{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "671d6582-6605-4b97-9790-cc868b1af70f",
          "code": "90421",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1546",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "9dbbe2c0-33dd-4f66-8a38-2e82568c175c"
          ]
        },
        {
          "uuid": "9a24b0e6-6ffd-444c-9ced-e54ff29f75ee",
          "code": "12040175",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/12040175",
          "code_system": "PUBCHEM",
          "references": [
            "9dbbe2c0-33dd-4f66-8a38-2e82568c175c"
          ]
        },
        {
          "uuid": "15d27b77-960d-4552-8db9-2d724a844283",
          "code": "163269-30-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=163269-30-5",
          "code_system": "CAS",
          "references": [
            "9dbbe2c0-33dd-4f66-8a38-2e82568c175c",
            "354da335-ac07-4e56-9f4d-59f629e0ce03"
          ]
        },
        {
          "uuid": "ac1aa3a5-bc70-5b9b-2c7f-20f175af27e8",
          "code": "DTXSID5048051",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5048051",
          "code_system": "EPA CompTox",
          "references": [
            "4d302072-d09c-7af5-83c5-673b841499bb"
          ]
        },
        {
          "uuid": "0e64890a-7b32-45f1-b4f8-34ab687108ce",
          "code": "DYC6660ZZ3",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ed5922e8-466b-22c4-7b94-1229ba175d76",
          "code": "bethoxazin",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/bethoxazin.html",
          "code_system": "ALANWOOD",
          "references": [
            "ef603411-749f-b100-6695-d35781faee29"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "769a6e46-d79c-402e-9191-0d45cda6642e",
          "name": "1,4,2-OXATHIAZINE, 3-BENZO(B)THIEN-2-YL-5,6-DIHYDRO-, 4-OXIDE",
          "stdName": "1,4,2-OXATHIAZINE, 3-BENZO(B)THIEN-2-YL-5,6-DIHYDRO-, 4-OXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e397996-2aca-4204-b61c-617c80c01168",
            "c24d5e4d-ca67-4942-a100-62205b7083d9"
          ],
          "display_name": false
        },
        {
          "uuid": "ebff2b6e-aaa8-4f69-b314-153d226c059c",
          "name": "3-(BENZO(B)THIEN-2-YL)-5,6-DIHYDRO-1,4,2-OXATHIAZINE 4-OXIDE",
          "stdName": "3-(BENZO(B)THIEN-2-YL)-5,6-DIHYDRO-1,4,2-OXATHIAZINE 4-OXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e397996-2aca-4204-b61c-617c80c01168",
            "c24d5e4d-ca67-4942-a100-62205b7083d9"
          ],
          "display_name": false
        },
        {
          "uuid": "af185355-1ea6-4a04-9b41-97e194e7b494",
          "name": "3-BENZO(B)THIEN-2-YL-5,6-DIHYDRO-1,4,2-OXATHIAZINE 4-OXIDE",
          "stdName": "3-BENZO(B)THIEN-2-YL-5,6-DIHYDRO-1,4,2-OXATHIAZINE 4-OXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40b1e1e9-ca01-4e7a-9436-445737011ebb",
            "1aede352-fd07-4f2d-9642-78c46fa4e872"
          ],
          "display_name": false
        },
        {
          "uuid": "4761baf7-4bf3-4fbc-867e-76d5ec1c4edc",
          "name": "BETHOGARD",
          "stdName": "BETHOGARD",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e397996-2aca-4204-b61c-617c80c01168",
            "c24d5e4d-ca67-4942-a100-62205b7083d9"
          ],
          "display_name": false
        },
        {
          "uuid": "4c7cd6aa-e02f-4a36-9f53-b13dde5ab01c",
          "name": "BETHOGUARD",
          "stdName": "BETHOGUARD",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e397996-2aca-4204-b61c-617c80c01168",
            "c24d5e4d-ca67-4942-a100-62205b7083d9"
          ],
          "display_name": false
        },
        {
          "uuid": "85257df6-d25d-4948-8777-39a7543f8d75",
          "name": "BETHOXAZIN",
          "stdName": "BETHOXAZIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "762861de-51f7-4249-8dde-32ef8bfd84a2",
            "e4c574ac-ece9-4b95-8e9e-8348fc28a64a",
            "0e397996-2aca-4204-b61c-617c80c01168",
            "c24d5e4d-ca67-4942-a100-62205b7083d9"
          ],
          "display_name": true
        },
        {
          "uuid": "19a703c2-defd-4732-8081-e626540c7d43",
          "name": "BETHOXAZIN [ISO]",
          "stdName": "BETHOXAZIN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e397996-2aca-4204-b61c-617c80c01168",
            "c24d5e4d-ca67-4942-a100-62205b7083d9"
          ],
          "display_name": false
        },
        {
          "uuid": "e2401b93-b199-4ff3-bcec-247addcd5e68",
          "name": "MICROBAN ADDITIVE GBF",
          "stdName": "MICROBAN ADDITIVE GBF",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e397996-2aca-4204-b61c-617c80c01168",
            "c24d5e4d-ca67-4942-a100-62205b7083d9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "762861de-51f7-4249-8dde-32ef8bfd84a2",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1aede352-fd07-4f2d-9642-78c46fa4e872",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40b1e1e9-ca01-4e7a-9436-445737011ebb",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e397996-2aca-4204-b61c-617c80c01168",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c24d5e4d-ca67-4942-a100-62205b7083d9",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9dbbe2c0-33dd-4f66-8a38-2e82568c175c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391928000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6fc14c3-c3f3-449c-aab9-a48edfb4d46f",
          "citation": "SRS import [DYC6660ZZ3]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=DYC6660ZZ3",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391928000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2d71a69-d75a-4ba7-8dab-a836f507c649",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4c574ac-ece9-4b95-8e9e-8348fc28a64a",
          "citation": "BETHOXAZIN [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4d302072-d09c-7af5-83c5-673b841499bb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=163269-30-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ef603411-749f-b100-6695-d35781faee29",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "354da335-ac07-4e56-9f4d-59f629e0ce03",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "95cdc725-6a7a-49bc-b3ef-22511143e5e7",
          "id": "95cdc725-6a7a-49bc-b3ef-22511143e5e7",
          "molfile": "\n  Marvin  01132107472D          \n\n 16 18  0  0  0  0            999 V2000\n    5.7814   -6.3548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7814   -5.5304    0.0000 S   0  0  0  0  0  0  0  0  0  3  0  0\n    5.0643   -5.1181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0643   -4.2937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7814   -3.8814    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4985   -4.2937    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4985   -5.1181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2155   -5.5304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8843   -5.0481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5530   -5.5304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3552   -5.3573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9106   -5.9733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6539   -6.7627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8472   -6.9311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2965   -6.3145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4676   -6.3145    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 16  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 15  2  0  0  0  0\n 11 12  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)cc(C3=NOCCS3=O)s2",
          "formula": "C11H9NO2S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bde40619-2439-4bf4-ac1a-d72eb441fb6e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "251.3272",
          "optical_activity": "NONE",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "dc66fd56-4c27-45ff-9d65-a63c3a294e0b",
      "version": "4",
      "structure": {
        "id": "83663f67-e503-4ca8-9e2b-79581fc2661c",
        "molfile": "\n  Marvin  01132106492D          \n\n 16 18  0  0  0  0            999 V2000\n    5.7814   -3.8814    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0643   -4.2937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0643   -5.1181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7814   -5.5304    0.0000 S   0  3  0  0  0  0  0  0  0  0  0  0\n    6.4985   -5.1181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4985   -4.2937    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2155   -5.5304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8843   -5.0481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5530   -5.5304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3552   -5.3573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9106   -5.9733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6539   -6.7627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8472   -6.9311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2965   -6.3145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4676   -6.3145    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7814   -6.3548    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  1  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n  7 15  1  0  0  0  0\n  9 14  1  0  0  0  0\n  4 16  1  0  0  0  0\nM  CHG  2   4   1  16  -1\nM  END",
        "smiles": "c1ccc2c(c1)cc(C3=NOCC[S+]3[O-])s2",
        "formula": "C11H9NO2S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "251.3272",
        "optical_activity": "( + / - )",
        "references": [
          "f6fc14c3-c3f3-449c-aab9-a48edfb4d46f",
          "e2d71a69-d75a-4ba7-8dab-a836f507c649"
        ],
        "stereo_centers": 1
      },
      "unii": "DYC6660ZZ3"
    }
  ]
}