{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f3334c1f-b2f0-431b-8bca-42d7b7eeb001",
          "code": "7779-88-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7779-88-6",
          "code_system": "CAS",
          "references": [
            "c604103a-ffdb-450a-bf7b-3fa716393ce3",
            "a1345065-8b86-41db-a5a9-dc4eee8c252f"
          ]
        },
        {
          "uuid": "67e63567-61db-472d-a05d-4c500bd172d4",
          "code": "C042103",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67042103",
          "code_system": "MESH",
          "references": [
            "c604103a-ffdb-450a-bf7b-3fa716393ce3"
          ]
        },
        {
          "uuid": "8754a9b0-c8d9-4abc-9d1a-3e180dd80416",
          "code": "ZINC NITRATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Zinc_nitrate",
          "code_system": "WIKIPEDIA",
          "references": [
            "c604103a-ffdb-450a-bf7b-3fa716393ce3"
          ]
        },
        {
          "uuid": "ca31fe55-f289-45d7-a8ac-a983162fcff4",
          "code": "231-943-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.029.039",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c604103a-ffdb-450a-bf7b-3fa716393ce3"
          ]
        },
        {
          "uuid": "3ca5f032-79dc-46fc-806d-71595689d700",
          "code": "m11613",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11613?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "c604103a-ffdb-450a-bf7b-3fa716393ce3"
          ]
        },
        {
          "uuid": "9c5f6078-cf57-42c1-ad53-eedae402ab3b",
          "code": "24518",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/24518",
          "code_system": "PUBCHEM",
          "references": [
            "c604103a-ffdb-450a-bf7b-3fa716393ce3"
          ]
        },
        {
          "uuid": "fd6ae2f5-fe6b-ce08-9c3d-601b410849b3",
          "code": "1056",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1056",
          "code_system": "HSDB",
          "references": [
            "1405a4f2-d673-7409-dc73-5c405ffa2618"
          ]
        },
        {
          "uuid": "d65bb15c-0852-4b8b-a671-8fa33222ce01",
          "code": "EDO66F5U49",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6ac11e10-a434-985a-d337-ace9c86d0f34",
          "code": "DTXSID10890636",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10890636",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "943f7e60-81ba-3520-7e90-2f6a819af136",
          "code": "100000178395",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "43d14812-3f06-ea3e-a241-f8a5785880a1"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "57346339-ef45-4347-87fb-5bac24f513e0",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "2b73ad60-09d1-4b2e-b118-eaecfb882f0c",
            "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c",
            "name": "ZINC CATION",
            "unii": "13S1S8SF37",
            "linking_id": "13S1S8SF37",
            "ref_pname": "ZINC CATION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d7961678-261d-42ff-9a68-0914b93ec482",
          "name": "NITRIC ACID, ZINC SALT (2:1)",
          "stdName": "NITRIC ACID, ZINC SALT (2:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07d369db-2fde-4c1a-929e-49f88cadbb1f",
            "48d4a449-e124-40e4-81d0-3fd70e004047"
          ],
          "display_name": false
        },
        {
          "uuid": "5fc1fc17-5fb7-49a6-890f-c36c61cc1726",
          "name": "ZINC DINITRATE",
          "stdName": "ZINC DINITRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48d4a449-e124-40e4-81d0-3fd70e004047",
            "87b1cd64-6757-4ea4-b742-de68e3b7a518"
          ],
          "display_name": false
        },
        {
          "uuid": "9f7bb191-fc10-4a71-b62a-854a9f0f9adc",
          "name": "ZINC NITRATE",
          "stdName": "ZINC NITRATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c73618e1-1b0b-4ce5-a973-d5aa6690d497",
            "7d5cbbde-ce96-4737-90b9-d9d374f1c4a9",
            "6fd08f76-9167-4a82-92aa-24653d3381f9",
            "ed06dee7-0849-451b-9e8f-48af84e0c26b",
            "328428f5-67ef-4525-934d-724892581cbb",
            "d818acd5-38d4-4104-9b0a-bae0903fff35",
            "38727579-942b-4b42-beba-f1622da4ab37",
            "0bc48c81-bd8f-4ea3-afb1-3654991e3112",
            "48d4a449-e124-40e4-81d0-3fd70e004047",
            "152e493b-61c0-4b76-8228-e96ab8c6b7b5",
            "74e7c12f-cfcd-4612-8b42-92b7d14b96d6"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f1df30be-3ed0-45c6-902d-dd86a9729eec",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "03d1c2bd-0983-4451-8205-c79cccef4f43",
          "name": "ZINC NITRATE [HSDB]",
          "stdName": "ZINC NITRATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38727579-942b-4b42-beba-f1622da4ab37",
            "48d4a449-e124-40e4-81d0-3fd70e004047"
          ],
          "display_name": false
        },
        {
          "uuid": "7a1b33f9-0aeb-494e-a528-2f04c88753da",
          "name": "ZINC NITRATE [MART.]",
          "stdName": "ZINC NITRATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48d4a449-e124-40e4-81d0-3fd70e004047",
            "6fd08f76-9167-4a82-92aa-24653d3381f9"
          ],
          "display_name": false
        },
        {
          "uuid": "7acc4bdb-5fb9-4fb1-ae61-7a50b95022d5",
          "name": "ZINC NITRATE [MI]",
          "stdName": "ZINC NITRATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48d4a449-e124-40e4-81d0-3fd70e004047",
            "328428f5-67ef-4525-934d-724892581cbb"
          ],
          "display_name": false
        },
        {
          "uuid": "8be6145e-ceb4-40e4-9287-517ad303287e",
          "name": "ZINC(II) NITRATE",
          "stdName": "ZINC(II) NITRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48d4a449-e124-40e4-81d0-3fd70e004047",
            "f0e33f70-1884-4ae1-ac12-67941b8d709a"
          ],
          "display_name": false
        },
        {
          "uuid": "f34097fc-bbbe-927d-eabe-7cc1a2fcbb55",
          "name": "Zinc Nitrate [WHO-DD]",
          "stdName": "ZINC NITRATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e64182d-b3d4-d46e-264f-1ab1c402f35b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c73618e1-1b0b-4ce5-a973-d5aa6690d497",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "48d4a449-e124-40e4-81d0-3fd70e004047",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "07d369db-2fde-4c1a-929e-49f88cadbb1f",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87b1cd64-6757-4ea4-b742-de68e3b7a518",
          "citation": "ChemSpider",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f0e33f70-1884-4ae1-ac12-67941b8d709a",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "328428f5-67ef-4525-934d-724892581cbb",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6fd08f76-9167-4a82-92aa-24653d3381f9",
          "citation": "MART",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38727579-942b-4b42-beba-f1622da4ab37",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0bc48c81-bd8f-4ea3-afb1-3654991e3112",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c604103a-ffdb-450a-bf7b-3fa716393ce3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390919000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "840f33d4-0d76-43da-938f-ae5bf5050b22",
          "citation": "SRS import [EDO66F5U49]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=EDO66F5U49",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390919000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "318119bd-8e72-4629-b785-29db9312b6e9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ed06dee7-0849-451b-9e8f-48af84e0c26b",
          "citation": "ZINC NITRATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d818acd5-38d4-4104-9b0a-bae0903fff35",
          "citation": "ZINC NITRATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7d5cbbde-ce96-4737-90b9-d9d374f1c4a9",
          "citation": "ZINC NITRATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "152e493b-61c0-4b76-8228-e96ab8c6b7b5",
          "citation": "ZINC NITRATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "74e7c12f-cfcd-4612-8b42-92b7d14b96d6",
          "citation": "ZINC NITRATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1405a4f2-d673-7409-dc73-5c405ffa2618",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+7779-88-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a1345065-8b86-41db-a5a9-dc4eee8c252f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5e64182d-b3d4-d46e-264f-1ab1c402f35b",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "43d14812-3f06-ea3e-a241-f8a5785880a1",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c22f6016-29ca-44f5-a2e2-5d8523980ecc",
          "id": "c22f6016-29ca-44f5-a2e2-5d8523980ecc",
          "molfile": "\n  Marvin  01132110022D          \n\n  1  0  0  0  0  0            999 V2000\n    7.4807   -0.8276    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "80fdafd7-a63b-4121-b95d-37e7a3621989"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "9841d159-8f29-4533-a73e-f25c79cbd7b0",
          "id": "9841d159-8f29-4533-a73e-f25c79cbd7b0",
          "molfile": "\n  Marvin  01132107542D          \n\n  4  3  0  0  0  0            999 V2000\n    4.0100   -3.2344    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.0100   -2.4094    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.7245   -1.9969    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.2955   -1.9969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\nM  CHG  3   1  -1   2   1   3  -1\nM  END",
          "smiles": "[N+](=O)([O-])[O-]",
          "formula": "NO3",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "ee46f612-69af-4937-8083-7cabbb4d4daf"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "62.0049",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b9389db7-8fed-4ffc-8616-c31d891fe7cd",
      "version": "8",
      "structure": {
        "id": "a7e9d492-bb25-41d4-bee9-5cf8b828fa81",
        "molfile": "\n  Marvin  01132108432D          \n\n  9  6  0  0  0  0            999 V2000\n    7.4807   -0.8276    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n    4.0100   -3.2344    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.0100   -2.4094    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    3.2955   -1.9969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7245   -1.9969    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.0100   -3.2344    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.0100   -2.4094    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    3.2955   -1.9969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7245   -1.9969    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\nM  CHG  7   1   2   2  -1   3   1   5  -1   6  -1   7   1   9  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  8   2   3   4   5   6   7   8   9\nM  SPA   1  4   2   3   4   5\nM  SDI   1  4    2.8755   -3.6544    2.8755   -1.5769\nM  SDI   1  4    5.1445   -1.5769    5.1445   -3.6544\nM  SMT   1 2\nM  END",
        "smiles": "[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Zn+2]",
        "formula": "2NO3.Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "189.4054",
        "optical_activity": "NONE",
        "references": [
          "318119bd-8e72-4629-b785-29db9312b6e9",
          "840f33d4-0d76-43da-938f-ae5bf5050b22"
        ],
        "stereo_centers": 0
      },
      "unii": "EDO66F5U49"
    }
  ]
}