{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "5b8e6204-6591-4444-8d35-c2d82880f823", "code": "119738-06-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=119738-06-6", "code_system": "CAS", "references": [ "d233fa1d-0833-43ee-8d71-a62c223b3607", "39bafffa-3c4c-4488-9331-628fedaa69e8" ] }, { "uuid": "86ce259e-8ccb-46f4-b0dc-c238208fb81a", "code": "86175", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/86175", "code_system": "PUBCHEM", "references": [ "d233fa1d-0833-43ee-8d71-a62c223b3607" ] }, { "uuid": "9f37f147-8b15-5b7f-cda4-3e589cac5597", "code": "DTXSID3058290", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3058290", "code_system": "EPA CompTox", "references": [ "cae90807-b049-ca72-fd6e-aff215234487" ] }, { "uuid": "a130d779-668e-43bb-a79c-ba257e89b4fc", "code": "EB75I82DU0", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "fbc15b21-f21b-539c-85b8-dc91d23a1dee", "code": "300000052863", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "6a20cba8-6357-b15f-2721-340680cc3e8f" ] } ], "substance_class": "chemical", "names": [ { "uuid": "c26fcc93-e6e1-46d8-a3e0-6afaeda9dc38", "name": "PROPANOIC ACID, 2-(4-((6-CHLORO-2-QUINOXALINYL)OXY)PHENOXY)-, (TETRAHYDRO-2-FURANYL)METHYL ESTER", "stdName": "PROPANOIC ACID, 2-(4-((6-CHLORO-2-QUINOXALINYL)OXY)PHENOXY)-, (TETRAHYDRO-2-FURANYL)METHYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5059ce55-4f66-4b27-b996-a5e836297557" ], "display_name": false }, { "uuid": "27b27d3a-0ab1-48f3-847b-f30379807671", "name": "QUIZALOFOP-P TEFURYL ESTER", "stdName": "QUIZALOFOP-P TEFURYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "754b363e-4323-4125-af0f-968bc8260087" ], "display_name": false }, { "uuid": "b28b8dd5-6bfe-4fcd-b792-4bfa3917737b", "name": "QUIZALOFOP-TEFURYL", "stdName": "QUIZALOFOP-TEFURYL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5059ce55-4f66-4b27-b996-a5e836297557" ], "display_name": true }, { "uuid": "fd3b4b63-4fe2-412e-b415-c24a169a359e", "name": "UBI-1956", "stdName": "UBI-1956", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "5059ce55-4f66-4b27-b996-a5e836297557" ], "display_name": false } ], "references": [ { "uuid": "754b363e-4323-4125-af0f-968bc8260087", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "5059ce55-4f66-4b27-b996-a5e836297557", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d233fa1d-0833-43ee-8d71-a62c223b3607", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390747000, "tags": [ "NOMEN" ] }, { "uuid": "11c90497-6484-4877-b1f3-0bb138c5029c", "citation": "SRS import [EB75I82DU0]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=EB75I82DU0", "doc_type": "SRS", "public_domain": true, "document_date": 1493390747000, "tags": [ "NOMEN" ] }, { "uuid": "cae90807-b049-ca72-fd6e-aff215234487", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=119738-06-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "39bafffa-3c4c-4488-9331-628fedaa69e8", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "6a20cba8-6357-b15f-2721-340680cc3e8f", "citation": "SMS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "878d4633-35ce-4773-9b68-04cbd67d1d7a", "id": "878d4633-35ce-4773-9b68-04cbd67d1d7a", "molfile": "\n Marvin 01132107022D \n\n 30 33 0 0 0 0 999 V2000\n 10.7764 -4.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7764 -5.7770 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 10.0619 -6.1896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3475 -5.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6330 -6.1896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9185 -5.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9185 -4.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2041 -4.5396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4895 -4.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4895 -5.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7751 -6.1896 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0606 -5.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3461 -6.1896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6316 -5.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9172 -6.1896 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6316 -4.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3461 -4.5396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0606 -4.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7751 -4.5396 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6330 -4.5396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3475 -4.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4909 -6.1896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4909 -7.0146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2053 -5.7770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9198 -6.1895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6343 -5.7770 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 13.7205 -4.9565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5275 -4.7850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9400 -5.4994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3879 -6.1126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 22 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 21 4 2 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 7 20 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 19 2 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 18 12 2 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 16 14 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 23 2 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 26 30 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 30 29 1 0 0 0 0\nM END", "smiles": "CC(C(=O)OCC1CCCO1)Oc2ccc(cc2)Oc3cnc4cc(ccc4n3)Cl", "formula": "C22H21ClN2O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a8553c67-4f20-43a5-b9db-d86c923761dd" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "428.8663", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "b904fecd-8029-41cb-aa68-608a015fa3ff", "version": "4", "structure": { "id": "f94b653c-9ed4-4ab0-8a43-ed16a1708175", "molfile": "\n Marvin 01132112552D \n\n 30 33 0 0 0 0 999 V2000\n 7.2041 -4.5396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4895 -4.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7751 -4.5396 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0606 -4.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0606 -5.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7751 -6.1896 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4895 -5.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3461 -6.1896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6316 -5.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6316 -4.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3461 -4.5396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9172 -6.1896 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9185 -4.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9185 -5.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6330 -6.1896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3475 -5.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3475 -4.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6330 -4.5396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0619 -6.1896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7764 -5.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4909 -6.1896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2053 -5.7770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9198 -6.1895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6343 -5.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7205 -4.9565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5275 -4.7850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9400 -5.4994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3879 -6.1126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4909 -7.0146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7764 -4.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 2 0 0 0 0\n 2 7 1 0 0 0 0\n 5 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 2 0 0 0 0\n 4 11 1 0 0 0 0\n 9 12 1 0 0 0 0\n 1 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 2 0 0 0 0\n 13 18 1 0 0 0 0\n 16 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 28 27 1 0 0 0 0\n 24 28 1 0 0 0 0\n 21 29 2 0 0 0 0\n 20 30 1 0 0 0 0\nM END", "smiles": "CC(C(=O)OCC1CCCO1)Oc2ccc(cc2)Oc3cnc4cc(ccc4n3)Cl", "formula": "C22H21ClN2O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "428.8663", "optical_activity": "UNSPECIFIED", "references": [ "11c90497-6484-4877-b1f3-0bb138c5029c", "5059ce55-4f66-4b27-b996-a5e836297557" ], "stereo_centers": 2 }, "unii": "EB75I82DU0" } ] }