{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "11edfdb7-c7e2-4153-b5dd-ee34ed388cbe",
          "code": "ES1O38J3C4",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3b149cc9-3e17-45b6-9a62-e1b99adb1beb",
          "code": "96847-55-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=96847-55-1",
          "code_system": "CAS",
          "references": [
            "72cb0037-d996-4ea9-ae46-92d76677b773",
            "78a0280e-c8f5-4c8e-b028-e2f0244cb7f8"
          ]
        },
        {
          "uuid": "139ef119-b79b-47bd-8c3e-177ad2bc39c6",
          "code": "DB08918",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB08918",
          "code_system": "DRUG BANK",
          "references": [
            "72cb0037-d996-4ea9-ae46-92d76677b773"
          ]
        },
        {
          "uuid": "e743fc7d-f752-40de-ab33-24ad36327dbd",
          "code": "65833",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/65833",
          "code_system": "PUBCHEM",
          "references": [
            "72cb0037-d996-4ea9-ae46-92d76677b773"
          ]
        },
        {
          "uuid": "978f6413-2a85-8be2-db9b-96c21be91f03",
          "code": "DTXSID601025164",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID601025164",
          "code_system": "EPA CompTox"
        }
      ],
      "relationships": [
        {
          "uuid": "262cc26e-8fb3-4643-b391-7bdf4517da7d",
          "type": "METABOLITE->PARENT",
          "references": [
            "b44e6ba6-ada4-4c4a-ac9b-327d29532f9c"
          ],
          "related_substance": {
            "uuid": "c71aaee0-7b17-4823-9ff9-2ac9b2227f76",
            "refuuid": "92104ea0-0387-4dd1-9d6d-13a76bc4df95",
            "name": "MILNACIPRAN CARBAMOYL O-GLUCURONIDE, D-",
            "unii": "9TK9IO76V9",
            "linking_id": "9TK9IO76V9",
            "ref_pname": "MILNACIPRAN CARBAMOYL O-GLUCURONIDE, D-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b8255650-76f1-4d93-bf2a-5573f431ad36",
          "type": "RACEMATE->ENANTIOMER",
          "related_substance": {
            "uuid": "66f93099-84e1-4971-b3bc-9f140a4add0f",
            "refuuid": "6bac5b83-bf1b-42d0-b9ab-8cb5abe2ce84",
            "name": "MILNACIPRAN",
            "unii": "G56VK1HF36",
            "linking_id": "G56VK1HF36",
            "ref_pname": "MILNACIPRAN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d900dfbc-df54-4da6-86bf-ca66480e436b",
          "amount": {
            "uuid": "37d6e2cb-b815-4de6-9c11-10032f4ef95b"
          },
          "type": "ENANTIOMER->ENANTIOMER",
          "related_substance": {
            "uuid": "4996a8e1-4b47-4b57-bd77-9d44b4d0dd85",
            "refuuid": "f319b645-15ca-418f-bdf8-89c1027b29d8",
            "name": "LEVOMILNACIPRAN",
            "unii": "UGM0326TXX",
            "linking_id": "UGM0326TXX",
            "ref_pname": "LEVOMILNACIPRAN"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7fe7952f-4d22-4235-8985-7ea0b5dd22b7",
          "name": "(1R,2S)-MILNACIPRAN",
          "stdName": "(1R,2S)-MILNACIPRAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64ba0e5c-90ec-4615-b8c9-f5241f5148fe",
            "4d1fe1e4-a16f-412a-9546-26a21649f4b7"
          ],
          "display_name": false
        },
        {
          "uuid": "cd413c94-c03f-461f-bba6-0d4a8a97ff3e",
          "name": "CYCLOPROPANECARBOXAMIDE, 2-(AMINOMETHYL)-N,N-DIETHYL-1-PHENYL-, (1R,2S)-",
          "stdName": "CYCLOPROPANECARBOXAMIDE, 2-(AMINOMETHYL)-N,N-DIETHYL-1-PHENYL-, (1R,2S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64ba0e5c-90ec-4615-b8c9-f5241f5148fe",
            "4d1fe1e4-a16f-412a-9546-26a21649f4b7"
          ],
          "display_name": false
        },
        {
          "uuid": "a9ac1b79-3ae5-41b6-9957-61fc21c8bdee",
          "name": "CYCLOPROPANECARBOXAMIDE, 2-(AMINOMETHYL)-N,N-DIETHYL-1-PHENYL-, (1R-CIS)-",
          "stdName": "CYCLOPROPANECARBOXAMIDE, 2-(AMINOMETHYL)-N,N-DIETHYL-1-PHENYL-, (1R-CIS)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64ba0e5c-90ec-4615-b8c9-f5241f5148fe",
            "4d1fe1e4-a16f-412a-9546-26a21649f4b7"
          ],
          "display_name": false
        },
        {
          "uuid": "c573c5d8-0482-4dfd-a7c3-0b3710775534",
          "name": "DEXTROMILNACIPRAN",
          "stdName": "DEXTROMILNACIPRAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64ba0e5c-90ec-4615-b8c9-f5241f5148fe",
            "4d1fe1e4-a16f-412a-9546-26a21649f4b7"
          ],
          "display_name": true
        },
        {
          "uuid": "a99c4db7-6c86-40e1-96d8-433bbc27d6de",
          "name": "F-2696",
          "stdName": "F-2696",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64ba0e5c-90ec-4615-b8c9-f5241f5148fe",
            "4d1fe1e4-a16f-412a-9546-26a21649f4b7"
          ],
          "display_name": false
        },
        {
          "uuid": "0f51382c-7cda-4df3-990d-c986f21a8a74",
          "name": "F2696",
          "stdName": "F2696",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64ba0e5c-90ec-4615-b8c9-f5241f5148fe"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4d1fe1e4-a16f-412a-9546-26a21649f4b7",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "64ba0e5c-90ec-4615-b8c9-f5241f5148fe",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "72cb0037-d996-4ea9-ae46-92d76677b773",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392510000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b44e6ba6-ada4-4c4a-ac9b-327d29532f9c",
          "citation": "DMD, SEPTEMBER 2012 VOL. 40 NO. 9 1723-1735",
          "url": "dmd.aspetjournals.org/content/40/9/1723.full.pdf",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a3c466b-e6de-46a4-bfbc-249f31b04dff",
          "citation": "SRS import [ES1O38J3C4]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ES1O38J3C4",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392510000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78a0280e-c8f5-4c8e-b028-e2f0244cb7f8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8b1c69ba-67a2-412a-9f9c-af66a4df4a68",
          "id": "8b1c69ba-67a2-412a-9f9c-af66a4df4a68",
          "molfile": "\n  Marvin  01132107132D          \n\n 18 19  0  0  1  0            999 V2000\n    9.2623   -5.4866    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.5242   -5.8552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8360   -5.4002    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7173   -4.7984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0858   -5.5366    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.1797   -6.3561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5167   -6.8473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9364   -6.6847    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0303   -7.5043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7871   -7.8329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6509   -6.2722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3780   -6.6079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8767   -5.3017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4755   -5.8693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2663   -5.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4585   -4.8321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8597   -4.2647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0688   -4.4994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  3  2  1  0  0  0  0\n  5  4  1  1  0  0  0\n  5  6  1  0  0  0  0\n  5 13  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 11  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 18 13  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "CCN(CC)C(=O)[C@@]1(C[C@@H]1CN)c2ccccc2",
          "formula": "C15H22N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "11a001da-7ad9-4445-a122-8a97df0482e9"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "246.3485",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b1ef1474-01af-43e7-87ca-be860979cf0a",
      "version": "6",
      "structure": {
        "id": "46b8a20d-42a1-4aee-95ca-d0d8177e1b3d",
        "molfile": "\n  Marvin  01132103432D          \n\n 18 19  0  0  1  0            999 V2000\n   11.7871   -7.8329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3780   -6.6079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0303   -7.5043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6509   -6.2722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9364   -6.6847    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2663   -5.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4755   -5.8693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5167   -6.8473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1797   -6.3561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4585   -4.8321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8767   -5.3017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0858   -5.5366    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.5242   -5.8552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2623   -5.4866    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.8360   -5.4002    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7173   -4.7984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0688   -4.4994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8597   -4.2647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  3  5  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  7  2  0  0  0  0\n  5  9  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  6  1  0  0  0  0\n  7 11  1  0  0  0  0\n 12  9  1  1  0  0  0\n 12 11  1  6  0  0  0\n 14 12  1  0  0  0  0\n 14 13  1  1  0  0  0\n 15 13  1  0  0  0  0\n 14 16  1  0  0  0  0\n 16 12  1  0  0  0  0\n 17 11  2  0  0  0  0\n 18 10  2  0  0  0  0\n 18 17  1  0  0  0  0\nM  END",
        "smiles": "CCN(CC)C(=O)[C@@]1(C[C@@H]1CN)c2ccccc2",
        "formula": "C15H22N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "246.3485",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "4d1fe1e4-a16f-412a-9546-26a21649f4b7",
          "9a3c466b-e6de-46a4-bfbc-249f31b04dff"
        ],
        "stereo_centers": 2
      },
      "unii": "ES1O38J3C4"
    }
  ]
}