{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "67edfb30-5db6-49c7-81bc-2dc0ee2b2ada",
          "code": "576-68-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=576-68-1",
          "code_system": "CAS",
          "references": [
            "8f25bc0c-cac4-482f-805d-74682bf6fe4a",
            "8824393c-ff1c-46ed-8696-a32bae2e75c2"
          ]
        },
        {
          "uuid": "6827a8db-4f88-45a3-be06-ef8a25c505b8",
          "code": "C2070",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2070",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8f25bc0c-cac4-482f-805d-74682bf6fe4a"
          ]
        },
        {
          "uuid": "f3fc2cda-24f8-4ce1-8fb6-b8a9c9e23197",
          "code": "D008357",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68008357",
          "code_system": "MESH",
          "references": [
            "8f25bc0c-cac4-482f-805d-74682bf6fe4a"
          ]
        },
        {
          "uuid": "84ee69b4-81f5-4fc2-abf5-a2d41b439c7c",
          "code": "SUB08643MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "8f25bc0c-cac4-482f-805d-74682bf6fe4a"
          ]
        },
        {
          "uuid": "0b1b3998-64b7-40ef-8c1a-b4b3312a8494",
          "code": "759",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=759",
          "code_system": "INN",
          "references": [
            "8f25bc0c-cac4-482f-805d-74682bf6fe4a"
          ]
        },
        {
          "uuid": "57a4cb26-2285-4f8b-b354-2d9bc8ea5f79",
          "code": "CHEMBL1908338",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1908338",
          "code_system": "ChEMBL",
          "references": [
            "8f25bc0c-cac4-482f-805d-74682bf6fe4a"
          ]
        },
        {
          "uuid": "e6ac0d2d-4f9b-4358-9d90-443e76fb9401",
          "code": "209-404-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.551",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8f25bc0c-cac4-482f-805d-74682bf6fe4a"
          ]
        },
        {
          "uuid": "a8b015bd-5a51-4ac0-8398-0713eb349993",
          "code": "3033867",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3033867",
          "code_system": "PUBCHEM",
          "references": [
            "8f25bc0c-cac4-482f-805d-74682bf6fe4a"
          ]
        },
        {
          "uuid": "b5eabdea-0c48-9362-9f15-d1c7cc57bfdb",
          "code": "DTXSID9020798",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9020798",
          "code_system": "EPA CompTox",
          "references": [
            "1ddc22bb-1b58-80d5-1b5e-d1637dad1366"
          ]
        },
        {
          "uuid": "e256ea0a-42aa-6efb-dd95-3aa41373b91b",
          "code": "C697",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Antineoplastic Alkylating Agent[C1590]|Mustard Agent[C2114]|Nitrogen Mustard Compound",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C697",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a88a33cc-5e78-99a3-9256-a447afaeb2d6"
          ]
        },
        {
          "uuid": "3c1fa1bf-d0ad-4f64-8888-6781d2904701",
          "code": "E60VWA40D2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0ee1d678-195b-75ac-8186-aca7321c6eb6",
          "code": "1633",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1633",
          "code_system": "DRUG CENTRAL",
          "references": [
            "a88a33cc-5e78-99a3-9256-a447afaeb2d6"
          ]
        },
        {
          "uuid": "5e3eba55-c573-7d45-a8ac-13831c0550e0",
          "code": "Mannomustine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Mannomustine",
          "code_system": "WIKIPEDIA",
          "references": [
            "25969b24-34e7-5be3-6bbe-eefa33227bd1"
          ]
        },
        {
          "uuid": "eebce627-552f-7350-8bd3-46d67cf90bc1",
          "code": "100000081741",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "206bdc42-3fd9-36cf-c1f5-068e12af71d4"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "aed536e9-304c-45a1-851c-93c6ad4d2a22",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "9a5dc4cf-4885-46f7-8261-a095e4af0e45",
            "refuuid": "e99d9cdd-9b76-4784-95f4-b3f7ed1cfab6",
            "name": "MANNOMUSTINE",
            "unii": "E60VWA40D2",
            "linking_id": "E60VWA40D2",
            "ref_pname": "MANNOMUSTINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "53150acc-020a-488d-bc47-36b4ec0271cd",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "a0f38b8b-1895-4814-b559-be9fa78e1053",
            "refuuid": "6b302ec6-83c3-4735-a5ed-79c01d5a6c25",
            "name": "MANNOMUSTINE HYDROCHLORIDE",
            "unii": "UOZ2JJZ3I5",
            "linking_id": "UOZ2JJZ3I5",
            "ref_pname": "MANNOMUSTINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "02d25b01-d932-415e-9908-993458832c70",
          "name": "1,6-BIS((2-CHLOROETHYL)AMINO)-1,6-DIDEOXY-D-MANNITOL",
          "stdName": "1,6-BIS((2-CHLOROETHYL)AMINO)-1,6-DIDEOXY-D-MANNITOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "584b3342-7243-44d9-9e89-6a69c24bd60f"
          ],
          "display_name": false
        },
        {
          "uuid": "753ad3b7-baa8-40a6-8fea-fc8ec5097cb6",
          "name": "BCM",
          "stdName": "BCM",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "69ed5abc-3ed7-42ae-b047-daac25b13932"
          ],
          "display_name": false
        },
        {
          "uuid": "704fa6e5-d544-4f09-8b0c-17e05869243d",
          "name": "MANNOMUSTINE",
          "stdName": "MANNOMUSTINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f91aba1-29ff-402c-8121-0270d4ebc2f2",
            "5f03d590-fc17-4737-9250-0a8fcaa74f0e",
            "584b3342-7243-44d9-9e89-6a69c24bd60f"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "ff7f972c-289d-43cc-abd1-b55fe27c71cd",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "1a9e2ce5-b416-45d8-88c3-119160ac6c2b",
          "name": "NSC-9698 FREE BASE",
          "stdName": "NSC-9698 FREE BASE",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "69ed5abc-3ed7-42ae-b047-daac25b13932"
          ],
          "display_name": false
        },
        {
          "uuid": "d18c6afb-2c66-453a-aa72-bbc270887919",
          "name": "mannomustine [INN]",
          "stdName": "MANNOMUSTINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f91aba1-29ff-402c-8121-0270d4ebc2f2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "584b3342-7243-44d9-9e89-6a69c24bd60f",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7f91aba1-29ff-402c-8121-0270d4ebc2f2",
          "citation": "INN Proposed List 8",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL08.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "69ed5abc-3ed7-42ae-b047-daac25b13932",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f25bc0c-cac4-482f-805d-74682bf6fe4a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390763000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "228c3ce8-d2e1-4bab-b9aa-746f96e1b7e1",
          "citation": "SRS import [E60VWA40D2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=E60VWA40D2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390763000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4b0f328-b6fd-4de6-b13e-dcf2d0b99d9b",
          "citation": "STN 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5f03d590-fc17-4737-9250-0a8fcaa74f0e",
          "citation": "MANNOMUSTINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1ddc22bb-1b58-80d5-1b5e-d1637dad1366",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=576-68-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a88a33cc-5e78-99a3-9256-a447afaeb2d6",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8824393c-ff1c-46ed-8696-a32bae2e75c2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "25969b24-34e7-5be3-6bbe-eefa33227bd1",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "206bdc42-3fd9-36cf-c1f5-068e12af71d4",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "20751b57-b627-4f02-b624-bfa1d86cfe26",
          "id": "20751b57-b627-4f02-b624-bfa1d86cfe26",
          "molfile": "\n  Marvin  01132101502D          \n\n 18 17  0  0  1  0            999 V2000\n    1.9373    0.8267    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    1.9332    1.6534    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2233    0.4134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5094    0.8225    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2046    0.4091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9186    0.8184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6326    0.4050    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.6513    0.4176    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.6472   -0.4091    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3653    0.8309    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.3612    1.6576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0792    0.4217    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.0751   -0.4050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7932    0.8350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5072    0.4259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2212    0.8392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9351    0.4301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6491    0.8434    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  8  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  1  6  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  6  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  1  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "C(CNC[C@H]([C@H]([C@@H]([C@@H](CNCCCl)O)O)O)O)Cl",
          "formula": "C10H22Cl2N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fca2a31f-23e6-4e4b-ae1f-c0b010f2ba5d"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "305.199",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e99d9cdd-9b76-4784-95f4-b3f7ed1cfab6",
      "version": "8",
      "structure": {
        "id": "957bc5fa-19db-4787-b0ae-9c5893da992f",
        "molfile": "\n  Marvin  01132107462D          \n\n 18 17  0  0  1  0            999 V2000\n   -1.6326    0.4050    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9186    0.8184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2046    0.4091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5094    0.8225    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2233    0.4134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9373    0.8267    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.6513    0.4176    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.3653    0.8309    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.0792    0.4217    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.7932    0.8350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5072    0.4259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2212    0.8392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9351    0.4301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6491    0.8434    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.9332    1.6534    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6472   -0.4091    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3612    1.6576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0751   -0.4050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  4  5  1  0  0  0  0\n  9 10  1  0  0  0  0\n  2  3  1  0  0  0  0\n 10 11  1  0  0  0  0\n  5  6  1  0  0  0  0\n 11 12  1  0  0  0  0\n  1  2  1  0  0  0  0\n 12 13  1  0  0  0  0\n  6  7  1  0  0  0  0\n 13 14  1  0  0  0  0\n  3  4  1  0  0  0  0\n  6 15  1  1  0  0  0\n  7  8  1  0  0  0  0\n  7 16  1  6  0  0  0\n  8 17  1  6  0  0  0\n  8  9  1  0  0  0  0\n  9 18  1  1  0  0  0\nM  END",
        "smiles": "C(CNC[C@H]([C@H]([C@@H]([C@@H](CNCCCl)O)O)O)O)Cl",
        "formula": "C10H22Cl2N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "305.199",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "228c3ce8-d2e1-4bab-b9aa-746f96e1b7e1",
          "d4b0f328-b6fd-4de6-b13e-dcf2d0b99d9b",
          "7f91aba1-29ff-402c-8121-0270d4ebc2f2"
        ],
        "stereo_centers": 4
      },
      "unii": "E60VWA40D2"
    }
  ]
}