{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ced53a34-3332-4852-9e33-ca63828cfd61",
          "code": "133-06-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=133-06-2",
          "code_system": "CAS",
          "references": [
            "f7e0c958-86c2-45df-a790-74684756961c",
            "d3ff8971-58f4-4306-9b78-b133d67f5105"
          ]
        },
        {
          "uuid": "894c90f0-a19a-4e08-80ce-b869480e83a0",
          "code": "14599-59-8",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=14599-59-8",
          "code_system": "CAS",
          "references": [
            "f7e0c958-86c2-45df-a790-74684756961c",
            "0de5f854-289b-45c9-ba0f-68324c499c87"
          ]
        },
        {
          "uuid": "f77f6ac4-0e51-466a-b57f-2b756308767d",
          "code": "C77379",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C77379",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f7e0c958-86c2-45df-a790-74684756961c"
          ]
        },
        {
          "uuid": "753ae146-2e38-4039-8da6-1ef77e2c726d",
          "code": "D002215",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68002215",
          "code_system": "MESH",
          "references": [
            "f7e0c958-86c2-45df-a790-74684756961c"
          ]
        },
        {
          "uuid": "0aa27d3f-95c5-452c-8f5b-48a0dc0629e5",
          "code": "CAPTAN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Captan",
          "code_system": "WIKIPEDIA",
          "references": [
            "f7e0c958-86c2-45df-a790-74684756961c"
          ]
        },
        {
          "uuid": "4c70f4af-0670-41f5-b39f-25afa073f625",
          "code": "21 CFR 176.170",
          "comments": "PART 176 -- INDIRECT FOOD ADDITIVES: PAPER AND PAPERBOARD COMPONENTS|Subpart B--Substances for Use Only as Components of Paper and Paperboard|Sec. 176.170 Components of paper and paperboard in contact with aqueous and fatty foods.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=176.170",
          "code_system": "CFR",
          "references": [
            "f7e0c958-86c2-45df-a790-74684756961c"
          ]
        },
        {
          "uuid": "acc262db-6c34-40a9-9bf9-7dfe29c4fe93",
          "code": "81301",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1701",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "f7e0c958-86c2-45df-a790-74684756961c"
          ]
        },
        {
          "uuid": "0218ea6c-b1cc-4244-a0d3-07a9a0be1a9e",
          "code": "1368147",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1368147/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "f7e0c958-86c2-45df-a790-74684756961c"
          ]
        },
        {
          "uuid": "046e064b-193a-4651-ba24-156becb50a8d",
          "code": "m3044",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3044?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f7e0c958-86c2-45df-a790-74684756961c"
          ]
        },
        {
          "uuid": "27470c6e-35d2-442d-87aa-f425b39d7fd9",
          "code": "205-087-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.626",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f7e0c958-86c2-45df-a790-74684756961c"
          ]
        },
        {
          "uuid": "f3cc0ce3-7c4a-4d42-8b7d-3b29eae300b8",
          "code": "18594026",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18594026",
          "code_system": "PUBCHEM",
          "references": [
            "f7e0c958-86c2-45df-a790-74684756961c"
          ]
        },
        {
          "uuid": "aa5f1c66-bba7-be68-743b-a6544ba0c625",
          "code": "951",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/951",
          "code_system": "HSDB",
          "references": [
            "e495ee6b-7a61-a854-dc89-3956ab982aad"
          ]
        },
        {
          "uuid": "0e09782b-a617-d043-ffe3-579d91f32c04",
          "code": "DTXSID9020243",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9020243",
          "code_system": "EPA CompTox",
          "references": [
            "076b01a5-1d68-e41c-43fe-078049fce8eb"
          ]
        },
        {
          "uuid": "b1ecc879-1c15-be24-6e45-aca3c64ad523",
          "code": "C737",
          "comments": "Industrial Aid[C45678]|Pesticide",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C737",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0aaca9d5-4aff-c103-75f9-5267a009b6c9"
          ]
        },
        {
          "uuid": "f72d0f44-d504-47dd-a4fe-cb7576eb7a40",
          "code": "EOL5G26Q9F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2743c37d-7677-c575-f569-a358f9da7395",
          "code": "34608",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34608",
          "code_system": "CHEBI",
          "references": [
            "0aaca9d5-4aff-c103-75f9-5267a009b6c9"
          ]
        },
        {
          "uuid": "1fdbf7a3-f3e0-4f86-d18f-e2c8585d8f2b",
          "code": "36726",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=36726",
          "code_system": "NSC",
          "references": [
            "0a2e57e0-b910-2ad9-ef08-eadaa0d0eab7"
          ]
        },
        {
          "uuid": "d5265c5b-c0dd-9537-2b5d-6aa2479c3df3",
          "code": "EOL5G26Q9F",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=EOL5G26Q9F",
          "code_system": "DAILYMED",
          "references": [
            "c6c0d708-996b-bbf9-a0d4-e468c521de16"
          ]
        },
        {
          "uuid": "83f48f7e-0085-0e72-e65b-f01caeefe5cc",
          "code": "captan",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/captan.html",
          "code_system": "ALANWOOD",
          "references": [
            "d4b945ee-d2d8-8567-b0fa-d8cd45ef151e"
          ]
        },
        {
          "uuid": "98e8394a-15fd-9d01-c501-5e68809649ef",
          "code": "100000142157",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "6e27012e-94ea-e171-e880-dfa9969ca04b"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "926ef1fe-6c47-46d4-a095-1bd7307598a2",
          "name": "1H-ISOINDOLE-1,3(2H)-DIONE, 3A,4,7,7A-TETRAHYDRO-2-((TRICHLOROMETHYL)THIO)-, (3AR,7AS)-REL-",
          "stdName": "1H-ISOINDOLE-1,3(2H)-DIONE, 3A,4,7,7A-TETRAHYDRO-2-((TRICHLOROMETHYL)THIO)-, (3AR,7AS)-REL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "88ab6f18-bd60-488e-8f35-3c3b56df209c",
            "f1c07765-88ab-4fdc-a729-619c3a96ae6a"
          ],
          "display_name": false
        },
        {
          "uuid": "e39c4d5f-4ef1-4e0b-84b9-753913bca1d5",
          "name": "1H-ISOINDOLE-1,3(2H)-DIONE, 3A,4,7,7A-TETRAHYDRO-2-((TRICHLOROMETHYL)THIO)-, CIS-",
          "stdName": "1H-ISOINDOLE-1,3(2H)-DIONE, 3A,4,7,7A-TETRAHYDRO-2-((TRICHLOROMETHYL)THIO)-, CIS-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "88ab6f18-bd60-488e-8f35-3c3b56df209c",
            "f1c07765-88ab-4fdc-a729-619c3a96ae6a"
          ],
          "display_name": false
        },
        {
          "uuid": "fd1aeb9c-1088-4f40-a1e8-1eb793a01d1a",
          "name": "4-CYCLOHEXENE-1,2-DICARBOXIMIDE, N-((TRICHLOROMETHYL)THIO)-, CIS-",
          "stdName": "4-CYCLOHEXENE-1,2-DICARBOXIMIDE, N-((TRICHLOROMETHYL)THIO)-, CIS-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "88ab6f18-bd60-488e-8f35-3c3b56df209c",
            "f1c07765-88ab-4fdc-a729-619c3a96ae6a"
          ],
          "display_name": false
        },
        {
          "uuid": "6e1c5b85-d447-4458-b634-0d97e0f29f9b",
          "name": "CAPTAN",
          "stdName": "CAPTAN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b5edee9-f5c3-4ec9-943b-c330af16c4a2",
            "f1c07765-88ab-4fdc-a729-619c3a96ae6a",
            "7314d487-d931-4f76-b17d-1ab813b7f5c3",
            "0e31e369-bdec-47ce-b7b8-6986f2986b64",
            "08972fc2-dc07-49a2-a4c4-4e834e2f2698",
            "d4a7b82f-7874-49fd-b119-0afeb3f55158",
            "5141a72d-f369-48e7-a415-10b4e5a68b4a",
            "4b6f89ac-39ee-4987-911f-967fa627948c",
            "e8b48edc-038f-42f6-9f76-21afd3d41c8a",
            "2fdfac0e-ca54-4aee-be8f-5d65d4c8d1e0",
            "12c47025-afe5-4272-83fc-572790fa646a",
            "3c9bab5b-98dd-4cc5-993e-d1600b8b662c"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "73fe867a-6d37-4335-b18f-d496414cac4a",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "441f2e02-cfa4-43eb-b6db-4cb2293cf61a",
          "name": "CAPTAN [HSDB]",
          "stdName": "CAPTAN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b5edee9-f5c3-4ec9-943b-c330af16c4a2",
            "f1c07765-88ab-4fdc-a729-619c3a96ae6a"
          ],
          "display_name": false
        },
        {
          "uuid": "428d0f14-822e-c368-af9b-8e2bd11a8f7e",
          "name": "CAPTAN [IARC]",
          "stdName": "CAPTAN [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9d84e01-9e09-17fd-ff7a-74b565f14c44"
          ],
          "display_name": false
        },
        {
          "uuid": "187e7130-1a70-4517-b819-1c2bcfea6b34",
          "name": "CAPTAN [II]",
          "stdName": "CAPTAN [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5141a72d-f369-48e7-a415-10b4e5a68b4a"
          ],
          "display_name": false
        },
        {
          "uuid": "4ba5b077-ae78-4ef0-9b8b-32dca1abca19",
          "name": "CAPTAN [ISO]",
          "stdName": "CAPTAN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1c07765-88ab-4fdc-a729-619c3a96ae6a",
            "d4a7b82f-7874-49fd-b119-0afeb3f55158"
          ],
          "display_name": false
        },
        {
          "uuid": "63384d3a-669f-488b-a3b7-9fe025e47ba3",
          "name": "CAPTAN [MI]",
          "stdName": "CAPTAN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1c07765-88ab-4fdc-a729-619c3a96ae6a",
            "12c47025-afe5-4272-83fc-572790fa646a"
          ],
          "display_name": false
        },
        {
          "uuid": "b90f4071-41ec-4cbe-86db-27f1eb2bceb5",
          "name": "ENT-26538",
          "stdName": "ENT-26538",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a68faba3-ab04-4ecc-9ca7-4bad1886f539",
            "f1c07765-88ab-4fdc-a729-619c3a96ae6a"
          ],
          "display_name": false
        },
        {
          "uuid": "a93b281b-f59c-4c74-af64-ee30b20a8e8b",
          "name": "MERPAN",
          "stdName": "MERPAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a68faba3-ab04-4ecc-9ca7-4bad1886f539",
            "f1c07765-88ab-4fdc-a729-619c3a96ae6a"
          ],
          "display_name": false
        },
        {
          "uuid": "a5d76ad1-c207-47f7-8799-e7b889457e3f",
          "name": "N-(TRICHLOROMETHYLTHIO)CYCLOHEX-4-ENE-1,2-DICARBOXIMIDE",
          "stdName": "N-(TRICHLOROMETHYLTHIO)CYCLOHEX-4-ENE-1,2-DICARBOXIMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "790f7c0f-8162-459b-a577-d03e6dae8187",
            "c98843db-2fde-4217-8e4f-0a4814ba74b2"
          ],
          "display_name": false
        },
        {
          "uuid": "62bf7c00-4bee-4763-b067-4a9c0e10f533",
          "name": "NSC-36726",
          "stdName": "NSC-36726",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "88ab6f18-bd60-488e-8f35-3c3b56df209c",
            "f1c07765-88ab-4fdc-a729-619c3a96ae6a"
          ],
          "display_name": false
        },
        {
          "uuid": "6ee9834e-d325-41e7-90fa-9a1eaf515949",
          "name": "ORTHOCIDE-406",
          "stdName": "ORTHOCIDE-406",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a68faba3-ab04-4ecc-9ca7-4bad1886f539",
            "f1c07765-88ab-4fdc-a729-619c3a96ae6a"
          ],
          "display_name": false
        },
        {
          "uuid": "83c32aca-e1d8-4cad-afe1-6c9c13ffa6f3",
          "name": "SR-406",
          "stdName": "SR-406",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a68faba3-ab04-4ecc-9ca7-4bad1886f539",
            "f1c07765-88ab-4fdc-a729-619c3a96ae6a"
          ],
          "display_name": false
        },
        {
          "uuid": "5298f47b-5ac3-4bbe-a03c-12c970abbd5b",
          "name": "VANCIDE 89",
          "stdName": "VANCIDE 89",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a68faba3-ab04-4ecc-9ca7-4bad1886f539",
            "f1c07765-88ab-4fdc-a729-619c3a96ae6a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a68faba3-ab04-4ecc-9ca7-4bad1886f539",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f1c07765-88ab-4fdc-a729-619c3a96ae6a",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5141a72d-f369-48e7-a415-10b4e5a68b4a",
          "citation": "ChemIDplus 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b6f89ac-39ee-4987-911f-967fa627948c",
          "citation": "OTC",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c98843db-2fde-4217-8e4f-0a4814ba74b2",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "790f7c0f-8162-459b-a577-d03e6dae8187",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "12c47025-afe5-4272-83fc-572790fa646a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8b48edc-038f-42f6-9f76-21afd3d41c8a",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b5edee9-f5c3-4ec9-943b-c330af16c4a2",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88ab6f18-bd60-488e-8f35-3c3b56df209c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4a7b82f-7874-49fd-b119-0afeb3f55158",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7e0c958-86c2-45df-a790-74684756961c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391757000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "173141a8-5f51-45d2-8bb1-02c7575f1761",
          "citation": "SRS import [EOL5G26Q9F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=EOL5G26Q9F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391757000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08972fc2-dc07-49a2-a4c4-4e834e2f2698",
          "citation": "CAPTAN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7314d487-d931-4f76-b17d-1ab813b7f5c3",
          "citation": "CAPTAN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0e31e369-bdec-47ce-b7b8-6986f2986b64",
          "citation": "CAPTAN [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2fdfac0e-ca54-4aee-be8f-5d65d4c8d1e0",
          "citation": "CAPTAN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3c9bab5b-98dd-4cc5-993e-d1600b8b662c",
          "citation": "CAPTAN [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e495ee6b-7a61-a854-dc89-3956ab982aad",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+133-06-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "076b01a5-1d68-e41c-43fe-078049fce8eb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=133-06-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c9d84e01-9e09-17fd-ff7a-74b565f14c44",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "0aaca9d5-4aff-c103-75f9-5267a009b6c9",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d4b945ee-d2d8-8567-b0fa-d8cd45ef151e",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "c6c0d708-996b-bbf9-a0d4-e468c521de16",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "0a2e57e0-b910-2ad9-ef08-eadaa0d0eab7",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d3ff8971-58f4-4306-9b78-b133d67f5105",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0de5f854-289b-45c9-ba0f-68324c499c87",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6e27012e-94ea-e171-e880-dfa9969ca04b",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d6854786-fe9f-4622-b9c1-ed2413b75640",
          "id": "d6854786-fe9f-4622-b9c1-ed2413b75640",
          "molfile": "\n  Marvin  01132111072D          \n\n 16 17  0  0  0  0            999 V2000\n    1.6108   -1.5536    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    0.8963   -1.1411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1818   -1.5536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1818   -2.3787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8963   -2.7911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6108   -2.3786    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.3954   -2.6335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6503   -3.4182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8803   -1.9661    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7053   -1.9661    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1178   -1.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9428   -1.2516    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.7053   -0.5372    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.5303   -0.5372    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.3954   -1.2987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6504   -0.5141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  6  1  1  0  0  0  0\n  1 15  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  1  0  0  0\n  8  7  2  0  0  0  0\n  7  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 15  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 11  1  0  0  0  0\n 16 15  2  0  0  0  0\nM  END",
          "smiles": "C1=CC[C@@H]2[C@H](C1)C(=O)N(C2=O)SC(Cl)(Cl)Cl",
          "formula": "C9H8Cl3NO2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8675d51b-0e7b-435f-b8a3-cf137f902fac"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "300.5906",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3d5ba1c0-cb47-45b4-aba7-7ed85e9c6a08",
      "version": "13",
      "structure": {
        "id": "0df1bb58-d989-4cd3-b22e-c046884a57ff",
        "molfile": "\n  Marvin  01132100582D          \n\n 18 19  0  0  1  0            999 V2000\n    2.8803   -1.9661    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3954   -2.6335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6108   -2.3786    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.8963   -2.7911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1818   -2.3787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1818   -1.5536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8963   -1.1411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6108   -1.5536    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.3954   -1.2987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6504   -0.5141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6970   -0.7331    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6970   -3.1991    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6503   -3.4182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7053   -1.9661    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1178   -1.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9428   -1.2516    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.7053   -0.5372    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.5303   -0.5372    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  9  2  0  0  0  0\n  3  8  1  0  0  0  0\n  8 11  1  6  0  0  0\n  3 12  1  6  0  0  0\n 13  2  2  0  0  0  0\n 14  1  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18 15  1  0  0  0  0\nM  END",
        "smiles": "C1=CC[C@]2([H])[C@]([H])(C1)C(=O)N(C2=O)SC(Cl)(Cl)Cl",
        "formula": "C9H8Cl3NO2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "300.5906",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "5141a72d-f369-48e7-a415-10b4e5a68b4a",
          "173141a8-5f51-45d2-8bb1-02c7575f1761"
        ],
        "stereo_centers": 2
      },
      "unii": "EOL5G26Q9F"
    }
  ]
}