{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4a78ea01-d89a-48fa-a39b-abfb790d791c",
          "code": "111129-35-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=111129-35-2",
          "code_system": "CAS",
          "references": [
            "6c4b732a-668e-4a23-9a9e-9d37bb3e32d9",
            "cb73b1fb-8217-4b29-aa9e-c12ab37aca45"
          ]
        },
        {
          "uuid": "19c1cd83-3f30-4890-a845-f58b137ec781",
          "code": "22842301",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/22842301",
          "code_system": "PUBCHEM",
          "references": [
            "6c4b732a-668e-4a23-9a9e-9d37bb3e32d9"
          ]
        },
        {
          "uuid": "f4fa23a4-dae9-4fad-8901-ef228484b01e",
          "code": "EBP6TXG8XV",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d73d0696-0c0d-4bed-1d68-1dd8905eb290",
          "code": "DTXSID601021693",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID601021693",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1bae8949-166d-4308-b1fb-44523af05212",
          "name": "ARGININE HEXYLDECYL PHOSPHATE",
          "stdName": "ARGININE HEXYLDECYL PHOSPHATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8283d352-6b74-4d09-bc2f-e83765e16cf0",
            "6abad61d-b42d-41b6-84c0-0adfa861c564",
            "399457f9-e359-4c19-b08b-2fac203a9315"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f16c2877-21e3-4009-af14-8a27e4e945aa",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "c4ef288e-f99b-48cb-a22a-a9bc919fc8ae",
          "name": "L-ARGININE, COMPD. WITH 2-HEXYLDECYL DIHYDROGEN PHOSPHATE (1:1)",
          "stdName": "L-ARGININE, COMPD. WITH 2-HEXYLDECYL DIHYDROGEN PHOSPHATE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6abad61d-b42d-41b6-84c0-0adfa861c564",
            "7c93eab1-fb0d-4860-88d4-b46cbbd961d7"
          ],
          "display_name": false
        },
        {
          "uuid": "bc18d8f6-3358-4d3c-95d5-c9c554d3a068",
          "name": "MAP-16G-ARG",
          "stdName": "MAP-16G-ARG",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6abad61d-b42d-41b6-84c0-0adfa861c564",
            "399457f9-e359-4c19-b08b-2fac203a9315"
          ],
          "display_name": false
        },
        {
          "uuid": "84fb32d2-839e-4624-96a8-336d3fc438c2",
          "name": "NIKKOL PUREPHOS LC",
          "stdName": "NIKKOL PUREPHOS LC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6abad61d-b42d-41b6-84c0-0adfa861c564",
            "399457f9-e359-4c19-b08b-2fac203a9315"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "399457f9-e359-4c19-b08b-2fac203a9315",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6abad61d-b42d-41b6-84c0-0adfa861c564",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c93eab1-fb0d-4860-88d4-b46cbbd961d7",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c4b732a-668e-4a23-9a9e-9d37bb3e32d9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393046000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93e01954-dc64-4706-a21a-9daceeee1a3c",
          "citation": "SRS import [EBP6TXG8XV]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=EBP6TXG8XV",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393046000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8283d352-6b74-4d09-bc2f-e83765e16cf0",
          "citation": "ARGININE HEXYLDECYL PHOSPHATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cb73b1fb-8217-4b29-aa9e-c12ab37aca45",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c1757685-8f18-44a3-9d65-433e5e64fe7a",
          "id": "c1757685-8f18-44a3-9d65-433e5e64fe7a",
          "molfile": "\n  Marvin  01132110002D          \n\n 12 11  0  0  1  0            999 V2000\n   13.0071   -8.0824    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   13.0071   -8.9073    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2927   -7.6698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5782   -8.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8638   -7.6698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1494   -8.0824    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4350   -7.6698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7206   -8.0824    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4350   -6.8449    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7216   -7.6698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7216   -6.8449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4360   -8.0824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1 10  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\nM  END",
          "smiles": "C(C[C@@H](C(=O)O)N)CNC(=N)N",
          "formula": "C6H14N4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "167d8600-f6d2-4d13-a9b6-5b7d0d488607"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "174.2012",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        },
        {
          "uuid": "6919ab58-9503-4be6-8b0a-9fc257767bae",
          "id": "6919ab58-9503-4be6-8b0a-9fc257767bae",
          "molfile": "\n  Marvin  01132105282D          \n\n 21 20  0  0  1  0            999 V2000\n   16.6738   -1.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9594   -1.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2449   -1.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5304   -1.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8159   -1.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1014   -1.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3869   -1.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6724   -1.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9579   -1.5175    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   10.2434   -1.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5289   -1.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8144   -1.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1000   -1.5176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3855   -1.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6710   -1.5176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9579   -2.3426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7331   -2.6247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8765   -3.4373    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5523   -3.9104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6984   -3.5091    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2444   -3.9675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 16  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 18 21  2  0  0  0  0\nM  END",
          "smiles": "CCCCCCCCC(CCCCCC)COP(=O)(O)O",
          "formula": "C16H35O4P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "75a83366-4f45-4713-8853-6e4bb5ff890f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "322.4211",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ed3387c1-c623-41aa-acc9-57cd5c8ce3f4",
      "version": "4",
      "structure": {
        "id": "9e919201-5f07-49a8-8a8d-66d6f303e7ec",
        "molfile": "\n  Marvin  01132108142D          \n\n 33 31  0  0  1  0            999 V2000\n   10.9579   -1.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9579   -2.3426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7331   -2.6247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8765   -3.4373    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5523   -3.9104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6984   -3.5091    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2444   -3.9675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2434   -1.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5289   -1.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8144   -1.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1000   -1.5176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3855   -1.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6710   -1.5176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6724   -1.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3869   -1.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1014   -1.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8159   -1.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5304   -1.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2449   -1.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9594   -1.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6738   -1.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2938   -7.6705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0083   -8.0831    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.0083   -8.9081    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7228   -7.6705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7228   -6.8455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4373   -8.0831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5793   -8.0831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8648   -7.6705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1503   -8.0831    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4359   -7.6705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7214   -8.0831    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4359   -6.8455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4  7  2  0  0  0  0\n  1  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n  1 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  1  0  0  0\n 23 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 25 27  1  0  0  0  0\n 22 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  1  0  0  0  0\n 31 32  1  0  0  0  0\n 31 33  2  0  0  0  0\nM  END",
        "smiles": "CCCCCCCCC(CCCCCC)COP(=O)(O)O.C(C[C@@H](C(=O)O)N)CNC(=N)N",
        "formula": "C16H35O4P.C6H14N4O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "EPIMERIC",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "496.6223",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "7c93eab1-fb0d-4860-88d4-b46cbbd961d7",
          "93e01954-dc64-4706-a21a-9daceeee1a3c"
        ],
        "stereo_centers": 2
      },
      "unii": "EBP6TXG8XV"
    }
  ]
}