{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "80bf3d6b-c2f0-402b-a299-382353907c70",
          "code": "526-99-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=526-99-8",
          "code_system": "CAS",
          "references": [
            "f7f552c2-6e6c-40c2-b489-d8ac32224d9b",
            "18e5ee23-fce3-4e82-b592-de8d2897a452"
          ]
        },
        {
          "uuid": "be512146-14b7-460b-bcb6-ae50ddaf9b7b",
          "code": "C000090",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67000090",
          "code_system": "MESH",
          "references": [
            "f7f552c2-6e6c-40c2-b489-d8ac32224d9b"
          ]
        },
        {
          "uuid": "0ad2cf1e-6cce-450f-8292-707afbd3bf50",
          "code": "MUCIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Mucic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "f7f552c2-6e6c-40c2-b489-d8ac32224d9b"
          ]
        },
        {
          "uuid": "72765379-fe9b-4a4f-91ce-3e11bd7b0ad2",
          "code": "m5631",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5631?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f7f552c2-6e6c-40c2-b489-d8ac32224d9b"
          ]
        },
        {
          "uuid": "6a65b7b8-f0ef-487c-86e0-6e0a1ef45b68",
          "code": "208-404-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.641",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f7f552c2-6e6c-40c2-b489-d8ac32224d9b"
          ]
        },
        {
          "uuid": "2d06ce3b-94c7-4911-923e-fcbecb8e2c6f",
          "code": "3037582",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3037582",
          "code_system": "PUBCHEM",
          "references": [
            "f7f552c2-6e6c-40c2-b489-d8ac32224d9b"
          ]
        },
        {
          "uuid": "e2a2999d-8806-e8e6-a4c3-3d098244d440",
          "code": "2116",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2116",
          "code_system": "HSDB",
          "references": [
            "6fd85d0e-dc25-b01a-224a-06bb83f6301c"
          ]
        },
        {
          "uuid": "84f68404-3eb2-a67c-dee5-cbc713956b70",
          "code": "DTXSID7048740",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7048740",
          "code_system": "EPA CompTox",
          "references": [
            "825fbc81-026c-52ee-a5af-1b69deca4dd9"
          ]
        },
        {
          "uuid": "183a4bb8-3bb0-4b36-80c0-cd7656cc5725",
          "code": "E149J5OTIF",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0259d5b4-c882-a552-0f4a-f0a8d7a91adc",
          "code": "30852",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:30852",
          "code_system": "CHEBI",
          "references": [
            "5874eb0f-2800-7af7-da91-dbf2dba639f5"
          ]
        },
        {
          "uuid": "81b79ef5-a79f-83e7-cb93-7b6f53bc86dc",
          "code": "17301",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17301",
          "code_system": "CHEBI",
          "references": [
            "5874eb0f-2800-7af7-da91-dbf2dba639f5"
          ]
        },
        {
          "uuid": "bbf0cd0d-4b65-3756-9006-8486bab2d6de",
          "code": "8127",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=8127",
          "code_system": "NSC",
          "references": [
            "524689c2-59f8-095c-f849-79574b79376b"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "281cd3fd-0c5a-4551-8ccf-4cba7c5ea0a0",
          "name": "GALACTARIC ACID",
          "stdName": "GALACTARIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2bcbe7db-2d5c-47e3-b032-272d92579ace",
            "a535a1b5-7f7c-4bc1-ab98-f73ee362441f",
            "5f2819f2-4e0f-4dc7-9c96-0103bc5b8dd3",
            "1a5458c3-66d1-44c8-84ca-d1f98d22cc27",
            "8852281a-f21f-4d3e-aa03-8009bc2ad3fc",
            "f1373044-8b35-4634-83cc-fc07199fdf22",
            "59013b9b-217c-4349-bdc3-325c274291c3"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "507d7100-0bb1-4b6c-88bc-81eeae4ea624",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "67775961-d984-4172-b12d-03506271ad1d",
          "name": "GALACTARIC ACID [HSDB]",
          "stdName": "GALACTARIC ACID [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2bcbe7db-2d5c-47e3-b032-272d92579ace",
            "a535a1b5-7f7c-4bc1-ab98-f73ee362441f"
          ],
          "display_name": false
        },
        {
          "uuid": "ed923002-ed0b-4ae4-8572-9d6455944fd6",
          "name": "GALACTARIC ACID [MI]",
          "stdName": "GALACTARIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a535a1b5-7f7c-4bc1-ab98-f73ee362441f",
            "5f2819f2-4e0f-4dc7-9c96-0103bc5b8dd3"
          ],
          "display_name": false
        },
        {
          "uuid": "dbd4089f-9190-49ce-9cc3-88048bff6c2b",
          "name": "GALACTARIC ACID, (±)-",
          "stdName": "GALACTARIC ACID, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5c9f1f3-b5db-4077-8f5f-0729c6b844eb",
            "a535a1b5-7f7c-4bc1-ab98-f73ee362441f"
          ],
          "display_name": false
        },
        {
          "uuid": "d4b73e25-26f0-47d5-a584-40b15147eb5b",
          "name": "GALACTOSACCHARIC ACID",
          "stdName": "GALACTOSACCHARIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a535a1b5-7f7c-4bc1-ab98-f73ee362441f",
            "8852281a-f21f-4d3e-aa03-8009bc2ad3fc"
          ],
          "display_name": false
        },
        {
          "uuid": "6f4f8f8b-4e95-4add-bd95-9fc1b5ab42b3",
          "name": "MUCIC ACID",
          "stdName": "MUCIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a535a1b5-7f7c-4bc1-ab98-f73ee362441f",
            "8852281a-f21f-4d3e-aa03-8009bc2ad3fc"
          ],
          "display_name": false
        },
        {
          "uuid": "156d4134-c408-4d2b-8e4d-117ea048ae2e",
          "name": "MUCILIANCE",
          "stdName": "MUCILIANCE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a535a1b5-7f7c-4bc1-ab98-f73ee362441f",
            "8852281a-f21f-4d3e-aa03-8009bc2ad3fc"
          ],
          "display_name": false
        },
        {
          "uuid": "8071e0b5-867b-448d-9b7c-9ec573c22942",
          "name": "NSC-8127",
          "stdName": "NSC-8127",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a535a1b5-7f7c-4bc1-ab98-f73ee362441f",
            "78a3f48e-beea-4350-867a-70c4b0eb1928"
          ],
          "display_name": false
        },
        {
          "uuid": "e99fd25a-81a1-4647-9db9-15afd2f973da",
          "name": "ORISTAR MCA",
          "stdName": "ORISTAR MCA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a535a1b5-7f7c-4bc1-ab98-f73ee362441f",
            "8852281a-f21f-4d3e-aa03-8009bc2ad3fc"
          ],
          "display_name": false
        },
        {
          "uuid": "49fef351-2539-438f-bd21-170544f6e904",
          "name": "SACCHAROLACTIC ACID",
          "stdName": "SACCHAROLACTIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a535a1b5-7f7c-4bc1-ab98-f73ee362441f",
            "8fedb75e-a4d6-456d-978b-373cfc0dedc1"
          ],
          "display_name": false
        },
        {
          "uuid": "450d23b2-541c-4132-820c-21e969a92f9c",
          "name": "TETRAHYDROXYADIPIC ACID",
          "stdName": "TETRAHYDROXYADIPIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a535a1b5-7f7c-4bc1-ab98-f73ee362441f",
            "5f2819f2-4e0f-4dc7-9c96-0103bc5b8dd3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a535a1b5-7f7c-4bc1-ab98-f73ee362441f",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8fedb75e-a4d6-456d-978b-373cfc0dedc1",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78a3f48e-beea-4350-867a-70c4b0eb1928",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5f2819f2-4e0f-4dc7-9c96-0103bc5b8dd3",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5c9f1f3-b5db-4077-8f5f-0729c6b844eb",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2bcbe7db-2d5c-47e3-b032-272d92579ace",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7f552c2-6e6c-40c2-b489-d8ac32224d9b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391502000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3037fa9b-2aa4-4574-b90a-35eca1e00be6",
          "citation": "SRS import [E149J5OTIF]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=E149J5OTIF",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391502000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1373044-8b35-4634-83cc-fc07199fdf22",
          "citation": "GALACTARIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "59013b9b-217c-4349-bdc3-325c274291c3",
          "citation": "GALACTARIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1a5458c3-66d1-44c8-84ca-d1f98d22cc27",
          "citation": "GALACTARIC ACID [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8852281a-f21f-4d3e-aa03-8009bc2ad3fc",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6fd85d0e-dc25-b01a-224a-06bb83f6301c",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+526-99-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "825fbc81-026c-52ee-a5af-1b69deca4dd9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=526-99-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "18e5ee23-fce3-4e82-b592-de8d2897a452",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5874eb0f-2800-7af7-da91-dbf2dba639f5",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "524689c2-59f8-095c-f849-79574b79376b",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "96a174d7-a16a-40d3-8eae-b7d32a3a0788",
          "id": "96a174d7-a16a-40d3-8eae-b7d32a3a0788",
          "molfile": "\n  Marvin  01132107492D          \n\n 14 13  0  0  0  0            999 V2000\n   11.7417   -5.8910    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   11.7949   -6.7270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9937   -5.5406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9363   -4.7107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3012   -5.9955    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4301   -5.4422    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   12.3769   -4.6124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1658   -5.7968    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   13.2212   -6.6287    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8563   -5.3460    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   13.8010   -4.5181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6022   -5.6984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2989   -5.2475    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6637   -6.5262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  6  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  6  7  1  1  0  0  0\n  8  6  1  0  0  0  0\n  8  9  1  6  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  6  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\nM  END",
          "smiles": "[C@H]([C@H]([C@@H](C(=O)O)O)O)([C@H](C(=O)O)O)O",
          "formula": "C6H10O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9b48aede-e5c9-4a1b-b0cc-848692d7dfb7"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "210.1391",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "18d631d0-2daa-4e44-9d86-f4e2bb9dc2e2",
      "version": "10",
      "structure": {
        "id": "c7d1b7d2-fc47-4718-8f34-dabbc79ef516",
        "molfile": "\n  Marvin  01132110192D          \n\n 14 13  0  0  1  0            999 V2000\n   10.9363   -4.7107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3012   -5.9955    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2989   -5.2475    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6637   -6.5262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7949   -6.7270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9937   -5.5406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8010   -4.5181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6022   -5.6984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3769   -4.6124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7417   -5.8910    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.2212   -6.6287    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8563   -5.3460    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.4301   -5.4422    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.1658   -5.7968    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n  6  1  2  0  0  0  0\n  6  2  1  0  0  0  0\n  8  3  2  0  0  0  0\n  8  4  1  0  0  0  0\n 10  5  1  1  0  0  0\n 10  6  1  0  0  0  0\n 12  7  1  6  0  0  0\n 12  8  1  0  0  0  0\n 13  9  1  1  0  0  0\n 13 10  1  0  0  0  0\n 14 11  1  6  0  0  0\n 14 12  1  0  0  0  0\n 14 13  1  0  0  0  0\nM  END",
        "smiles": "[C@H]([C@H]([C@@H](C(=O)O)O)O)([C@H](C(=O)O)O)O",
        "formula": "C6H10O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "210.1391",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "8fedb75e-a4d6-456d-978b-373cfc0dedc1",
          "3037fa9b-2aa4-4574-b90a-35eca1e00be6"
        ],
        "stereo_centers": 4
      },
      "unii": "E149J5OTIF"
    }
  ]
}