{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "5ce8be3b-30fd-4e74-9a76-a5bd45ebbf84", "code": "64577-63-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=64577-63-5", "code_system": "CAS", "references": [ "77c088bb-770d-4024-ae97-1089e7ba6db4" ] }, { "uuid": "630aaf6b-f42f-64a2-3606-7eafc711eea4", "code": "40785040", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/40785040", "code_system": "PUBCHEM", "references": [ "b675262b-2521-4445-4b64-de7422265d48" ] }, { "uuid": "9a694fd6-55a3-4cd1-b384-050163fb59c3", "code": "E6WT9V3SGO", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "0642297d-f9bf-a97e-1b5d-d0d6a2c63cb9", "code": "E6WT9V3SGO", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(E6WT9V3SGO)", "code_system": "DAILYMED", "references": [ "a5ff382b-b774-3105-a004-fa44e2300a87" ] } ], "relationships": [ { "uuid": "6806e769-11b5-4f8a-91d1-30d5e938a325", "type": "SUBSTANCE->SUB_ALTERNATE", "related_substance": { "uuid": "acd8cd0e-8d39-4d8d-8d77-7f0a0ceb022f", "refuuid": "bda527de-79ec-41d1-a446-acc8b22e4bb3", "name": "ALTERNATIVE DEFINITION for [TRIFLUOROACETYL TRIPEPTIDE-2]", "linking_id": "bda527de-79ec-41d1-a446-acc8b22e4bb3", "ref_pname": "NO NAME" } } ], "substance_class": "chemical", "names": [ { "uuid": "f6b602c7-76d7-45c2-ba69-acc4549d9de9", "name": "ECM-PROTECT", "stdName": "ECM-PROTECT", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "3fe63ca4-8df3-4679-ab0e-0cc6bc4cdb01" ], "display_name": false }, { "uuid": "e39e2e88-e446-4137-ae5c-51a40901cca1", "name": "IP 2000", "stdName": "IP 2000", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "3fe63ca4-8df3-4679-ab0e-0cc6bc4cdb01" ], "display_name": false }, { "uuid": "54d3009a-69cd-4125-8166-2b2627bbab56", "name": "L-VALINE, N-(2,2,2-TRIFLUOROACETYL)-L-VALYL-L-TYROSYL-", "stdName": "L-VALINE, N-(2,2,2-TRIFLUOROACETYL)-L-VALYL-L-TYROSYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "77c088bb-770d-4024-ae97-1089e7ba6db4" ], "display_name": false }, { "uuid": "2f8f39e0-8c42-434d-a050-1403284ae7a6", "name": "L-VALINE, N-(N-(N-(TRIFLUOROACETYL)-L-VALYL)-L-TYROSYL)-", "stdName": "L-VALINE, N-(N-(N-(TRIFLUOROACETYL)-L-VALYL)-L-TYROSYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "77c088bb-770d-4024-ae97-1089e7ba6db4" ], "display_name": false }, { "uuid": "edb6a360-8711-471d-82f3-a216c8badd62", "name": "L-VALINE, N-(TRIFLUOROACETYL)-L-VALYL-L-TYROSYL-", "stdName": "L-VALINE, N-(TRIFLUOROACETYL)-L-VALYL-L-TYROSYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "77c088bb-770d-4024-ae97-1089e7ba6db4" ], "display_name": false }, { "uuid": "54112060-a133-4244-887d-5c0928a5d684", "name": "N-(2,2,2-TRIFLUOROACETYL)-L-VALYL-L-TYROSYL-L-VALINE", "stdName": "N-(2,2,2-TRIFLUOROACETYL)-L-VALYL-L-TYROSYL-L-VALINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "77c088bb-770d-4024-ae97-1089e7ba6db4" ], "display_name": false }, { "uuid": "23da8dca-5b4a-47a9-a41b-fd082af31542", "name": "TRIFLUOROACETYL TRIPEPTIDE-2", "stdName": "TRIFLUOROACETYL TRIPEPTIDE-2", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "3fe63ca4-8df3-4679-ab0e-0cc6bc4cdb01" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "637ac749-4b35-4d00-bca9-db9d982d5136", "name_org": "INCI" } ] } ], "references": [ { "uuid": "b675262b-2521-4445-4b64-de7422265d48", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "77c088bb-770d-4024-ae97-1089e7ba6db4", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "3fe63ca4-8df3-4679-ab0e-0cc6bc4cdb01", "citation": "PCPC", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "a5ff382b-b774-3105-a004-fa44e2300a87", "citation": "DAILYMED", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "2814b336-2695-443e-939e-a4458c759bd9", "id": "2814b336-2695-443e-939e-a4458c759bd9", "molfile": "\n Marvin 01132102122D \n\n 33 33 0 0 0 0 999 V2000\n 8.1617 -3.8886 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.5175 -3.3732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1617 -4.9258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7995 -3.3732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8797 -3.8886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7995 -5.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4373 -3.8886 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7995 -2.3296 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2355 -3.3732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8797 -4.9258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7995 -6.4655 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.4437 -4.9065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0815 -3.3732 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.5913 -3.8886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2355 -5.4412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4437 -6.9809 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1682 -6.9809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7257 -3.8886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0815 -2.3296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5913 -4.9258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0879 -6.4655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5239 -6.4655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1682 -8.0245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3635 -3.3732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7257 -4.9258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7257 -1.8142 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4373 -1.8142 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9471 -5.4412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7321 -6.9680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0879 -5.4283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3764 -6.4526 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1187 -7.8570 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3778 -7.8763 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 1 0 0 0\n 1 4 1 0 0 0 0\n 2 5 1 0 0 0 0\n 3 6 1 0 0 0 0\n 4 7 1 0 0 0 0\n 4 8 2 0 0 0 0\n 5 9 2 0 0 0 0\n 5 10 1 0 0 0 0\n 6 12 2 0 0 0 0\n 11 6 1 1 0 0 0\n 7 13 1 0 0 0 0\n 9 14 1 0 0 0 0\n 10 15 2 0 0 0 0\n 11 16 1 0 0 0 0\n 11 17 1 0 0 0 0\n 13 18 1 0 0 0 0\n 13 19 1 6 0 0 0\n 14 20 2 0 0 0 0\n 15 20 1 0 0 0 0\n 16 21 1 0 0 0 0\n 17 22 1 0 0 0 0\n 17 23 1 0 0 0 0\n 18 24 1 0 0 0 0\n 18 25 1 0 0 0 0\n 19 26 1 0 0 0 0\n 19 27 2 0 0 0 0\n 20 28 1 0 0 0 0\n 21 29 1 0 0 0 0\n 21 30 2 0 0 0 0\n 29 31 1 0 0 0 0\n 29 32 1 0 0 0 0\n 29 33 1 0 0 0 0\nM END", "smiles": "CC(C)[C@@H](C(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)N[C@@H](C(C)C)C(=O)O)NC(=O)C(F)(F)F", "formula": "C21H28F3N3O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "8393b03c-b235-4ca2-9b28-de62b302d23a" }, "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "475.4595", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "020767ae-bee0-4e44-a877-a73ee795ef46", "version": "11", "structure": { "id": "1439e5e3-968f-4df6-beb4-e5bbe65b57f9", "molfile": "L-Valine, N-(2,2,2-trifluoroacetyl)-L-valyl-L-tyrosyl-\n Marvin 01132101152D \n\n 33 33 0 0 1 0 999 V2000\n 13.3099 -3.2450 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.5955 -2.8324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8811 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1665 -2.8324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4521 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4521 -4.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1665 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8811 -4.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7376 -4.4824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3099 -4.0700 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0245 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7389 -4.0700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0245 -5.3074 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.7389 -5.7200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4534 -5.3074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1679 -5.7200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8824 -5.3074 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8824 -6.1324 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1679 -6.5450 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4534 -4.4824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3099 -5.7200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5955 -5.3074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3099 -6.5450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0245 -2.8324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7389 -3.2450 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4534 -2.8324 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.1679 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8823 -2.8324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1679 -4.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4534 -2.0074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1679 -1.5950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7389 -1.5950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0245 -2.0074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 2 0 0 0 0\n 3 8 1 0 0 0 0\n 6 9 1 0 0 0 0\n 1 10 1 1 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 13 11 1 1 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 16 19 1 0 0 0 0\n 15 20 2 0 0 0 0\n 13 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 1 0 0 0 0\n 1 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 1 0 0 0 0\n 26 30 1 6 0 0 0\n 30 31 1 0 0 0 0\n 30 32 2 0 0 0 0\n 24 33 2 0 0 0 0\nM END", "smiles": "CC(C)[C@@H](C(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)N[C@@H](C(C)C)C(=O)O)NC(=O)C(F)(F)F", "formula": "C21H28F3N3O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "475.4595", "optical_activity": "UNSPECIFIED", "references": [ "77c088bb-770d-4024-ae97-1089e7ba6db4" ], "stereo_centers": 3 }, "unii": "E6WT9V3SGO" } ] }