3.0887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1024   -2.6784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8041   -1.9094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9931   -1.9094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6762   -2.6784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9537   -3.0887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9537   -3.9135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6762   -4.3284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3986   -3.9135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3986   -3.0887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n 14  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n 15  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 15 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\nM  CHG  2   1  -1   2   1\nM  END",
          "smiles": "c1cc2CCc3ccc(c(c1)c23)[N+](=O)[O-]",
          "formula": "C12H9NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "24cd10d0-92b6-47af-8fc4-e0c3ab3dd6b8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "199.2058",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3c18fd67-7d6b-41a8-a70d-230e62ee9a3c",
      "version": "9",
      "structure": {
        "id": "2b46f3e4-1caa-4e10-85c9-0c9cdfaa2d4e",
        "molfile": "\n  Marvin  01132102212D          \n\n 15 17  0  0  0  0            999 V2000\n    4.3986   -3.0887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3986   -3.9135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1024   -4.3284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8249   -3.9135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8249   -3.0887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1024   -2.6784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8041   -1.9094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9931   -1.9094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6762   -2.6784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9537   -3.0887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9537   -3.9135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6762   -4.3284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1024   -5.1534    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.3893   -5.5729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8016   -5.5729    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  1  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n  2 12  1  0  0  0  0\n  3 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\nM  CHG  2  13   1  15  -1\nM  END",
        "smiles": "c1cc2CCc3ccc(c(c1)c23)[N+](=O)[O-]",
        "formula": "C12H9NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "199.2058",
        "optical_activity": "NONE",
        "references": [
          "2d861fea-5bae-4885-adcb-08a3beab7afd",
          "070903b1-c868-43db-aebb-7d85b382e174"
        ],
        "stereo_centers": 0
      },
      "unii": "F023F6C79X"
    }
  ]
}