{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c4f0356d-7385-4acc-ab59-755f34e1bcee", "code": "4654-26-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=4654-26-6", "code_system": "CAS", "references": [ "394988f8-b51a-4848-8369-e286058bba18", "89c435e5-03e4-472e-b9cf-e2c228428d24" ] }, { "uuid": "9ad2d58c-eb4d-4dce-b63e-7f5e005cd7ee", "code": "DIOCTYL TEREPHTHALATE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Dioctyl_terephthalate", "code_system": "WIKIPEDIA", "references": [ "394988f8-b51a-4848-8369-e286058bba18" ] }, { "uuid": "427df1c7-038d-48d8-a971-0cece95b0ca8", "code": "225-091-6", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.022.810", "code_system": "ECHA (EC/EINECS)", "references": [ "394988f8-b51a-4848-8369-e286058bba18" ] }, { "uuid": "e869d60c-d670-4b45-b810-1bfa773b3a66", "code": "62546", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/62546", "code_system": "PUBCHEM", "references": [ "394988f8-b51a-4848-8369-e286058bba18" ] }, { "uuid": "2f650616-437b-3e44-3971-6b92e919399b", "code": "DTXSID3021699", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3021699", "code_system": "EPA CompTox", "references": [ "618163c9-6263-c238-e56f-e40c7b464255" ] }, { "uuid": "78680568-7eec-4999-ad4f-5c9bf027ec70", "code": "EZS4NL164S", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "70c33344-913e-4f1b-b68b-8e58aeb60afc", "name": "DI-N-OCTYL TEREPHTHALATE", "stdName": "DI-N-OCTYL TEREPHTHALATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9f3a9a38-eea9-48bf-9691-71296ad15e1a", "d829caac-6f69-409f-9944-0c81d26aa345" ], "display_name": false }, { "uuid": "10340782-5e71-43d4-9073-7f1abc18d82e", "name": "DIOCTYL TEREPHTHALATE", "stdName": "DIOCTYL TEREPHTHALATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "630d0ec9-e867-414a-ac9e-6a2e2ac8a799" ], "display_name": true } ], "references": [ { "uuid": "630d0ec9-e867-414a-ac9e-6a2e2ac8a799", "citation": "ICSAS BATCH 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "d829caac-6f69-409f-9944-0c81d26aa345", "citation": "stn", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9f3a9a38-eea9-48bf-9691-71296ad15e1a", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "394988f8-b51a-4848-8369-e286058bba18", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390932000, "tags": [ "NOMEN" ] }, { "uuid": "4c955196-b022-426b-a0fa-14c40c3b5228", "citation": "SRS import [EZS4NL164S]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=EZS4NL164S", "doc_type": "SRS", "public_domain": true, "document_date": 1493390932000, "tags": [ "NOMEN" ] }, { "uuid": "168226d1-baa1-4c63-845f-4308908f66db", "citation": "CHEMID 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "618163c9-6263-c238-e56f-e40c7b464255", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4654-26-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "89c435e5-03e4-472e-b9cf-e2c228428d24", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "0974fd55-6fc7-4858-9d51-93b9af16588c", "id": "0974fd55-6fc7-4858-9d51-93b9af16588c", "molfile": "\n Marvin 01132100452D \n\n 28 28 0 0 0 0 999 V2000\n 15.3468 -4.3867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6310 -3.9783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9153 -4.3913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2042 -3.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4884 -4.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7773 -3.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0615 -4.4004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3458 -3.9921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6347 -4.4050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9189 -3.9966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9189 -3.1707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2087 -4.4100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4897 -4.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7734 -4.4141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7734 -5.2425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4917 -5.6559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2087 -5.2421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0605 -5.6483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0605 -6.4741 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3448 -5.2354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6337 -5.6438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9179 -5.2308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2022 -5.6392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4911 -5.2262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7753 -5.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0642 -5.2216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3484 -5.6301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3673 -5.2171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 12 10 1 0 0 0 0\n 12 13 1 0 0 0 0\n 17 12 2 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 18 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\nM END", "smiles": "CCCCCCCCOC(=O)c1ccc(cc1)C(=O)OCCCCCCCC", "formula": "C24H38O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "4ddaf389-0148-4b49-a3c3-55e4a4e50fd1" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "390.557", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "201db73d-39d7-4ec8-9cc0-01221e76cef5", "version": "3", "structure": { "id": "641f8f8e-3a0c-4a6e-aee9-ca938b907b1d", "molfile": "\n Marvin 01132105122D \n\n 28 28 0 0 0 0 999 V2000\n 6.7734 -4.4141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4897 -4.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2087 -4.4100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9189 -3.9966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6347 -4.4050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3458 -3.9921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0615 -4.4004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7773 -3.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4884 -4.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2042 -3.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9153 -4.3913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6310 -3.9783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3468 -4.3867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9189 -3.1707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2087 -5.2421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4917 -5.6559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7734 -5.2425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0605 -5.6483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3448 -5.2354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6337 -5.6438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9179 -5.2308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2022 -5.6392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4911 -5.2262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7753 -5.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0642 -5.2216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3484 -5.6301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3673 -5.2171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0605 -6.4741 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 4 14 2 0 0 0 0\n 15 3 1 0 0 0 0\n 16 15 2 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 18 28 2 0 0 0 0\n 1 17 2 0 0 0 0\nM END", "smiles": "CCCCCCCCOC(=O)c1ccc(cc1)C(=O)OCCCCCCCC", "formula": "C24H38O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "390.557", "optical_activity": "NONE", "references": [ "168226d1-baa1-4c63-845f-4308908f66db", "4c955196-b022-426b-a0fa-14c40c3b5228" ], "stereo_centers": 0 }, "unii": "EZS4NL164S" } ] }