{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e22c4a30-9a3c-40aa-a282-60d26df76ab0",
          "code": "A10BB06",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|DRUGS USED IN DIABETES|BLOOD GLUCOSE LOWERING DRUGS, EXCL. INSULINS|Sulfonamides, urea derivatives|carbutamide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A10BB06&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "c7150b49-7b90-49bb-832d-3b1400feb111"
          ]
        },
        {
          "uuid": "2f598fa5-a7ca-4107-87ea-4737a67a534a",
          "code": "QA10BB06",
          "comments": "VATC|DRUGS USED IN DIABETES|BLOOD GLUCOSE LOWERING DRUGS, EXCL. INSULINS|Sulfonamides, urea derivatives|carbutamide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA10BB06&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "c7150b49-7b90-49bb-832d-3b1400feb111"
          ]
        },
        {
          "uuid": "5740f939-f09d-4188-b454-54fe9bb9487b",
          "code": "339-43-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=339-43-5",
          "code_system": "CAS",
          "references": [
            "c7150b49-7b90-49bb-832d-3b1400feb111",
            "b2f5650a-f8be-44ba-9f6c-035295a10aaa"
          ]
        },
        {
          "uuid": "f03a2d25-bcf9-4b84-a41c-cfcd1824ef65",
          "code": "C83597",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C83597",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c7150b49-7b90-49bb-832d-3b1400feb111"
          ]
        },
        {
          "uuid": "a1b3003a-fea3-4f90-9d2b-f2aeb339ef18",
          "code": "D002271",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68002271",
          "code_system": "MESH",
          "references": [
            "c7150b49-7b90-49bb-832d-3b1400feb111"
          ]
        },
        {
          "uuid": "e0a7b6ce-78ad-4a16-9661-920de2ec09e9",
          "code": "CARBUTAMIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Carbutamide",
          "code_system": "WIKIPEDIA",
          "references": [
            "c7150b49-7b90-49bb-832d-3b1400feb111"
          ]
        },
        {
          "uuid": "f1ae3976-3ee1-4731-b4de-3d260bd6c417",
          "code": "SUB06620MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "c7150b49-7b90-49bb-832d-3b1400feb111"
          ]
        },
        {
          "uuid": "a14e1131-e7c7-4e10-8601-5e3e0b20ee09",
          "code": "615",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=615",
          "code_system": "INN",
          "references": [
            "c7150b49-7b90-49bb-832d-3b1400feb111"
          ]
        },
        {
          "uuid": "e2c96bed-5b01-43f0-8596-79b88d16597f",
          "code": "2068",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2068/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "c7150b49-7b90-49bb-832d-3b1400feb111"
          ]
        },
        {
          "uuid": "de20cc87-3ac1-4cd4-924c-af36d0a1f33d",
          "code": "m3101",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3101?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "c7150b49-7b90-49bb-832d-3b1400feb111"
          ]
        },
        {
          "uuid": "aeda01c7-fe77-4117-944d-1578ee240d26",
          "code": "CHEMBL448570",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL448570",
          "code_system": "ChEMBL",
          "references": [
            "c7150b49-7b90-49bb-832d-3b1400feb111"
          ]
        },
        {
          "uuid": "77c7a5db-3698-4c69-acf9-8294e8ee7d78",
          "code": "206-424-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.841",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c7150b49-7b90-49bb-832d-3b1400feb111"
          ]
        },
        {
          "uuid": "5f620cb8-265f-4d7b-8fd9-df7698c6f0b9",
          "code": "9564",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9564",
          "code_system": "PUBCHEM",
          "references": [
            "c7150b49-7b90-49bb-832d-3b1400feb111"
          ]
        },
        {
          "uuid": "6b8b5f64-ed31-762a-4484-e3960cdf6eba",
          "code": "5488",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5488",
          "code_system": "HSDB",
          "references": [
            "2d8a574c-b531-1ce7-9f2d-dc056f8101f8"
          ]
        },
        {
          "uuid": "e03f2d90-f25d-6b5a-dfba-6ec4fed10a19",
          "code": "DTXSID8022741",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8022741",
          "code_system": "EPA CompTox",
          "references": [
            "cbd32d26-6af9-2afe-1508-87223f3a744b"
          ]
        },
        {
          "uuid": "f7e168d5-ee04-11b0-a0c4-01dc04f59ff1",
          "code": "C97936",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Digestive System or Metabolism[C78276]|Anti-diabetic Agent[C29711]|Sulfonylurea Antidiabetic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C97936",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6984b601-bb96-5794-dbd9-7fea66ef7e5c"
          ]
        },
        {
          "uuid": "724205a7-0553-4b20-8faf-3eb1909d5f63",
          "code": "E3K8P4869P",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "aef5b8bf-3e38-ab08-b527-fc7a861a3313",
          "code": "505",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/505",
          "code_system": "DRUG CENTRAL",
          "references": [
            "6984b601-bb96-5794-dbd9-7fea66ef7e5c"
          ]
        },
        {
          "uuid": "d5577415-804e-97ff-27d2-da0c0fe9b353",
          "code": "DB13406",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB13406",
          "code_system": "DRUG BANK",
          "references": [
            "6984b601-bb96-5794-dbd9-7fea66ef7e5c"
          ]
        },
        {
          "uuid": "705fe546-0885-56f8-f5df-aa3924c27a9d",
          "code": "100000084589",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "de5abf3b-b9d6-66c2-462f-62d0bb0ad83d"
          ]
        },
        {
          "uuid": "3d55a6ca-f7df-9343-bbc0-993705e4ade4",
          "code": "242409",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=242409",
          "code_system": "NSC",
          "references": [
            "8b64ff8f-6e95-7439-963e-4790826f0198"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "18f65fa1-a411-4276-8071-bc39708da4b7",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "8d1722a3-de94-48f5-99fd-5ec7f6006427",
            "refuuid": "71533c21-e884-4025-ac7a-7372c1af88bf",
            "name": "CARBUTAMIDE",
            "unii": "E3K8P4869P",
            "linking_id": "E3K8P4869P",
            "ref_pname": "CARBUTAMIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1b6687b6-c08e-4c39-afd3-ab99332428e7",
          "name": "1-BUTYL-3-SULFANILYL-UREA",
          "stdName": "1-BUTYL-3-SULFANILYL-UREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60a7f521-face-4774-a596-6460743c5db9"
          ],
          "display_name": false
        },
        {
          "uuid": "3d05bd03-fd30-4dfd-ad9d-f9ec2012c4f4",
          "name": "BZ 55",
          "stdName": "BZ 55",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60a7f521-face-4774-a596-6460743c5db9"
          ],
          "display_name": false
        },
        {
          "uuid": "deb2b970-2ffd-4f25-9a7d-eb8a394e0ad6",
          "name": "BZ-55",
          "stdName": "BZ-55",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41031559-a19d-4675-9953-9193a6857147"
          ],
          "display_name": false
        },
        {
          "uuid": "49ad3543-893f-4584-8a31-57abdc2803b4",
          "name": "CA 1022",
          "stdName": "CA 1022",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60a7f521-face-4774-a596-6460743c5db9"
          ],
          "display_name": false
        },
        {
          "uuid": "6b41bbaf-3443-4925-af11-c853f512a311",
          "name": "CARBUTAMIDE",
          "stdName": "CARBUTAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27ab85dc-4966-4151-b851-76b72764baaa",
            "54c8a599-757b-4f44-af50-911e49f5d64f",
            "60a7f521-face-4774-a596-6460743c5db9",
            "5d113434-2fe8-4946-ba3f-a097b8daf702",
            "56767800-4506-49f0-9420-fbb1771a5d2f",
            "0482b235-1846-4403-b504-8361235bab0b",
            "f47d8d0f-54f7-4de8-8808-cd2ab176bb8a",
            "bfcef98e-7434-4d44-b6c7-8308cd94ccfc",
            "bf08cd29-2277-4173-8f8c-e4ece38e7108",
            "368d669f-78e5-4740-b737-853a23228a2b",
            "2d9ab83f-1132-4a9b-bef0-90334a79e407"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "068cbcc6-62e6-42f1-b63c-62ce0c8c50cc",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "30a51a2a-4087-49d4-ab33-6439b5b1e70d",
          "name": "CARBUTAMIDE [HSDB]",
          "stdName": "CARBUTAMIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0482b235-1846-4403-b504-8361235bab0b"
          ],
          "display_name": false
        },
        {
          "uuid": "72ed2691-0838-4a6b-a062-cf53e5301516",
          "name": "CARBUTAMIDE [MART.]",
          "stdName": "CARBUTAMIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56767800-4506-49f0-9420-fbb1771a5d2f"
          ],
          "display_name": false
        },
        {
          "uuid": "c28198a9-e53d-4a7e-891f-026a1ba2ffaa",
          "name": "CARBUTAMIDE [MI]",
          "stdName": "CARBUTAMIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bf08cd29-2277-4173-8f8c-e4ece38e7108"
          ],
          "display_name": false
        },
        {
          "uuid": "8bc5efb7-e635-5830-0831-5012a4eb6abc",
          "name": "Carbutamide [WHO-DD]",
          "stdName": "CARBUTAMIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6659d34c-a230-877b-d3f5-d9173a457148"
          ],
          "display_name": false
        },
        {
          "uuid": "b913c3d9-6b86-4e30-8011-6d525d7307ee",
          "name": "DIABORAL",
          "stdName": "DIABORAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aad79f63-2e56-42af-99a6-bc11e511fbff"
          ],
          "display_name": false
        },
        {
          "uuid": "28412f5f-f254-420e-95e0-8282618e1d7d",
          "name": "EMEDAN",
          "stdName": "EMEDAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aad79f63-2e56-42af-99a6-bc11e511fbff"
          ],
          "display_name": false
        },
        {
          "uuid": "f0943a5e-63ba-41e0-942d-0e3713ec7357",
          "name": "GLUCIDORAL",
          "stdName": "GLUCIDORAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bf1e41ea-a0e6-4f97-ab8d-eea7f086e02d"
          ],
          "display_name": false
        },
        {
          "uuid": "e30c9532-b622-43d4-a717-9d1ed7b1a45b",
          "name": "GLUCOFREN",
          "stdName": "GLUCOFREN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aad79f63-2e56-42af-99a6-bc11e511fbff"
          ],
          "display_name": false
        },
        {
          "uuid": "6d4956e2-d07d-4a90-b770-48c06d91c75d",
          "name": "GLYBUTAMIDE",
          "stdName": "GLYBUTAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e53e993-deb3-4957-9e22-36bbb46accb3"
          ],
          "display_name": false
        },
        {
          "uuid": "293ecf20-5e40-438b-922c-bd1e6380b164",
          "name": "INVENOL",
          "stdName": "INVENOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9a3f5694-1445-4465-a11b-7dd6d847e5b4",
            "747350f5-19f2-4e21-877d-d5af30174344"
          ],
          "display_name": false
        },
        {
          "uuid": "fbecedfc-d919-44ff-ae61-bc7f72e0fa42",
          "name": "NSC-242409",
          "stdName": "NSC-242409",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "52221bb9-b70c-4aa5-8ada-d3a33d8970ff"
          ],
          "display_name": false
        },
        {
          "uuid": "b8dc5014-34e3-442b-824a-76c84aab8166",
          "name": "U-6987",
          "stdName": "U-6987",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60a7f521-face-4774-a596-6460743c5db9"
          ],
          "display_name": false
        },
        {
          "uuid": "7662357f-0c04-43d3-8aa8-209f11074213",
          "name": "carbutamide [INN]",
          "stdName": "CARBUTAMIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "368d669f-78e5-4740-b737-853a23228a2b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "60a7f521-face-4774-a596-6460743c5db9",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "368d669f-78e5-4740-b737-853a23228a2b",
          "citation": "INN Proposed List 36",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL36.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "56767800-4506-49f0-9420-fbb1771a5d2f",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf08cd29-2277-4173-8f8c-e4ece38e7108",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a3f5694-1445-4465-a11b-7dd6d847e5b4",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "747350f5-19f2-4e21-877d-d5af30174344",
          "citation": "D02425",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0482b235-1846-4403-b504-8361235bab0b",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27ab85dc-4966-4151-b851-76b72764baaa",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "41031559-a19d-4675-9953-9193a6857147",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52221bb9-b70c-4aa5-8ada-d3a33d8970ff",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e53e993-deb3-4957-9e22-36bbb46accb3",
          "citation": "chembl",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aad79f63-2e56-42af-99a6-bc11e511fbff",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf1e41ea-a0e6-4f97-ab8d-eea7f086e02d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c7150b49-7b90-49bb-832d-3b1400feb111",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389687000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c834cb6-9bc9-436e-8894-197403f141c7",
          "citation": "SRS import [E3K8P4869P]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=E3K8P4869P",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389687000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f47d8d0f-54f7-4de8-8808-cd2ab176bb8a",
          "citation": "CARBUTAMIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5d113434-2fe8-4946-ba3f-a097b8daf702",
          "citation": "CARBUTAMIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "54c8a599-757b-4f44-af50-911e49f5d64f",
          "citation": "CARBUTAMIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bfcef98e-7434-4d44-b6c7-8308cd94ccfc",
          "citation": "CARBUTAMIDE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2d9ab83f-1132-4a9b-bef0-90334a79e407",
          "citation": "CARBUTAMIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2d8a574c-b531-1ce7-9f2d-dc056f8101f8",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+339-43-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cbd32d26-6af9-2afe-1508-87223f3a744b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=339-43-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6984b601-bb96-5794-dbd9-7fea66ef7e5c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b2f5650a-f8be-44ba-9f6c-035295a10aaa",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8b64ff8f-6e95-7439-963e-4790826f0198",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6659d34c-a230-877b-d3f5-d9173a457148",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "de5abf3b-b9d6-66c2-462f-62d0bb0ad83d",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "46ed5f59-c987-462c-a0d7-6bd6db44116f",
          "id": "46ed5f59-c987-462c-a0d7-6bd6db44116f",
          "molfile": "\n  Marvin  01132103432D          \n\n 18 18  0  0  0  0            999 V2000\n    4.2234   -2.6261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4971   -3.0319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7967   -2.6080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0704   -3.0035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3647   -2.5899    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6384   -2.9931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6332   -3.8099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0646   -2.5692    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7754   -2.9776    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1864   -3.6858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3696   -3.6858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4862   -2.5615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2022   -2.9802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9182   -2.5615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9182   -1.7447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6316   -1.3260    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2073   -1.3260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4888   -1.7421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  9  2  0  0  0  0\n 12  9  1  0  0  0  0\n 13 12  1  0  0  0  0\n 18 12  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 15 17  2  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "CCCCNC(=O)NS(=O)(=O)c1ccc(cc1)N",
          "formula": "C11H17N3O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0e947c81-ff17-41c4-9f88-5f96ccb97179"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "271.3375",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "71533c21-e884-4025-ac7a-7372c1af88bf",
      "version": "13",
      "structure": {
        "id": "2260ff29-73d2-443c-bdfb-f4968834accd",
        "molfile": "\n  Marvin  01132101562D          \n\n 18 18  0  0  0  0            999 V2000\n   -0.7754   -2.9776    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0646   -2.5692    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6384   -2.9931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4862   -2.5615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1864   -3.6858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3696   -3.6858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6332   -3.8099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3647   -2.5899    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2022   -2.9802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4888   -1.7421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9182   -1.7447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6316   -1.3260    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9182   -2.5615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2073   -1.3260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0704   -3.0035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7967   -2.6080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4971   -3.0319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2234   -2.6261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  1  2  0  0  0  0\n  7  3  2  0  0  0  0\n  8  3  1  0  0  0  0\n  9  4  2  0  0  0  0\n 10  4  1  0  0  0  0\n 11 14  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13  9  1  0  0  0  0\n 14 10  2  0  0  0  0\n 15  8  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 11 13  2  0  0  0  0\nM  END",
        "smiles": "CCCCNC(=O)NS(=O)(=O)c1ccc(cc1)N",
        "formula": "C11H17N3O3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "271.3375",
        "optical_activity": "NONE",
        "references": [
          "0c834cb6-9bc9-436e-8894-197403f141c7",
          "60a7f521-face-4774-a596-6460743c5db9",
          "368d669f-78e5-4740-b737-853a23228a2b"
        ],
        "stereo_centers": 0
      },
      "unii": "E3K8P4869P"
    }
  ]
}