{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f008e898-92bf-4354-9ec5-722a2151792b",
          "code": "606-27-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=606-27-9",
          "code_system": "CAS",
          "references": [
            "8e7f2ff3-f617-42f9-812a-a0376eb62a04",
            "36765274-a101-4146-af9a-d60673e5c46e"
          ]
        },
        {
          "uuid": "6065bb3a-2487-4543-84cf-defc4859dec5",
          "code": "210-111-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.009.193",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8e7f2ff3-f617-42f9-812a-a0376eb62a04"
          ]
        },
        {
          "uuid": "70793636-dfd9-4ed7-88a9-fde94c440a03",
          "code": "69072",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/69072",
          "code_system": "PUBCHEM",
          "references": [
            "8e7f2ff3-f617-42f9-812a-a0376eb62a04"
          ]
        },
        {
          "uuid": "fb13e4ca-4a81-e774-ea88-8179764ae37f",
          "code": "DTXSID7060548",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7060548",
          "code_system": "EPA CompTox",
          "references": [
            "2f42324e-3022-b97f-8314-bc884287145c"
          ]
        },
        {
          "uuid": "208ebc7e-607a-446b-b18c-988e1f54c851",
          "code": "EG4HK2H9C3",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "67930f5f-1846-4e29-b96f-d36d2d25a758"
          ]
        },
        {
          "uuid": "95560f3a-d0cd-d4c2-20c5-72243c657a92",
          "code": "4136",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=4136",
          "code_system": "NSC",
          "references": [
            "1942df0e-cc53-8a34-09e0-e61a50089a48"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5d330b87-2051-492c-97b3-ac468b87ec45",
          "name": "2-NITROBENZOIC ACID METHYL ESTER",
          "stdName": "2-NITROBENZOIC ACID METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36765274-a101-4146-af9a-d60673e5c46e"
          ],
          "display_name": false
        },
        {
          "uuid": "f98123eb-a505-40fe-bcc9-0442a089a858",
          "name": "BENZOIC ACID, 2-NITRO-, METHYL ESTER",
          "stdName": "BENZOIC ACID, 2-NITRO-, METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67930f5f-1846-4e29-b96f-d36d2d25a758",
            "a02aa9dd-edb3-4d83-b14a-7534f0b481c9"
          ],
          "display_name": false
        },
        {
          "uuid": "23703366-48a2-48df-8af3-616fafa93c91",
          "name": "BENZOIC ACID, O-NITRO-, METHYL ESTER",
          "stdName": "BENZOIC ACID, O-NITRO-, METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67930f5f-1846-4e29-b96f-d36d2d25a758"
          ],
          "display_name": false
        },
        {
          "uuid": "14a79cdd-ea33-4e4e-a921-4f88190ca70a",
          "name": "METHYL 2-NITROBENZOATE",
          "stdName": "METHYL 2-NITROBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67930f5f-1846-4e29-b96f-d36d2d25a758"
          ],
          "display_name": true
        },
        {
          "uuid": "a64a0e52-f7a1-4faf-a432-ea2b4e718e8b",
          "name": "METHYL O-NITROBENZOATE",
          "stdName": "METHYL O-NITROBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67930f5f-1846-4e29-b96f-d36d2d25a758"
          ],
          "display_name": false
        },
        {
          "uuid": "e8f11515-e281-41b0-807b-e6b15b928d93",
          "name": "NSC-4136",
          "stdName": "NSC-4136",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67930f5f-1846-4e29-b96f-d36d2d25a758",
            "a02aa9dd-edb3-4d83-b14a-7534f0b481c9"
          ],
          "display_name": false
        },
        {
          "uuid": "7c0e52d6-a6b4-4a68-af48-e7cfa27263ff",
          "name": "O-NITROBENZOIC ACID METHYL ESTER",
          "stdName": "O-NITROBENZOIC ACID METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36765274-a101-4146-af9a-d60673e5c46e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a02aa9dd-edb3-4d83-b14a-7534f0b481c9",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67930f5f-1846-4e29-b96f-d36d2d25a758",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e7f2ff3-f617-42f9-812a-a0376eb62a04",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393762000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f42324e-3022-b97f-8314-bc884287145c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=606-27-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "36765274-a101-4146-af9a-d60673e5c46e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1942df0e-cc53-8a34-09e0-e61a50089a48",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ff39e3fe-19b0-46fb-a591-858144a1fa0a",
          "id": "ff39e3fe-19b0-46fb-a591-858144a1fa0a",
          "molfile": "\n  Marvin  01132113132D          \n\n 13 13  0  0  0  0            999 V2000\n   -0.5047    2.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2192    1.6499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9337    2.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9337    2.8873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6481    1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6480    0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3625    0.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0770    0.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0770    1.6497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3626    2.0622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3627    2.8872    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -4.0772    3.2997    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -2.6482    3.2998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  3  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\nM  CHG  2  11   1  12  -1\nM  END",
          "smiles": "COC(=O)c1ccccc1[N+](=O)[O-]",
          "formula": "C8H7NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a02243c7-b640-4f65-a908-9e107edb1fa1"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "181.1458",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1709bbab-1ca6-4486-ad49-fd265df608da",
      "version": "7",
      "structure": {
        "id": "a1c6836d-5eeb-4798-800b-0b11a9414b40",
        "molfile": "\n  Marvin  01132108242D          \n\n 13 13  0  0  0  0            999 V2000\n   -1.9337    2.8873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9337    2.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2192    1.6499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5047    2.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6481    1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3626    2.0622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3627    2.8872    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -4.0772    3.2997    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -2.6482    3.2998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0770    1.6497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0770    0.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3625    0.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6480    0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  6 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13  5  2  0  0  0  0\nM  CHG  2   7   1   8  -1\nM  END",
        "smiles": "COC(=O)c1ccccc1[N+](=O)[O-]",
        "formula": "C8H7NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "181.1458",
        "optical_activity": "NONE",
        "references": [
          "a02aa9dd-edb3-4d83-b14a-7534f0b481c9"
        ],
        "stereo_centers": 0
      },
      "unii": "EG4HK2H9C3"
    }
  ]
}