{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "38512ecc-db29-41a9-9618-c790610e7b34", "code": "68391-30-0", "type": "NON-SPECIFIC STEREOCHEMISTRY", "url": "https://commonchemistry.cas.org/detail?cas_rn=68391-30-0", "code_system": "CAS", "references": [ "b02a0bf4-6190-45d4-be17-ded12cf0674e", "5013a227-bf50-4bd7-a7fb-6e877ba67b4c" ] }, { "uuid": "71d1d049-22c5-4c94-8be9-855a1023c245", "code": "269-941-4", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.063.564", "code_system": "ECHA (EC/EINECS)", "references": [ "b02a0bf4-6190-45d4-be17-ded12cf0674e" ] }, { "uuid": "4f675c26-ecf4-e23c-7b89-870fe29dacd3", "code": "DTXSID10879784", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10879784", "code_system": "EPA CompTox", "references": [ "25841539-8817-a6b0-5e3c-6b0379a720b9" ] }, { "uuid": "171e4e72-1b90-3bf0-2f1e-7cb9f3dfff30", "code": "110099", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/110099", "code_system": "PUBCHEM", "references": [ "836bc052-b18a-14af-0368-7cfc1fe5b9d6" ] }, { "uuid": "16fc1ad4-fd67-4b28-83f6-3dcd6b9a70ab", "code": "ES19W9WI76", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "bea310cb-f0b5-4d5b-914f-1a4b7aa7e883", "name": "2-NAPHTHALENAMINIUM, 7-HYDROXY-8-(2-(2-METHOXYPHENYL)DIAZENYL)-N,N,N-TRIMETHYL-, CHLORIDE (1:1)", "stdName": "2-NAPHTHALENAMINIUM, 7-HYDROXY-8-(2-(2-METHOXYPHENYL)DIAZENYL)-N,N,N-TRIMETHYL-, CHLORIDE (1:1)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f0123c08-c5f8-4729-b913-6804b1f6a418", "797e191f-b32c-44b9-9f01-82e81ecdd9dd" ], "display_name": false }, { "uuid": "9fa98e8d-5f52-41f8-8ff9-99ab36879552", "name": "ARIANOR MADDER RED 306003", "stdName": "ARIANOR MADDER RED 306003", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "797e191f-b32c-44b9-9f01-82e81ecdd9dd", "ce7f7b37-aefa-4890-88d7-63c2e6f0241e" ], "display_name": false }, { "uuid": "a1dde8e1-85bd-45de-9188-173d38a95ecd", "name": "BASIC RED 76", "stdName": "BASIC RED 76", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "797e191f-b32c-44b9-9f01-82e81ecdd9dd", "f0446627-1867-4b59-bd00-98f78949d70d", "ce7f7b37-aefa-4890-88d7-63c2e6f0241e" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "eece402b-a8b4-4467-911b-7625f1453ddc", "name_org": "INCI" } ] }, { "uuid": "fe58ab5c-9677-486c-9402-93f345146420", "name": "C.I. 12245", "stdName": "C.I. 12245", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "f0123c08-c5f8-4729-b913-6804b1f6a418", "797e191f-b32c-44b9-9f01-82e81ecdd9dd" ], "display_name": false }, { "uuid": "776b65b4-c87e-4f8a-b4d9-2f28e679b9f9", "name": "C.I. BASIC RED 76", "stdName": "C.I. BASIC RED 76", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "f0123c08-c5f8-4729-b913-6804b1f6a418", "797e191f-b32c-44b9-9f01-82e81ecdd9dd" ], "display_name": false }, { "uuid": "dc36aefa-b014-40f3-bcef-eb7e1606c8cd", "name": "JAROCOL MADDER RED", "stdName": "JAROCOL MADDER RED", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "797e191f-b32c-44b9-9f01-82e81ecdd9dd", "ce7f7b37-aefa-4890-88d7-63c2e6f0241e" ], "display_name": false } ], "references": [ { "uuid": "ce7f7b37-aefa-4890-88d7-63c2e6f0241e", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "797e191f-b32c-44b9-9f01-82e81ecdd9dd", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f0123c08-c5f8-4729-b913-6804b1f6a418", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b02a0bf4-6190-45d4-be17-ded12cf0674e", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391866000, "tags": [ "NOMEN" ] }, { "uuid": "d8a558fd-c2a6-4282-8015-a7ffab652d3d", "citation": "SRS import [ES19W9WI76]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ES19W9WI76", "doc_type": "SRS", "public_domain": true, "document_date": 1493391866000, "tags": [ "NOMEN" ] }, { "uuid": "f0446627-1867-4b59-bd00-98f78949d70d", "citation": "BASIC RED 76 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "836bc052-b18a-14af-0368-7cfc1fe5b9d6", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "5013a227-bf50-4bd7-a7fb-6e877ba67b4c", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "25841539-8817-a6b0-5e3c-6b0379a720b9", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4ab55f7e-f5b2-4fb6-8cf9-5f617dd29e8d", "id": "4ab55f7e-f5b2-4fb6-8cf9-5f617dd29e8d", "molfile": "\n Marvin 01132103542D \n\n 1 0 0 0 0 0 999 V2000\n 3.5244 -5.2324 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\nM END", "smiles": "Cl", "formula": "ClH", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "469c0021-6e4f-4fe7-9686-42f8386346d1" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "36.4609", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "7c6993dc-e21a-4b9a-965e-f9ad25dd5a93", "id": "7c6993dc-e21a-4b9a-965e-f9ad25dd5a93", "molfile": "\n Marvin 01132106272D \n\n 25 27 0 0 0 0 999 V2000\n 7.2134 -3.8116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2134 -2.9766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9238 -2.5570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9238 -1.7220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6301 -1.3065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3405 -1.7220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3405 -2.5570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6301 -2.9766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6301 -3.8116 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3405 -4.2271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3405 -5.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0509 -5.4816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7613 -5.0621 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 10.0509 -6.3166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3405 -6.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6301 -6.3166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9238 -6.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2134 -6.3166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2134 -5.4816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9238 -5.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6301 -5.4816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5030 -5.0621 0.0000 N 0 3 0 0 0 0 0 0 0 3 0 0\n 6.3244 -5.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6888 -5.1452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3576 -4.1730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 8 2 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 21 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 14 12 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 2 0 0 0 0\n 17 16 1 0 0 0 0\n 16 21 1 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 2 0 0 0 0\n 22 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 22 1 0 0 0 0\n 25 22 1 0 0 0 0\nM CHG 2 13 -1 22 1\nM END", "smiles": "C[N+](C)(C)c1ccc2ccc(c(c2c1)/N=N/c3ccccc3OC)[O-]", "formula": "C20H21N3O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "88e52a31-abf2-41ae-b286-6c35121b7753" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "335.4004", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "64b644b0-49e3-4526-acde-0275ffd8a830", "version": "9", "structure": { "id": "4e5b1cc7-3bff-46cd-9c7f-ef51abe90235", "molfile": "\n Marvin 01132104052D \n\n 26 27 0 0 0 0 999 V2000\n 3.5244 -5.2324 0.0000 Cl 0 5 0 0 0 0 0 0 0 0 0 0\n 9.3405 -5.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3405 -4.2271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6301 -3.8116 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6301 -2.9766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9238 -2.5570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2134 -2.9766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2134 -3.8116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9238 -1.7220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6301 -1.3065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3405 -1.7220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3405 -2.5570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6301 -5.4816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9238 -5.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2134 -5.4816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5030 -5.0621 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 6.3244 -5.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6888 -5.1452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3576 -4.1730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2134 -6.3166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9238 -6.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6301 -6.3166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3405 -6.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0509 -6.3166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0509 -5.4816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7613 -5.0621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 6 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 12 5 2 0 0 0 0\n 11 12 1 0 0 0 0\n 13 2 1 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 16 1 0 0 0 0\n 19 16 1 0 0 0 0\n 15 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 22 13 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 25 2 2 0 0 0 0\n 24 25 1 0 0 0 0\n 26 25 1 0 0 0 0\nM CHG 2 1 -1 16 1\nM END", "smiles": "C[N+](C)(C)c1ccc2ccc(c(c2c1)/N=N/c3ccccc3OC)O.[Cl-]", "formula": "C20H22N3O2.Cl", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "371.8613", "optical_activity": "NONE", "references": [ "f0123c08-c5f8-4729-b913-6804b1f6a418", "d8a558fd-c2a6-4282-8015-a7ffab652d3d" ], "stereo_centers": 0 }, "unii": "ES19W9WI76" } ] }