{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "df01e96c-742d-4490-87a1-dd24a98b1cd1",
          "code": "1641-17-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1641-17-4",
          "code_system": "CAS",
          "references": [
            "28c7995b-82df-4c3d-9a33-38bbc78dea05",
            "7a92bf87-7255-4af5-a1d4-1c4445c2368f"
          ]
        },
        {
          "uuid": "5bf8bd13-107f-4e72-a3cb-634faa930e6b",
          "code": "C011031",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67011031",
          "code_system": "MESH",
          "references": [
            "28c7995b-82df-4c3d-9a33-38bbc78dea05"
          ]
        },
        {
          "uuid": "3994bd1b-5224-405e-97f7-ba05d0359dd0",
          "code": "SUB08930MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "28c7995b-82df-4c3d-9a33-38bbc78dea05"
          ]
        },
        {
          "uuid": "c89a2caa-7f23-437f-b3c7-74104b46faea",
          "code": "1835",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1835",
          "code_system": "INN",
          "references": [
            "28c7995b-82df-4c3d-9a33-38bbc78dea05"
          ]
        },
        {
          "uuid": "8c851b42-fdd5-470f-8279-661f65d87f4b",
          "code": "216-688-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.015.172",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "28c7995b-82df-4c3d-9a33-38bbc78dea05"
          ]
        },
        {
          "uuid": "b58ee95e-3ca9-4a8e-8f37-c163341d8224",
          "code": "C66142",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66142",
          "code_system": "NCI_THESAURUS",
          "references": [
            "28c7995b-82df-4c3d-9a33-38bbc78dea05"
          ]
        },
        {
          "uuid": "139d1baa-7f6e-4363-95d7-922bdffe704b",
          "code": "m7516",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7516?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "28c7995b-82df-4c3d-9a33-38bbc78dea05"
          ]
        },
        {
          "uuid": "1d628cc9-659b-4217-a0ec-1db66744e81d",
          "code": "CHEMBL1898387",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1898387",
          "code_system": "ChEMBL",
          "references": [
            "28c7995b-82df-4c3d-9a33-38bbc78dea05"
          ]
        },
        {
          "uuid": "571f7e00-2185-41e9-8874-6b3ca663d1a2",
          "code": "71645",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71645",
          "code_system": "PUBCHEM",
          "references": [
            "28c7995b-82df-4c3d-9a33-38bbc78dea05"
          ]
        },
        {
          "uuid": "cbcf6997-48cb-add5-f25d-db29547149e9",
          "code": "DTXSID8046242",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8046242",
          "code_system": "EPA CompTox",
          "references": [
            "3b779eb2-5b46-b4fd-ff85-27e041136c4e"
          ]
        },
        {
          "uuid": "1b3f91c3-f84a-217d-7782-88fb4d039efd",
          "code": "C851",
          "comments": "Pharmacologic Substance[C1909]|Chemopreventive Agent[C1892]|Sunscreen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C851",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d5daab49-6833-c555-6a2b-7877c5ddd37c"
          ]
        },
        {
          "uuid": "745e92ec-415a-4816-96ec-e4d096b4b501",
          "code": "ET1UGF4A0B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8d9d22e5-1c4f-ad5b-3d1f-0b233210f96b",
          "code": "3359",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3359",
          "code_system": "DRUG CENTRAL",
          "references": [
            "d5daab49-6833-c555-6a2b-7877c5ddd37c"
          ]
        },
        {
          "uuid": "226b15e9-dfdb-f69d-b359-ac1597ebfa4d",
          "code": "Mexenone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Mexenone",
          "code_system": "WIKIPEDIA",
          "references": [
            "dd88f51f-8e56-1e71-2214-1829cc0304ed"
          ]
        },
        {
          "uuid": "075c89a6-0fc1-424f-8480-ebac12998182",
          "code": "100000081159",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "34613922-f945-6a52-a7d8-c96fdbba7450"
          ]
        },
        {
          "uuid": "4ca1d518-1cf8-0d38-4fd6-9ce93a7ba119",
          "code": "760432",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=760432",
          "code_system": "NSC",
          "references": [
            "7aedc0b5-630a-5682-cd6d-72ebd135ce8b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "77a1b5c7-32d7-40a4-be1b-597282810a92",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "29248bb1-e591-45bf-b8b0-0ce9cbcfbcef",
            "refuuid": "8b5085ec-e318-44df-bb73-b62049f3d924",
            "name": "MEXENONE",
            "unii": "ET1UGF4A0B",
            "linking_id": "ET1UGF4A0B",
            "ref_pname": "MEXENONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fb6d36af-7b70-432b-8ad2-571d01720c55",
          "name": "2-HYDROXY-4-METHOXY-4'-METHYLBENZOPHENONE",
          "stdName": "2-HYDROXY-4-METHOXY-4'-METHYLBENZOPHENONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9fc4dca-9470-409c-bce0-2caeaa0157e0"
          ],
          "display_name": false
        },
        {
          "uuid": "7a562b3e-0edf-424e-84d3-0f8cd22d795a",
          "name": "BENZOPHENONE-10",
          "stdName": "BENZOPHENONE-10",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "a526f7d6-2096-4e22-83d2-bbe11ec7fb2c",
            "589ba23c-1cee-49d5-a467-ce64d204469a",
            "1e215ba2-10cb-4bad-8c25-05d3b571773a"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "5d836abd-43fc-4d75-a723-86db67c15ba2",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "beb49b15-e920-4ece-8bb5-7da08c04bdb1",
          "name": "MEXENONE",
          "stdName": "MEXENONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e452d118-bd43-49e0-a619-aea37d440272",
            "10c4ec9b-58cb-4e9c-be62-9bddd9fca6c8",
            "cf046e5e-9fa0-40df-8d7d-de5c5e3b1483",
            "ce4f6549-6d99-462d-b942-89ceb6530f74",
            "523458d0-ef42-48a9-ba67-21e7cc40ccc3",
            "c9fc4dca-9470-409c-bce0-2caeaa0157e0",
            "a526f7d6-2096-4e22-83d2-bbe11ec7fb2c",
            "80e84bbf-ec51-4ab6-893c-43f6c083d055",
            "3d9e6b34-043d-4de6-b2a4-7fff039e60cc",
            "94c96d0f-52a5-456e-a54d-33f3ca8a1c3e"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "59130ae6-7e9a-4af9-99c8-254a59b42525",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "feba630a-fbb3-4b96-a76b-45b380007bc0",
          "name": "MEXENONE [MART.]",
          "stdName": "MEXENONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e452d118-bd43-49e0-a619-aea37d440272"
          ],
          "display_name": false
        },
        {
          "uuid": "9f350046-fb13-41d0-81bb-8630d93d909e",
          "name": "MEXENONE [MI]",
          "stdName": "MEXENONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10c4ec9b-58cb-4e9c-be62-9bddd9fca6c8",
            "a526f7d6-2096-4e22-83d2-bbe11ec7fb2c"
          ],
          "display_name": false
        },
        {
          "uuid": "694ad0d7-425c-9f5f-1b11-37b52276c5ab",
          "name": "Mexenone [WHO-DD]",
          "stdName": "MEXENONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a4789ee-6d94-e70f-3758-87eb8f538ce4"
          ],
          "display_name": false
        },
        {
          "uuid": "5cf6132b-ec77-af6e-234e-c5a28f88f907",
          "name": "NSC-760432",
          "stdName": "NSC-760432",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7aedc0b5-630a-5682-cd6d-72ebd135ce8b"
          ],
          "display_name": false
        },
        {
          "uuid": "be6742c3-6cab-4e2c-94e5-540fc5a119ff",
          "name": "mexenone [INN]",
          "stdName": "MEXENONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf046e5e-9fa0-40df-8d7d-de5c5e3b1483"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c9fc4dca-9470-409c-bce0-2caeaa0157e0",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cf046e5e-9fa0-40df-8d7d-de5c5e3b1483",
          "citation": "INN Proposed List 15",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL15.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e452d118-bd43-49e0-a619-aea37d440272",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10c4ec9b-58cb-4e9c-be62-9bddd9fca6c8",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a526f7d6-2096-4e22-83d2-bbe11ec7fb2c",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "589ba23c-1cee-49d5-a467-ce64d204469a",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d9e6b34-043d-4de6-b2a4-7fff039e60cc",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "28c7995b-82df-4c3d-9a33-38bbc78dea05",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390692000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20cd67c0-4e17-463d-af93-f45857e12d73",
          "citation": "SRS import [ET1UGF4A0B]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ET1UGF4A0B",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390692000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "523458d0-ef42-48a9-ba67-21e7cc40ccc3",
          "citation": "MEXENONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "94c96d0f-52a5-456e-a54d-33f3ca8a1c3e",
          "citation": "MEXENONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ce4f6549-6d99-462d-b942-89ceb6530f74",
          "citation": "MEXENONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1e215ba2-10cb-4bad-8c25-05d3b571773a",
          "citation": "BENZOPHENONE-10 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "80e84bbf-ec51-4ab6-893c-43f6c083d055",
          "citation": "MEXENONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3b779eb2-5b46-b4fd-ff85-27e041136c4e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1641-17-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d5daab49-6833-c555-6a2b-7877c5ddd37c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "dd88f51f-8e56-1e71-2214-1829cc0304ed",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "7a92bf87-7255-4af5-a1d4-1c4445c2368f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7aedc0b5-630a-5682-cd6d-72ebd135ce8b",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2a4789ee-6d94-e70f-3758-87eb8f538ce4",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "34613922-f945-6a52-a7d8-c96fdbba7450",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c709aff4-1efb-4a15-b09d-d568d338abca",
          "id": "c709aff4-1efb-4a15-b09d-d568d338abca",
          "molfile": "\n  Marvin  01132110172D          \n\n 18 19  0  0  0  0            999 V2000\n    0.0643   -3.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7756   -3.6401    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4943   -3.2338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4955   -2.4058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2079   -1.9928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9237   -2.4022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6359   -1.9847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6337   -1.1591    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3489   -2.3975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3452   -3.2225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0573   -3.6352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7723   -3.2241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4874   -3.6368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7706   -2.3959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0579   -1.9869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9266   -3.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5067   -3.8152    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2097   -3.6470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3 18  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n 16  6  2  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 15  9  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 16  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(cc1)C(=O)c2ccc(cc2O)OC",
          "formula": "C15H14O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d35be93c-04fd-4c59-9f35-44d9344d0dd8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "242.2704",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8b5085ec-e318-44df-bb73-b62049f3d924",
      "version": "13",
      "structure": {
        "id": "d4fefae6-053b-438c-8d74-42bcf25197ee",
        "molfile": "\n  Marvin  01132111022D          \n\n 18 19  0  0  0  0            999 V2000\n    1.4955   -2.4058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4943   -3.2338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2097   -3.6470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9266   -3.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9237   -2.4022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2079   -1.9928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6359   -1.9847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3489   -2.3975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6337   -1.1591    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3452   -3.2225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0573   -3.6352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7723   -3.2241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7706   -2.3959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0579   -1.9869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5067   -3.8152    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7756   -3.6401    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0643   -3.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4874   -3.6368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  7  9  2  0  0  0  0\n  4  5  1  0  0  0  0\n  8 10  2  0  0  0  0\n  2  3  1  0  0  0  0\n 10 11  1  0  0  0  0\n  5  6  2  0  0  0  0\n 11 12  2  0  0  0  0\n  6  1  1  0  0  0  0\n 12 13  1  0  0  0  0\n  1  2  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14  8  1  0  0  0  0\n  5  7  1  0  0  0  0\n  4 15  1  0  0  0  0\n  3  4  2  0  0  0  0\n  2 16  1  0  0  0  0\n  7  8  1  0  0  0  0\n 16 17  1  0  0  0  0\n 12 18  1  0  0  0  0\nM  END",
        "smiles": "Cc1ccc(cc1)C(=O)c2ccc(cc2O)OC",
        "formula": "C15H14O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "242.2704",
        "optical_activity": "NONE",
        "references": [
          "c9fc4dca-9470-409c-bce0-2caeaa0157e0",
          "20cd67c0-4e17-463d-af93-f45857e12d73",
          "cf046e5e-9fa0-40df-8d7d-de5c5e3b1483"
        ],
        "stereo_centers": 0
      },
      "unii": "ET1UGF4A0B"
    }
  ]
}