{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e2ccf2c5-f329-4e3d-b5d2-eaeaacdc9f90",
          "code": "15183-37-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=15183-37-6",
          "code_system": "CAS",
          "references": [
            "955e9ea5-5c43-46b1-9329-f860da9700ff",
            "48ee2a65-353b-4d7d-8560-0ef61d38318c"
          ]
        },
        {
          "uuid": "03f3cb66-a6be-4a65-93a6-2e6c57474e69",
          "code": "ESTETROL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Estetrol",
          "code_system": "WIKIPEDIA",
          "references": [
            "955e9ea5-5c43-46b1-9329-f860da9700ff"
          ]
        },
        {
          "uuid": "093ed20e-c37c-4a07-aad9-16d85cd2d2e9",
          "code": "10439",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=10439",
          "code_system": "INN",
          "references": [
            "955e9ea5-5c43-46b1-9329-f860da9700ff"
          ]
        },
        {
          "uuid": "bea249b1-4f91-4ee7-b8ed-652a59d95c37",
          "code": "27125",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/27125",
          "code_system": "PUBCHEM",
          "references": [
            "955e9ea5-5c43-46b1-9329-f860da9700ff"
          ]
        },
        {
          "uuid": "16d61c09-964f-e111-ba5a-19536732f020",
          "code": "DTXSID50164888",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50164888",
          "code_system": "EPA CompTox",
          "references": [
            "d346a50a-8a0a-6da0-d66d-38d4b5705f1a"
          ]
        },
        {
          "uuid": "54de229c-9596-4488-a1dc-56c0bf1d4c49",
          "code": "C68928",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68928",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4269647d-501e-8d06-ed96-d911089d9abe"
          ]
        },
        {
          "uuid": "4f84a381-1999-48df-4b1f-2e7a6924d2c7",
          "code": "678119",
          "comments": "ORPHAN DRUG|Designated|Treatment of neonatal hypoxic ischemic encephalopathy",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=678119",
          "code_system": "FDA ORPHAN DRUG",
          "references": [
            "65ceb8d6-bc6d-21a8-64a9-613a5f080dbd"
          ]
        },
        {
          "uuid": "954d50db-cc37-d491-6b21-4e6d77d801ae",
          "code": "EU/3/17/1865",
          "comments": "EU ORPHAN DRUG|Positive|Treatment of neonatal encephalopathy",
          "type": "PRIMARY",
          "url": "https://www.ema.europa.eu/en/medicines/human/orphan-designations/eu3171865",
          "code_system": "EU-Orphan Drug",
          "references": [
            "65ceb8d6-bc6d-21a8-64a9-613a5f080dbd"
          ]
        },
        {
          "uuid": "65bf6d2b-9496-455d-ae2c-9b6b315b9192",
          "code": "ENB39R14VF",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c7e7d612-c9d8-6d32-8caf-c7bc0ada50ca",
          "code": "DB12235",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB12235",
          "code_system": "DRUG BANK",
          "references": [
            "65ceb8d6-bc6d-21a8-64a9-613a5f080dbd"
          ]
        },
        {
          "uuid": "353b46d6-c35f-a290-7724-6150a4a1f50e",
          "code": "2539031",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2539031/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "6f166873-b7ea-6472-5c05-714079ae606f"
          ]
        },
        {
          "uuid": "d368d40b-9c24-9994-dee6-963517b6fcff",
          "code": "142773",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:142773",
          "code_system": "CHEBI",
          "references": [
            "65ceb8d6-bc6d-21a8-64a9-613a5f080dbd"
          ]
        },
        {
          "uuid": "a9556eca-7620-a268-bf02-534c539803aa",
          "code": "Estetrol (medication)",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Estetrol_(medication)",
          "code_system": "WIKIPEDIA",
          "references": [
            "96905a24-f549-a4ac-0c0a-4b607a23f9aa"
          ]
        },
        {
          "uuid": "f0999880-7233-166d-1135-0e1de9659e03",
          "code": "100000172329",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "708aebca-881a-f9f4-a04a-eb7cbdefb13d"
          ]
        },
        {
          "uuid": "49260f94-7fa9-8092-2e71-74eb48fe3946",
          "code": "FG-207",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/FG-207/relevant/1/",
          "code_system": "USAN",
          "references": [
            "c0513eb9-01f0-ef06-5598-672d26d52a29"
          ]
        },
        {
          "uuid": "6f959761-ed17-1885-4047-0cdfb140c638",
          "code": "ENB39R14VF",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=ENB39R14VF",
          "code_system": "DAILYMED",
          "references": [
            "2771ff07-65d0-61f2-4e96-6050d2763967"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "46687341-f838-4387-b595-396feef6c19d",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0f1a7be9-c103-4666-ab8d-e9fe9882a950",
          "citation": "INN Proposed List 120",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL120.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "590f1625-17d1-4f84-a51c-901fea715cf6",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "955e9ea5-5c43-46b1-9329-f860da9700ff",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389736000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e47f62d-17f6-4afe-ac62-c5d85a9990dd",
          "citation": "SRS import [ENB39R14VF]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ENB39R14VF",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389736000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c4eaa816-4ec0-4373-ab6a-d91a91c1ae9b",
          "citation": "ESTETROL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "28ded6fa-18f4-ff07-2b63-00d7a35da26f",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d346a50a-8a0a-6da0-d66d-38d4b5705f1a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=15183-37-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4269647d-501e-8d06-ed96-d911089d9abe",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9e486c8f-5571-4d06-8383-287e463ba193",
          "citation": "Visser, M., J-M. Foidart, and H. J. T. Coelingh Bennink. \"In vitro effects of estetrol on receptor binding, drug targets and human liver cell metabolism.\" Climacteric 11.sup1 (2008): 64-68.",
          "url": "https://www.tandfonline.com/doi/full/10.1080/13697130802050340",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "7d403959-1849-f0dc-acb5-5ca638474bcc",
          "citation": "USAN COUN 2018",
          "doc_type": "USANCOUN",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "48ee2a65-353b-4d7d-8560-0ef61d38318c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c0513eb9-01f0-ef06-5598-672d26d52a29",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "06080414-c733-4446-8d15-04acfb3b695b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "65ceb8d6-bc6d-21a8-64a9-613a5f080dbd",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "2582f25e-9c28-4f19-f1f1-4e1af6cf8aae",
          "citation": "USAN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "96905a24-f549-a4ac-0c0a-4b607a23f9aa",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "6f166873-b7ea-6472-5c05-714079ae606f",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "efb1dd79-ca87-4ffa-bf09-dd5a97880b48",
          "citation": "https://www.ncbi.nlm.nih.gov/pmc/articles/PMC8658652/pdf/jcm-10-05625.pdf",
          "url": "https://www.ncbi.nlm.nih.gov/pmc/articles/PMC8658652/pdf/jcm-10-05625.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7d035e51-ff34-3db2-5237-72cacdfc3893",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2771ff07-65d0-61f2-4e96-6050d2763967",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "46c44b5f-0be6-4c2e-bf3e-80cb5103aacb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "708aebca-881a-f9f4-a04a-eb7cbdefb13d",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "73da9f5e-6706-4871-aaa9-3d2067de57be",
          "id": "73da9f5e-6706-4871-aaa9-3d2067de57be",
          "molfile": "\n  Marvin  01132106002D          \n\n 22 25  0  0  1  0            999 V2000\n    9.8704   -5.5931    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   10.6897   -5.5931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3753   -6.2688    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.7285   -7.1007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5932   -6.0097    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.8665   -6.4170    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.8665   -7.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1631   -7.6619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4456   -7.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7283   -7.6619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0063   -7.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2935   -7.6619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0063   -6.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7283   -6.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4456   -6.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1631   -6.0097    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.1631   -5.1905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8665   -4.7693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5932   -5.1905    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.5932   -4.3713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3753   -4.9405    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.6345   -4.1399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  3  1  1  0  0  0  0\n  1 21  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  3  1  1  0  0  0\n  5  6  1  0  0  0  0\n  5 19  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6 16  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 15  2  0  0  0  0\n 10 11  2  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  1  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  1  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  1  0  0  0\nM  END",
          "smiles": "C[C@@]12CC[C@@H]3c4ccc(cc4CC[C@H]3[C@@H]2C([C@H]([C@@H]1O)O)O)O",
          "formula": "C18H24O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a3bb51aa-ab7f-4ef7-925e-86e56b04e9b1"
          },
          "defined_stereo": 6,
          "ez_centers": 0,
          "molecular_weight": "304.3814",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 7
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b235403b-c8db-4ebb-8b70-4b7716557163",
      "version": "36",
      "structure": {
        "id": "a14068d7-2f4b-46ae-a5ed-58a3b8d573f9",
        "molfile": "\n  Marvin  01132108232D          \n\n 25 28  0  0  1  0            999 V2000\n    8.5932   -5.1905    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.5932   -6.0097    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.8665   -6.4170    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.1631   -6.0097    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4456   -6.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4456   -7.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7283   -7.6619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0063   -7.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0063   -6.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7283   -6.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2935   -7.6619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1631   -7.6619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8665   -7.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1631   -6.8335    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1631   -5.1905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8665   -4.7693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8665   -5.5886    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3753   -6.2688    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.8704   -5.5931    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.3753   -4.9405    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.6345   -4.1399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6897   -5.5931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7285   -7.1007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5932   -6.8382    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5932   -4.3713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10  5  1  0  0  0  0\n 11  8  1  0  0  0  0\n  6 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13  3  1  0  0  0  0\n  4 14  1  6  0  0  0\n 15  4  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16  1  1  0  0  0  0\n  3 17  1  1  0  0  0\n 18  2  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20  1  1  0  0  0  0\n 20 21  1  1  0  0  0\n 19 22  1  6  0  0  0\n 18 23  1  6  0  0  0\n  2 24  1  6  0  0  0\n  1 25  1  1  0  0  0\nM  END",
        "smiles": "C[C@@]12CC[C@]3([H])c4ccc(cc4CC[C@@]3([H])[C@]2([H])[C@H]([C@H]([C@@H]1O)O)O)O",
        "formula": "C18H24O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 7,
        "ez_centers": 0,
        "molecular_weight": "304.3814",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "590f1625-17d1-4f84-a51c-901fea715cf6",
          "4e47f62d-17f6-4afe-ac62-c5d85a9990dd",
          "0f1a7be9-c103-4666-ab8d-e9fe9882a950"
        ],
        "stereo_centers": 7
      },
      "unii": "ENB39R14VF",
      "relationships": [
        {
          "uuid": "b78cd8be-682d-445a-a3e5-1bf3c83f9f6d",
          "amount": {
            "uuid": "2c6df638-f4f7-4c2a-9106-5897cc3ec9b5"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "13d5e081-5409-497c-a543-f9280528e0fc",
            "refuuid": "b235403b-c8db-4ebb-8b70-4b7716557163",
            "name": "ESTETROL ANHYDROUS",
            "unii": "ENB39R14VF",
            "linking_id": "ENB39R14VF",
            "ref_pname": "ESTETROL ANHYDROUS",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "aa0c161a-47c2-40bc-b32e-3cf958e6e7e2",
          "amount": {
            "uuid": "430e3613-38c0-4ccd-9ced-ae3606b563a4"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "06080414-c733-4446-8d15-04acfb3b695b"
          ],
          "related_substance": {
            "uuid": "8859aad1-a362-4563-b420-d6092382dcf3",
            "refuuid": "59af8c4e-9f54-4766-9a2e-a0b614b1ab4e",
            "name": "ESTETROL MONOHYDRATE",
            "unii": "KC3GI9UM9V",
            "linking_id": "KC3GI9UM9V",
            "ref_pname": "ESTETROL MONOHYDRATE"
          }
        },
        {
          "uuid": "5e3a916b-c520-4189-93fd-b0c547873906",
          "amount": {
            "uuid": "6880f234-8d02-433c-bc37-e2309205124d",
            "average": 19,
            "high": 20,
            "low": 18,
            "units": "NANOMOLAR"
          },
          "qualification": "Ki",
          "type": "TARGET->AGONIST",
          "references": [
            "9e486c8f-5571-4d06-8383-287e463ba193"
          ],
          "related_substance": {
            "uuid": "19c9bad3-48ca-489f-ba67-0a2c1cc98bbb",
            "refuuid": "76ca6a0a-c020-48da-84b0-eaa4bbf232c9",
            "name": "ESTROGEN RECEPTOR BETA",
            "unii": "FO7FW4DL8V",
            "linking_id": "FO7FW4DL8V",
            "ref_pname": "ESTROGEN RECEPTOR BETA",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fa4c8583-e82a-4353-b6b7-e5ddafeb1c5a",
          "amount": {
            "uuid": "fc9f35dd-b16d-4efe-89d5-85608266402f",
            "average": 4.9,
            "high": 5.5,
            "low": 4.3,
            "units": "NANOMOLAR"
          },
          "qualification": "Ki",
          "type": "TARGET->AGONIST",
          "references": [
            "efb1dd79-ca87-4ffa-bf09-dd5a97880b48"
          ],
          "related_substance": {
            "uuid": "760071d2-a23a-4a12-9f3b-196e89e4b645",
            "refuuid": "4673cf81-dd46-4a8d-8696-823ccebce65d",
            "name": "ESTROGEN RECEPTOR",
            "unii": "SIDP85PFD6",
            "linking_id": "SIDP85PFD6",
            "ref_pname": "ESTROGEN RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "70231339-10c7-373d-274f-96842359d830",
          "amount": {
            "uuid": "6e7048af-5fbd-4b3a-b8d3-f31057acfc09"
          },
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "46c44b5f-0be6-4c2e-bf3e-80cb5103aacb"
          ],
          "related_substance": {
            "uuid": "1f5f1d06-6732-475a-9bd3-49b26d66e4d5",
            "refuuid": "59af8c4e-9f54-4766-9a2e-a0b614b1ab4e",
            "name": "ESTETROL MONOHYDRATE",
            "unii": "KC3GI9UM9V",
            "linking_id": "KC3GI9UM9V",
            "ref_pname": "ESTETROL MONOHYDRATE"
          }
        }
      ],
      "names": [
        {
          "uuid": "d791b86d-bb0f-475b-a264-34ddb1392453",
          "name": "15.ALPHA.-HYDROXYESTRIOL",
          "stdName": "15.ALPHA.-HYDROXYESTRIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f1a7be9-c103-4666-ab8d-e9fe9882a950",
            "590f1625-17d1-4f84-a51c-901fea715cf6"
          ],
          "display_name": false
        },
        {
          "uuid": "c130d9d2-06c2-1030-71cb-4eeca78b41a8",
          "name": "E-4",
          "stdName": "E-4",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d403959-1849-f0dc-acb5-5ca638474bcc"
          ],
          "display_name": false
        },
        {
          "uuid": "189a5ce0-7512-47d8-ac49-b528a5659e91",
          "name": "E4",
          "stdName": "E4",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f1a7be9-c103-4666-ab8d-e9fe9882a950",
            "590f1625-17d1-4f84-a51c-901fea715cf6"
          ],
          "display_name": false
        },
        {
          "uuid": "ef58521f-23b8-47fc-91d2-d03d521245b7",
          "name": "ESTETROL",
          "stdName": "ESTETROL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "0f1a7be9-c103-4666-ab8d-e9fe9882a950",
            "46687341-f838-4387-b595-396feef6c19d",
            "c4eaa816-4ec0-4373-ab6a-d91a91c1ae9b"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "bf573948-5eac-4b4b-a41b-fc7b88d99ab5",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "5cb5eea1-17fe-2077-8a66-be6c76790e3a",
          "name": "ESTETROL (ANHYDROUS) [USAN]",
          "stdName": "ESTETROL (ANHYDROUS) [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d403959-1849-f0dc-acb5-5ca638474bcc"
          ],
          "display_name": false
        },
        {
          "uuid": "c11eb5bd-a4a8-4c38-998e-1d24c80c2dc9",
          "name": "ESTETROL (E4)",
          "stdName": "ESTETROL (E4)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96905a24-f549-a4ac-0c0a-4b607a23f9aa"
          ],
          "display_name": false
        },
        {
          "uuid": "0c17ec3d-2ccc-44bc-a591-d348528065f8",
          "name": "ESTETROL ANHYDROUS",
          "stdName": "ESTETROL ANHYDROUS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d403959-1849-f0dc-acb5-5ca638474bcc"
          ],
          "display_name": true
        },
        {
          "uuid": "4bbabd6a-e99f-fe67-ff3c-14327e2f1915",
          "name": "ESTRA-1,3,5(10)-TRIENE-3,15,16,17-TETROL, (15.ALPHA.,16.ALPHA.,17.BETA.)-",
          "stdName": "ESTRA-1,3,5(10)-TRIENE-3,15,16,17-TETROL, (15.ALPHA.,16.ALPHA.,17.BETA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d403959-1849-f0dc-acb5-5ca638474bcc"
          ],
          "display_name": false
        },
        {
          "uuid": "743d3369-fe59-4208-bed8-2b2fa71fa9ce",
          "name": "ESTRA-1,3,5(10)-TRIENE-3,15.ALPHA.,16.ALPHA.,17.BETA.-TETROL",
          "stdName": "ESTRA-1,3,5(10)-TRIENE-3,15.ALPHA.,16.ALPHA.,17.BETA.-TETROL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f1a7be9-c103-4666-ab8d-e9fe9882a950",
            "46687341-f838-4387-b595-396feef6c19d"
          ],
          "display_name": false
        },
        {
          "uuid": "2bd28c0f-11e9-335b-9a92-1aa22a322372",
          "name": "Estetrol [WHO-DD]",
          "stdName": "ESTETROL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d035e51-ff34-3db2-5237-72cacdfc3893"
          ],
          "display_name": false
        },
        {
          "uuid": "81ee62fc-4afa-48e8-b82b-f6b75fdd4e75",
          "name": "estetrol [INN]",
          "stdName": "ESTETROL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f1a7be9-c103-4666-ab8d-e9fe9882a950",
            "46687341-f838-4387-b595-396feef6c19d"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "379cd14d-a85d-462f-abcd-a52d150b0479",
          "name": "Biological Half-life",
          "value": {
            "uuid": "b12f4a27-cacb-4bad-80a4-8b5dd7212478",
            "average": 28,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC"
        }
      ],
      "modifications": {
        "uuid": "92505898-0950-4e0c-950b-1d018ee576a5"
      }
    }
  ]
}