{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "96336a58-28d3-49a2-afa3-9b7c1f9776cf", "code": "E8M9W728TN", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "34e98023-92aa-48e4-a41a-c34dc16a1089", "code": "142770-42-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=142770-42-1", "code_system": "CAS", "references": [ "1bf75348-e2ad-4938-9d20-1860107b21e4", "8fd9312d-f0d0-40d4-85e2-738184d8e399" ] }, { "uuid": "01d30a8c-6b95-4880-8ae0-0bb6cc443128", "code": "5212856", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5212856", "code_system": "PUBCHEM", "references": [ "1bf75348-e2ad-4938-9d20-1860107b21e4" ] }, { "uuid": "77bcdf7c-85e5-b266-b330-15a275ad8f82", "code": "DTXSID50888976", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50888976", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "be4a54bb-f38e-4a4c-89a5-2840346b4c81", "name": "1-Chloro-4-propoxy-9H-thioxanthen-9-one", "stdName": "1-CHLORO-4-PROPOXY-9H-THIOXANTHEN-9-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8fd9312d-f0d0-40d4-85e2-738184d8e399" ], "display_name": false }, { "uuid": "ae077705-0f58-4197-8d39-dad4c24c83fb", "name": "1-Chloro-4-propoxythioxanthone", "stdName": "1-CHLORO-4-PROPOXYTHIOXANTHONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8fd9312d-f0d0-40d4-85e2-738184d8e399" ], "display_name": true }, { "uuid": "04743756-1eb0-4b3d-ba42-7e5e4706a943", "name": "9H-Thioxanthen-9-one, 1-chloro-4-propoxy-", "stdName": "9H-THIOXANTHEN-9-ONE, 1-CHLORO-4-PROPOXY-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1f910050-f811-4324-a13f-6a5d40d16626" ], "display_name": false } ], "references": [ { "uuid": "1f910050-f811-4324-a13f-6a5d40d16626", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1bf75348-e2ad-4938-9d20-1860107b21e4", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392263000, "tags": [ "NOMEN" ] }, { "uuid": "8fd9312d-f0d0-40d4-85e2-738184d8e399", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "42e3a7c4-ee7a-4b5e-a6e4-406bbf52da28", "id": "42e3a7c4-ee7a-4b5e-a6e4-406bbf52da28", "molfile": "\n Marvin 01132103322D \n\n 20 22 0 0 0 0 999 V2000\n 5.0199 -2.4296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0199 -3.2579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3020 -3.6796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5942 -3.2730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5942 -2.4547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3121 -2.0431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3121 -1.2249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5942 -0.8183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5942 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8764 -1.2249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8764 -2.0431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1586 -2.4547 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4407 -2.0431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7178 -2.4547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.0431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.2249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7178 -0.8183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4407 -1.2249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1586 -0.8183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1586 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 11 5 2 0 0 0 0\n 6 7 2 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 8 2 0 0 0 0\n 11 10 1 0 0 0 0\n 10 19 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 18 2 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 2 0 0 0 0\nM END", "smiles": "CCCOc1ccc(c2c(=O)c3ccccc3sc12)Cl", "formula": "C16H13ClO2S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "35fd7cc6-2075-4450-b467-5f4b278d9c78" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "304.7928", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "b1e4f17a-7cb1-4d29-ba78-52db71696b0d", "version": "5", "structure": { "id": "7809af6f-c8e9-487c-9556-6120daf3fb66", "molfile": "\n JSDraw202132508362D\n\n 20 22 0 0 0 0 0 V2000\n 27.4072 -12.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.0607 -11.5962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.0767 -10.0320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.7302 -9.2359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.7463 -7.6716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.1021 -6.8999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.1021 -5.3356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.7463 -4.5639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4010 -5.3669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0974 -4.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0974 -3.0517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.7938 -5.3669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4485 -4.5639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0928 -5.3356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0928 -6.8999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4485 -7.6716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.7938 -6.8686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0974 -7.6195 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4010 -6.8686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.7302 -2.9997 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 12 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 5 19 1 0 0 0 0\n 9 19 2 0 0 0 0\n 8 20 1 0 0 0 0\nM END", "smiles": "CCCOc1ccc(c2c(=O)c3ccccc3sc12)Cl", "formula": "C16H13ClO2S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "304.7928", "optical_activity": "NONE", "references": [ "1f910050-f811-4324-a13f-6a5d40d16626" ], "stereo_centers": 0 }, "unii": "E8M9W728TN" } ] }