{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "bb5918dc-5dc1-a4e7-070e-e135f56ceeae", "code": "224451", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/224451", "code_system": "PUBCHEM", "references": [ "a0406dbd-c8a4-9e6f-ebd8-1455b4f699a7" ] }, { "uuid": "bd978a7c-29a1-4c19-83af-ae4a989bdb48", "code": "2427-64-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2427-64-7", "code_system": "CAS", "references": [ "bd925147-3fd7-4e53-8150-802d0e30376e" ] }, { "uuid": "c70d5fcf-b992-4fc2-8a1e-bda91818d6a6", "code": "EEN45FVD9K", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "0ae1939a-716b-9d67-377f-e750c92eda34", "code": "DTXSID90279501", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90279501", "code_system": "EPA CompTox" }, { "uuid": "d2c264df-8778-d16e-f490-82fd8029c51e", "code": "12882", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=12882", "code_system": "NSC", "references": [ "a9cb61c8-363a-e2a4-1345-a2ca76805d51" ] } ], "relationships": [ { "uuid": "efcb571a-811b-436c-8b66-276a22bf3428", "amount": { "uuid": "d8cc582d-d712-4233-923b-3161a7917609", "units": "PERCENT PEAK AREA", "high_limit": 0.1 }, "qualification": "EP", "type": "PARENT->IMPURITY", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "4da93ddd-8661-1e81-5ecf-48f6b3b35af7" ], "related_substance": { "uuid": "2489ef95-7138-4562-9ccf-57cff4b2f0a9", "refuuid": "9646220b-4066-4271-9435-e166e3075d55", "name": "Prednisolone", "unii": "9PHQ9Y1OLM", "linking_id": "9PHQ9Y1OLM", "ref_pname": "Prednisolone", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "60d5e0ac-71c2-d385-db88-85d88c485879", "name": "(11.BETA.)-11,17,21-TRIHYDROXYPREGNA-1,4,6-TRIENE-3,20-DIONE", "stdName": "(11.BETA.)-11,17,21-TRIHYDROXYPREGNA-1,4,6-TRIENE-3,20-DIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a8b7a6f8-8d10-4e79-03c9-ee0fdef2fc9b" ], "display_name": false }, { "uuid": "832f2c98-060f-3474-13e5-61afe94c11d6", "name": ".DELTA.6-PREDNISOLONE", "stdName": ".DELTA.6-PREDNISOLONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4da93ddd-8661-1e81-5ecf-48f6b3b35af7" ], "display_name": true }, { "uuid": "bf9b829f-a963-d10a-9d79-98b34660d052", "name": "11.BETA.,17,21-TRIHYDROXYPREGNA-1,4,6-TRIENE-3,20-DIONE", "stdName": "11.BETA.,17,21-TRIHYDROXYPREGNA-1,4,6-TRIENE-3,20-DIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4da93ddd-8661-1e81-5ecf-48f6b3b35af7" ], "display_name": false }, { "uuid": "cc0d3ca4-5cba-fba6-4ac5-f6b0b0df4bcc", "name": "6,7-DEHYDROPREDNISOLONE", "stdName": "6,7-DEHYDROPREDNISOLONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a8b7a6f8-8d10-4e79-03c9-ee0fdef2fc9b" ], "display_name": false }, { "uuid": "c2740d72-0ad8-02db-e1ff-de23d8f5d5a7", "name": "NSC-12882", "stdName": "NSC-12882", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "a8b7a6f8-8d10-4e79-03c9-ee0fdef2fc9b" ], "display_name": false }, { "uuid": "47e46b30-9528-32da-5e65-8f7748522b8a", "name": "PREDNISOLONE IMPURITY H [EP IMPURITY]", "stdName": "PREDNISOLONE IMPURITY H [EP IMPURITY]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4da93ddd-8661-1e81-5ecf-48f6b3b35af7" ], "display_name": false }, { "uuid": "0edcbbff-a562-1c9d-d424-916ec19a1fa0", "name": "PREGNA-1,4,6-TRIENE-3,20-DIONE, 11,17,21-TRIHYDROXY-, (11.BETA.)-", "stdName": "PREGNA-1,4,6-TRIENE-3,20-DIONE, 11,17,21-TRIHYDROXY-, (11.BETA.)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a8b7a6f8-8d10-4e79-03c9-ee0fdef2fc9b" ], "display_name": false } ], "references": [ { "uuid": "4da93ddd-8661-1e81-5ecf-48f6b3b35af7", "citation": "European Pharmacopoeia Online 9.8, Prednisolone Monograph", "doc_type": "EP", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a8b7a6f8-8d10-4e79-03c9-ee0fdef2fc9b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "bd925147-3fd7-4e53-8150-802d0e30376e", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "a0406dbd-c8a4-9e6f-ebd8-1455b4f699a7", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "a9cb61c8-363a-e2a4-1345-a2ca76805d51", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "97d922cc-1e9a-7bec-c24a-1095e0265cb7", "id": "97d922cc-1e9a-7bec-c24a-1095e0265cb7", "molfile": "\n Marvin 01132107532D \n\n 29 32 0 0 1 0 999 V2000\n 16.3540 -3.8351 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.2127 -5.0609 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 17.1376 -3.5842 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 15.6325 -5.0609 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.3540 -4.6548 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.9265 -4.6548 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.2127 -5.8884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6325 -3.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9265 -3.8351 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.4990 -4.6548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4990 -6.3022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3936 -2.7877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6263 -4.2385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1376 -4.9109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6325 -5.8884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7774 -5.0609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7774 -5.8884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9265 -6.3022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8660 -2.2264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0636 -6.3022 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9289 -3.3696 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3617 -3.0205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2127 -3.4161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2127 -4.2385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2082 -2.6248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4642 -1.8385 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6325 -4.2307 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3540 -5.4798 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9265 -5.4772 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 3 1 1 0 0 0 0\n 5 1 1 0 0 0 0\n 8 1 1 0 0 0 0\n 1 22 1 1 0 0 0\n 2 6 1 0 0 0 0\n 7 2 1 0 0 0 0\n 10 2 1 0 0 0 0\n 2 24 1 1 0 0 0\n 3 12 1 1 0 0 0\n 13 3 1 0 0 0 0\n 3 21 1 6 0 0 0\n 4 5 1 0 0 0 0\n 15 4 1 0 0 0 0\n 4 27 1 1 0 0 0\n 4 6 1 0 0 0 0\n 14 5 1 0 0 0 0\n 5 28 1 6 0 0 0\n 6 9 1 0 0 0 0\n 6 29 1 6 0 0 0\n 11 7 2 0 0 0 0\n 18 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 23 1 1 0 0 0\n 16 10 2 0 0 0 0\n 17 11 1 0 0 0 0\n 19 12 2 0 0 0 0\n 25 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 18 15 2 0 0 0 0\n 17 16 1 0 0 0 0\n 20 17 2 0 0 0 0\n 26 25 1 0 0 0 0\nM END", "smiles": "C[C@@]12C=CC(=O)C=C2C=C[C@@]3([H])[C@]4([H])CC[C@](C(=O)CO)([C@@]4(C)C[C@@H]([C@@]31[H])O)O", "formula": "C21H26O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "878ec829-dcd7-42b0-80eb-c3a3b9264b06" }, "defined_stereo": 7, "ez_centers": 0, "molecular_weight": "358.4289", "optical_activity": "UNSPECIFIED", "stereo_centers": 7 } ], "definition_level": "COMPLETE", "uuid": "bde9adbe-4310-4400-8b69-ca8958506a39", "version": "13", "structure": { "id": "85129b7a-6b06-0b7e-b50e-41eee04dd885", "molfile": "\n Marvin 01132106542D \n\n 29 32 0 0 1 0 999 V2000\n 16.3544 -3.8352 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.2130 -5.0611 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 17.1381 -3.5843 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 15.6329 -5.0611 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.3544 -4.6549 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.9269 -4.6549 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.2130 -5.8886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6329 -3.4162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9269 -3.8352 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.4993 -4.6549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4993 -6.3024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3940 -2.7878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6268 -4.2386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1381 -4.9111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6329 -5.8886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7777 -5.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7777 -5.8886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9269 -6.3024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8665 -2.2265 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0639 -6.3024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9293 -3.3697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3621 -3.0206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2130 -3.4162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2130 -4.2386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2087 -2.6249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4647 -1.8385 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6329 -4.2308 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3544 -5.4800 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9269 -5.4774 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2 6 1 0 0 0 0\n 3 1 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 1 1 0 0 0 0\n 6 9 1 0 0 0 0\n 7 2 1 0 0 0 0\n 8 1 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 2 1 0 0 0 0\n 11 7 2 0 0 0 0\n 3 12 1 0 0 0 0\n 13 3 1 0 0 0 0\n 14 5 1 0 0 0 0\n 15 4 1 0 0 0 0\n 16 10 2 0 0 0 0\n 17 16 1 0 0 0 0\n 18 15 2 0 0 0 0\n 19 12 2 0 0 0 0\n 20 17 2 0 0 0 0\n 3 21 1 6 0 0 0\n 1 22 1 1 0 0 0\n 9 23 1 1 0 0 0\n 2 24 1 1 0 0 0\n 25 12 1 0 0 0 0\n 26 25 1 0 0 0 0\n 4 27 1 1 0 0 0\n 5 28 1 6 0 0 0\n 6 29 1 6 0 0 0\n 13 14 1 0 0 0 0\n 4 6 1 0 0 0 0\n 18 7 1 0 0 0 0\n 17 11 1 0 0 0 0\nM END", "smiles": "C[C@@]12C=CC(=O)C=C2C=C[C@@]3([H])[C@]4([H])CC[C@](C(=O)CO)([C@@]4(C)C[C@@H]([C@@]31[H])O)O", "formula": "C21H26O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 7, "ez_centers": 0, "molecular_weight": "358.4289", "optical_activity": "UNSPECIFIED", "references": [ "4da93ddd-8661-1e81-5ecf-48f6b3b35af7" ], "stereo_centers": 7 }, "unii": "EEN45FVD9K" } ] }