{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f824e18b-33f8-4ff7-afaa-453946096f37",
          "code": "H01BA02",
          "comments": "ATC|SYSTEMIC HORMONAL PREPARATIONS, EXCL. SEX HORMONES AND INSULINS|PITUITARY AND HYPOTHALAMIC HORMONES AND ANALOGUES|POSTERIOR PITUITARY LOBE HORMONES|Vasopressin and analogues|desmopressin",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=H01BA02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "67a0608c-77e8-4d61-ad56-97b15f521800",
          "code": "N0000175905",
          "comments": "Established Pharmacologic Class [EPC]|Vasopressin Analog [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175905",
          "code_system": "NDF-RT",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "f7fe2f05-fd73-4178-b26b-daf838a3e8af",
          "code": "N0000175916",
          "comments": "Established Pharmacologic Class [EPC]|Factor VIII Activator [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175916",
          "code_system": "NDF-RT",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "5fc30a34-a759-4a61-bf2e-88a9e5a9abaf",
          "code": "N0000006320",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Hormones, Hormone Substitutes, and Hormone Antagonists [Chemical/Ingredient]|Hormones [Chemical/Ingredient]|Peptide Hormones [Chemical/Ingredient]|Pituitary Hormones [Chemical/Ingredient]|Pituitary Hormones, Posterior [Chemical/Ingredient]|Vasopressins [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000006320",
          "code_system": "NDF-RT",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "cadee20a-76df-4923-a65f-c467ce2b3370",
          "code": "N0000006320",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Amino Acids, Peptides, and Proteins [Chemical/Ingredient]|Proteins [Chemical/Ingredient]|Nerve Tissue Proteins [Chemical/Ingredient]|Neuropeptides [Chemical/Ingredient]|Vasopressins [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000006320",
          "code_system": "NDF-RT",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "6457583b-ed68-4c56-a9c3-23ef16045a3a",
          "code": "N0000006320",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Amino Acids, Peptides, and Proteins [Chemical/Ingredient]|Peptides [Chemical/Ingredient]|Peptide Hormones [Chemical/Ingredient]|Pituitary Hormones [Chemical/Ingredient]|Pituitary Hormones, Posterior [Chemical/Ingredient]|Vasopressins [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000006320",
          "code_system": "NDF-RT",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "26af1123-d046-455c-9781-312ee3158103",
          "code": "N0000006320",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Amino Acids, Peptides, and Proteins [Chemical/Ingredient]|Peptides [Chemical/Ingredient]|Neuropeptides [Chemical/Ingredient]|Vasopressins [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000006320",
          "code_system": "NDF-RT",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "5c60ae7a-7a1b-4131-b2ef-c2d884900a6a",
          "code": "N0000006320",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Amino Acids, Peptides, and Proteins [Chemical/Ingredient]|Peptides [Chemical/Ingredient]|Oligopeptides [Chemical/Ingredient]|Vasopressins [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000006320",
          "code_system": "NDF-RT",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "99ebba38-5be3-4a52-aba4-4f1fe876e6a2",
          "code": "N0000175915",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Hemic/Lymphatic Activity Alteration [PE]|Hematologic Activity Alteration [PE]|Hemostasis Alteration [PE]|Coagulation Factor Alteration [PE]|Coagulation Factor Concentration Alteration [PE]|Increased Coagulation Factor Concentration [PE]|Increased Coagulation Factor VIII Concentration [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175915",
          "code_system": "NDF-RT",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "88197a63-7ed7-4461-9048-ddec0c8c3cc3",
          "code": "N0000175915",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Hemic/Lymphatic Activity Alteration [PE]|Hematologic Activity Alteration [PE]|Hemostasis Alteration [PE]|Coagulation Activity Alteration [PE]|Increased Coagulation Activity [PE]|Increased Coagulation Factor Concentration [PE]|Increased Coagulation Factor VIII Concentration [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175915",
          "code_system": "NDF-RT",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "f83f5f42-a7d9-4845-afc5-1da252112d98",
          "code": "N0000175914",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Hemic/Lymphatic Activity Alteration [PE]|Hematologic Activity Alteration [PE]|Hemostasis Alteration [PE]|Coagulation Factor Alteration [PE]|Coagulation Factor Activity Alteration [PE]|Increased Coagulation Factor Activity [PE]|Increased Coagulation Factor VIII Activity [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175914",
          "code_system": "NDF-RT",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "79663a9a-844d-45a8-9187-d6cb76ede089",
          "code": "N0000175914",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Hemic/Lymphatic Activity Alteration [PE]|Hematologic Activity Alteration [PE]|Hemostasis Alteration [PE]|Coagulation Activity Alteration [PE]|Increased Coagulation Activity [PE]|Increased Coagulation Factor Activity [PE]|Increased Coagulation Factor VIII Activity [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175914",
          "code_system": "NDF-RT",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "dfe9739b-2186-4c9c-98cf-ac39565ea7d1",
          "code": "QH01BA02",
          "comments": "VATC|PITUITARY AND HYPOTHALAMIC HORMONES AND ANALOGUES|POSTERIOR PITUITARY LOBE HORMONES|Vasopressin and analogues|desmopressin",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QH01BA02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "3b7a23d5-0b76-477c-a7cb-572039cddea8",
          "code": "16679-58-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=16679-58-6",
          "code_system": "CAS",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc",
            "16eca533-5d55-4216-96ec-50d6bf8b1de2"
          ]
        },
        {
          "uuid": "34866483-51cb-4066-9222-e7c06e98f9ee",
          "code": "C61701",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61701",
          "code_system": "NCI_THESAURUS",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "244135cf-2234-4dbd-a89c-4b39f167d904",
          "code": "DESMOPRESSIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Desmopressin",
          "code_system": "WIKIPEDIA",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "df86d36c-eea4-4756-9ccb-47f52da6c0eb",
          "code": "SUB07001MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "000bacd1-4669-4cf9-8625-49f4eba26b86",
          "code": "3799",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3799",
          "code_system": "INN",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "be60bc41-dd5a-45b7-88dd-4d37b56be50b",
          "code": "240-726-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.037.009",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "5d75e898-0630-4bf5-b409-005125b6b9a3",
          "code": "3251",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/3251/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "10c7b044-d032-4c74-b11b-40d4c0001a19",
          "code": "m4196",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4196?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "0106eddf-d474-482f-8781-57280141ff0d",
          "code": "DB00035",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00035",
          "code_system": "DRUG BANK",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "1726770a-2352-43e2-8411-b16af8731674",
          "code": "CHEMBL1429",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1429",
          "code_system": "ChEMBL",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "70c3d590-ba65-4b0b-a8da-982c5d7c632a",
          "code": "N0000175914",
          "comments": "Increased Coagulation Factor VIII Activity [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175914",
          "code_system": "NDF-RT",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "1ec354b5-7f6a-43e8-b439-f95b41165185",
          "code": "5311065",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5311065",
          "code_system": "PUBCHEM",
          "references": [
            "db6f6f7e-568b-4a60-8196-81e5ca947bbc"
          ]
        },
        {
          "uuid": "aba4c36d-7b1a-2c3b-d104-0eb54033daa3",
          "code": "DTXSID1048259",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1048259",
          "code_system": "EPA CompTox",
          "references": [
            "0b52c197-c55d-16d2-97f4-b9b5306b2b68"
          ]
        },
        {
          "uuid": "3cb397e2-c77c-c4a1-9a7b-b4387565b2de",
          "code": "C80212",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Antidiuretic Hormone Analogue",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C80212",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ee1da446-dc73-93fa-b5e0-43e89b500fbe"
          ]
        },
        {
          "uuid": "e57ccf08-5e2f-4d02-b97d-1402337778c2",
          "code": "ENR1LLB0FP",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "765bf3bc-fe83-d391-c5c8-ccb243f616c2",
          "code": "Desmopressin",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM439/",
          "code_system": "LACTMED",
          "references": [
            "ee1da446-dc73-93fa-b5e0-43e89b500fbe"
          ]
        },
        {
          "uuid": "434427f3-0104-e7c2-0f0b-2a00248d36ff",
          "code": "817",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/817",
          "code_system": "DRUG CENTRAL",
          "references": [
            "ee1da446-dc73-93fa-b5e0-43e89b500fbe"
          ]
        },
        {
          "uuid": "472fc8c4-2e37-2d2e-cd10-b2b006970fd0",
          "code": "4450",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:4450",
          "code_system": "CHEBI",
          "references": [
            "ee1da446-dc73-93fa-b5e0-43e89b500fbe"
          ]
        },
        {
          "uuid": "4fa86d78-682b-5513-15e6-5a140fe5cc1e",
          "code": "100000092796",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "cdc8b0d0-7aca-bbd3-e934-3f340feecd3e"
          ]
        },
        {
          "uuid": "1a71ea7b-1dc6-974d-7cce-03f9c87d425c",
          "code": "ENR1LLB0FP",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=ENR1LLB0FP",
          "code_system": "DAILYMED",
          "references": [
            "78507c36-541a-5a55-b881-2750e6f959a8"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "0b2c4cb3-cce9-4a6d-a793-c39971baee20",
          "amount": {
            "uuid": "ed71bab0-b443-4c35-8f6a-3a3aa51c3e8c"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "b4fd31fa-eb16-4dc8-b3fc-5079b70c5d59",
            "refuuid": "be9dbcb4-fb58-4325-b637-35de4fc63542",
            "name": "DESMOPRESSIN",
            "unii": "ENR1LLB0FP",
            "linking_id": "ENR1LLB0FP",
            "ref_pname": "DESMOPRESSIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "48f5ba4c-0828-4f7f-8df6-2248725f8838",
          "amount": {
            "uuid": "bfc793fd-da93-4029-8904-23a6fff9a83b"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "1d4f2b45-75b1-4973-8f13-146a1ac85e3f",
            "refuuid": "aa798ebf-e328-41c6-bf04-ac000ab14fa1",
            "name": "DESMOPRESSIN ACETATE",
            "unii": "XB13HYU18U",
            "linking_id": "XB13HYU18U",
            "ref_pname": "DESMOPRESSIN ACETATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "80717fca-9c8a-4614-83e8-3a6ad2cb64ff",
          "amount": {
            "uuid": "8e0411ad-a725-4be4-a14a-257d94ffc03a"
          },
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "4625e591-4e7a-434c-a4ab-302ef66b5aae",
            "refuuid": "53c52fba-a46f-9eb9-8ca8-4367c9766352",
            "name": "ALTERNATIVE DEFINITION for [DESMOPRESSIN]",
            "linking_id": "53c52fba-a46f-9eb9-8ca8-4367c9766352",
            "ref_pname": "NO NAME"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ca449aae-c3c4-4ad3-9feb-75f8441979b9",
          "name": "1-(3-MERCAPTOPROPIONIC ACID)-8-D-ARGININE-VASOPRESSIN",
          "stdName": "1-(3-MERCAPTOPROPIONIC ACID)-8-D-ARGININE-VASOPRESSIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e7ee0d1-7db0-49c8-9816-da49bb700059"
          ],
          "display_name": false
        },
        {
          "uuid": "a71a118a-a687-4bf4-bc6e-b9475722b646",
          "name": "DESMOPRESSIN",
          "stdName": "DESMOPRESSIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b120ee57-3125-4f24-ba95-b27cbb7eb762",
            "5e420f43-4fd8-4775-93f1-b745173a20c9",
            "d9643c99-70bd-4eb2-bb17-9a09cd440b18",
            "2d5372da-651b-46be-8116-2e30175e4ce0",
            "1e06aaae-0215-496e-853c-eb49cfd9ebeb",
            "9f4e0086-c86b-41fc-9350-6683d9c72667",
            "f7d8e836-701b-48d5-b19a-ce2619d61f61",
            "04c5ab7e-38d6-4205-94cd-f544acb506f4",
            "f6958bec-315f-4cca-82ae-300197789e8e",
            "e5b11818-dc07-4582-99d4-55860b1e2990",
            "1a37a577-dc63-449f-84fe-94747293bca1",
            "9b009a40-a0ec-4e29-a06e-da7a5bd87fa6",
            "bec34b62-41dd-4391-9f19-7716f2dd5735"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "bc79bf05-58eb-4b5a-9b67-c2484ee1686c",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "c56d691a-851b-9a87-469f-0666f95ea15e",
          "name": "DESMOPRESSIN [EP MONOGRAPH]",
          "stdName": "DESMOPRESSIN [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4808dc19-d1fb-1884-f877-1b7f7cd3e1bc"
          ],
          "display_name": false
        },
        {
          "uuid": "3673dcec-7293-4bd6-bf48-884c1e261f10",
          "name": "DESMOPRESSIN [MART.]",
          "stdName": "DESMOPRESSIN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e420f43-4fd8-4775-93f1-b745173a20c9"
          ],
          "display_name": false
        },
        {
          "uuid": "fdc82084-85c0-4f91-b1a2-ecc6e5c25c7b",
          "name": "DESMOPRESSIN [MI]",
          "stdName": "DESMOPRESSIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b120ee57-3125-4f24-ba95-b27cbb7eb762"
          ],
          "display_name": false
        },
        {
          "uuid": "a086ab84-2610-491c-837c-fa325886f400",
          "name": "DESMOPRESSIN [VANDF]",
          "stdName": "DESMOPRESSIN [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b009a40-a0ec-4e29-a06e-da7a5bd87fa6"
          ],
          "display_name": false
        },
        {
          "uuid": "a7054c51-e202-03c0-6fcb-95b1ad87a167",
          "name": "Desmopressin [WHO-DD]",
          "stdName": "DESMOPRESSIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ed2ee39-270b-644d-bb1a-78858906d481"
          ],
          "display_name": false
        },
        {
          "uuid": "a46bf75d-6958-4558-a954-de7b64d18672",
          "name": "H01BA02",
          "stdName": "H01BA02",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6e7c230-1ae6-4dc3-a711-28660328fd81",
            "04247493-7cc4-4fc5-a041-2b64ca28ce0b"
          ],
          "display_name": false
        },
        {
          "uuid": "d25f0ac7-6521-4c6b-9eda-6e3e9aaa8da8",
          "name": "SER-120",
          "stdName": "SER-120",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81218d9c-0c19-4e41-84dd-61b64e9515a4"
          ],
          "display_name": false
        },
        {
          "uuid": "8e67b816-6c51-44b2-8108-22703f67e195",
          "name": "SER120",
          "stdName": "SER120",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81218d9c-0c19-4e41-84dd-61b64e9515a4"
          ],
          "display_name": false
        },
        {
          "uuid": "99dbf8be-24db-430b-8f72-9e07d3c93ccf",
          "name": "VASOPRESSIN, 1-(3-MERCAPTOPROPANOIC ACID)-8-D-ARGININE-",
          "stdName": "VASOPRESSIN, 1-(3-MERCAPTOPROPANOIC ACID)-8-D-ARGININE-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e7ee0d1-7db0-49c8-9816-da49bb700059"
          ],
          "display_name": false
        },
        {
          "uuid": "3da6b146-d356-4dc3-81b5-4b1e83672232",
          "name": "desmopressin [INN]",
          "stdName": "DESMOPRESSIN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f4e0086-c86b-41fc-9350-6683d9c72667",
            "39c708b6-4c2c-4b82-892b-ef02d2763310"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f7d8e836-701b-48d5-b19a-ce2619d61f61",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2e7ee0d1-7db0-49c8-9816-da49bb700059",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "04247493-7cc4-4fc5-a041-2b64ca28ce0b",
          "citation": "ATC CODE 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6e7c230-1ae6-4dc3-a711-28660328fd81",
          "citation": "WHO 2009",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f4e0086-c86b-41fc-9350-6683d9c72667",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1e06aaae-0215-496e-853c-eb49cfd9ebeb",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e420f43-4fd8-4775-93f1-b745173a20c9",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b120ee57-3125-4f24-ba95-b27cbb7eb762",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a37a577-dc63-449f-84fe-94747293bca1",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b009a40-a0ec-4e29-a06e-da7a5bd87fa6",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db6f6f7e-568b-4a60-8196-81e5ca947bbc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389748000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d0cc9cc-e199-4394-8f91-c19c10dd1e3f",
          "citation": "SRS import [ENR1LLB0FP]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ENR1LLB0FP",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389748000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d5372da-651b-46be-8116-2e30175e4ce0",
          "citation": "DESMOPRESSIN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d9643c99-70bd-4eb2-bb17-9a09cd440b18",
          "citation": "DESMOPRESSIN [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e5b11818-dc07-4582-99d4-55860b1e2990",
          "citation": "DESMOPRESSIN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f6958bec-315f-4cca-82ae-300197789e8e",
          "citation": "DESMOPRESSIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bec34b62-41dd-4391-9f19-7716f2dd5735",
          "citation": "DESMOPRESSIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "04c5ab7e-38d6-4205-94cd-f544acb506f4",
          "citation": "DESMOPRESSIN [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0b52c197-c55d-16d2-97f4-b9b5306b2b68",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=16679-58-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "894efd01-b24f-14e7-3978-5834c679db20",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+16679-58-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ee1da446-dc73-93fa-b5e0-43e89b500fbe",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "81218d9c-0c19-4e41-84dd-61b64e9515a4",
          "citation": "Kaminetsky, Jed, et al. \"Efficacy and safety of SER120 nasal spray in patients with nocturia: pooled analysis of 2 randomized, double-blind, placebo controlled, phase 3 trials.\" The Journal of Urology 200.3 (2018): 604-611.",
          "url": "https://www.auajournals.org/article/S0022-5347(18)42971-0/fulltext",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "16eca533-5d55-4216-96ec-50d6bf8b1de2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "39c708b6-4c2c-4b82-892b-ef02d2763310",
          "citation": "INN Proposed List 33",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL33.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4808dc19-d1fb-1884-f877-1b7f7cd3e1bc",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "0ed2ee39-270b-644d-bb1a-78858906d481",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "78507c36-541a-5a55-b881-2750e6f959a8",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "cdc8b0d0-7aca-bbd3-e934-3f340feecd3e",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a3c38766-d632-4c1d-9cf6-b5b88a292902",
          "id": "a3c38766-d632-4c1d-9cf6-b5b88a292902",
          "molfile": "\n  Marvin  01132108302D          \n\n 74 77  0  0  1  0            999 V2000\n   16.3441   -4.8524    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   17.0609   -4.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7755   -4.8504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4955   -4.4404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2157   -4.8448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   19.9303   -4.4348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6504   -4.8392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   19.9303   -3.6151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3441   -5.6723    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6421   -6.0912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9147   -5.6904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6421   -6.9111    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   16.3670   -7.3264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3670   -8.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9281   -8.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9281   -7.3264    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2136   -6.9165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2136   -6.0966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4977   -7.3336    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   13.4977   -8.1495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7756   -8.5499    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0586   -8.1407    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3420   -8.5494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6290   -8.1403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9106   -8.5486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9106   -9.3685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1963   -8.1423    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6021   -8.7200    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.0118   -9.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0118  -10.2456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2889  -10.6538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2889  -11.4727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0036  -11.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0036  -12.7028    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7267  -11.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7267  -10.6550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7711   -8.7200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1783   -9.2986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1823   -8.1423    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1823   -7.3224    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.4582   -6.9111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7380   -7.3210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0193   -6.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2943   -7.3053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2943   -8.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0136   -8.5412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7380   -8.1343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7711   -6.7447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4566   -5.9862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6021   -6.7447    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2820   -6.4167    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.5022   -5.7014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6407   -5.4763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6407   -4.6564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9209   -4.2513    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3608   -4.2418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0799   -6.4718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6636   -5.8882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6330   -7.3179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3501   -6.9099    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   11.3501   -5.7244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0766   -5.3166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0766   -4.4967    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7981   -5.7288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0636   -7.3248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0636   -6.5011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7803   -6.9183    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6206   -4.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9029   -4.8553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6206   -3.6261    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9059   -3.2162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9059   -2.4019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1859   -1.9920    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6235   -1.9926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  9  1  1  0  0  0\n  1 68  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  3  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  6  0  0  0\n 12 13  1  0  0  0  0\n 12 16  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 17  1  6  0  0  0\n 19 20  1  0  0  0  0\n 19 67  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  2  0  0  0  0\n 27 25  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  1  0  0  0\n 28 37  1  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  1  0  0  0  0\n 36 30  2  0  0  0  0\n 31 32  2  0  0  0  0\n 32 33  1  0  0  0  0\n 33 34  1  0  0  0  0\n 33 35  2  0  0  0  0\n 35 36  1  0  0  0  0\n 37 38  2  0  0  0  0\n 37 39  1  0  0  0  0\n 39 40  1  0  0  0  0\n 40 41  1  1  0  0  0\n 40 48  1  0  0  0  0\n 41 42  1  0  0  0  0\n 42 43  1  0  0  0  0\n 47 42  2  0  0  0  0\n 43 44  2  0  0  0  0\n 44 45  1  0  0  0  0\n 45 46  2  0  0  0  0\n 46 47  1  0  0  0  0\n 48 49  2  0  0  0  0\n 48 50  1  0  0  0  0\n 50 51  1  0  0  0  0\n 51 52  1  1  0  0  0\n 51 57  1  0  0  0  0\n 52 53  1  0  0  0  0\n 53 54  1  0  0  0  0\n 54 55  1  0  0  0  0\n 54 56  2  0  0  0  0\n 57 58  2  0  0  0  0\n 59 57  1  0  0  0  0\n 59 60  1  0  0  0  0\n 60 61  1  1  0  0  0\n 65 60  1  0  0  0  0\n 61 62  1  0  0  0  0\n 62 63  1  0  0  0  0\n 62 64  2  0  0  0  0\n 65 66  2  0  0  0  0\n 65 67  1  0  0  0  0\n 68 69  2  0  0  0  0\n 68 70  1  0  0  0  0\n 70 71  1  0  0  0  0\n 71 72  1  0  0  0  0\n 72 73  1  0  0  0  0\n 72 74  2  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)C[C@H]2C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CSSCCC(=O)N[C@@H](Cc3ccc(cc3)O)C(=O)N2)C(=O)N4CCC[C@H]4C(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N",
          "formula": "C46H64N14O12S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "badfdefe-aef1-4e12-ab53-28ca02cb457b"
          },
          "defined_stereo": 7,
          "ez_centers": 0,
          "molecular_weight": "1069.2209",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 7
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "be9dbcb4-fb58-4325-b637-35de4fc63542",
      "version": "21",
      "structure": {
        "id": "bc54295a-b5d3-415c-9d07-c84894e348ce",
        "molfile": "\n  Marvin  01132109442D          \n\n 74 77  0  0  1  0            999 V2000\n   14.9281   -7.3264    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9281   -8.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3670   -8.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3670   -7.3264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6421   -6.9111    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.7711   -6.7447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6021   -6.7447    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6021   -8.7200    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.7711   -8.7200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1823   -8.1423    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1823   -7.3224    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.2820   -6.4167    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.1963   -8.1423    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9106   -8.5486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0799   -6.4718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6330   -7.3179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6290   -8.1403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3420   -8.5494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3501   -6.9099    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.0636   -7.3248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0586   -8.1407    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7756   -8.5499    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4977   -8.1495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4977   -7.3336    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.7803   -6.9183    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1783   -9.2986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0118   -9.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0118  -10.2456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2889  -10.6538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2889  -11.4727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0036  -11.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7267  -11.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7267  -10.6550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0036  -12.7028    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9106   -9.3685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4582   -6.9111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7380   -7.3210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0193   -6.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2943   -7.3053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2943   -8.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0136   -8.5412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7380   -8.1343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4566   -5.9862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6636   -5.8882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3501   -5.7244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0766   -5.3166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0766   -4.4967    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7981   -5.7288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5022   -5.7014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6407   -5.4763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6407   -4.6564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3608   -4.2418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9209   -4.2513    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0636   -6.5011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2136   -6.9165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2136   -6.0966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6421   -6.0912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9147   -5.6904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3441   -5.6723    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3441   -4.8524    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   15.6206   -4.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6206   -3.6261    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9059   -3.2162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9059   -2.4019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1859   -1.9920    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0609   -4.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7755   -4.8504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4955   -4.4404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2157   -4.8448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   19.9303   -4.4348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6504   -4.8392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   19.9303   -3.6151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9029   -4.8553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6235   -1.9926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n 37 38  2  0  0  0  0\n 17 18  1  0  0  0  0\n 38 39  1  0  0  0  0\n 18 21  1  0  0  0  0\n 39 40  2  0  0  0  0\n 20 19  1  0  0  0  0\n 40 41  1  0  0  0  0\n  7 12  1  0  0  0  0\n 41 42  2  0  0  0  0\n 42 37  1  0  0  0  0\n 13  8  1  0  0  0  0\n  6 43  2  0  0  0  0\n  8  9  1  0  0  0  0\n 15 44  2  0  0  0  0\n  9 10  1  0  0  0  0\n 19 45  1  1  0  0  0\n 10 11  1  0  0  0  0\n 45 46  1  0  0  0  0\n 11  6  1  0  0  0  0\n 46 47  1  0  0  0  0\n 20 25  1  0  0  0  0\n 46 48  2  0  0  0  0\n 21 22  1  0  0  0  0\n 12 49  1  1  0  0  0\n 22 23  1  0  0  0  0\n 49 50  1  0  0  0  0\n 24 23  1  6  0  0  0\n 50 51  1  0  0  0  0\n 24 25  1  0  0  0  0\n 51 52  2  0  0  0  0\n  2  3  1  0  0  0  0\n 51 53  1  0  0  0  0\n  9 26  2  0  0  0  0\n 20 54  2  0  0  0  0\n  1  2  1  0  0  0  0\n 24 55  1  0  0  0  0\n 55  1  1  0  0  0  0\n  8 27  1  1  0  0  0\n 55 56  2  0  0  0  0\n  5 57  1  6  0  0  0\n 27 28  1  0  0  0  0\n 57 58  2  0  0  0  0\n 57 59  1  0  0  0  0\n 28 29  2  0  0  0  0\n 59 60  1  0  0  0  0\n 12 15  1  0  0  0  0\n 60 61  1  0  0  0  0\n 29 30  1  0  0  0  0\n 61 62  1  0  0  0  0\n 13 14  1  0  0  0  0\n 62 63  1  0  0  0  0\n 30 31  2  0  0  0  0\n 63 64  1  0  0  0  0\n 14 17  1  0  0  0  0\n 64 65  1  0  0  0  0\n 31 32  1  0  0  0  0\n 60 66  1  1  0  0  0\n 16 15  1  0  0  0  0\n 66 67  1  0  0  0  0\n 32 33  2  0  0  0  0\n 67 68  1  0  0  0  0\n 33 28  1  0  0  0  0\n 68 69  1  0  0  0  0\n  3  4  1  0  0  0  0\n 69 70  1  0  0  0  0\n 31 34  1  0  0  0  0\n 70 71  1  0  0  0  0\n  4  5  1  0  0  0  0\n 70 72  2  0  0  0  0\n 14 35  2  0  0  0  0\n 61 73  2  0  0  0  0\n  5  1  1  0  0  0  0\n 64 74  2  0  0  0  0\n 11 36  1  1  0  0  0\n  6  7  1  0  0  0  0\n 36 37  1  0  0  0  0\n 16 19  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)C[C@H]2C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CSSCCC(=O)N[C@@H](Cc3ccc(cc3)O)C(=O)N2)C(=O)N4CCC[C@H]4C(=O)N[C@H](CCCNC(=N)N)C(=O)NCC(=O)N",
        "formula": "C46H64N14O12S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 7,
        "ez_centers": 0,
        "molecular_weight": "1069.2209",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "9d0cc9cc-e199-4394-8f91-c19c10dd1e3f",
          "f7d8e836-701b-48d5-b19a-ce2619d61f61",
          "39c708b6-4c2c-4b82-892b-ef02d2763310"
        ],
        "stereo_centers": 7
      },
      "unii": "ENR1LLB0FP"
    }
  ]
}