{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8f894ac7-ee2a-4246-83f3-774220d4e2a8",
          "code": "31034-03-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=31034-03-4",
          "code_system": "CAS",
          "references": [
            "238ba583-1485-49f7-974b-e5db5552f98c",
            "3b4c87ca-da03-4d4a-b337-28589e805a9d"
          ]
        },
        {
          "uuid": "519de73b-2bc6-45da-9635-02f2a62aec32",
          "code": "193668",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/193668",
          "code_system": "PUBCHEM",
          "references": [
            "238ba583-1485-49f7-974b-e5db5552f98c"
          ]
        },
        {
          "uuid": "5ed3557f-3a00-6fb9-3fe2-45092e3b5edf",
          "code": "DTXSID20185000",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20185000",
          "code_system": "EPA CompTox",
          "references": [
            "4b2e77c6-b452-89f2-29e5-656464b467e1"
          ]
        },
        {
          "uuid": "365c30ed-3f7e-43bf-9b74-b4cc29dd58f3",
          "code": "E36PQ5WGN6",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "42c3bc11-1fc8-4716-9a0a-eabab9d8a17b"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a8772963-e81c-414a-8f6c-d00e2a345024",
          "name": "2-Naphthalenesulfonic acid, 6,6′-oxybis-",
          "stdName": "2-NAPHTHALENESULFONIC ACID, 6,6'-OXYBIS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "42c3bc11-1fc8-4716-9a0a-eabab9d8a17b"
          ],
          "display_name": false
        },
        {
          "uuid": "da66ec17-9a3a-41d8-9689-09f3fcd3506f",
          "name": "6,6′-Oxybis(2-naphthalenesulfonic acid)",
          "stdName": "6,6'-OXYBIS(2-NAPHTHALENESULFONIC ACID)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b4c87ca-da03-4d4a-b337-28589e805a9d"
          ],
          "display_name": false
        },
        {
          "uuid": "f1166b0f-759f-4292-ab58-70c7ed36077c",
          "name": "6,6′-Oxybis[2-naphthalenesulfonic acid]",
          "stdName": "6,6'-OXYBIS(2-NAPHTHALENESULFONIC ACID)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "42c3bc11-1fc8-4716-9a0a-eabab9d8a17b"
          ],
          "display_name": false
        },
        {
          "uuid": "ecf08d82-745c-416b-bd45-f4762e7659cb",
          "name": "DONS",
          "stdName": "DONS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "42c3bc11-1fc8-4716-9a0a-eabab9d8a17b"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "238ba583-1485-49f7-974b-e5db5552f98c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391006000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c7d4374d-ed16-4985-9a75-7f93beccc106",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b2e77c6-b452-89f2-29e5-656464b467e1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=31034-03-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3b4c87ca-da03-4d4a-b337-28589e805a9d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "42c3bc11-1fc8-4716-9a0a-eabab9d8a17b",
          "citation": "PUBCHEM",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/193668",
          "doc_type": "PUBCHEM",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "22565106-4b46-4a1a-b80d-857ec4517efb",
          "id": "22565106-4b46-4a1a-b80d-857ec4517efb",
          "molfile": "\n  Marvin  01132101562D          \n\n 29 32  0  0  0  0            999 V2000\n    1.7950   -1.5865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2051   -2.2988    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9221   -1.8886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4883   -2.7136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6199   -3.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2051   -3.7278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6199   -4.4448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4449   -4.4448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8551   -5.1616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6801   -5.1616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0949   -5.8739    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9199   -5.8739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3300   -6.5861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1551   -6.5861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5699   -5.8739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3949   -5.8739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8050   -5.1616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3949   -4.4448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5699   -4.4448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1551   -5.1616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3300   -5.1616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6300   -5.1616    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4550   -5.1616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6300   -5.9866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6300   -4.3366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0949   -4.4448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6801   -3.7278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8551   -3.7278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4449   -3.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  2  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  1  0  0  0  0\n 29  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 28  2  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 10 26  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 21 12  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 20 15  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 17 22  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  2  0  0  0  0\n 22 25  2  0  0  0  0\n 26 27  2  0  0  0  0\n 27 28  1  0  0  0  0\n 29 28  1  0  0  0  0\nM  END",
          "smiles": "c1cc(cc2ccc(cc12)S(=O)(=O)O)Oc3ccc4cc(ccc4c3)S(=O)(=O)O",
          "formula": "C20H14O7S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bd3f51e1-a9ba-43dc-80b1-6e7a2c2dc7ba"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "430.4539",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "21fda168-36ba-48bd-a982-aee19018345f",
      "version": "5",
      "structure": {
        "id": "fc355e8f-1f0f-44ef-8731-8b1094ea1eb9",
        "molfile": "\n  Marvin  01132113042D          \n\n 29 32  0  0  0  0            999 V2000\n    5.0949   -5.8739    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6801   -5.1616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8551   -5.1616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4449   -4.4448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6199   -4.4448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2051   -3.7278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6199   -3.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4449   -3.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8551   -3.7278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6801   -3.7278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0949   -4.4448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2051   -2.2988    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9221   -1.8886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4883   -2.7136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7950   -1.5865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9199   -5.8739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3300   -5.1616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1551   -5.1616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5699   -4.4448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3949   -4.4448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8050   -5.1616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3949   -5.8739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5699   -5.8739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1551   -6.5861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3300   -6.5861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6300   -5.1616    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6300   -5.9866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6300   -4.3366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4550   -5.1616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n  2 11  1  0  0  0  0\n  4  9  1  0  0  0  0\n  7 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  2  0  0  0  0\n 12 15  1  0  0  0  0\n  1 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  2  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  2  0  0  0  0\n 16 25  1  0  0  0  0\n 18 23  1  0  0  0  0\n 21 26  1  0  0  0  0\n 26 27  2  0  0  0  0\n 26 28  2  0  0  0  0\n 26 29  1  0  0  0  0\nM  END",
        "smiles": "c1cc(cc2ccc(cc12)S(=O)(=O)O)Oc3ccc4cc(ccc4c3)S(=O)(=O)O",
        "formula": "C20H14O7S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "430.4539",
        "optical_activity": "NONE",
        "references": [
          "c7d4374d-ed16-4985-9a75-7f93beccc106"
        ],
        "stereo_centers": 0
      },
      "unii": "E36PQ5WGN6"
    }
  ]
}