{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0291b1cd-e4fb-48d5-9ffa-722a5e591a20",
          "code": "520-26-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=520-26-3",
          "code_system": "CAS",
          "references": [
            "3c29f73d-45d3-4d23-9952-039bc17b89e3",
            "846da697-c85b-4e34-9c9a-008b4f32ed86"
          ]
        },
        {
          "uuid": "322ed2e7-848c-42bb-a3da-bd94b004cf95",
          "code": "C506722",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67506722",
          "code_system": "MESH",
          "references": [
            "3c29f73d-45d3-4d23-9952-039bc17b89e3"
          ]
        },
        {
          "uuid": "716b7c22-5959-4d7b-97d3-ff627ebdfb5c",
          "code": "D006569",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68006569",
          "code_system": "MESH",
          "references": [
            "3c29f73d-45d3-4d23-9952-039bc17b89e3"
          ]
        },
        {
          "uuid": "44dbead5-2643-46ab-b5c0-662405026410",
          "code": "HESPERIDIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Hesperidin",
          "code_system": "WIKIPEDIA",
          "references": [
            "3c29f73d-45d3-4d23-9952-039bc17b89e3"
          ]
        },
        {
          "uuid": "cf3468c9-1778-4315-80b9-e975c880cb9d",
          "code": "208-288-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.536",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3c29f73d-45d3-4d23-9952-039bc17b89e3"
          ]
        },
        {
          "uuid": "60f50062-b6ba-426c-83b3-f91da9e191fb",
          "code": "C68460",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68460",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3c29f73d-45d3-4d23-9952-039bc17b89e3"
          ]
        },
        {
          "uuid": "74b621f2-ed41-44e2-8ea6-8c27b826e46d",
          "code": "5281",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/5281/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "3c29f73d-45d3-4d23-9952-039bc17b89e3"
          ]
        },
        {
          "uuid": "4c4667ea-e7d6-4f26-945f-58cdb9e8e0c5",
          "code": "m5976",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5976?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3c29f73d-45d3-4d23-9952-039bc17b89e3"
          ]
        },
        {
          "uuid": "1d768dd7-f909-4bf7-bfcc-820ac3359e6e",
          "code": "SUB14093MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "3c29f73d-45d3-4d23-9952-039bc17b89e3"
          ]
        },
        {
          "uuid": "bb10736a-185c-4e3e-bc1a-17948c03fbf2",
          "code": "CHEMBL449317",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL449317",
          "code_system": "ChEMBL",
          "references": [
            "3c29f73d-45d3-4d23-9952-039bc17b89e3"
          ]
        },
        {
          "uuid": "6c9696a5-dd4a-4c69-b5e8-674909b48873",
          "code": "10621",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10621",
          "code_system": "PUBCHEM",
          "references": [
            "3c29f73d-45d3-4d23-9952-039bc17b89e3"
          ]
        },
        {
          "uuid": "8c431070-0050-f09c-c1cd-fb20697b091d",
          "code": "DTXSID9044328",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9044328",
          "code_system": "EPA CompTox",
          "references": [
            "dc7f1f83-a846-7c38-b7be-15497b41697d"
          ]
        },
        {
          "uuid": "fe9121d6-a8d3-97ee-aa35-4837181a28ae",
          "code": "C68461",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Dietary Polyphenol[C70553]|Dietary Flavonoid[C70554]|Flavanone[C68459]|Hesperetin",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68461",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5f7ad800-0f86-bb32-975e-0a6cb8c9c7e9"
          ]
        },
        {
          "uuid": "94d9f88d-6b2a-9664-5142-ca9e84f3f439",
          "code": "83 (Number of products:829)",
          "comments": "Dietary Supplement Label Database|Botanical|Hesperidin",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=83&item=Hesperidin",
          "code_system": "DSLD",
          "references": [
            "5f7ad800-0f86-bb32-975e-0a6cb8c9c7e9"
          ]
        },
        {
          "uuid": "47c67e86-fbb7-4f5f-2345-0dc615c64907",
          "code": "DB04703",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB04703",
          "code_system": "DRUG BANK",
          "references": [
            "5f7ad800-0f86-bb32-975e-0a6cb8c9c7e9"
          ]
        },
        {
          "uuid": "a6dbb642-6d9a-419c-a7a7-6ddd77c11a86",
          "code": "E750O06Y6O",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0513e687-0a4c-0e79-9892-53f9688f8cd8",
          "code": "28775",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28775",
          "code_system": "CHEBI",
          "references": [
            "5f7ad800-0f86-bb32-975e-0a6cb8c9c7e9"
          ]
        },
        {
          "uuid": "c532dd27-22c1-1bf4-8bcb-a3ba23788b50",
          "code": "61606",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:61606",
          "code_system": "CHEBI",
          "references": [
            "5f7ad800-0f86-bb32-975e-0a6cb8c9c7e9"
          ]
        },
        {
          "uuid": "8726ad99-bb28-6649-7227-297b4be2fc9b",
          "code": "1304377",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1304377",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "5f7ad800-0f86-bb32-975e-0a6cb8c9c7e9"
          ]
        },
        {
          "uuid": "8c9a2c35-6fdc-7287-8117-0ab221c13c77",
          "code": "100000088498",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "1e0f0fc6-bce8-3efe-079f-8e3fbb53a6c9"
          ]
        },
        {
          "uuid": "4564e3a5-e78b-c0ed-31de-9632f6083150",
          "code": "44184",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=44184",
          "code_system": "NSC",
          "references": [
            "3424253d-439d-39b0-f140-d104eb96b030"
          ]
        },
        {
          "uuid": "dc53948f-9a58-ff68-0d05-6d4cc98a076e",
          "code": "E750O06Y6O",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=E750O06Y6O",
          "code_system": "DAILYMED",
          "references": [
            "38c02c41-0a58-4dd8-506d-07eb2d799272"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "0d5e7f68-7b4d-4c29-a37a-ca157d3fa697",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "0510d588-3e4d-4179-96fa-3c8731670e35",
            "refuuid": "507c5427-c8fd-4863-a97c-f681a3a5614c",
            "name": "HESPERIDIN",
            "unii": "E750O06Y6O",
            "linking_id": "E750O06Y6O",
            "ref_pname": "HESPERIDIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4f1d03bf-885f-4d5f-9d06-b67eb56c6ae3",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "related_substance": {
            "uuid": "3d80c3bb-1c94-4374-aa95-5810a0122675",
            "refuuid": "7147e1a0-0c1a-4a31-87fd-ba5f0a85d5d8",
            "name": "TANGERINE PEEL",
            "unii": "JU3D414057",
            "linking_id": "JU3D414057",
            "ref_pname": "TANGERINE PEEL"
          }
        },
        {
          "uuid": "24320c98-0727-46b6-84bb-08ab578f1648",
          "amount": {
            "uuid": "846d2ff2-2b87-409e-b910-d8b834353102"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "29ddd6c0-ac55-4991-9d76-b317a0a8b7f1",
            "refuuid": "cd80960d-ac14-45a7-91ff-2289e17bfd14",
            "name": "Hesperidin phosphate",
            "unii": "8HDT8GA9UW",
            "linking_id": "8HDT8GA9UW",
            "ref_pname": "Hesperidin phosphate",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "df758e24-5093-4510-b083-a0a35389a737",
          "name": "(2S)-7-((6-O-(6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL)-.BETA.-D-GLUCOPYRANOSYL)OXY)-2,3-DIHYDRO-5-HYDROXY-2-(3-HYDROXY-4-METHOXYPHENYL)-4H-1-BENZOPYRAN-4-ONE",
          "stdName": "(2S)-7-((6-O-(6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL)-.BETA.-D-GLUCOPYRANOSYL)OXY)-2,3-DIHYDRO-5-HYDROXY-2-(3-HYDROXY-4-METHOXYPHENYL)-4H-1-BENZOPYRAN-4-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68ba366e-012e-4670-a81f-95542560c3d1",
            "1320faa3-04b7-4629-bce6-38de94a62621"
          ],
          "display_name": false
        },
        {
          "uuid": "fd27c3b5-0b4d-4354-9251-a01e1c0fb002",
          "name": "3',5'-DIHYDROXY-4'-METHOXY-7-RUTINOSYLOXYFLAVAN-4-ONE",
          "stdName": "3',5'-DIHYDROXY-4'-METHOXY-7-RUTINOSYLOXYFLAVAN-4-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c948c8a1-b730-41ec-9385-8d262b0fd33f",
            "907a7ae4-e592-4974-aa64-0f0eb7204100"
          ],
          "display_name": false
        },
        {
          "uuid": "193f4cef-72e7-4185-82b8-7183c00447dd",
          "name": "4H-1-BENZOPYRAN-4-ONE, 7-((6-O-(6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL)-.BETA.-D-GLUCOPYRANOSYL)OXY)-2,3-DIHYDO-5-HYDROXY-2-(3-HYDROXY-4-METHOXYPHENYL)-, (S)-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 7-((6-O-(6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL)-.BETA.-D-GLUCOPYRANOSYL)OXY)-2,3-DIHYDO-5-HYDROXY-2-(3-HYDROXY-4-METHOXYPHENYL)-, (S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c948c8a1-b730-41ec-9385-8d262b0fd33f",
            "907a7ae4-e592-4974-aa64-0f0eb7204100"
          ],
          "display_name": false
        },
        {
          "uuid": "d9c67a0b-882f-415d-af18-ef5382ad2ed7",
          "name": "5-HYDROXY-2-(3-HYDROXY-4-METHOXYPHENYL)-7-((6-O-.ALPHA.-L-RHAMNOPYRANOSYL-.BETA.-D-GLUCOPYRANOSYL)OXY)-4-CHROMANON",
          "stdName": "5-HYDROXY-2-(3-HYDROXY-4-METHOXYPHENYL)-7-((6-O-.ALPHA.-L-RHAMNOPYRANOSYL-.BETA.-D-GLUCOPYRANOSYL)OXY)-4-CHROMANON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c948c8a1-b730-41ec-9385-8d262b0fd33f",
            "907a7ae4-e592-4974-aa64-0f0eb7204100"
          ],
          "display_name": false
        },
        {
          "uuid": "a915637b-1ed1-4bf1-a5d4-a2f9cc772cb8",
          "name": "CIRANTIN",
          "stdName": "CIRANTIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68ba366e-012e-4670-a81f-95542560c3d1",
            "1320faa3-04b7-4629-bce6-38de94a62621"
          ],
          "display_name": false
        },
        {
          "uuid": "26731875-fc66-4830-8d22-0f821eb77082",
          "name": "DIOSMIN [NDI]",
          "stdName": "DIOSMIN [NDI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a43e7d1-b3c1-4231-b0f6-7e86a2c2e876"
          ],
          "display_name": false
        },
        {
          "uuid": "6b8e5343-2d65-458c-b40a-1184d3c28221",
          "name": "DIOSVEIN",
          "stdName": "DIOSVEIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a43e7d1-b3c1-4231-b0f6-7e86a2c2e876"
          ],
          "display_name": false
        },
        {
          "uuid": "ab64885a-26f2-4481-bf4d-e7a8946d3ed7",
          "name": "HESPERETIN 7-RHAMNOGLUCOSIDE",
          "stdName": "HESPERETIN 7-RHAMNOGLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68ba366e-012e-4670-a81f-95542560c3d1",
            "1320faa3-04b7-4629-bce6-38de94a62621"
          ],
          "display_name": false
        },
        {
          "uuid": "1d187fc8-c53d-435f-88f4-5cabdddce80a",
          "name": "HESPERETIN 7-RUTINOSIDE",
          "stdName": "HESPERETIN 7-RUTINOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c948c8a1-b730-41ec-9385-8d262b0fd33f",
            "907a7ae4-e592-4974-aa64-0f0eb7204100"
          ],
          "display_name": false
        },
        {
          "uuid": "f023cdf5-819f-421e-8963-3f81ae548b45",
          "name": "HESPERETIN-7-RUTINOSIDE",
          "stdName": "HESPERETIN-7-RUTINOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68ba366e-012e-4670-a81f-95542560c3d1",
            "1320faa3-04b7-4629-bce6-38de94a62621"
          ],
          "display_name": false
        },
        {
          "uuid": "55ab2b80-5df8-4ebd-b116-3a0c8e017986",
          "name": "HESPERIDIN",
          "stdName": "HESPERIDIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae4b6308-ab60-49d1-ad6a-41e04a262c16",
            "665615c7-3d79-472f-9243-117d97910611",
            "31f908fc-83eb-4b2a-bb6e-e35c9913c496",
            "1ea2bacf-ccf0-42e9-9e56-ec629c8995ce",
            "0cedbc66-c150-46fb-88a0-ed956f88f089",
            "4474b561-f0e9-40f5-a07f-a2b700d56dc2",
            "15673ef2-61a5-425d-a039-6625f829bd4c",
            "68ba366e-012e-4670-a81f-95542560c3d1",
            "fbd1b83f-4e44-4492-9f2e-4f756a7c0e1a",
            "9022a273-5571-44a0-9e32-dc6d5f70f568",
            "dc387cd3-b7c0-449b-86db-a25d2ee24e07",
            "5d4f01fa-9944-43f1-a84d-49e278186db4",
            "362887c7-b5b9-47c4-9848-76e0c1338b4f",
            "be900d36-6019-45a8-ba35-0dd5255db604"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "8f880cd3-7fb7-4bc5-808c-ef6dea0233e1",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "5b9953ee-69e4-4f55-b94b-69101dd56688",
          "name": "HESPERIDIN [JAN]",
          "stdName": "HESPERIDIN [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68ba366e-012e-4670-a81f-95542560c3d1",
            "5d4f01fa-9944-43f1-a84d-49e278186db4"
          ],
          "display_name": false
        },
        {
          "uuid": "4aa0a11b-7521-456b-afa6-be338f2b235e",
          "name": "HESPERIDIN [MART.]",
          "stdName": "HESPERIDIN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4474b561-f0e9-40f5-a07f-a2b700d56dc2"
          ],
          "display_name": false
        },
        {
          "uuid": "90abe01f-f1f9-4591-babd-ef5bd03bef84",
          "name": "HESPERIDIN [MI]",
          "stdName": "HESPERIDIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae4b6308-ab60-49d1-ad6a-41e04a262c16",
            "68ba366e-012e-4670-a81f-95542560c3d1"
          ],
          "display_name": false
        },
        {
          "uuid": "eda9edc2-b0e3-4e3e-18f4-ff58b3ee9517",
          "name": "HESPERIDIN [USP-RS]",
          "stdName": "HESPERIDIN [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cabaef24-0f50-4646-f27e-08ea912f772e"
          ],
          "display_name": false
        },
        {
          "uuid": "50e57c72-9a06-4d12-9dcb-c3a14bbb8a5c",
          "name": "HESPERIDIN [VANDF]",
          "stdName": "HESPERIDIN [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68ba366e-012e-4670-a81f-95542560c3d1",
            "0cedbc66-c150-46fb-88a0-ed956f88f089"
          ],
          "display_name": false
        },
        {
          "uuid": "6e7606b7-5e2a-4a66-bbc0-e1b3c0b10d1d",
          "name": "HESPERIDOSIDE",
          "stdName": "HESPERIDOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68ba366e-012e-4670-a81f-95542560c3d1",
            "907a7ae4-e592-4974-aa64-0f0eb7204100"
          ],
          "display_name": false
        },
        {
          "uuid": "8a2c3ee6-042e-a208-93e9-f6718c935e5e",
          "name": "Hesperidin [WHO-DD]",
          "stdName": "HESPERIDIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "675bf296-ba3a-aa56-c460-0e7e4b1a3f28"
          ],
          "display_name": false
        },
        {
          "uuid": "64bad65a-bd98-4e75-b1fc-0cb684e7a1ac",
          "name": "NDI 590 [FDMS]",
          "stdName": "NDI 590 [FDMS]",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a43e7d1-b3c1-4231-b0f6-7e86a2c2e876"
          ],
          "display_name": false
        },
        {
          "uuid": "7791badc-0636-4e23-9f4d-e55c1db8ba4c",
          "name": "NSC-44184",
          "stdName": "NSC-44184",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c948c8a1-b730-41ec-9385-8d262b0fd33f",
            "907a7ae4-e592-4974-aa64-0f0eb7204100"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "907a7ae4-e592-4974-aa64-0f0eb7204100",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c948c8a1-b730-41ec-9385-8d262b0fd33f",
          "citation": "STN 2008",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fbd1b83f-4e44-4492-9f2e-4f756a7c0e1a",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1320faa3-04b7-4629-bce6-38de94a62621",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68ba366e-012e-4670-a81f-95542560c3d1",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d4f01fa-9944-43f1-a84d-49e278186db4",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4474b561-f0e9-40f5-a07f-a2b700d56dc2",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae4b6308-ab60-49d1-ad6a-41e04a262c16",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "665615c7-3d79-472f-9243-117d97910611",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a43e7d1-b3c1-4231-b0f6-7e86a2c2e876",
          "citation": "FDMS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15673ef2-61a5-425d-a039-6625f829bd4c",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0cedbc66-c150-46fb-88a0-ed956f88f089",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c29f73d-45d3-4d23-9952-039bc17b89e3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390553000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0097d459-41d3-4f04-a844-270076559fd8",
          "citation": "SRS import [E750O06Y6O]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=E750O06Y6O",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390553000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "362887c7-b5b9-47c4-9848-76e0c1338b4f",
          "citation": "HESPERIDIN [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "31f908fc-83eb-4b2a-bb6e-e35c9913c496",
          "citation": "HESPERIDIN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dc387cd3-b7c0-449b-86db-a25d2ee24e07",
          "citation": "HESPERIDIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9022a273-5571-44a0-9e32-dc6d5f70f568",
          "citation": "HESPERIDIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "be900d36-6019-45a8-ba35-0dd5255db604",
          "citation": "HESPERIDIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1ea2bacf-ccf0-42e9-9e56-ec629c8995ce",
          "citation": "HESPERIDIN [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dc7f1f83-a846-7c38-b7be-15497b41697d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=520-26-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5f7ad800-0f86-bb32-975e-0a6cb8c9c7e9",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "cabaef24-0f50-4646-f27e-08ea912f772e",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "846da697-c85b-4e34-9c9a-008b4f32ed86",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3424253d-439d-39b0-f140-d104eb96b030",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "38c02c41-0a58-4dd8-506d-07eb2d799272",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "675bf296-ba3a-aa56-c460-0e7e4b1a3f28",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "1e0f0fc6-bce8-3efe-079f-8e3fbb53a6c9",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5a57ee79-aa24-4e7f-a64c-327c489b6b15",
          "id": "5a57ee79-aa24-4e7f-a64c-327c489b6b15",
          "molfile": "\n  Marvin  01132104412D          \n\n 43 47  0  0  1  0            999 V2000\n   -4.5102  -17.9081    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   -4.9218  -17.1972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6872  -17.9081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2674  -18.6189    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   -2.4401  -18.6189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9685  -18.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5612  -19.3339    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    0.2619  -19.3339    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6734  -20.0531    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    1.5007  -20.0573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2115  -20.4771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2115  -21.3001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9224  -21.7117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9224  -22.5348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6332  -21.2919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3523  -21.7117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3440  -22.5348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0673  -21.3001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0673  -20.4688    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.3523  -20.0573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6415  -20.4688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9224  -20.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7782  -20.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7657  -19.2342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4641  -18.8184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1874  -19.2217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8982  -18.8060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6090  -19.2175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1998  -20.0448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9107  -20.4563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4890  -20.4563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2536  -20.7681    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    0.6651  -21.4872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5695  -20.7639    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   -0.9852  -21.4789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9810  -20.0448    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   -1.8041  -20.0448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6789  -19.3339    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -3.2632  -20.0531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.5102  -19.3339    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -4.9218  -20.0573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.9218  -18.6231    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   -5.7449  -18.6231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 42  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n 38  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  1  0  0  0\n  7  8  1  0  0  0  0\n 36  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  1  0  0  0\n 32  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 22 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 21 15  2  0  0  0  0\n 17 16  2  0  0  0  0\n 18 16  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  6  0  0  0\n 19 23  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 24 23  1  0  0  0  0\n 31 23  2  0  0  0  0\n 25 24  2  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 29 26  2  0  0  0  0\n 28 27  1  0  0  0  0\n 30 29  1  0  0  0  0\n 29 31  1  0  0  0  0\n 32 33  1  6  0  0  0\n 34 32  1  0  0  0  0\n 34 35  1  1  0  0  0\n 36 34  1  0  0  0  0\n 36 37  1  6  0  0  0\n 38 39  1  6  0  0  0\n 40 38  1  0  0  0  0\n 40 41  1  6  0  0  0\n 42 40  1  0  0  0  0\n 42 43  1  1  0  0  0\nM  END",
          "smiles": "C[C@H]1[C@@H]([C@H]([C@H]([C@H](OC[C@@H]2[C@H]([C@@H]([C@H]([C@H](Oc3cc(c4C(=O)C[C@@H](c5ccc(c(c5)O)OC)Oc4c3)O)O2)O)O)O)O1)O)O)O",
          "formula": "C28H34O15",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b50d6d95-54d4-40ed-8f54-0f0843870439"
          },
          "defined_stereo": 11,
          "ez_centers": 0,
          "molecular_weight": "610.5617",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 11
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "507c5427-c8fd-4863-a97c-f681a3a5614c",
      "version": "24",
      "structure": {
        "id": "ee5d7cff-ce75-4b15-8819-d6dc9590a109",
        "molfile": "\n  Marvin  01132112212D          \n\n 43 47  0  0  1  0            999 V2000\n    3.6332  -21.2919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6734  -20.0531    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.2536  -20.7681    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -3.6789  -19.3339    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.3523  -21.7117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6415  -20.4688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5695  -20.7639    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -4.5102  -19.3339    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -3.2674  -18.6189    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.2619  -19.3339    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3523  -20.0573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9810  -20.0448    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -3.6872  -17.9081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5612  -19.3339    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.9224  -21.7117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.9218  -18.6231    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.0673  -20.4688    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.0673  -21.3001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.5102  -17.9081    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.2115  -20.4771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9224  -20.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5007  -20.0573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2115  -21.3001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7782  -20.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4890  -20.4563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1998  -20.0448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4401  -18.6189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9685  -18.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3440  -22.5348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1874  -19.2217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7657  -19.2342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4641  -18.8184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6651  -21.4872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2632  -20.0531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.9218  -20.0573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9852  -21.4789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8041  -20.0448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9224  -22.5348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.7449  -18.6231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9107  -20.4563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8982  -18.8060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.9218  -17.1972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6090  -19.2175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2 22  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  9  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  3  1  0  0  0  0\n  8  4  1  0  0  0  0\n  9 27  1  1  0  0  0\n 10  2  1  0  0  0  0\n 11  6  1  0  0  0  0\n 12 14  1  0  0  0  0\n 13  9  1  0  0  0  0\n 14 10  1  0  0  0  0\n 15  1  2  0  0  0  0\n 16 19  1  0  0  0  0\n 17 11  1  0  0  0  0\n 18  5  1  0  0  0  0\n 19 13  1  0  0  0  0\n 20 23  2  0  0  0  0\n 21  6  2  0  0  0  0\n 22 20  1  0  0  0  0\n 23 15  1  0  0  0  0\n 17 24  1  6  0  0  0\n 25 24  2  0  0  0  0\n 26 25  1  0  0  0  0\n 27 28  1  0  0  0  0\n 14 28  1  1  0  0  0\n 29  5  2  0  0  0  0\n 30 32  1  0  0  0  0\n 31 24  1  0  0  0  0\n 32 31  2  0  0  0  0\n  3 33  1  6  0  0  0\n  4 34  1  6  0  0  0\n  8 35  1  6  0  0  0\n  7 36  1  1  0  0  0\n 12 37  1  6  0  0  0\n 38 15  1  0  0  0  0\n 16 39  1  1  0  0  0\n 40 26  1  0  0  0  0\n 41 30  1  0  0  0  0\n 19 42  1  6  0  0  0\n 43 41  1  0  0  0  0\n 21 20  1  0  0  0  0\n 18 17  1  0  0  0  0\n 26 30  2  0  0  0  0\n  7 12  1  0  0  0  0\n  8 16  1  0  0  0  0\nM  END",
        "smiles": "C[C@H]1[C@@H]([C@H]([C@H]([C@H](OC[C@@H]2[C@H]([C@@H]([C@H]([C@H](Oc3cc(c4C(=O)C[C@@H](c5ccc(c(c5)O)OC)Oc4c3)O)O2)O)O)O)O1)O)O)O",
        "formula": "C28H34O15",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 11,
        "ez_centers": 0,
        "molecular_weight": "610.5617",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "fbd1b83f-4e44-4492-9f2e-4f756a7c0e1a",
          "0097d459-41d3-4f04-a844-270076559fd8"
        ],
        "stereo_centers": 11
      },
      "unii": "E750O06Y6O"
    }
  ]
}