{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c3a0891e-fe75-4f70-b2db-814b7c3e4bb9",
          "code": "31972-43-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=31972-43-7",
          "code_system": "CAS",
          "references": [
            "09fa6cc4-bdf7-4d4f-9c42-763a8cf4c1c1",
            "10e90713-27ab-484d-a408-ef2e330af4fd"
          ]
        },
        {
          "uuid": "6e4b087d-2e47-42d9-852b-fb72022b4db4",
          "code": "36027",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/36027",
          "code_system": "PUBCHEM",
          "references": [
            "09fa6cc4-bdf7-4d4f-9c42-763a8cf4c1c1"
          ]
        },
        {
          "uuid": "609d619b-baf1-7061-bd70-5ae68ad8da74",
          "code": "DTXSID8037548",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8037548",
          "code_system": "EPA CompTox",
          "references": [
            "ad61bec0-5a38-13df-a5b9-e1f30b029d6e"
          ]
        },
        {
          "uuid": "6f3896a3-384b-4ca2-8d8d-e1157f3ac075",
          "code": "E9KC714FKU",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "257b2342-dfce-4c9f-a256-85f55138e7ce",
          "name": "BAY-68138 SULFOXIDE",
          "stdName": "BAY-68138 SULFOXIDE",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "363e2872-847a-4f29-9cbd-7719e3871b37",
            "ad3468b4-8617-452c-9a67-4a22e174f9ba"
          ],
          "display_name": false
        },
        {
          "uuid": "7a583130-2dfb-4bde-ac05-fd44eb0765af",
          "name": "FENAMIPHOS SULFOXIDE",
          "stdName": "FENAMIPHOS SULFOXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1c534c2-4832-4dcf-9195-5a4bc7dc37e3"
          ],
          "display_name": true
        },
        {
          "uuid": "f5156533-7944-4a4f-a86e-ac3ff091fe08",
          "name": "FENAMIPHOS SULPHOXIDE",
          "stdName": "FENAMIPHOS SULPHOXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2662a93b-9587-4752-8f8e-e1dea757bdd5"
          ],
          "display_name": false
        },
        {
          "uuid": "0f8aa873-676c-4d35-9d53-2ab1a4324f58",
          "name": "O-ETHYL O-(4-(METHYLSULFINYL)-M-TOLYL)ISOPROPYLPHOSPHORAMIDATE",
          "stdName": "O-ETHYL O-(4-(METHYLSULFINYL)-M-TOLYL)ISOPROPYLPHOSPHORAMIDATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "363e2872-847a-4f29-9cbd-7719e3871b37",
            "ad3468b4-8617-452c-9a67-4a22e174f9ba"
          ],
          "display_name": false
        },
        {
          "uuid": "2dd6f877-ba79-49cd-ac07-66840322f439",
          "name": "PHOSPHORAMIDIC ACID, N-(1-METHYLETHYL)-, ETHYL 3-METHYL-4-(METHYLSULFINYL)PHENYL ESTER",
          "stdName": "PHOSPHORAMIDIC ACID, N-(1-METHYLETHYL)-, ETHYL 3-METHYL-4-(METHYLSULFINYL)PHENYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "363e2872-847a-4f29-9cbd-7719e3871b37",
            "ad3468b4-8617-452c-9a67-4a22e174f9ba"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2662a93b-9587-4752-8f8e-e1dea757bdd5",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c1c534c2-4832-4dcf-9195-5a4bc7dc37e3",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "363e2872-847a-4f29-9cbd-7719e3871b37",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad3468b4-8617-452c-9a67-4a22e174f9ba",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09fa6cc4-bdf7-4d4f-9c42-763a8cf4c1c1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390924000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e14ddaf-b9e4-40bd-beea-d61420e7e10a",
          "citation": "SRS import [E9KC714FKU]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=E9KC714FKU",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390924000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60ea2d34-2416-4af4-a3bd-9e757b01ef45",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad61bec0-5a38-13df-a5b9-e1f30b029d6e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=31972-43-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "10e90713-27ab-484d-a408-ef2e330af4fd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ffa67f6d-74f1-442c-a34e-107fc7fed062",
          "id": "ffa67f6d-74f1-442c-a34e-107fc7fed062",
          "molfile": "\n  Marvin  01132113142D          \n\n 20 20  0  0  0  0            999 V2000\n   12.3552   -5.3584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0669   -6.1225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1400   -6.1225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7460   -6.8412    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3519   -7.5846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4917   -7.2399    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4917   -8.0543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8161   -8.4784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2287   -8.4413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0281   -6.4472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3086   -6.8814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3086   -7.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5890   -8.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8781   -7.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8781   -6.8814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1563   -6.4472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5890   -6.4679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1563   -8.1407    0.0000 S   0  0  0  0  0  0  0  0  0  3  0  0\n    6.4377   -7.7227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1563   -8.9611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n 10  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 17  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  2  0  0  0  0\n 14 18  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\nM  END",
          "smiles": "CCOP(=O)(NC(C)C)Oc1ccc(c(C)c1)S(=O)C",
          "formula": "C13H22NO4PS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7466e1c4-9be2-4495-bacf-ad984a09485c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "319.3584",
          "optical_activity": "NONE",
          "stereo_centers": 2
        }
      ],
      "definition_level": "INCOMPLETE",
      "uuid": "0ebdc349-55dc-409f-b585-60039b6f95c8",
      "version": "3",
      "structure": {
        "id": "27703166-81da-4cda-9e9d-0e437692e37e",
        "molfile": "\n  Marvin  01132102102D          \n\n 20 20  0  0  0  0            999 V2000\n   10.0281   -6.4472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3086   -6.8814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5890   -6.4679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8781   -6.8814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8781   -7.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1563   -8.1407    0.0000 S   0  3  0  0  0  0  0  0  0  0  0  0\n    6.4377   -7.7227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1563   -8.9611    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.5890   -8.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3086   -7.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1563   -6.4472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7460   -6.8412    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4917   -7.2399    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4917   -8.0543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8161   -8.4784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2287   -8.4413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1400   -6.1225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0669   -6.1225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3552   -5.3584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3519   -7.5846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9  5  2  0  0  0  0\n 10  9  1  0  0  0  0\n  2 10  2  0  0  0  0\n  4 11  1  0  0  0  0\n  1 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 12 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 12 20  2  0  0  0  0\nM  CHG  2   6   1   8  -1\nM  END",
        "smiles": "CCOP(=O)(NC(C)C)Oc1ccc(c(C)c1)[S+](C)[O-]",
        "formula": "C13H22NO4PS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "319.3584",
        "optical_activity": "( + / - )",
        "references": [
          "9e14ddaf-b9e4-40bd-beea-d61420e7e10a",
          "60ea2d34-2416-4af4-a3bd-9e757b01ef45"
        ],
        "stereo_centers": 2
      },
      "unii": "E9KC714FKU"
    }
  ]
}