{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e99eea19-c682-4794-bc76-18f5bf325ae4",
          "code": "472981-92-3",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=472981-92-3",
          "code_system": "CAS",
          "references": [
            "017a8637-2e6c-48ff-a839-3cfc23031ed2",
            "8379261e-cda4-4873-9816-b69d0316380e"
          ]
        },
        {
          "uuid": "a9d5330c-f3a6-4b0f-8abc-692187f91fdc",
          "code": "667594",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/667594",
          "code_system": "PUBCHEM",
          "references": [
            "017a8637-2e6c-48ff-a839-3cfc23031ed2"
          ]
        },
        {
          "uuid": "7e1e3b58-c30b-b482-b1c1-cd9ef57ab7a3",
          "code": "SB-366791",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/SB-366791",
          "code_system": "WIKIPEDIA",
          "references": [
            "584dde4a-3de3-f02a-7980-cc45f666898d"
          ]
        },
        {
          "uuid": "246cfd43-736d-f785-9c4e-c2f208bf449e",
          "code": "DTXSID001017242",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID001017242",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "b7f9f9d0-1e74-4b4f-8d07-de349cfe05ee",
          "code": "1649486-65-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1649486-65-6",
          "code_system": "CAS"
        },
        {
          "uuid": "ee874695-3871-4a87-8457-df473d40ba50",
          "code": "E8EY4M2N4H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6052e49d-7c08-4f48-81a9-0e2cced037a9",
          "name": "(2E)-3-(4-Chlorophenyl)-N-(3-methoxyphenyl)-2-propenamide",
          "stdName": "(2E)-3-(4-CHLOROPHENYL)-N-(3-METHOXYPHENYL)-2-PROPENAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8379261e-cda4-4873-9816-b69d0316380e"
          ],
          "display_name": false
        },
        {
          "uuid": "41ae1303-e61a-44d6-9e8c-5a52b90066c0",
          "name": "2-Propenamide, 3-(4-chlorophenyl)-N-(3-methoxyphenyl)-",
          "stdName": "2-PROPENAMIDE, 3-(4-CHLOROPHENYL)-N-(3-METHOXYPHENYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8379261e-cda4-4873-9816-b69d0316380e"
          ],
          "display_name": false
        },
        {
          "uuid": "8649ceba-038e-4d04-98e8-c1bb8fbfe6bc",
          "name": "2-Propenamide, 3-(4-chlorophenyl)-N-(3-methoxyphenyl)-, (2E)-",
          "stdName": "2-PROPENAMIDE, 3-(4-CHLOROPHENYL)-N-(3-METHOXYPHENYL)-, (2E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8379261e-cda4-4873-9816-b69d0316380e"
          ],
          "display_name": false
        },
        {
          "uuid": "63c9623e-c842-46af-810e-bbcab0776b29",
          "name": "3-(4-Chlorophenyl)-N-(3-methoxyphenyl)-2-propenamide",
          "stdName": "3-(4-CHLOROPHENYL)-N-(3-METHOXYPHENYL)-2-PROPENAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8379261e-cda4-4873-9816-b69d0316380e"
          ],
          "display_name": false
        },
        {
          "uuid": "02de0ab6-84a0-4c90-b033-45dc5a3e92c8",
          "name": "SB-366791",
          "stdName": "SB-366791",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "14b00070-200b-4b62-bdd7-c617fa89d857",
            "5ded64dd-2232-427f-8555-a771387abb69",
            "8379261e-cda4-4873-9816-b69d0316380e"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "5ded64dd-2232-427f-8555-a771387abb69",
          "citation": "NCI DRUG DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "14b00070-200b-4b62-bdd7-c617fa89d857",
          "citation": "NCI DRUG DICTIONARY",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "017a8637-2e6c-48ff-a839-3cfc23031ed2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393225000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0051d199-aa99-4f6a-9117-7e7ea708bc1c",
          "citation": "NCI RECORD 472981-92-3",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "584dde4a-3de3-f02a-7980-cc45f666898d",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "8379261e-cda4-4873-9816-b69d0316380e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "30710730-84d8-4730-beee-e452bd0cc595",
          "id": "30710730-84d8-4730-beee-e452bd0cc595",
          "molfile": "\n  Marvin  06232217572D          \n\n 20 21  0  0  0  0            999 V2000\n   13.6945   -4.2762    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9800   -3.8637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2655   -4.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9800   -3.0387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5511   -3.8637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5523   -4.2762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2668   -3.8637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6932   -5.5137    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   14.4089   -3.8637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1234   -4.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4089   -3.0387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8378   -3.8637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1234   -2.6262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8378   -3.0387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8366   -4.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8366   -5.1012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1222   -3.8637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1222   -5.5137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4077   -4.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4077   -5.1012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  9  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  3  5  2  0  0  0  0\n  5 15  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 12  1  0  0  0  0\n  8 20  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 12 14  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n 18 20  2  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "COc1cccc(c1)NC(=O)/C=C/c2ccc(cc2)Cl",
          "formula": "C16H14ClNO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e52616d0-f6a1-4346-bbb1-d08c2e6eee49"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "287.7414",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8c625d5e-b6ac-4839-8940-32d9a6c17d98",
      "version": "6",
      "structure": {
        "id": "573f7b07-9ac9-487c-8c68-f4a800a9cfac",
        "molfile": "3-(4-Chlorophenyl)-N-(3-methoxyphenyl)-2-propenamide\n   JSDraw206232217572D\n\n 20 21  0  0  0  0              0 V2000\n   25.8950   -8.0860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   24.5440   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1930   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.5440   -5.7460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8420   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.2989   -8.0860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   32.6499   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4381  -10.4260    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   27.2459   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5969   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.2459   -5.7460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.9479   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5969   -4.9660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.9479   -5.7460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4910   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4910   -9.6460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1401   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1401  -10.4260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7891   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7891   -9.6460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  9  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  3  5  2  0  0  0  0\n  5 15  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 12  1  0  0  0  0\n  8 20  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 12 14  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n 18 20  2  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
        "smiles": "COc1cccc(c1)NC(=O)/C=C/c2ccc(cc2)Cl",
        "formula": "C16H14ClNO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "287.7414",
        "optical_activity": "NONE",
        "references": [
          "0051d199-aa99-4f6a-9117-7e7ea708bc1c",
          "8379261e-cda4-4873-9816-b69d0316380e"
        ],
        "stereo_centers": 0
      },
      "unii": "E8EY4M2N4H"
    }
  ]
}