{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "84315610-af3c-4ab5-bd08-e2c254e34d6c",
          "code": "214414-88-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=214414-88-7",
          "code_system": "CAS",
          "references": [
            "61f51ff7-50d5-47c3-af43-775449daa4d3",
            "90cb6a23-b42b-4edd-a43b-5e662f7fb0fb"
          ]
        },
        {
          "uuid": "f22df32c-b6a5-49f4-8a21-80d1d133ec8e",
          "code": "3,4-Methylenedioxy-N-hydroxy-N-methylamphetamine",
          "comments": "3,4-Methylenedioxy-N-hydroxy-N-methylamphetamine (MDHMA; FLEA) is an entactogen, psychedelic, and stimulant of the phenethylamine and amphetamine chemical classes. It is the N-hydroxy homologue of MDMA (\"Ecstasy\"), and the N-methyl homologue of MDOH. MDHMA was first synthesized and assayed by Alexander Shulgin.",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/3,4-Methylenedioxy-N-hydroxy-N-methylamphetamine",
          "code_system": "WIKIPEDIA"
        },
        {
          "uuid": "744dfc44-3468-43a8-b28d-1ec865c70c66",
          "code": "44350092",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44350092",
          "code_system": "PUBCHEM",
          "references": [
            "61f51ff7-50d5-47c3-af43-775449daa4d3"
          ]
        },
        {
          "uuid": "c8837ba4-8b54-4abd-b52d-a370acf13db9",
          "code": "E2816HU3KT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "cc1cb042-0ee2-7632-916d-e71d13d8f908",
          "code": "Designer-drugs-FLEA",
          "comments": "Wikipedia|List of designer drugs|Empathogens|MDxx (Substituted methylenedioxyphenethylamines)",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "ac76c208-8594-d322-8b77-a4f9539ae2cd"
          ]
        },
        {
          "uuid": "70fb5ef8-291a-42f4-9683-be4fb7e21199",
          "code": "PiHKAL",
          "comments": "Wikipedia|PiHKAL|Phenethylamines",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/PiHKAL",
          "code_system": "WIKIPEDIA"
        },
        {
          "uuid": "486380bf-caba-3dda-c5c6-13a26c720d15",
          "code": "DTXSID90658377",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90658377",
          "code_system": "EPA CompTox",
          "references": [
            "ac76c208-8594-d322-8b77-a4f9539ae2cd"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "07925be4-9ffe-4b64-b4d5-ea57965398b7",
          "amount": {
            "uuid": "1fadf4cc-fe19-4ecd-ae1b-ce4f40b8a797"
          },
          "type": "ACTIVE MOIETY",
          "references": [
            "13a5a023-5674-4845-be37-fe90642911eb"
          ],
          "related_substance": {
            "uuid": "98083eae-86ab-4a63-afa5-2c14d7fd8810",
            "refuuid": "0c4311f2-d4ed-424a-879a-492ec049d8a9",
            "name": "FLEA",
            "unii": "E2816HU3KT",
            "linking_id": "E2816HU3KT",
            "ref_pname": "FLEA",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a4c30832-2175-4375-9f0e-8fd40028c2e3",
          "name": "1,3-BENZODIOXOLE-5-ETHANAMINE, N-HYDROXY-N,.ALPHA.-DIMETHYL-",
          "stdName": "1,3-BENZODIOXOLE-5-ETHANAMINE, N-HYDROXY-N,.ALPHA.-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90cb6a23-b42b-4edd-a43b-5e662f7fb0fb"
          ],
          "display_name": false
        },
        {
          "uuid": "cdda9b31-f3ae-4d9d-97ba-47d89dfd25f3",
          "name": "3,4-METHYLENEDIOXY-N-HYDROXY-N-METHYLAMPHETAMINE",
          "stdName": "3,4-METHYLENEDIOXY-N-HYDROXY-N-METHYLAMPHETAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "13a5a023-5674-4845-be37-fe90642911eb"
          ],
          "display_name": false
        },
        {
          "uuid": "8ae71538-177e-4b21-8e27-841b3bce6c34",
          "name": "FLEA",
          "stdName": "FLEA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "13a5a023-5674-4845-be37-fe90642911eb"
          ],
          "display_name": true
        },
        {
          "uuid": "d2b1047a-c8e1-4f12-94a4-74d87fc8e968",
          "name": "FLEA (PSYCHEDELIC)",
          "stdName": "FLEA (PSYCHEDELIC)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c8b24c0-8bff-406d-8e88-ebca5800c4f7"
          ],
          "display_name": false
        },
        {
          "uuid": "b6db22e5-8f86-4ed5-b433-58855f49d38e",
          "name": "MDHMA",
          "stdName": "MDHMA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "13a5a023-5674-4845-be37-fe90642911eb"
          ],
          "display_name": false
        },
        {
          "uuid": "6b265455-1595-46ac-a889-273d571582fb",
          "name": "N-HYDROXY-N,.ALPHA.-DIMETHYL-1,3-BENZODIOXOLE-5-ETHANAMINE",
          "stdName": "N-HYDROXY-N,.ALPHA.-DIMETHYL-1,3-BENZODIOXOLE-5-ETHANAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90cb6a23-b42b-4edd-a43b-5e662f7fb0fb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5bd9858c-da62-42ed-bec9-42e396502c7b",
          "citation": "DESIGNER-DRUGS-LIST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13a5a023-5674-4845-be37-fe90642911eb",
          "citation": "https://en.wikipedia.org/wiki/3,4-Methylenedioxy-N-hydroxy-N-methylamphetamine",
          "doc_type": "WIKIPEDIA",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "61f51ff7-50d5-47c3-af43-775449daa4d3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393050000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac76c208-8594-d322-8b77-a4f9539ae2cd",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4c8b24c0-8bff-406d-8e88-ebca5800c4f7",
          "citation": "SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "90cb6a23-b42b-4edd-a43b-5e662f7fb0fb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0b84af98-d3d8-4aa6-98f6-71595497c755",
          "id": "0b84af98-d3d8-4aa6-98f6-71595497c755",
          "molfile": "\n  Marvin  01132100512D          \n\n 15 16  0  0  0  0            999 V2000\n    6.3218   -3.9935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0360   -4.4022    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.0416   -5.2251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3282   -5.6394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3338   -6.4670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6223   -6.8815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9053   -6.4767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1200   -6.7377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6290   -6.0714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1110   -5.3986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8997   -5.6490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6111   -5.2263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7472   -3.9881    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7417   -3.1651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4615   -4.3967    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 13  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 12  2  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n 11  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  1  0  0  0  0\nM  END",
          "smiles": "CC(Cc1ccc2c(c1)OCO2)N(C)O",
          "formula": "C11H15NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "354439d3-4077-4bc8-a961-461394195e09"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "209.2421",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0c4311f2-d4ed-424a-879a-492ec049d8a9",
      "version": "10",
      "structure": {
        "id": "ec71886f-073f-4f43-b6f6-17f117215bf9",
        "molfile": "\n  Marvin  01132112142D          \n\n 15 16  0  0  0  0            999 V2000\n    5.6223   -6.8815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3338   -6.4670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3282   -5.6394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6111   -5.2263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8997   -5.6490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9053   -6.4767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0416   -5.2251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0360   -4.4022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3218   -3.9935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7472   -3.9881    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4615   -4.3967    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7417   -3.1651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1110   -5.3986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1200   -6.7377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6290   -6.0714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  1  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  1  0  0  0  0\n  5 13  1  0  0  0  0\n  6 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 13  1  0  0  0  0\nM  END",
        "smiles": "CC(Cc1ccc2c(c1)OCO2)N(C)O",
        "formula": "C11H15NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "209.2421",
        "optical_activity": "( + / - )",
        "references": [
          "90cb6a23-b42b-4edd-a43b-5e662f7fb0fb",
          "13a5a023-5674-4845-be37-fe90642911eb"
        ],
        "stereo_centers": 1
      },
      "unii": "E2816HU3KT"
    }
  ]
}