{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b9a18c78-992d-45e9-bffc-a0bf7a8d1139",
          "code": "LITHOL RUBINE BK",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Lithol_Rubine_BK",
          "code_system": "WIKIPEDIA",
          "references": [
            "33359190-47a4-4478-a04b-5a049e8d7241"
          ]
        },
        {
          "uuid": "59c7dd41-f044-46e4-bd51-f85190cf49c2",
          "code": "C71668",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C71668",
          "code_system": "NCI_THESAURUS",
          "references": [
            "33359190-47a4-4478-a04b-5a049e8d7241"
          ]
        },
        {
          "uuid": "72fa14f1-0bfe-4bf9-b118-db35afbd86a0",
          "code": "21 CFR 74.1307",
          "comments": "PART 74 -- LISTING OF COLOR ADDITIVES SUBJECT TO CERTIFICATION|Subpart B--Drugs|Sec. 74.1307 D&C Red No. 7.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=74.1307",
          "code_system": "CFR",
          "references": [
            "33359190-47a4-4478-a04b-5a049e8d7241"
          ]
        },
        {
          "uuid": "f9e89e23-8d57-4479-ab39-01e60a506369",
          "code": "21 CFR 74.2307",
          "comments": "PART 74 -- LISTING OF COLOR ADDITIVES SUBJECT TO CERTIFICATION|Subpart C--Cosmetics|Sec. 74.2307 D&C Red No. 7",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=74.2307",
          "code_system": "CFR",
          "references": [
            "33359190-47a4-4478-a04b-5a049e8d7241"
          ]
        },
        {
          "uuid": "c5a2fdcb-c26a-4cc8-8580-f9d55c4f1113",
          "code": "1310564",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1310564/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "33359190-47a4-4478-a04b-5a049e8d7241"
          ]
        },
        {
          "uuid": "dd186ea4-c929-4657-a3d1-678577239109",
          "code": "226-109-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.023.736",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "33359190-47a4-4478-a04b-5a049e8d7241"
          ]
        },
        {
          "uuid": "ab898385-af86-4967-9805-b420d0ee88ea",
          "code": "29092-56-6",
          "type": "NON-SPECIFIC STOICHIOMETRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=29092-56-6",
          "code_system": "CAS",
          "references": [
            "abdc8ea4-8ace-40f5-918d-57be2a8a3b01"
          ]
        },
        {
          "uuid": "3d9c5acd-3e45-2ace-5142-ed1d752f1f39",
          "code": "C461",
          "comments": "Industrial Aid[C45678]|Dye",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C461",
          "code_system": "NCI_THESAURUS",
          "references": [
            "912a4ab5-c276-7869-2847-feebd7969d2d"
          ]
        },
        {
          "uuid": "e225c5fa-2768-46f2-8d07-9a8fde160fe6",
          "code": "ECW0LZ41X8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d7ef877a-151c-1c9e-65c7-fc3d0f32e7b9",
          "code": "1369055",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1369055",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "912a4ab5-c276-7869-2847-feebd7969d2d"
          ]
        },
        {
          "uuid": "e3a152f3-517a-73a9-243b-efc6203acd97",
          "code": "5281-04-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5281-04-9",
          "code_system": "CAS",
          "references": [
            "0af42796-a012-921d-6056-774742259a4a",
            "31c100ae-1dfd-4880-89d8-ff07e1fd8b39"
          ]
        },
        {
          "uuid": "bc8bd7c2-9ac4-edbc-9682-15c0986a4c2e",
          "code": "DTXSID7027594",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7027594",
          "code_system": "EPA CompTox",
          "references": [
            "d4676e42-eddf-bdbd-e56c-e1546e0a581c"
          ]
        },
        {
          "uuid": "ed0b474d-ea74-86c4-65a0-bd8f7982992d",
          "code": "ECW0LZ41X8",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=ECW0LZ41X8",
          "code_system": "DAILYMED",
          "references": [
            "6b8ef8a7-3ee8-1635-a92f-2426907f772a"
          ]
        },
        {
          "uuid": "fd25e3d6-c086-86b7-a467-9e41ec385ba0",
          "code": "300000054534",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "55e220f5-2be8-bee2-90e5-884ae6feee4a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "38f51e54-f4e2-4a7b-b3a5-3f71514ace26",
          "name": "2-NAPHTHALENECARBOXYLIC ACID, 3-HYDROXY-4-((E)-(4-METHYL-2-SULFOPHENYL)AZO)-, CALCIUM SALT (1:1)",
          "stdName": "2-NAPHTHALENECARBOXYLIC ACID, 3-HYDROXY-4-((E)-(4-METHYL-2-SULFOPHENYL)AZO)-, CALCIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3be9a17-3a49-445e-9acc-a74640a94d6b",
            "189fe506-0ee8-4081-8bf6-be782c8fdd1a"
          ],
          "display_name": false
        },
        {
          "uuid": "88b1ff54-7088-4bd7-9f40-59b498c6f40c",
          "name": "2-NAPHTHALENECARBOXYLIC ACID, 3-HYDROXY-4-(2-(4-METHYL-2-SULFOPHENYL)DIAZENYL)-, CALCIUM SALT (1:1)",
          "stdName": "2-NAPHTHALENECARBOXYLIC ACID, 3-HYDROXY-4-(2-(4-METHYL-2-SULFOPHENYL)DIAZENYL)-, CALCIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75be8b0c-ff60-4f81-adc5-29dc15b89316",
            "6ab94a72-ce22-4a08-8a6c-2344ef6328d3"
          ],
          "display_name": false
        },
        {
          "uuid": "f8c8d3ea-10b4-4a48-a8c0-9a2008d8fb52",
          "name": "AKA202",
          "stdName": "AKA202",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "7d31e03f-e7ab-4184-895f-629b317f31e6",
            "6ab94a72-ce22-4a08-8a6c-2344ef6328d3",
            "b18c27e0-7da6-451c-8b8a-47c59b14ab8f"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "60707f40-188b-459a-96b8-dc8a4d3bd625",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "8fc612e4-bd77-4679-9734-a238b98b5da5",
          "name": "BRILLIANT CARMINE 6B",
          "stdName": "BRILLIANT CARMINE 6B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ab94a72-ce22-4a08-8a6c-2344ef6328d3",
            "b53833f2-b479-4009-86a3-8c466ee7bba9"
          ],
          "display_name": false
        },
        {
          "uuid": "561fd048-055a-4ee9-9e47-a2a2e987d204",
          "name": "C.I. 15850:1",
          "stdName": "C.I. 15850:1",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d31e03f-e7ab-4184-895f-629b317f31e6",
            "6ab94a72-ce22-4a08-8a6c-2344ef6328d3"
          ],
          "display_name": false
        },
        {
          "uuid": "f8f320d9-f138-4f1b-9365-ec337e349f66",
          "name": "CALCIUM 3-HYDROXY-4-((E)-(4-METHYL-2-SULFONATOPHENYL)DIAZENYL)-2-NAPHTHOATE",
          "stdName": "CALCIUM 3-HYDROXY-4-((E)-(4-METHYL-2-SULFONATOPHENYL)DIAZENYL)-2-NAPHTHOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3be9a17-3a49-445e-9acc-a74640a94d6b",
            "b4f57188-ae07-4cb5-b23c-eff00b1232f0"
          ],
          "display_name": false
        },
        {
          "uuid": "b4147ab5-c9b8-4472-b070-1740cc68a94e",
          "name": "CALCIUM SALT OF 3-HYDROXY-4-((4-METHYL-2-SULFOPHENYL)AZO)-2- NAPHTHALENECARBOXYLIC ACID",
          "stdName": "CALCIUM SALT OF 3-HYDROXY-4-((4-METHYL-2-SULFOPHENYL)AZO)-2- NAPHTHALENECARBOXYLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4f57188-ae07-4cb5-b23c-eff00b1232f0",
            "81227971-22c8-4713-b574-f25bf3d480ba"
          ],
          "display_name": false
        },
        {
          "uuid": "5e167389-8cad-4e86-aad6-1873f9b48ed3",
          "name": "CI 15850:1",
          "stdName": "CI 15850:1",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d31e03f-e7ab-4184-895f-629b317f31e6",
            "6ab94a72-ce22-4a08-8a6c-2344ef6328d3"
          ],
          "display_name": false
        },
        {
          "uuid": "688ef484-e40d-42d4-980d-83671cd9c208",
          "name": "D&C RED 7 CALCIUM LAKE",
          "stdName": "D&C RED 7 CALCIUM LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ab94a72-ce22-4a08-8a6c-2344ef6328d3",
            "746e01f2-8c23-4382-b266-3919556b9448"
          ],
          "display_name": false
        },
        {
          "uuid": "0c0e7956-5c94-4882-a1ed-07455f4102ce",
          "name": "D&C RED NO. 7",
          "stdName": "D&C RED NO. 7",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98f5404c-7c27-438f-bf86-a3a8f0a2cd74",
            "81227971-22c8-4713-b574-f25bf3d480ba"
          ],
          "display_name": true
        },
        {
          "uuid": "ead326b3-dc29-455f-9913-55dc904eb937",
          "name": "D&C RED NO. 7 [II]",
          "stdName": "D&C RED NO. 7 [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81227971-22c8-4713-b574-f25bf3d480ba"
          ],
          "display_name": false
        },
        {
          "uuid": "e563907b-b223-f8a1-9f2d-5759c32c722f",
          "name": "D&C RED NO. 7--CALCIUM LAKE",
          "stdName": "D&C RED NO. 7--CALCIUM LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "44814fa6-352b-d8b5-1f0f-acf6adcdd8c4",
            "02c9f549-89a4-8d1f-9ef5-7e739af677e4",
            "b91a74a1-fcc7-5958-1911-e9b2889ba9ca"
          ],
          "display_name": false
        },
        {
          "uuid": "21fa916d-0b33-3de5-0696-868ada2ab341",
          "name": "D&C RED NO. 7--CALCIUM LAKE [II]",
          "stdName": "D&C RED NO. 7--CALCIUM LAKE [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "44814fa6-352b-d8b5-1f0f-acf6adcdd8c4",
            "02c9f549-89a4-8d1f-9ef5-7e739af677e4"
          ],
          "display_name": false
        },
        {
          "uuid": "748afad2-42fd-43c6-883f-c8df242fa379",
          "name": "DC RED NO. 7",
          "stdName": "DC RED NO. 7",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ab94a72-ce22-4a08-8a6c-2344ef6328d3",
            "fd17f2e9-86f7-4c9a-be37-8a85b165bfa6"
          ],
          "display_name": false
        },
        {
          "uuid": "ee76f8fd-6280-fdf6-0e08-2f901cee03ce",
          "name": "DC RED NO. 7-CALCIUM LAKE",
          "stdName": "DC RED NO. 7-CALCIUM LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48a0bd4c-472e-e7ab-dd1e-6d81e7bc6123"
          ],
          "display_name": false
        },
        {
          "uuid": "ef6fd398-a122-db2e-2738-0cb8cbec0aea",
          "name": "DYE DC RED NO. 7 CALCIUM LAKE",
          "stdName": "DYE DC RED NO. 7 CALCIUM LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "44814fa6-352b-d8b5-1f0f-acf6adcdd8c4"
          ],
          "display_name": false
        },
        {
          "uuid": "3b59dbe3-f72f-4081-b8a4-f0ac8f86bf1a",
          "name": "LITHOL RUBINE BK",
          "stdName": "LITHOL RUBINE BK",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ab94a72-ce22-4a08-8a6c-2344ef6328d3",
            "b53833f2-b479-4009-86a3-8c466ee7bba9"
          ],
          "display_name": false
        },
        {
          "uuid": "6430ee87-a9ac-5e82-6191-d73c355c34c0",
          "name": "LITHOL RUBINE BK [USP-RS]",
          "stdName": "LITHOL RUBINE BK [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85ce367e-ed77-6ecd-ea5f-9289f835dcc6"
          ],
          "display_name": false
        },
        {
          "uuid": "11e36281-7511-4c92-a59b-aff20d4fa386",
          "name": "LITHOLRUBINE",
          "stdName": "LITHOLRUBINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ab94a72-ce22-4a08-8a6c-2344ef6328d3",
            "b53833f2-b479-4009-86a3-8c466ee7bba9"
          ],
          "display_name": false
        },
        {
          "uuid": "9c8c87a5-9f03-4eb1-9a2f-0fd2c76a39aa",
          "name": "PIGMENT RED 57:1",
          "stdName": "PIGMENT RED 57:1",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "7d31e03f-e7ab-4184-895f-629b317f31e6",
            "41cb460a-c0d8-46ea-b115-6f928a624563",
            "6ab94a72-ce22-4a08-8a6c-2344ef6328d3",
            "8bd797a2-7b39-462c-831c-b33f80341229"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ead4c021-6b18-4cc6-9678-504b967cd374",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "70853162-2fde-43fc-ace0-c171d8ffe6f1",
          "name": "PIGMENT RUBINE [MART.]",
          "stdName": "PIGMENT RUBINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb39096c-4cac-473e-a149-002cfbc70413"
          ],
          "display_name": false
        },
        {
          "uuid": "429f48d9-4a99-4806-99cc-171c0360f86f",
          "name": "RED 7",
          "stdName": "RED 7",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "7d31e03f-e7ab-4184-895f-629b317f31e6",
            "6ab94a72-ce22-4a08-8a6c-2344ef6328d3",
            "341260c9-4ec7-48c6-a932-fdbdc340ea27",
            "d3848b61-af70-4bff-8dad-c5db441c66f4"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "21b18468-a478-4f9a-ba47-1fc3a5a2f59d",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "81227971-22c8-4713-b574-f25bf3d480ba",
          "citation": "21CFR74.1307",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b4f57188-ae07-4cb5-b23c-eff00b1232f0",
          "citation": "CFR",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e3be9a17-3a49-445e-9acc-a74640a94d6b",
          "citation": "ACD 8.0(21CFR74.1307",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "189fe506-0ee8-4081-8bf6-be782c8fdd1a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "341260c9-4ec7-48c6-a932-fdbdc340ea27",
          "citation": "CTFA 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ab94a72-ce22-4a08-8a6c-2344ef6328d3",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb39096c-4cac-473e-a149-002cfbc70413",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7d31e03f-e7ab-4184-895f-629b317f31e6",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "75be8b0c-ff60-4f81-adc5-29dc15b89316",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8bd797a2-7b39-462c-831c-b33f80341229",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fd17f2e9-86f7-4c9a-be37-8a85b165bfa6",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b53833f2-b479-4009-86a3-8c466ee7bba9",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "746e01f2-8c23-4382-b266-3919556b9448",
          "citation": "www.emeraldmaterials.com/.../fis_ftp.do..",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33359190-47a4-4478-a04b-5a049e8d7241",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389949000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "153c9279-59a1-4339-8c5b-1b288234a6d0",
          "citation": "SRS import [ECW0LZ41X8]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ECW0LZ41X8",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389949000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd4b9f71-41bd-423d-b57f-26a8c4f12872",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d3848b61-af70-4bff-8dad-c5db441c66f4",
          "citation": "RED 7 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "98f5404c-7c27-438f-bf86-a3a8f0a2cd74",
          "citation": "D&C RED NO. 7 [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "41cb460a-c0d8-46ea-b115-6f928a624563",
          "citation": "PIGMENT RED 57:1 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b18c27e0-7da6-451c-8b8a-47c59b14ab8f",
          "citation": "AKA202 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "912a4ab5-c276-7869-2847-feebd7969d2d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "85ce367e-ed77-6ecd-ea5f-9289f835dcc6",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "abdc8ea4-8ace-40f5-918d-57be2a8a3b01",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b91a74a1-fcc7-5958-1911-e9b2889ba9ca",
          "citation": "D&C RED NO. 7--CALCIUM LAKE [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "44814fa6-352b-d8b5-1f0f-acf6adcdd8c4",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "02c9f549-89a4-8d1f-9ef5-7e739af677e4",
          "citation": "21CFR82.1307",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48a0bd4c-472e-e7ab-dd1e-6d81e7bc6123",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0af42796-a012-921d-6056-774742259a4a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389949000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4676e42-eddf-bdbd-e56c-e1546e0a581c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5281-04-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "31c100ae-1dfd-4880-89d8-ff07e1fd8b39",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6b8ef8a7-3ee8-1635-a92f-2426907f772a",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "55e220f5-2be8-bee2-90e5-884ae6feee4a",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e966dab4-21c1-4904-9a0c-4c4cdeee2353",
          "id": "e966dab4-21c1-4904-9a0c-4c4cdeee2353",
          "molfile": "\n  Marvin  01132112042D          \n\n  1  0  0  0  0  0            999 V2000\n   11.4594   -7.6256    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Ca+2]",
          "formula": "Ca",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0ba1a21f-5f87-4329-aed7-a05279d93e0a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "40.078",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "679f57c7-5326-4b34-bddd-eb1f1605d54a",
          "id": "679f57c7-5326-4b34-bddd-eb1f1605d54a",
          "molfile": "\n  Marvin  01132105232D          \n\n 27 29  0  0  0  0            999 V2000\n    1.9086   -6.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7337   -6.1534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1381   -6.8726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9630   -6.8868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3836   -6.1819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1963   -6.1797    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7589   -7.0381    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5881   -7.0381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9983   -6.3237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2797   -5.9088    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.8260   -6.3273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2373   -7.0437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8209   -7.7565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2274   -8.4629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8120   -9.1688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9947   -9.1637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5927   -8.4527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0035   -7.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2382   -5.6088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0662   -5.6069    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.8217   -4.8927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9875   -5.4629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1627   -5.4487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9795   -4.6379    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8035   -4.6364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9650   -3.8172    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1524   -4.6426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n 23  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 22  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 18  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  2  0  0  0  0\n 12 11  1  0  0  0  0\n 11 19  1  0  0  0  0\n 13 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 18  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  2  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  2  0  0  0  0\n 24 27  2  0  0  0  0\nM  CHG  2  10  -1  20  -1\nM  END",
          "smiles": "Cc1ccc(c(c1)S(=O)(=O)O)/N=N/c2c3ccccc3cc(c2[O-])C(=O)[O-]",
          "formula": "C18H12N2O6S",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "80eae9ab-c319-4a26-b54e-059955f275e5"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "384.3645",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ce7899f8-c339-477e-9bb7-c8e4e35ce268",
      "version": "17",
      "structure": {
        "id": "293ad287-5171-4825-9081-b79031e6b285",
        "molfile": "\n   JSDraw209272113172D\n\n 28 29  0  0  0  0            999 V2000\n   37.8860   -9.8367    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\n   28.6787   -8.7263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.7959   -8.7369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.0185   -7.3828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.4541   -7.3760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.0088  -10.0841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.4639  -10.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.6874  -11.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.4473  -12.7439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.9920  -12.7535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.7772  -11.4193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0958   -6.5918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1115   -8.7263    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1579   -8.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7171   -8.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.5120   -7.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7634   -5.7490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.2044   -5.7222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.3936   -7.0541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8340   -7.0407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7482   -4.1897    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   25.3057   -4.1868    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   23.7208   -2.6385    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1849   -4.1986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.0481   -7.1038    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   31.7976   -6.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   33.3626   -6.0212    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   31.0104   -4.6713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  6 11  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  2  0  0  0  0\n 21 24  2  0  0  0  0\n  9 10  1  0  0  0  0\n 16 25  1  0  0  0  0\n 13 25  2  0  0  0  0\n 10 11  2  0  0  0  0\n  4 26  1  0  0  0  0\n  6  3  2  0  0  0  0\n  5 12  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 28  2  0  0  0  0\n  3  4  1  0  0  0  0\n  2 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  2  7  2  0  0  0  0\n 14 19  2  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n  2  5  1  0  0  0  0\n 17 21  1  0  0  0  0\nM  CHG  3   1   2  22  -1  27  -1\nM  END",
        "smiles": "Cc1ccc(c(c1)S(=O)(=O)[O-])/N=N/c2c3ccccc3cc(c2O)C(=O)[O-].[Ca+2]",
        "formula": "C18H12N2O6S.Ca",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "424.4425",
        "optical_activity": "NONE",
        "references": [
          "153c9279-59a1-4339-8c5b-1b288234a6d0",
          "dd4b9f71-41bd-423d-b57f-26a8c4f12872"
        ],
        "stereo_centers": 0
      },
      "modifications": {
        "uuid": "2fdc1acc-0ea6-4512-ae46-98235fca57e2"
      },
      "unii": "ECW0LZ41X8"
    }
  ]
}