{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1d7f2f34-0d71-4b6e-b10c-3f782134d639", "code": "943454-44-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=943454-44-2", "code_system": "CAS", "references": [ "88f207a2-2817-4f41-a568-e6771638542d", "e3477c30-5036-4cd6-9860-659e3102cecf" ] }, { "uuid": "86571565-5f40-43a2-af79-1ab62f04cba8", "code": "72941959", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72941959", "code_system": "PUBCHEM", "references": [ "88f207a2-2817-4f41-a568-e6771638542d" ] }, { "uuid": "1b9630eb-71eb-4684-8ae5-fa0a77104580", "code": "E2VNL539HH", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "0f930af1-9b03-415a-94bb-5b250edc4544", "name": "BIS-(±)-HEXYLDIOXODECYL METHYL L-LYSINATE", "stdName": "BIS-(+/-)-HEXYLDIOXODECYL METHYL L-LYSINATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "827c0218-750c-4823-a8da-dd7b849a75be", "6f734795-4982-46dc-bc3f-97ef7127e1a0" ], "display_name": false }, { "uuid": "81da08e7-a7f6-42c6-9bce-28cd1d64a05b", "name": "BIS-HEXYLDIOXODECYL METHYL LYSINATE", "stdName": "BIS-HEXYLDIOXODECYL METHYL LYSINATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "26e82fea-4819-406f-be9b-538eff69bfde", "844b1d80-bf2d-4c3a-aa97-9d9f94217998", "827c0218-750c-4823-a8da-dd7b849a75be" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "cb4dc310-d6b0-4b32-970c-06bf639223ef", "name_org": "INCI" } ] }, { "uuid": "496600f8-2995-4520-a192-b34d744a4635", "name": "K6EAA-L12", "stdName": "K6EAA-L12", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "26e82fea-4819-406f-be9b-538eff69bfde", "827c0218-750c-4823-a8da-dd7b849a75be" ], "display_name": false }, { "uuid": "689a1fa4-ec4f-4535-99cb-356b8daf584b", "name": "L-LYSINE, N2,N6-BIS(2-HEXYL-1,3-DIOXODECYL)-, METHYL ESTER", "stdName": "L-LYSINE, N2,N6-BIS(2-HEXYL-1,3-DIOXODECYL)-, METHYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3e4cd9fb-fada-41a5-8410-c7edff4c0cdb", "827c0218-750c-4823-a8da-dd7b849a75be" ], "display_name": false } ], "references": [ { "uuid": "26e82fea-4819-406f-be9b-538eff69bfde", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "827c0218-750c-4823-a8da-dd7b849a75be", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3e4cd9fb-fada-41a5-8410-c7edff4c0cdb", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6f734795-4982-46dc-bc3f-97ef7127e1a0", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "88f207a2-2817-4f41-a568-e6771638542d", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391413000, "tags": [ "NOMEN" ] }, { "uuid": "4089cc42-4a47-4258-b944-d55719056b7c", "citation": "SRS import [E2VNL539HH]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=E2VNL539HH", "doc_type": "SRS", "public_domain": true, "document_date": 1493391413000, "tags": [ "NOMEN" ] }, { "uuid": "844b1d80-bf2d-4c3a-aa97-9d9f94217998", "citation": "BIS-HEXYLDIOXODECYL METHYL LYSINATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "e3477c30-5036-4cd6-9860-659e3102cecf", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "771870b5-83e7-42cb-bf81-becb9d8788b4", "id": "771870b5-83e7-42cb-bf81-becb9d8788b4", "molfile": "\n Marvin 01132106112D \n\n 47 46 0 0 1 0 999 V2000\n 6.7403 -6.4391 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 7.4548 -6.8517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1693 -6.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8838 -6.8517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5982 -6.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3127 -6.8517 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0272 -6.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0272 -5.6141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7416 -6.8517 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 11.7417 -7.6767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4561 -8.0891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4561 -8.9141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1706 -9.3267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1706 -10.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8851 -10.5641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4561 -6.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4561 -5.6141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1706 -6.8517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8850 -6.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5995 -6.8516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3140 -6.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0284 -6.8516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0284 -7.6767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7429 -8.0891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0258 -6.8517 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3114 -6.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3114 -5.6141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5969 -6.8517 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 4.5969 -7.6767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3114 -8.0892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3114 -8.9142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0258 -9.3267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0258 -10.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7403 -10.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8824 -6.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1680 -6.8517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8824 -5.6141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1680 -5.2017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1680 -4.3767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4535 -3.9641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4535 -3.1391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7390 -2.7267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7390 -1.9017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7403 -5.6141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0258 -5.2017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4548 -5.2017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4548 -4.3767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 25 1 6 0 0 0\n 1 44 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 16 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 17 2 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 2 0 0 0 0\n 28 26 1 0 0 0 0\n 28 29 1 0 0 0 0\n 35 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 35 36 2 0 0 0 0\n 37 35 1 0 0 0 0\n 38 37 1 0 0 0 0\n 39 38 1 0 0 0 0\n 40 39 1 0 0 0 0\n 41 40 1 0 0 0 0\n 42 41 1 0 0 0 0\n 43 42 1 0 0 0 0\n 44 45 2 0 0 0 0\n 44 46 1 0 0 0 0\n 46 47 1 0 0 0 0\nM END", "smiles": "CCCCCCCC(=O)C(CCCCCC)C(=O)NCCCC[C@@H](C(=O)OC)NC(=O)C(CCCCCC)C(=O)CCCCCCC", "formula": "C39H72N2O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "683a0614-8260-4d56-be18-c69a25428cab" }, "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "665.0003", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "27f565a1-e395-43df-9e90-2202ab507daf", "version": "3", "structure": { "id": "619de71c-a00a-4d83-b2a7-fbe974983b27", "molfile": "\n Marvin 01132105032D \n\n 47 46 0 0 1 0 999 V2000\n 1.7390 -1.9017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7390 -2.7267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4535 -3.1391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4535 -3.9641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1680 -4.3767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1680 -5.2017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8824 -5.6141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8824 -6.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5969 -6.8517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5969 -7.6767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3114 -8.0892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3114 -8.9142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0258 -9.3267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0258 -10.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7403 -10.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1680 -6.8517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3114 -6.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0258 -6.8517 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7403 -6.4391 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.7403 -5.6141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4548 -5.2017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4548 -4.3767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4548 -6.8517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1693 -6.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8838 -6.8517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5982 -6.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3127 -6.8517 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0272 -6.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7416 -6.8517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4561 -6.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1706 -6.8517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8850 -6.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5995 -6.8516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3140 -6.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0284 -6.8516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0284 -7.6767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7429 -8.0891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3114 -5.6141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0258 -5.2017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0272 -5.6141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4561 -5.6141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7417 -7.6767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4561 -8.0891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4561 -8.9141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1706 -9.3267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1706 -10.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8851 -10.5641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 8 16 2 0 0 0 0\n 9 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 19 18 1 6 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 19 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 17 38 2 0 0 0 0\n 20 39 2 0 0 0 0\n 28 40 2 0 0 0 0\n 30 41 2 0 0 0 0\n 29 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 1 0 0 0 0\n 46 47 1 0 0 0 0\nM END", "smiles": "CCCCCCCC(=O)C(CCCCCC)C(=O)NCCCC[C@@H](C(=O)OC)NC(=O)C(CCCCCC)C(=O)CCCCCCC", "formula": "C39H72N2O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "665.0003", "optical_activity": "UNSPECIFIED", "references": [ "3e4cd9fb-fada-41a5-8410-c7edff4c0cdb", "4089cc42-4a47-4258-b944-d55719056b7c" ], "stereo_centers": 3 }, "unii": "E2VNL539HH" } ] }