{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "af03bd0c-cf5c-4ad0-84fe-09e628c0549a",
          "code": "34014-18-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=34014-18-1",
          "code_system": "CAS",
          "references": [
            "a95be15f-999f-4052-bcbe-6969e4e4f9bb",
            "65521b18-f898-4240-9d51-838325121bb1"
          ]
        },
        {
          "uuid": "c4d86fac-0d97-449b-b60b-b292dab9493f",
          "code": "C010346",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67010346",
          "code_system": "MESH",
          "references": [
            "a95be15f-999f-4052-bcbe-6969e4e4f9bb"
          ]
        },
        {
          "uuid": "1ce06b68-c26e-4d75-b833-c837e97289dd",
          "code": "TEBUTHIURON",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Tebuthiuron",
          "code_system": "WIKIPEDIA",
          "references": [
            "a95be15f-999f-4052-bcbe-6969e4e4f9bb"
          ]
        },
        {
          "uuid": "81c1b58f-b226-4d75-89c5-cfe83850c85b",
          "code": "105501",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3986",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "a95be15f-999f-4052-bcbe-6969e4e4f9bb"
          ]
        },
        {
          "uuid": "4535e1a9-82ea-4799-9e41-2852db91ab2f",
          "code": "m10502",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10502?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a95be15f-999f-4052-bcbe-6969e4e4f9bb"
          ]
        },
        {
          "uuid": "94cf81cd-b31a-46d7-9b56-a145aa6ebd30",
          "code": "5383",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5383",
          "code_system": "PUBCHEM",
          "references": [
            "a95be15f-999f-4052-bcbe-6969e4e4f9bb"
          ]
        },
        {
          "uuid": "428adf76-0794-4e2a-9b9c-b133b52fb95e",
          "code": "251-793-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.047.070",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a95be15f-999f-4052-bcbe-6969e4e4f9bb"
          ]
        },
        {
          "uuid": "379c6eab-8060-d329-22c2-74a9e7b0c1d1",
          "code": "6863",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6863",
          "code_system": "HSDB",
          "references": [
            "3cf3506e-3848-6b27-5b1b-74fa637b1ed5"
          ]
        },
        {
          "uuid": "357599a1-e8d8-6cd6-350c-e46002c3ce2a",
          "code": "DTXSID3024316",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3024316",
          "code_system": "EPA CompTox",
          "references": [
            "3f4f7442-e752-bfe6-a517-7b774234f655"
          ]
        },
        {
          "uuid": "1f7dc3d3-a325-4875-8a89-f3d80307c54a",
          "code": "E5OX6GM11E",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "688afe5a-a7f0-36c1-d4f3-d127c71162bb",
          "code": "tebuthiuron",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/tebuthiuron.html",
          "code_system": "ALANWOOD",
          "references": [
            "59445eb4-4428-d153-fb86-2f6c6ecca83c"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2bb91137-a1cd-4371-b03c-c7c18f05b756",
          "name": "1-(5-TERT-BUTYL-1,3,4-THIADIAZOL-2-YL)-1,3-DIMETHYLUREA",
          "stdName": "1-(5-TERT-BUTYL-1,3,4-THIADIAZOL-2-YL)-1,3-DIMETHYLUREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "753960fc-0434-4755-a273-3ea6ae5034f8",
            "1f82c736-1bc1-44f3-b852-b58066c5c2c6"
          ],
          "display_name": false
        },
        {
          "uuid": "0e389d7f-cf8b-436e-b3af-8e5ed7fd2ce6",
          "name": "EL-103",
          "stdName": "EL-103",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "586ec288-0f13-4290-a967-946eb2e792dd",
            "e637e2b4-0414-487c-8d0f-c475cdc52144"
          ],
          "display_name": false
        },
        {
          "uuid": "d57e82f2-20c3-4a89-b4ca-5a3c20e1b71f",
          "name": "GRASLAN",
          "stdName": "GRASLAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "586ec288-0f13-4290-a967-946eb2e792dd",
            "e637e2b4-0414-487c-8d0f-c475cdc52144"
          ],
          "display_name": false
        },
        {
          "uuid": "242df231-d90e-4340-bf5f-733d509cd446",
          "name": "N-(5-(1,1-DIMETHYLETHYL)-1,3,4-THIADIAZOL-2-YL)-N,N'-DIMETHYLUREA",
          "stdName": "N-(5-(1,1-DIMETHYLETHYL)-1,3,4-THIADIAZOL-2-YL)-N,N'-DIMETHYLUREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "824f8948-30c1-44fe-85f2-636a334a0c30",
            "1f82c736-1bc1-44f3-b852-b58066c5c2c6"
          ],
          "display_name": false
        },
        {
          "uuid": "f62c9103-b4e9-4ca9-974f-6747bfc5c42a",
          "name": "PERFLAN",
          "stdName": "PERFLAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "586ec288-0f13-4290-a967-946eb2e792dd",
            "e637e2b4-0414-487c-8d0f-c475cdc52144"
          ],
          "display_name": false
        },
        {
          "uuid": "bff876e0-4c8c-4127-ad44-8851f65c5fab",
          "name": "SPIKE",
          "stdName": "SPIKE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "586ec288-0f13-4290-a967-946eb2e792dd",
            "e637e2b4-0414-487c-8d0f-c475cdc52144"
          ],
          "display_name": false
        },
        {
          "uuid": "fed60e83-3c9a-449a-b33d-fddc394b666e",
          "name": "TEBUTHIURON",
          "stdName": "TEBUTHIURON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c60ef1ee-20a4-45da-9412-657162571971",
            "586ec288-0f13-4290-a967-946eb2e792dd",
            "2b1f2fd3-a104-4439-b666-8b1283ebe89c",
            "df7d59a6-d640-4073-8416-962a2f105736",
            "4166301f-f1bb-4956-a3ce-8ac4b2251cb1",
            "8d532de9-f7ce-4c32-b695-9b28b0ffbf3d",
            "371f2f41-7785-4e8f-aba9-ab7e0c23a8eb",
            "fad76cd3-44f9-4b2d-9d85-62dccb07e4ba"
          ],
          "display_name": true
        },
        {
          "uuid": "c34087ff-7d17-48b9-b28b-ee9d0ae1d6a7",
          "name": "TEBUTHIURON [HSDB]",
          "stdName": "TEBUTHIURON [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "586ec288-0f13-4290-a967-946eb2e792dd",
            "4166301f-f1bb-4956-a3ce-8ac4b2251cb1"
          ],
          "display_name": false
        },
        {
          "uuid": "4f49224f-dbdc-4910-95fe-2fd304788fb4",
          "name": "TEBUTHIURON [ISO]",
          "stdName": "TEBUTHIURON [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "586ec288-0f13-4290-a967-946eb2e792dd",
            "df7d59a6-d640-4073-8416-962a2f105736"
          ],
          "display_name": false
        },
        {
          "uuid": "fcc54a7b-f1af-4514-96a5-5c2fd506698e",
          "name": "TEBUTHIURON [MI]",
          "stdName": "TEBUTHIURON [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "586ec288-0f13-4290-a967-946eb2e792dd",
            "371f2f41-7785-4e8f-aba9-ab7e0c23a8eb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c60ef1ee-20a4-45da-9412-657162571971",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1f82c736-1bc1-44f3-b852-b58066c5c2c6",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "753960fc-0434-4755-a273-3ea6ae5034f8",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "824f8948-30c1-44fe-85f2-636a334a0c30",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "371f2f41-7785-4e8f-aba9-ab7e0c23a8eb",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "586ec288-0f13-4290-a967-946eb2e792dd",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e637e2b4-0414-487c-8d0f-c475cdc52144",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4166301f-f1bb-4956-a3ce-8ac4b2251cb1",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "df7d59a6-d640-4073-8416-962a2f105736",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a95be15f-999f-4052-bcbe-6969e4e4f9bb",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390947000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "849b9d81-575e-4151-97d4-0081b720cf7f",
          "citation": "SRS import [E5OX6GM11E]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=E5OX6GM11E",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390947000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8df4ab9b-4b54-456b-bbb7-ec407551c583",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b1f2fd3-a104-4439-b666-8b1283ebe89c",
          "citation": "TEBUTHIURON [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fad76cd3-44f9-4b2d-9d85-62dccb07e4ba",
          "citation": "TEBUTHIURON [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8d532de9-f7ce-4c32-b695-9b28b0ffbf3d",
          "citation": "TEBUTHIURON [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3cf3506e-3848-6b27-5b1b-74fa637b1ed5",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+34014-18-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3f4f7442-e752-bfe6-a517-7b774234f655",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=34014-18-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "59445eb4-4428-d153-fb86-2f6c6ecca83c",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "65521b18-f898-4240-9d51-838325121bb1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b17d0c50-a342-42fd-874b-24544b65f148",
          "id": "b17d0c50-a342-42fd-874b-24544b65f148",
          "molfile": "\n  Marvin  01132109122D          \n\n 15 15  0  0  0  0            999 V2000\n    9.8789   -4.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1686   -4.5300    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4543   -4.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4543   -5.7642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7447   -4.5368    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7447   -3.7114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0341   -4.9494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7817   -5.7378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9490   -5.7378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6995   -4.9494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3692   -4.4665    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9112   -4.7008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9112   -3.8898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4131   -5.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1115   -4.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7 11  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)c1nnc(N(C)C(=O)NC)s1",
          "formula": "C9H16N4OS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "80f4995e-ee25-4ca8-b2b9-344826b2b78f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "228.316",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f5b3b8ea-8759-4fdf-98de-60d3897d12bf",
      "version": "6",
      "structure": {
        "id": "7c932ced-1cf0-46c8-9f12-4f96c3ca235a",
        "molfile": "\n  Marvin  01132106282D          \n\n 15 15  0  0  0  0            999 V2000\n    7.0341   -4.9494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3692   -4.4665    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6995   -4.9494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9112   -4.7008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9112   -3.8898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4131   -5.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1115   -4.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9490   -5.7378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7817   -5.7378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7447   -4.5368    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4543   -4.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1686   -4.5300    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8789   -4.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4543   -5.7642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7447   -3.7114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  3  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n  1  9  2  0  0  0  0\n  1 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 11 14  2  0  0  0  0\n 10 15  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)c1nnc(N(C)C(=O)NC)s1",
        "formula": "C9H16N4OS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "228.316",
        "optical_activity": "NONE",
        "references": [
          "8df4ab9b-4b54-456b-bbb7-ec407551c583",
          "849b9d81-575e-4151-97d4-0081b720cf7f"
        ],
        "stereo_centers": 0
      },
      "unii": "E5OX6GM11E"
    }
  ]
}