{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "384050f7-2507-4b95-be0e-243fc1253492",
          "code": "4373-41-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4373-41-5",
          "code_system": "CAS",
          "references": [
            "b34853d8-f597-40d7-a122-c06988cf6609",
            "ad1c3df4-200a-4b55-83b0-e1c6924e90a2"
          ]
        },
        {
          "uuid": "6ba97be5-5f66-45f0-a3af-9217802d469c",
          "code": "73659",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/73659",
          "code_system": "PUBCHEM",
          "references": [
            "b34853d8-f597-40d7-a122-c06988cf6609"
          ]
        },
        {
          "uuid": "cfddf193-c96c-e147-2abd-3bb1e17ae2bf",
          "code": "Maslinic acid",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Maslinic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "6ea27f7d-5b95-485f-508a-fae0d4d217f1"
          ]
        },
        {
          "uuid": "6c1d7536-fdc9-2456-6cde-2c640dec4c6f",
          "code": "8099",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/8099",
          "code_system": "HSDB",
          "references": [
            "e962ccaf-4bad-02c5-db22-7d4fb3a99534"
          ]
        },
        {
          "uuid": "f0b65774-4988-4b17-9f01-ef2c1ac16178",
          "code": "E233J88OHQ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "cbd8391b-f56a-7328-4c63-b46b810901b4",
          "code": "66682",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:66682",
          "code_system": "CHEBI",
          "references": [
            "7275d13c-90b8-7444-e9b2-4d0b02a3bcdd"
          ]
        },
        {
          "uuid": "ed2f9f49-917b-11fe-c751-3bb97954e659",
          "code": "DTXSID30905074",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30905074",
          "code_system": "EPA CompTox",
          "references": [
            "7275d13c-90b8-7444-e9b2-4d0b02a3bcdd"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "cc6d59fb-eee7-45cd-9c9d-8ffbaa4363be",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "be4e32d6-421e-4b26-8260-c78abbc36969"
          ],
          "related_substance": {
            "uuid": "4f406eb2-93ab-4b6e-85f9-ffe094934708",
            "refuuid": "2f00e021-a109-40d1-bf86-43b69127d5f4",
            "name": "CENTAURIUM ERYTHRAEA WHOLE",
            "unii": "T0N9DND3W1",
            "linking_id": "T0N9DND3W1",
            "ref_pname": "CENTAURIUM ERYTHRAEA WHOLE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4c34184c-8897-4092-9ac7-0b2d475672bb",
          "name": "2.ALPHA.-HYDROXYOLEANOLIC ACID",
          "stdName": "2.ALPHA.-HYDROXYOLEANOLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c918de2a-1a90-40e2-9dd9-04fce03427af",
            "95870dcb-bbd4-4595-8a32-76087c618ba8"
          ],
          "display_name": false
        },
        {
          "uuid": "d6078dcb-bc62-46db-8970-caafff8a0448",
          "name": "CRATAEGOLIC ACID",
          "stdName": "CRATAEGOLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c918de2a-1a90-40e2-9dd9-04fce03427af",
            "95870dcb-bbd4-4595-8a32-76087c618ba8"
          ],
          "display_name": false
        },
        {
          "uuid": "44313dee-91d8-4877-8c15-70c0c0b28e53",
          "name": "CRATEGOLIC ACID",
          "stdName": "CRATEGOLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c918de2a-1a90-40e2-9dd9-04fce03427af",
            "95870dcb-bbd4-4595-8a32-76087c618ba8"
          ],
          "display_name": false
        },
        {
          "uuid": "246d5127-59b5-4ad2-8ad3-d1f1910211a4",
          "name": "MASLIC ACID",
          "stdName": "MASLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c918de2a-1a90-40e2-9dd9-04fce03427af",
            "95870dcb-bbd4-4595-8a32-76087c618ba8"
          ],
          "display_name": false
        },
        {
          "uuid": "df3008ea-4bd0-4cad-afa5-81ca49ba400c",
          "name": "MASLINIC ACID",
          "stdName": "MASLINIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8ea82f6-658d-4f36-b0bc-d95b5bc9b783",
            "270aceaa-3c6c-448a-ac6c-1957616b8812",
            "bcd33285-02bd-4eb7-970f-693c6b39fc13",
            "95870dcb-bbd4-4595-8a32-76087c618ba8"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b344f4fe-b59b-4361-8286-a1bac1589703",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "9ea4395e-3ea0-400e-a698-d8e662cf6940",
          "name": "OLEAN-12-EN-28-OIC ACID, 2,3-DIHYDROXY-, (2.ALPHA.,3.BETA.)-",
          "stdName": "OLEAN-12-EN-28-OIC ACID, 2,3-DIHYDROXY-, (2.ALPHA.,3.BETA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c918de2a-1a90-40e2-9dd9-04fce03427af",
            "95870dcb-bbd4-4595-8a32-76087c618ba8"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f8ea82f6-658d-4f36-b0bc-d95b5bc9b783",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "95870dcb-bbd4-4595-8a32-76087c618ba8",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bcd33285-02bd-4eb7-970f-693c6b39fc13",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c918de2a-1a90-40e2-9dd9-04fce03427af",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b34853d8-f597-40d7-a122-c06988cf6609",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391969000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be4e32d6-421e-4b26-8260-c78abbc36969",
          "citation": "HERBAL MEDICINES 4TH ED 2103",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "960e38de-0150-4ac8-a3eb-07ec1f75e9c9",
          "citation": "SRS import [E233J88OHQ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=E233J88OHQ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391969000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "270aceaa-3c6c-448a-ac6c-1957616b8812",
          "citation": "MASLINIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e962ccaf-4bad-02c5-db22-7d4fb3a99534",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+4373-41-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6ea27f7d-5b95-485f-508a-fae0d4d217f1",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Maslinic_acid",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7275d13c-90b8-7444-e9b2-4d0b02a3bcdd",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ad1c3df4-200a-4b55-83b0-e1c6924e90a2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5b38cfc2-7af4-48ab-901c-476d2009b23e",
          "id": "5b38cfc2-7af4-48ab-901c-476d2009b23e",
          "molfile": "\n  Marvin  01132104442D          \n\n 34 38  0  0  1  0            999 V2000\n    4.8209   -3.7787    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.1044   -3.3699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5251   -3.3623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2378   -3.7787    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.2378   -2.9537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2378   -4.6044    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.9467   -5.0131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6593   -4.6006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6593   -3.7787    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.6593   -2.9537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9467   -3.3623    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.9467   -2.5374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6670   -2.1326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3720   -2.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0999   -2.1440    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.0999   -1.3115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8386   -0.9059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2434   -0.1940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4184   -0.1940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5359   -1.3337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5359   -2.1662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8119   -2.5672    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.8119   -3.3968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0771   -3.7940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3720   -3.3738    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.3720   -4.1988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5206   -2.9767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3076   -3.7717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3120   -2.7627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5251   -5.0092    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.7313   -5.7266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9849   -5.6942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8209   -4.6044    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.1083   -5.0168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 33  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  4  6  1  0  0  0  0\n 11  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 30  1  1  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  1  0  0  0\n  9 11  1  0  0  0  0\n  9 25  1  0  0  0  0\n 11 12  1  1  0  0  0\n 12 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  6  0  0  0\n 25 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 22  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 27  1  1  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  1  6  0  0  0\n 27 28  1  0  0  0  0\n 27 29  2  0  0  0  0\n 30 31  1  0  0  0  0\n 30 32  1  0  0  0  0\n 33 30  1  0  0  0  0\n 33 34  1  1  0  0  0\nM  END",
          "smiles": "CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@H]([C@@H](C(C)(C)[C@@H]5CC[C@]43C)O)O)[C@@H]2C1)C(=O)O",
          "formula": "C30H48O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "72cc896e-58f8-477c-9a94-e4e2098716e7"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "472.7009",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 9
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5de96d48-807b-434d-b0c0-e29deb6de1a5",
      "version": "7",
      "structure": {
        "id": "9552b41b-c8ed-49ba-9c5f-72aaee6ffd3e",
        "molfile": "\n  Marvin  01132107452D          \n\n 37 41  0  0  1  0            999 V2000\n    7.6593   -3.7787    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.6593   -4.6006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9467   -5.0131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2378   -4.6044    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.2378   -3.7787    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.9467   -3.3623    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.9467   -2.5374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6670   -2.1326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3720   -2.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3720   -3.3738    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.0771   -3.7940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8119   -3.3968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8119   -2.5672    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.0999   -2.1440    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.0999   -1.3115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8386   -0.9059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2434   -0.1940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4184   -0.1940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5359   -1.3337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5359   -2.1662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0999   -2.9631    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5206   -2.9767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3076   -3.7717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3120   -2.7627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3720   -4.1988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9467   -4.1871    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5251   -3.3623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8209   -3.7787    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.1044   -3.3699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8209   -4.6044    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.5251   -5.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7313   -5.7266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9849   -5.6942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1083   -5.0168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2378   -2.9537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2378   -5.4248    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6593   -2.9537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n  9 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 16 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 13 20  1  0  0  0  0\n 14 21  1  1  0  0  0\n 13 22  1  1  0  0  0\n 22 23  1  0  0  0  0\n 22 24  2  0  0  0  0\n 10 25  1  6  0  0  0\n  1 10  1  0  0  0  0\n  1  6  1  0  0  0  0\n  6 26  1  6  0  0  0\n  5 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  6  0  0  0\n 28 30  1  0  0  0  0\n 31 30  1  0  0  0  0\n  4 31  1  0  0  0  0\n 31 32  1  0  0  0  0\n 31 33  1  0  0  0  0\n 30 34  1  1  0  0  0\n  5 35  1  1  0  0  0\n  4 36  1  6  0  0  0\n  1 37  1  1  0  0  0\nM  END",
        "smiles": "CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@]4([H])[C@@]5(C)C[C@H]([C@@H](C(C)(C)[C@]5([H])CC[C@]43C)O)O)[C@]2([H])C1)C(=O)O",
        "formula": "C30H48O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 9,
        "ez_centers": 0,
        "molecular_weight": "472.7009",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "960e38de-0150-4ac8-a3eb-07ec1f75e9c9",
          "bcd33285-02bd-4eb7-970f-693c6b39fc13"
        ],
        "stereo_centers": 9
      },
      "unii": "E233J88OHQ"
    }
  ]
}