{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7c42ce8e-03ee-45df-ab0a-a961b90b9486",
          "code": "5928-25-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5928-25-6",
          "code_system": "CAS",
          "references": [
            "d51f18e5-9ef0-48e5-94ec-17c2194ac990",
            "83b077de-706d-4cc0-b3b0-09d6d2934ef0"
          ]
        },
        {
          "uuid": "b6a2066a-ec89-478f-831c-fae5f196e261",
          "code": "442126",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/442126",
          "code_system": "PUBCHEM",
          "references": [
            "d51f18e5-9ef0-48e5-94ec-17c2194ac990"
          ]
        },
        {
          "uuid": "91bea2fe-445a-42c9-acb4-7d39538578dd",
          "code": "E95RTO3YQR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4978c348-2bf8-8d33-fabe-153829d606a8",
          "code": "DTXSID90974706",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90974706",
          "code_system": "EPA CompTox"
        }
      ],
      "relationships": [
        {
          "uuid": "afbe999b-5a17-40ce-8a6d-3219cba37dc5",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "5cd27186-4dd5-4c03-9599-15787443c331"
          ],
          "related_substance": {
            "uuid": "46c57e59-8bec-4b71-aa42-9bce4f085a03",
            "refuuid": "e5539bc6-80d7-4ef2-a2fd-eef038224894",
            "name": "ANGELICA GIGAS ROOT",
            "unii": "32766B2FHX",
            "linking_id": "32766B2FHX",
            "ref_pname": "ANGELICA GIGAS ROOT"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "dfc707fb-ce6d-4eaf-9d7b-d68589852001",
          "name": "(+)-DECURSIN",
          "stdName": "(+)-DECURSIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7bb82ada-1264-41ce-a315-8abeceee202f",
            "45f415ea-9118-4899-8d31-c865da5bf7c2"
          ],
          "display_name": false
        },
        {
          "uuid": "889ba20c-c656-4c3a-b3ab-6e95ee25ec0c",
          "name": "2-BUTENOIC ACID, 3-METHYL-, (7S)-7,8-DIHYDRO-8,8-DIMETHYL-2-OXO-2H,6H-PYRANO(3,2-G)-1-BENZOPYRAN-7-YL ESTER",
          "stdName": "2-BUTENOIC ACID, 3-METHYL-, (7S)-7,8-DIHYDRO-8,8-DIMETHYL-2-OXO-2H,6H-PYRANO(3,2-G)-1-BENZOPYRAN-7-YL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7bb82ada-1264-41ce-a315-8abeceee202f",
            "45f415ea-9118-4899-8d31-c865da5bf7c2"
          ],
          "display_name": false
        },
        {
          "uuid": "516f55fc-b189-4913-9545-95561cab1d37",
          "name": "2-BUTENOIC ACID, 3-METHYL-, 7,8-DIHYDRO-8,8-DIMETHYL-2-OXO-2H,6H-BENZO(1,2-B:5,4-B')DIPYRAN-7-YL ESTER, (S)-",
          "stdName": "2-BUTENOIC ACID, 3-METHYL-, 7,8-DIHYDRO-8,8-DIMETHYL-2-OXO-2H,6H-BENZO(1,2-B:5,4-B')DIPYRAN-7-YL ESTER, (S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7bb82ada-1264-41ce-a315-8abeceee202f",
            "45f415ea-9118-4899-8d31-c865da5bf7c2"
          ],
          "display_name": false
        },
        {
          "uuid": "45649253-b380-4d73-8b7b-d83a34c2c61c",
          "name": "CROTONIC ACID, 3-METHYL-, ESTER WITH 7,8-DIHYDRO-7-HYDROXY-8,8-DIMETHYL-2H,6H-BENZO(1,2-B:5,4-B')DIPYRAN-2-ONE, (+)-",
          "stdName": "CROTONIC ACID, 3-METHYL-, ESTER WITH 7,8-DIHYDRO-7-HYDROXY-8,8-DIMETHYL-2H,6H-BENZO(1,2-B:5,4-B')DIPYRAN-2-ONE, (+)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7bb82ada-1264-41ce-a315-8abeceee202f",
            "45f415ea-9118-4899-8d31-c865da5bf7c2"
          ],
          "display_name": false
        },
        {
          "uuid": "5155c860-d8aa-47af-a358-846c9a28f395",
          "name": "DECURSIN",
          "stdName": "DECURSIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7bb82ada-1264-41ce-a315-8abeceee202f",
            "45f415ea-9118-4899-8d31-c865da5bf7c2"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7f7d6fb7-caca-41aa-930a-7fdbc8baec4e",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "7bb82ada-1264-41ce-a315-8abeceee202f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "45f415ea-9118-4899-8d31-c865da5bf7c2",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d51f18e5-9ef0-48e5-94ec-17c2194ac990",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391948000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae9849a1-e79c-4c89-ba0b-5435ec07f428",
          "citation": "SRS import [E95RTO3YQR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=E95RTO3YQR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391948000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6447fed0-43b8-c331-0dd1-7d5ac8d30d8b",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "83b077de-706d-4cc0-b3b0-09d6d2934ef0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5cd27186-4dd5-4c03-9599-15787443c331",
          "citation": "Jiang, Cheng, et al. \"Decursin and decursinol angelate inhibit estrogen-stimulated and estrogen-independent growth and survival of breast cancer cells.\" Breast Cancer Research 9.6 (2007): R77.",
          "url": "https://link.springer.com/article/10.1186/bcr1790",
          "doc_type": "JA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5f3361a6-f532-4946-96fa-012be0be11e7",
          "id": "5f3361a6-f532-4946-96fa-012be0be11e7",
          "molfile": "\n  Marvin  01132104552D          \n\n 24 26  0  0  1  0            999 V2000\n   13.2029   -9.7309    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   12.4884  -10.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7739   -9.7309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0595  -10.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3450   -9.7309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6305  -10.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9160   -9.7309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9160   -8.9059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2016   -8.4934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6305   -8.4934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3450   -8.9059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0595   -8.4934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7739   -8.9059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4884   -8.4934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2029   -8.9059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6154   -8.1914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0279   -8.9059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9173  -10.1434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6318   -9.7309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6318   -8.9059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3463  -10.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0608   -9.7309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0608   -8.9059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7752  -10.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1 15  1  0  0  0  0\n  1 18  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n 13  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 11  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  2  0  0  0  0\n 19 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\nM  END",
          "smiles": "CC(=CC(=O)O[C@H]1Cc2cc3ccc(=O)oc3cc2OC1(C)C)C",
          "formula": "C19H20O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7838104f-c74f-46a0-84b4-3eadd93b1e30"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "328.3598",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fb569ae1-4c91-46c8-b32f-bab9350243a6",
      "version": "6",
      "structure": {
        "id": "59aef432-76e3-4a9e-8e12-a69b360e8ddc",
        "molfile": "\n  Marvin  01132104392D          \n\n 24 26  0  0  1  0            999 V2000\n   14.6318   -9.7309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3463  -10.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0608   -9.7309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0608   -8.9059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6318   -8.9059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9173  -10.1434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7752  -10.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9160   -8.9059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9160   -9.7309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6305  -10.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3450   -9.7309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3450   -8.9059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6305   -8.4934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0595   -8.4934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7739   -8.9059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7739   -9.7309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0595  -10.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4884  -10.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2029   -9.7309    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.2029   -8.9059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4884   -8.4934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2016   -8.4934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6154   -8.1914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0279   -8.9059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  1  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n  8 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 11  2  0  0  0  0\n 14 12  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 18 16  1  0  0  0  0\n 21 15  1  0  0  0  0\n  8 22  2  0  0  0  0\n 20 23  1  0  0  0  0\n 20 24  1  0  0  0  0\n 19  6  1  1  0  0  0\nM  END",
        "smiles": "CC(=CC(=O)O[C@H]1Cc2cc3ccc(=O)oc3cc2OC1(C)C)C",
        "formula": "C19H20O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "328.3598",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "ae9849a1-e79c-4c89-ba0b-5435ec07f428",
          "7bb82ada-1264-41ce-a315-8abeceee202f"
        ],
        "stereo_centers": 1
      },
      "unii": "E95RTO3YQR"
    }
  ]
}