{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "39d2428a-b056-41ee-83dc-6cbf0f6c0f55",
          "code": "1135-66-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1135-66-6",
          "code_system": "CAS",
          "references": [
            "46929bbb-7f41-499a-8a13-cbb1d5fe9428",
            "0e69a955-1a35-4001-8484-30f768776649"
          ]
        },
        {
          "uuid": "6097c443-9561-4ba3-9f4f-5452e7b00752",
          "code": "214-494-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.013.177",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "46929bbb-7f41-499a-8a13-cbb1d5fe9428"
          ]
        },
        {
          "uuid": "b136f8a9-8882-4e3c-986c-e081f0f7b1ca",
          "code": "11127402",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11127402",
          "code_system": "PUBCHEM",
          "references": [
            "46929bbb-7f41-499a-8a13-cbb1d5fe9428"
          ]
        },
        {
          "uuid": "4cb8a129-6292-8d78-1164-a9a3ed3b327a",
          "code": "DTXSID1044518",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1044518",
          "code_system": "EPA CompTox",
          "references": [
            "45d6dcb8-7373-0b80-a2a7-802d52709294"
          ]
        },
        {
          "uuid": "c21ca1df-328b-4781-92ba-19e3053e8c60",
          "code": "E0LN4V7EY4",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fa5f600b-8f96-4e04-9206-32b62784125e",
          "name": "(-)-ISOLONGIFOLENE",
          "stdName": "(-)-ISOLONGIFOLENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "667b0ee4-5eb0-4db2-8d59-9ca7eaf170d6"
          ],
          "display_name": false
        },
        {
          "uuid": "4c992798-042a-44eb-aee6-de831797632f",
          "name": "2H-2,4A-METHANONAPHTHALENE, 1,3,4,5,6,7-HEXAHYDRO-1,1,5,5-TETRAMETHYL-, (2S)-",
          "stdName": "2H-2,4A-METHANONAPHTHALENE, 1,3,4,5,6,7-HEXAHYDRO-1,1,5,5-TETRAMETHYL-, (2S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0014c493-98d9-470f-ab5b-94e48ecd7289"
          ],
          "display_name": false
        },
        {
          "uuid": "b2e57fa7-c8a7-4636-9bd5-a28304a1b979",
          "name": "2H-2,4A-METHANONAPHTHALENE, 1,3,4,5,6,7-HEXAHYDRO-1,1,5,5-TETRAMETHYL-, (2S,4AR)-",
          "stdName": "2H-2,4A-METHANONAPHTHALENE, 1,3,4,5,6,7-HEXAHYDRO-1,1,5,5-TETRAMETHYL-, (2S,4AR)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0014c493-98d9-470f-ab5b-94e48ecd7289"
          ],
          "display_name": false
        },
        {
          "uuid": "d09edf15-cb31-4249-8e23-a6610faf3699",
          "name": "2H-2,4A-METHANONAPHTHALENE, 1,3,4,5,6,7-HEXAHYDRO-1,1,5,5-TETRAMETHYL-, (2S,4AR)-(-)-",
          "stdName": "2H-2,4A-METHANONAPHTHALENE, 1,3,4,5,6,7-HEXAHYDRO-1,1,5,5-TETRAMETHYL-, (2S,4AR)-(-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0014c493-98d9-470f-ab5b-94e48ecd7289"
          ],
          "display_name": false
        },
        {
          "uuid": "3dd26d30-3d36-48eb-b910-ad94f1119bc2",
          "name": "ISOLONGIFOLENE",
          "stdName": "ISOLONGIFOLENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0014c493-98d9-470f-ab5b-94e48ecd7289"
          ],
          "display_name": false
        },
        {
          "uuid": "c0167bec-5436-413a-aa5b-8e2b37024d8c",
          "name": "ISOLONGIFOLENE, (-)-",
          "stdName": "ISOLONGIFOLENE, (-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84c49904-7298-4682-a7d1-5391028c30f9"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "667b0ee4-5eb0-4db2-8d59-9ca7eaf170d6",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "84c49904-7298-4682-a7d1-5391028c30f9",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0014c493-98d9-470f-ab5b-94e48ecd7289",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "46929bbb-7f41-499a-8a13-cbb1d5fe9428",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391994000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "767f77d1-bc24-470a-b9cf-983ef2e57537",
          "citation": "SRS import [E0LN4V7EY4]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=E0LN4V7EY4",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391994000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45d6dcb8-7373-0b80-a2a7-802d52709294",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1135-66-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0e69a955-1a35-4001-8484-30f768776649",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "83fd4114-a836-45a0-9b85-05dcf548c345",
          "id": "83fd4114-a836-45a0-9b85-05dcf548c345",
          "molfile": "\n  Marvin  01132106512D          \n\n 15 17  0  0  1  0            999 V2000\n   10.4582   -5.0308    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   10.4582   -5.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1726   -6.2684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8872   -5.8557    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   11.4108   -5.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8872   -5.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6016   -4.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3162   -5.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3162   -5.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6016   -6.2684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1320   -6.9003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0713   -6.9003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1726   -4.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7030   -3.9863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6423   -3.9863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  5  1  1  0  0  0\n  1 13  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  4  6  1  0  0  0  0\n  4 10  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6 13  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\nM  END",
          "smiles": "CC1(C)CCC=C2C(C)(C)[C@H]3CC[C@]21C3",
          "formula": "C15H24",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d8be1a9f-dad1-49d6-9593-ab07b3396e7d"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "204.3516",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d981f88f-f0e3-4585-a882-9a2915f101de",
      "version": "4",
      "structure": {
        "id": "8bf68efd-b0f0-4bfc-a809-f77ca116e02d",
        "molfile": "\n  Marvin  01132107162D          \n\n 15 17  0  0  1  0            999 V2000\n   13.1320   -6.9003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6016   -6.2684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3162   -5.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3162   -5.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6016   -4.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8872   -5.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1726   -4.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7030   -3.9863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6423   -3.9863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4582   -5.0308    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.4582   -5.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1726   -6.2684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8872   -5.8557    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.4108   -5.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0713   -6.9003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13  6  1  0  0  0  0\n  2 13  1  0  0  0  0\n 13 14  1  1  0  0  0\n 10 14  1  1  0  0  0\n  2 15  1  0  0  0  0\nM  END",
        "smiles": "CC1(C)CCC=C2C(C)(C)[C@H]3CC[C@]21C3",
        "formula": "C15H24",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "204.3516",
        "optical_activity": "( - )",
        "references": [
          "667b0ee4-5eb0-4db2-8d59-9ca7eaf170d6",
          "767f77d1-bc24-470a-b9cf-983ef2e57537"
        ],
        "stereo_centers": 2
      },
      "unii": "E0LN4V7EY4"
    }
  ]
}