{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "28302658-cd99-490e-a2bd-1ca3b2e8e505",
          "code": "541-05-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=541-05-9",
          "code_system": "CAS",
          "references": [
            "953f1d17-bb70-4d5c-b4c1-56b25ace5098",
            "fbf537fa-6423-4674-a9ba-98a5c944f803"
          ]
        },
        {
          "uuid": "2f1651df-37a7-48aa-847e-64b9b82dab2e",
          "code": "208-765-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.970",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "953f1d17-bb70-4d5c-b4c1-56b25ace5098"
          ]
        },
        {
          "uuid": "6decdd3c-f880-4014-ab44-51724d77353c",
          "code": "10914",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10914",
          "code_system": "PUBCHEM",
          "references": [
            "953f1d17-bb70-4d5c-b4c1-56b25ace5098"
          ]
        },
        {
          "uuid": "9349bb9b-db76-4851-5323-3c46fc0ce36a",
          "code": "1994321",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1994321/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "1f9a4be3-acbd-607f-18cd-480ed4249440"
          ]
        },
        {
          "uuid": "35f2e32e-ae78-4d74-b475-65adfa480bae",
          "code": "EPV75L8O0R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "181fbf33-ab60-f8e2-002b-461048f3fd59",
          "code": "Hexamethylcyclotrisiloxane",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Hexamethylcyclotrisiloxane",
          "code_system": "WIKIPEDIA",
          "references": [
            "777782e1-f050-9452-ad3f-7098c3eb9d16"
          ]
        },
        {
          "uuid": "2da7f534-f468-ec66-51e4-10a2ad713ced",
          "code": "EPV75L8O0R",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(EPV75L8O0R)",
          "code_system": "DAILYMED",
          "references": [
            "523e67f0-0214-7d63-b066-68a2bacaddad"
          ]
        },
        {
          "uuid": "4a1b6537-b22c-9d2c-01ce-dac5432f55b7",
          "code": "DTXSID6027185",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6027185",
          "code_system": "EPA CompTox",
          "references": [
            "fb731822-5ad4-7634-ac7c-680819faf5c2"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9d8f5796-2be4-4d01-a8f2-13d035e4a1dd",
          "name": "CYCLOTRISILOXANE, HEXAMETHYL-",
          "stdName": "CYCLOTRISILOXANE, HEXAMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5b0ea71e-5f28-48d2-86db-796258c307b0",
            "c320f05b-499e-403a-a637-d97f39e446be"
          ],
          "display_name": false
        },
        {
          "uuid": "216b4312-8921-43f1-96a4-1050ea913fc1",
          "name": "HEXAMETHYLCYCLOTRISILOXANE",
          "stdName": "HEXAMETHYLCYCLOTRISILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "821adc4d-2129-4e21-a0c7-45f039ff147c"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "821adc4d-2129-4e21-a0c7-45f039ff147c",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5b0ea71e-5f28-48d2-86db-796258c307b0",
          "citation": "http://datasheets.scbt.com/sc-235302.pdf",
          "url": "http://datasheets.scbt.com/sc-235302.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c320f05b-499e-403a-a637-d97f39e446be",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "953f1d17-bb70-4d5c-b4c1-56b25ace5098",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391111000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56e94753-63af-4aa7-a5b2-c30334920837",
          "citation": "SRS import [EPV75L8O0R]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=EPV75L8O0R",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391111000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d06f509e-e117-4fa6-afb2-68cbc094830a",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45c21f20-d70e-5f46-baa6-8aeb5e09c1e5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=541-05-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1f9a4be3-acbd-607f-18cd-480ed4249440",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "fbf537fa-6423-4674-a9ba-98a5c944f803",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "777782e1-f050-9452-ad3f-7098c3eb9d16",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "523e67f0-0214-7d63-b066-68a2bacaddad",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "200d36e5-cf9d-14f2-6a84-1f3f8b11ffeb",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "4b4d7694-0932-576f-e570-5d48837c7808",
          "citation": "EPA",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "fb731822-5ad4-7634-ac7c-680819faf5c2",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1a665b52-8a3d-401f-9647-c8a3ef25fed2",
          "id": "1a665b52-8a3d-401f-9647-c8a3ef25fed2",
          "molfile": "\n  Marvin  01132101332D          \n\n 12 12  0  0  0  0            999 V2000\n    8.4459   -5.3795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6337   -5.5201    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    7.6337   -6.3502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6337   -4.6948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9220   -4.2840    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    7.5293   -3.7170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3132   -3.7165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2069   -4.6948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2069   -5.5201    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    6.1362   -6.3416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4050   -5.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9220   -5.9274    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n 12  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  1  0  0  0  0\nM  END",
          "smiles": "C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O1",
          "formula": "C6H18O3Si3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6dee0752-f194-4fc1-ab87-c729783e9751"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "222.4617",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a9efd1af-49a5-409b-84ce-8b7567999154",
      "version": "14",
      "structure": {
        "id": "e908ea7a-ba20-4621-b1cd-203286cba949",
        "molfile": "\n  Marvin  01132112032D          \n\n 12 12  0  0  0  0            999 V2000\n    6.2069   -5.5201    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    6.2069   -4.6948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9220   -4.2840    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    7.6337   -4.6948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6337   -5.5201    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    6.9220   -5.9274    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4459   -5.3795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6337   -6.3502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5293   -3.7170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3132   -3.7165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1362   -6.3416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4050   -5.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  3  9  1  0  0  0  0\n  3 10  1  0  0  0  0\n  1 11  1  0  0  0  0\n  1 12  1  0  0  0  0\nM  END",
        "smiles": "C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O1",
        "formula": "C6H18O3Si3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "222.4617",
        "optical_activity": "NONE",
        "references": [
          "d06f509e-e117-4fa6-afb2-68cbc094830a",
          "56e94753-63af-4aa7-a5b2-c30334920837"
        ],
        "stereo_centers": 0
      },
      "unii": "EPV75L8O0R"
    }
  ]
}