{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b93420eb-ee95-4ded-ab91-75f07a24bff4",
          "code": "131341-86-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=131341-86-1",
          "code_system": "CAS",
          "references": [
            "7649bdf0-d85b-4ab5-ae44-866371e993f7",
            "ed3205f7-8fa4-48ad-9570-f5cef7a69916"
          ]
        },
        {
          "uuid": "b6da7be4-e16c-48ff-8e82-12b60cb02824",
          "code": "71503",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2391",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "7649bdf0-d85b-4ab5-ae44-866371e993f7"
          ]
        },
        {
          "uuid": "079c306b-1fc9-4539-8a04-a9d05050356f",
          "code": "m5430",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5430?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7649bdf0-d85b-4ab5-ae44-866371e993f7"
          ]
        },
        {
          "uuid": "98603cb5-758a-47bd-aa13-ffc51b0c9bae",
          "code": "86398",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/86398",
          "code_system": "PUBCHEM",
          "references": [
            "7649bdf0-d85b-4ab5-ae44-866371e993f7"
          ]
        },
        {
          "uuid": "044a42c1-f462-9d66-b8aa-1b3640d3fbad",
          "code": "DTXSID2032398",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2032398",
          "code_system": "EPA CompTox",
          "references": [
            "f6cad36f-9065-b234-8f23-ccf84bf62120"
          ]
        },
        {
          "uuid": "08946be2-834c-8dcc-a70e-de63a84503b1",
          "code": "8246",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/8246",
          "code_system": "HSDB",
          "references": [
            "da5218d9-b11b-a30d-e172-cbbdfd3ce23e"
          ]
        },
        {
          "uuid": "26dac39d-9ce4-4c99-8acc-8a5d732d75d0",
          "code": "ENS9J0YM16",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "58a07ad5-ce1e-28c6-b232-2fbbbc597968",
          "code": "81763",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:81763",
          "code_system": "CHEBI",
          "references": [
            "c98a8e82-ee76-6315-fd7f-50df38db6864"
          ]
        },
        {
          "uuid": "7f25d71d-b391-8b1f-2f3d-ef894ed9655d",
          "code": "Fludioxonil",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Fludioxonil",
          "code_system": "WIKIPEDIA",
          "references": [
            "388f6a8e-d76b-56b6-4bd0-8b7e059036fb"
          ]
        },
        {
          "uuid": "b980c57d-abd8-92f0-ee1f-9f8ceaf78ea1",
          "code": "fludioxonil",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/fludioxonil.html",
          "code_system": "ALANWOOD",
          "references": [
            "1ac57a9a-8427-71bd-b92b-373dd8ead0c3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1c295ae9-a4de-4d82-8c84-4c3329b6165f",
          "name": "3-(2,2-DIFLUOROBENZODIOXOL-4-YL)-4-CYANOPYRROLE",
          "stdName": "3-(2,2-DIFLUOROBENZODIOXOL-4-YL)-4-CYANOPYRROLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6121b68-df3d-4697-8cd2-5827c55860b7",
            "bab4265f-7e82-4081-a21a-9cf4e3c06af6"
          ],
          "display_name": false
        },
        {
          "uuid": "4a6cb99e-0a54-497e-b80b-ed1290e45711",
          "name": "4-(2,2-DIFLUORO-1,3-BENZODIOXOL-4-YL)-1H-PYRROLE-3-CARBONITRILE",
          "stdName": "4-(2,2-DIFLUORO-1,3-BENZODIOXOL-4-YL)-1H-PYRROLE-3-CARBONITRILE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3207b274-ace6-4f5e-9834-b775689c7d12",
            "d1d6d49e-79de-4814-a5f7-f1a9c1e33548"
          ],
          "display_name": false
        },
        {
          "uuid": "525b6a5d-d3b3-4786-b5cb-abd5156290df",
          "name": "CELEST",
          "stdName": "CELEST",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f92c8003-b6c9-47d8-8c1a-690f47aed18e",
            "b6121b68-df3d-4697-8cd2-5827c55860b7"
          ],
          "display_name": false
        },
        {
          "uuid": "8f99b707-a98c-400a-bc4e-e4d06d4a7923",
          "name": "CGA-173506",
          "stdName": "CGA-173506",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6121b68-df3d-4697-8cd2-5827c55860b7",
            "bab4265f-7e82-4081-a21a-9cf4e3c06af6"
          ],
          "display_name": false
        },
        {
          "uuid": "d8f8c47d-8222-47fa-98cc-5e366c295fd4",
          "name": "FLUDIOXONIL",
          "stdName": "FLUDIOXONIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b33270a-7c56-4053-a833-907b598ce58d",
            "34b78162-d3f5-47fd-ba99-5f3acea898cf",
            "cdc5ecfa-2adb-42e1-a84d-0011a98681a4",
            "cf171c24-e0cf-4bda-ab90-12d3cc6b19dc",
            "b6121b68-df3d-4697-8cd2-5827c55860b7",
            "80e0188d-ef82-410e-bd9b-977c64342082"
          ],
          "display_name": true
        },
        {
          "uuid": "4510c9bd-9ccb-4bca-9c3e-adde024aeabc",
          "name": "FLUDIOXONIL [ISO]",
          "stdName": "FLUDIOXONIL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cdc5ecfa-2adb-42e1-a84d-0011a98681a4",
            "b6121b68-df3d-4697-8cd2-5827c55860b7"
          ],
          "display_name": false
        },
        {
          "uuid": "8d8dd0ac-bb93-4b9c-9559-808afed67e72",
          "name": "FLUDIOXONIL [MI]",
          "stdName": "FLUDIOXONIL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf171c24-e0cf-4bda-ab90-12d3cc6b19dc",
            "b6121b68-df3d-4697-8cd2-5827c55860b7"
          ],
          "display_name": false
        },
        {
          "uuid": "848bdf94-b659-4b3d-a0d7-da5de0ff0ac1",
          "name": "MAXIM",
          "stdName": "MAXIM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f92c8003-b6c9-47d8-8c1a-690f47aed18e",
            "b6121b68-df3d-4697-8cd2-5827c55860b7"
          ],
          "display_name": false
        },
        {
          "uuid": "a3ccdb3c-f41d-4b9a-bcb2-f467deb3711d",
          "name": "MEDALLION",
          "stdName": "MEDALLION",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f92c8003-b6c9-47d8-8c1a-690f47aed18e",
            "b6121b68-df3d-4697-8cd2-5827c55860b7"
          ],
          "display_name": false
        },
        {
          "uuid": "9059f6d1-d5d0-4641-a2a2-228f3acfcf9e",
          "name": "SCHOLAR",
          "stdName": "SCHOLAR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f92c8003-b6c9-47d8-8c1a-690f47aed18e",
            "b6121b68-df3d-4697-8cd2-5827c55860b7"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "80e0188d-ef82-410e-bd9b-977c64342082",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d1d6d49e-79de-4814-a5f7-f1a9c1e33548",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3207b274-ace6-4f5e-9834-b775689c7d12",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf171c24-e0cf-4bda-ab90-12d3cc6b19dc",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6121b68-df3d-4697-8cd2-5827c55860b7",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bab4265f-7e82-4081-a21a-9cf4e3c06af6",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f92c8003-b6c9-47d8-8c1a-690f47aed18e",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cdc5ecfa-2adb-42e1-a84d-0011a98681a4",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7649bdf0-d85b-4ab5-ae44-866371e993f7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c855a431-1cef-4054-9d05-452db47a0ad4",
          "citation": "SRS import [ENS9J0YM16]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ENS9J0YM16",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09504b30-b721-45a2-bc2b-562a79de07a9",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34b78162-d3f5-47fd-ba99-5f3acea898cf",
          "citation": "FLUDIOXONIL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8b33270a-7c56-4053-a833-907b598ce58d",
          "citation": "FLUDIOXONIL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "da5218d9-b11b-a30d-e172-cbbdfd3ce23e",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+131341-86-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f6cad36f-9065-b234-8f23-ccf84bf62120",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=131341-86-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "388f6a8e-d76b-56b6-4bd0-8b7e059036fb",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "1ac57a9a-8427-71bd-b92b-373dd8ead0c3",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "c98a8e82-ee76-6315-fd7f-50df38db6864",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ed3205f7-8fa4-48ad-9570-f5cef7a69916",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "83f27cb9-c8f1-4931-8388-639e61b77761",
          "id": "83f27cb9-c8f1-4931-8388-639e61b77761",
          "molfile": "\n  Marvin  01132106512D          \n\n 18 20  0  0  0  0            999 V2000\n    8.0671   -3.1470    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2494   -3.2348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2494   -2.3939    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4363   -3.1701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0990   -3.9231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3045   -4.1771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1382   -4.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7433   -5.5399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5426   -5.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1477   -5.8356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9654   -5.6647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3674   -6.3762    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8176   -6.9905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0646   -6.6534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3486   -7.0597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6324   -7.4664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7089   -4.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4249   -4.0524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n 18  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 17  2  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n  9 17  1  0  0  0  0\n 11 10  2  0  0  0  0\n 14 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  3  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "c1cc(-c2c[nH]cc2C#N)c3c(c1)OC(F)(F)O3",
          "formula": "C12H6F2N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ff701883-f787-4b72-b40c-b1885ca80604"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "248.1855",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "56374731-faab-4a87-99b1-cf6792fe7285",
      "version": "7",
      "structure": {
        "id": "ea58315d-e243-49b6-b330-e89aefdd1ffc",
        "molfile": "\n  Marvin  01132112072D          \n\n 18 20  0  0  0  0            999 V2000\n    7.2494   -3.2348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4249   -4.0524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7089   -4.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5426   -5.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7433   -5.5399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1382   -4.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3045   -4.1771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0990   -3.9231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4363   -3.1701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1477   -5.8356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0646   -6.6534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8176   -6.9905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3674   -6.3762    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9654   -5.6647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3486   -7.0597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6324   -7.4664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0671   -3.1470    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2494   -2.3939    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9  1  1  0  0  0  0\n  8  3  2  0  0  0  0\n 10  4  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 10  2  0  0  0  0\n 11 15  1  0  0  0  0\n 15 16  3  0  0  0  0\n 17  1  1  0  0  0  0\n 18  1  1  0  0  0  0\nM  END",
        "smiles": "c1cc(-c2c[nH]cc2C#N)c3c(c1)OC(F)(F)O3",
        "formula": "C12H6F2N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "248.1855",
        "optical_activity": "NONE",
        "references": [
          "c855a431-1cef-4054-9d05-452db47a0ad4",
          "09504b30-b721-45a2-bc2b-562a79de07a9"
        ],
        "stereo_centers": 0
      },
      "unii": "ENS9J0YM16"
    }
  ]
}