{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d2bf060f-7668-45ba-8eda-5128e3e0ce4b",
          "code": "55837-15-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=55837-15-5",
          "code_system": "CAS",
          "references": [
            "a814a460-9163-4216-a2ff-3812c677c043",
            "756a0c81-44a5-4852-a782-aa1ca9b1e64f"
          ]
        },
        {
          "uuid": "69b92b82-034d-46df-87bd-2debd9c281b2",
          "code": "C78104",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C78104",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a814a460-9163-4216-a2ff-3812c677c043"
          ]
        },
        {
          "uuid": "c59be97b-67c4-465d-af9d-0189afa3770f",
          "code": "SUB06032MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a814a460-9163-4216-a2ff-3812c677c043"
          ]
        },
        {
          "uuid": "fbefec3e-3390-4a03-b3b4-e0c6653e2c12",
          "code": "1442",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1442",
          "code_system": "INN",
          "references": [
            "a814a460-9163-4216-a2ff-3812c677c043"
          ]
        },
        {
          "uuid": "3c60e90c-1a83-41d6-92f2-dd1fb69f6c57",
          "code": "259-848-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.054.390",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a814a460-9163-4216-a2ff-3812c677c043"
          ]
        },
        {
          "uuid": "9e294e79-3056-4866-b784-c92d95745477",
          "code": "CHEMBL2104630",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2104630",
          "code_system": "ChEMBL",
          "references": [
            "a814a460-9163-4216-a2ff-3812c677c043"
          ]
        },
        {
          "uuid": "05af1400-8bc7-446a-9da0-ecccb4e8d463",
          "code": "71735",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71735",
          "code_system": "PUBCHEM",
          "references": [
            "a814a460-9163-4216-a2ff-3812c677c043"
          ]
        },
        {
          "uuid": "f00c5f9a-75e7-cb8e-061b-abf7d3ae7a7c",
          "code": "C66917",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Respiratory System[C78273]|Antitussive Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66917",
          "code_system": "NCI_THESAURUS",
          "references": [
            "770048e5-959f-2ad0-b67d-9d32880f9bfa"
          ]
        },
        {
          "uuid": "6eabd65f-18ec-479b-8d25-b148e0c86031",
          "code": "EHX04MU69R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ef493c6c-4c11-8713-d636-92a86b7ca558",
          "code": "100000081585",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "65a8bf27-033d-139b-592e-542077535dfb"
          ]
        },
        {
          "uuid": "c933dc86-e2c5-4d5d-fc4c-98c693897a16",
          "code": "DTXSID40866506",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40866506",
          "code_system": "EPA CompTox",
          "references": [
            "770048e5-959f-2ad0-b67d-9d32880f9bfa"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "3d6d4ee6-4e51-45a3-930d-e7b7f5f38016",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "70315e1e-e60e-4c02-8786-4cd97253faf4",
            "refuuid": "8f7260b8-b714-4384-b52b-c2e7170b1529",
            "name": "BUTOPIPRINE",
            "unii": "EHX04MU69R",
            "linking_id": "EHX04MU69R",
            "ref_pname": "BUTOPIPRINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "531d54e6-0d49-4290-9e6e-52badf87b86f",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "992f4d5e-5246-42a0-bfff-507596cdb241",
            "refuuid": "b9665dbc-da56-48bd-8a13-caaafea97da9",
            "name": "BUTOPIPRINE HYDROBROMIDE",
            "unii": "3A54RW6OZ2",
            "linking_id": "3A54RW6OZ2",
            "ref_pname": "BUTOPIPRINE HYDROBROMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ed93428c-994b-4361-8283-c27e4edafb6e",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "24f6507b-590a-40c9-8090-56acedf76c06",
            "refuuid": "73ab5554-290f-4772-addd-dac845a1e06a",
            "name": "BUTOPIPRINE, (R)-",
            "unii": "ZE0IPS1EWN",
            "linking_id": "ZE0IPS1EWN",
            "ref_pname": "BUTOPIPRINE, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ac5b87a9-4a64-4319-8515-8fe2d95a7003",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "f288e2f7-ca1d-4cba-9f0e-9cdb5e99282f",
            "refuuid": "e8c2fb2b-2ca8-4a7d-865e-1693de0b9870",
            "name": "BUTOPIPRINE, (S)-",
            "unii": "W6N8HGX854",
            "linking_id": "W6N8HGX854",
            "ref_pname": "BUTOPIPRINE, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a4ecac51-38f3-4b6c-a17a-a541193d2962",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "15a9e52d-01b2-4143-89c3-ff00788e6217",
            "refuuid": "3d90f1bb-a4f6-431d-88b0-9da6f5fa236f",
            "name": "BUTOPIPRINE HYDROCHLORIDE",
            "unii": "2H1P4K9C0I",
            "linking_id": "2H1P4K9C0I",
            "ref_pname": "BUTOPIPRINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6de1f63a-d2e3-451f-b1e0-538be7a369a7",
          "name": "BUTOPIPRINE",
          "stdName": "BUTOPIPRINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5036cc1f-7e23-463b-ba12-e4a8076a96f6",
            "9f4f92e9-4d39-4713-a117-eb27b06b14dd",
            "ca123907-0097-4d28-aed8-6a94dabebbb6",
            "c3096854-9830-4287-bea4-3adab82e7775",
            "69037ab1-97d0-4a8b-8c28-be230aead8f4",
            "50fb8a2a-4ba3-4299-b80a-27c2875ee9a1"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "56054028-96ca-47b8-8274-462284caae67",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "2f6de576-7485-2a7e-db5f-50e5040c3c65",
          "name": "Butopiprine [WHO-DD]",
          "stdName": "BUTOPIPRINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9358aef-4805-184f-8261-1151473c09f9"
          ],
          "display_name": false
        },
        {
          "uuid": "7f1c6b8d-e8e0-436d-90d3-4c8a0a8e0072",
          "name": "LD 2351 FREE BASE",
          "stdName": "LD 2351 FREE BASE",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89ad60b4-ca70-4aa2-a349-252365f3291d",
            "ca123907-0097-4d28-aed8-6a94dabebbb6"
          ],
          "display_name": false
        },
        {
          "uuid": "0a77eb8a-092e-4abd-b725-2d9227907296",
          "name": "LD-2351 FREE BASE",
          "stdName": "LD-2351 FREE BASE",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89ad60b4-ca70-4aa2-a349-252365f3291d",
            "ca123907-0097-4d28-aed8-6a94dabebbb6"
          ],
          "display_name": false
        },
        {
          "uuid": "4b2f3c97-e1a0-4402-a1ab-a73b85730df3",
          "name": "butopiprine [INN]",
          "stdName": "BUTOPIPRINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5036cc1f-7e23-463b-ba12-e4a8076a96f6"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9f4f92e9-4d39-4713-a117-eb27b06b14dd",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5036cc1f-7e23-463b-ba12-e4a8076a96f6",
          "citation": "INN Proposed List 31",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL31.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c3096854-9830-4287-bea4-3adab82e7775",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca123907-0097-4d28-aed8-6a94dabebbb6",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89ad60b4-ca70-4aa2-a349-252365f3291d",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a814a460-9163-4216-a2ff-3812c677c043",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390746000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81deddf4-8e46-45c2-8c21-559ce1bd3495",
          "citation": "SRS import [EHX04MU69R]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=EHX04MU69R",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390746000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d2b36b85-7b3a-4d58-909d-ff8a069ef34f",
          "citation": "USP DICTIONARY 2008; INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "50fb8a2a-4ba3-4299-b80a-27c2875ee9a1",
          "citation": "BUTOPIPRINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "69037ab1-97d0-4a8b-8c28-be230aead8f4",
          "citation": "BUTOPIPRINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "770048e5-959f-2ad0-b67d-9d32880f9bfa",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "756a0c81-44a5-4852-a782-aa1ca9b1e64f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c9358aef-4805-184f-8261-1151473c09f9",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "65a8bf27-033d-139b-592e-542077535dfb",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b3f6e4a7-d258-4847-bc16-1015a77029ad",
          "id": "b3f6e4a7-d258-4847-bc16-1015a77029ad",
          "molfile": "\n  Marvin  01132109192D          \n\n 23 24  0  0  0  0            999 V2000\n    7.7619   -3.3527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0479   -3.7661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3339   -3.3569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6199   -3.7703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9059   -3.3612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1920   -3.7745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4780   -3.3653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7640   -3.7786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0500   -3.3695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0482   -2.5428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3361   -3.7828    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.6197   -3.3704    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6225   -2.5436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0898   -2.1312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8077   -2.5419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8087   -3.3696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0918   -3.7865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3371   -4.6095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6188   -5.0210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6195   -5.8470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3365   -6.2602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0542   -5.8416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0500   -5.0171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 18  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 17  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 23 18  2  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "CCCCOCCOC(=O)C(c1ccccc1)N2CCCCC2",
          "formula": "C19H29NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "30178b71-a464-479c-8622-94f2b2905d14"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "319.4392",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8f7260b8-b714-4384-b52b-c2e7170b1529",
      "version": "8",
      "structure": {
        "id": "833eb786-0d13-4fce-a2f8-409a0df889c4",
        "molfile": "\n  Marvin  01132106482D          \n\n 23 24  0  0  0  0            999 V2000\n    1.3361   -3.7828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0500   -3.3695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7640   -3.7786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4780   -3.3653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1920   -3.7745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9059   -3.3612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6199   -3.7703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3339   -3.3569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0479   -3.7661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7619   -3.3527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6197   -3.3704    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3371   -4.6095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6225   -2.5436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0898   -2.1312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8077   -2.5419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8087   -3.3696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0918   -3.7865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6188   -5.0210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6195   -5.8470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3365   -6.2602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0542   -5.8416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0500   -5.0171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0482   -2.5428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n  1  2  1  0  0  0  0\n  6  7  1  0  0  0  0\n  3  4  1  0  0  0  0\n  7  8  1  0  0  0  0\n 11 17  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n  8  9  1  0  0  0  0\n 12 18  2  0  0  0  0\n  4  5  1  0  0  0  0\n 18 19  1  0  0  0  0\n  9 10  1  0  0  0  0\n 19 20  2  0  0  0  0\n  2  3  1  0  0  0  0\n 20 21  1  0  0  0  0\n  1 11  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 12  1  0  0  0  0\n  5  6  1  0  0  0  0\n  2 23  2  0  0  0  0\nM  END",
        "smiles": "CCCCOCCOC(=O)C(c1ccccc1)N2CCCCC2",
        "formula": "C19H29NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "319.4392",
        "optical_activity": "( + / - )",
        "references": [
          "81deddf4-8e46-45c2-8c21-559ce1bd3495",
          "d2b36b85-7b3a-4d58-909d-ff8a069ef34f",
          "5036cc1f-7e23-463b-ba12-e4a8076a96f6"
        ],
        "stereo_centers": 1
      },
      "unii": "EHX04MU69R"
    }
  ]
}