{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2ad66852-36dd-4e11-a9bb-e64c9c67990a",
          "code": "28159-98-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=28159-98-0",
          "code_system": "CAS",
          "references": [
            "dd8ec8d7-937f-4730-831a-ceab3d7293f0",
            "67d4ac98-450e-4938-9fcc-6c61b721321b"
          ]
        },
        {
          "uuid": "655c96bb-566e-41ad-be15-270c7226afa8",
          "code": "248-872-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.044.415",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "dd8ec8d7-937f-4730-831a-ceab3d7293f0"
          ]
        },
        {
          "uuid": "b45e236c-b67d-40d7-b212-b750cc784a5b",
          "code": "m6398",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6398?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "dd8ec8d7-937f-4730-831a-ceab3d7293f0"
          ]
        },
        {
          "uuid": "6563d3e5-4274-4688-a63f-9e20925e0a24",
          "code": "91590",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91590",
          "code_system": "PUBCHEM",
          "references": [
            "dd8ec8d7-937f-4730-831a-ceab3d7293f0"
          ]
        },
        {
          "uuid": "461627cf-ec57-0a0c-9716-cc5759c413e3",
          "code": "DTXSID3032416",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3032416",
          "code_system": "EPA CompTox",
          "references": [
            "c172c064-4a19-9f50-a607-d222d28305c2"
          ]
        },
        {
          "uuid": "e725ab39-d5c3-4bc1-b894-d1d2b7ac2d04",
          "code": "E7B77O21GH",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e7f92b29-868a-b516-cb5f-ba5707aa6670",
          "code": "5962",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:5962",
          "code_system": "CHEBI",
          "references": [
            "ab533934-7006-a9f4-16dc-029cbabf24dc"
          ]
        },
        {
          "uuid": "50983cac-1a1f-9271-414c-da1a4f55e19d",
          "code": "cybutryne",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/cybutryne.html",
          "code_system": "ALANWOOD",
          "references": [
            "46b4361d-f06e-3f80-cf39-858a2fd65794"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a8b1349a-84fc-4674-85b8-2b591054671a",
          "name": "CYBUTRYNE",
          "stdName": "CYBUTRYNE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f356215d-62d5-46c9-9dac-e8b417bc953e",
            "b4e632e3-7698-40d5-8c8c-905f96564f40",
            "8ac1e99f-848e-478c-bfee-254bc665c067",
            "f58fac4d-2210-418d-b812-557030130528"
          ],
          "display_name": true
        },
        {
          "uuid": "0149c037-6980-493f-881a-e83d480e4999",
          "name": "CYBUTRYNE [ISO]",
          "stdName": "CYBUTRYNE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4e632e3-7698-40d5-8c8c-905f96564f40",
            "f58fac4d-2210-418d-b812-557030130528"
          ],
          "display_name": false
        },
        {
          "uuid": "233b1412-a339-4286-937e-3a76e6d54fb4",
          "name": "IRGAROL [MI]",
          "stdName": "IRGAROL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f58fac4d-2210-418d-b812-557030130528",
            "be4e8d85-0b43-4691-9e89-04ec44befa81"
          ],
          "display_name": false
        },
        {
          "uuid": "03caae24-418a-4436-a639-286f47a4eaea",
          "name": "N(SUP 2)-TERT-BUTYL-N(SUP 4)-CYCLOPROPYL-6-METHYLTHIO-1,3,5-TRIAZINE-2,4-DIAMINE",
          "stdName": "N(SUP 2)-TERT-BUTYL-N(SUP 4)-CYCLOPROPYL-6-METHYLTHIO-1,3,5-TRIAZINE-2,4-DIAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7479f096-d541-4c72-915e-9715424af697",
            "f07a6d58-fd32-48ca-a91c-2ce984ed5fe9"
          ],
          "display_name": false
        },
        {
          "uuid": "a94b5dfa-516e-4c12-8be4-4e34f85cad42",
          "name": "N-CYCLOPROPYL-N'-(1,1-DIMETHYLETHYL)-6-(METHYLTHIO)-1,3,5-TRIAZINE-2,4-DIAMINE",
          "stdName": "N-CYCLOPROPYL-N'-(1,1-DIMETHYLETHYL)-6-(METHYLTHIO)-1,3,5-TRIAZINE-2,4-DIAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f07a6d58-fd32-48ca-a91c-2ce984ed5fe9",
            "ec04248b-4253-4a8a-b93b-c46bb39436d4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8ac1e99f-848e-478c-bfee-254bc665c067",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f07a6d58-fd32-48ca-a91c-2ce984ed5fe9",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec04248b-4253-4a8a-b93b-c46bb39436d4",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7479f096-d541-4c72-915e-9715424af697",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be4e8d85-0b43-4691-9e89-04ec44befa81",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f58fac4d-2210-418d-b812-557030130528",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4e632e3-7698-40d5-8c8c-905f96564f40",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd8ec8d7-937f-4730-831a-ceab3d7293f0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390917000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e5b666b-98f8-4cf6-b000-ef68f1585cfb",
          "citation": "SRS import [E7B77O21GH]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=E7B77O21GH",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390917000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "951c424c-20b8-4acb-89da-1f5b0d185c1b",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f356215d-62d5-46c9-9dac-e8b417bc953e",
          "citation": "CYBUTRYNE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c172c064-4a19-9f50-a607-d222d28305c2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=28159-98-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "46b4361d-f06e-3f80-cf39-858a2fd65794",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "67d4ac98-450e-4938-9fcc-6c61b721321b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ab533934-7006-a9f4-16dc-029cbabf24dc",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "678eee9e-baa9-4a19-8f6e-90f8d74af77f",
          "id": "678eee9e-baa9-4a19-8f6e-90f8d74af77f",
          "molfile": "\n  Marvin  01132105232D          \n\n 17 18  0  0  0  0            999 V2000\n    5.1157   -7.3880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1157   -6.5560    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8268   -6.1332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5378   -6.5560    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2535   -6.1332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9600   -6.5560    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6756   -6.1332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0893   -5.4267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5121   -6.1332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2535   -5.3012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5378   -4.8784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5378   -4.0418    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8268   -3.6236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2450   -2.9124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4085   -4.3346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1157   -3.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8268   -5.3012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n 17  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  6  5  1  0  0  0  0\n 10  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 11 17  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 13  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)Nc1nc(NC2CC2)nc(n1)SC",
          "formula": "C11H19N5S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "812dc5df-4bda-4fa3-8ca9-93d285d9ae6e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "253.3686",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c461bde3-a37b-4bfa-b503-0a0b2ab63240",
      "version": "6",
      "structure": {
        "id": "eb5078fc-14dc-4297-9cbf-5720d21aab97",
        "molfile": "\n  Marvin  01132112102D          \n\n 17 18  0  0  0  0            999 V2000\n    7.2535   -6.1332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2535   -5.3012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5378   -4.8784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5378   -4.0418    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8268   -3.6236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2450   -2.9124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4085   -4.3346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1157   -3.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8268   -5.3012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8268   -6.1332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5378   -6.5560    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1157   -6.5560    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1157   -7.3880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9600   -6.5560    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6756   -6.1332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0893   -5.4267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5121   -6.1332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  5  1  0  0  0  0\n  3  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11  1  1  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14  1  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 15  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)Nc1nc(NC2CC2)nc(n1)SC",
        "formula": "C11H19N5S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "253.3686",
        "optical_activity": "NONE",
        "references": [
          "0e5b666b-98f8-4cf6-b000-ef68f1585cfb",
          "951c424c-20b8-4acb-89da-1f5b0d185c1b"
        ],
        "stereo_centers": 0
      },
      "unii": "E7B77O21GH"
    }
  ]
}