{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "56ba9ce1-8be4-4c44-80e9-e24e1be816a7",
          "code": "51267-48-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=51267-48-2",
          "code_system": "CAS",
          "references": [
            "7dc83d64-90f3-44be-b773-b28b7ccb705d",
            "c9194326-2c9e-4d4b-ad11-e3e77dd9e963"
          ]
        },
        {
          "uuid": "2356bffa-ebff-48df-bcf3-87b432c9e761",
          "code": "46832155",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/46832155",
          "code_system": "PUBCHEM",
          "references": [
            "7dc83d64-90f3-44be-b773-b28b7ccb705d"
          ]
        },
        {
          "uuid": "075108f2-9621-fe2e-a295-dd52dd359970",
          "code": "DTXSID60199267",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60199267",
          "code_system": "EPA CompTox",
          "references": [
            "fd9c98eb-414e-4c58-6e3b-a73d9897a8e2"
          ]
        },
        {
          "uuid": "b8d503a3-1eaf-b16d-54d7-95ada3d347eb",
          "code": "2043287",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2043287/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "26e162b3-e1ec-6949-c648-31d4b656c9e3"
          ]
        },
        {
          "uuid": "52f8c015-2be6-41a5-be4a-f0b9b3be047e",
          "code": "EZ6196NB0X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b0989e66-e97f-4ea7-9f55-8ef10d2b71f0",
          "name": "(±)-HYDROXYMETHOXYPHENYL PROPYLMETHYLMETHOXYBENZOFURAN",
          "stdName": "(+/-)-HYDROXYMETHOXYPHENYL PROPYLMETHYLMETHOXYBENZOFURAN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f87f9e80-3b5c-4bfd-9b04-058dfd613fa4",
            "27614d22-aed6-407b-9375-22a6059c779d"
          ],
          "display_name": false
        },
        {
          "uuid": "3c2a3c61-34f2-41c1-98c5-de1b306482e6",
          "name": "HYDROXYMETHOXYPHENYL PROPYLMETHYLMETHOXYBENZOFURAN",
          "stdName": "HYDROXYMETHOXYPHENYL PROPYLMETHYLMETHOXYBENZOFURAN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27614d22-aed6-407b-9375-22a6059c779d",
            "928244ff-5e0c-4e8d-9d4e-4e7b6a330919",
            "c0b8a790-d665-403b-a6ae-51ee5e2479e7"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "bbd78145-6a15-4e71-87fd-cff87f691800",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "92f9c0f6-971a-4b96-856e-9e397c299bf7",
          "name": "HYDROXYMETHOXYPHENYL PROPYLMETHYLMETHOXYBENZOFURAN, (±)-",
          "stdName": "HYDROXYMETHOXYPHENYL PROPYLMETHYLMETHOXYBENZOFURAN, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f87f9e80-3b5c-4bfd-9b04-058dfd613fa4",
            "27614d22-aed6-407b-9375-22a6059c779d"
          ],
          "display_name": false
        },
        {
          "uuid": "b57cefb2-48f4-4ddc-89ee-021b7e541334",
          "name": "PHENOL, 4-(2,3-DIHYDRO-7-METHOXY-3-METHYL-5-PROPYL-2-BENZOFURANYL)-2-METHOXY-,TRANS-",
          "stdName": "PHENOL, 4-(2,3-DIHYDRO-7-METHOXY-3-METHYL-5-PROPYL-2-BENZOFURANYL)-2-METHOXY-,TRANS-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27614d22-aed6-407b-9375-22a6059c779d",
            "c0b8a790-d665-403b-a6ae-51ee5e2479e7"
          ],
          "display_name": false
        },
        {
          "uuid": "d6d96598-d084-4fec-8761-b02fb601bc69",
          "name": "PROPYLGUAIACOL-DIMER",
          "stdName": "PROPYLGUAIACOL-DIMER",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27614d22-aed6-407b-9375-22a6059c779d",
            "c0b8a790-d665-403b-a6ae-51ee5e2479e7"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f87f9e80-3b5c-4bfd-9b04-058dfd613fa4",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7dc83d64-90f3-44be-b773-b28b7ccb705d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391530000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac4ee221-c5aa-4653-962a-a0add1d3a724",
          "citation": "SRS import [EZ6196NB0X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=EZ6196NB0X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391530000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a13948b-5d3c-48d3-af32-4141e3b5702c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "928244ff-5e0c-4e8d-9d4e-4e7b6a330919",
          "citation": "HYDROXYMETHOXYPHENYL PROPYLMETHYLMETHOXYBENZOFURAN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c0b8a790-d665-403b-a6ae-51ee5e2479e7",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "27614d22-aed6-407b-9375-22a6059c779d",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fd9c98eb-414e-4c58-6e3b-a73d9897a8e2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=51267-48-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "26e162b3-e1ec-6949-c648-31d4b656c9e3",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "c9194326-2c9e-4d4b-ad11-e3e77dd9e963",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "87c8e669-ff9d-fdf9-385d-6dedb2b8a203",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b526ed61-010f-48ab-9fe0-b63f27532474",
          "id": "b526ed61-010f-48ab-9fe0-b63f27532474",
          "molfile": "\n  Marvin  01132109232D          \n\n 24 26  0  0  0  0            999 V2000\n    7.1493   -3.6583    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.4087   -2.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3632   -3.9087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6511   -3.4922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9343   -3.9005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2222   -3.4839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5054   -3.8923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7933   -3.4757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9296   -4.7255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6416   -5.1421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6369   -5.9671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3489   -6.3836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3584   -4.7337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1416   -4.9932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6304   -4.3285    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.4553   -4.3333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8637   -5.0502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6887   -5.0549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1053   -4.3428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9302   -4.3475    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6969   -3.6260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1135   -2.9139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7051   -2.1971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8719   -3.6213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 15  1  0  0  0  0\n  3  4  1  0  0  0  0\n 13  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  5  9  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 13  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  1  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 24 16  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 21 24  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "CCCc1cc2[C@H](C)[C@@H](c3ccc(c(c3)OC)O)Oc2c(c1)OC",
          "formula": "C20H24O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1921a394-17bd-485d-a108-81e068cb8b3e"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "328.4029",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d339d4f4-ea7f-49dc-b739-7e5c0ca7d5a4",
      "version": "9",
      "structure": {
        "id": "b5a1fb5b-1f8d-4487-a7ee-40e793cb5145",
        "molfile": "\n  Marvin  01132109242D          \n\n 24 26  0  0  0  0            999 V2000\n    4.9343   -3.9005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2222   -3.4839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5054   -3.8923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7933   -3.4757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9296   -4.7255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6416   -5.1421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6369   -5.9671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3489   -6.3836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3584   -4.7337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1416   -4.9932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6304   -4.3285    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.4553   -4.3333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8637   -5.0502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6887   -5.0549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1053   -4.3428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9302   -4.3475    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6969   -3.6260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1135   -2.9139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7051   -2.1971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8719   -3.6213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1493   -3.6583    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.3632   -3.9087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6511   -3.4922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4087   -2.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  1  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 20 12  2  0  0  0  0\n 21 11  1  0  0  0  0\n 22 21  1  0  0  0  0\n  9 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23  1  2  0  0  0  0\n 21 24  1  6  0  0  0\nM  END",
        "smiles": "CCCc1cc2[C@H](C)[C@@H](c3ccc(c(c3)OC)O)Oc2c(c1)OC",
        "formula": "C20H24O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "328.4029",
        "optical_activity": "( + / - )",
        "references": [
          "ac4ee221-c5aa-4653-962a-a0add1d3a724",
          "9a13948b-5d3c-48d3-af32-4141e3b5702c"
        ],
        "stereo_centers": 2
      },
      "unii": "EZ6196NB0X"
    }
  ]
}