{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "37fc5f73-a1ff-4e18-8131-d2654f5f0406",
          "code": "943632-92-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=943632-92-6",
          "code_system": "CAS",
          "references": [
            "ba42858a-09d3-4283-ae0c-9346aa12da96",
            "e32e6c99-2eb9-4815-82cd-6d9d59c5a11a"
          ]
        },
        {
          "uuid": "dccd4044-2120-44e4-b53f-b19954ddc44f",
          "code": "16737295",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16737295",
          "code_system": "PUBCHEM",
          "references": [
            "ba42858a-09d3-4283-ae0c-9346aa12da96"
          ]
        },
        {
          "uuid": "4102f4b2-4312-40d4-835f-03442cc87374",
          "code": "DV9X6303MC",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f019dcde-ec84-416d-b361-02e5c51ba48c",
          "name": "(±)-CYATHUSAL C",
          "stdName": "(+/-)-CYATHUSAL C",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fafea7cf-c0ae-4500-9874-5c2792f0f5ff",
            "7306b9bd-073c-4327-8bc0-1fdd19df8d76"
          ],
          "display_name": false
        },
        {
          "uuid": "8f63668d-5170-4902-af04-0070d1abdecb",
          "name": "1H,6H-PYRANO(4,3-C)(2)BENZOPYRAN-7-CARBOXALDEHYDE, 9,10-DIHYDROXY-8-METHOXY-6-(1-METHYLETHOXY)-1-OXO-3-(1E)-1-PROPEN-1-YL-",
          "stdName": "1H,6H-PYRANO(4,3-C)(2)BENZOPYRAN-7-CARBOXALDEHYDE, 9,10-DIHYDROXY-8-METHOXY-6-(1-METHYLETHOXY)-1-OXO-3-(1E)-1-PROPEN-1-YL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fafea7cf-c0ae-4500-9874-5c2792f0f5ff",
            "771c2fd9-cba7-4063-92d6-0bf0e0421e97"
          ],
          "display_name": false
        },
        {
          "uuid": "65e5d777-4ffb-4ba6-afe2-51ce8cfb44f6",
          "name": "CYATHUSAL C",
          "stdName": "CYATHUSAL C",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3788b33b-7abf-4f79-9d67-19a2c03bd281",
            "fafea7cf-c0ae-4500-9874-5c2792f0f5ff",
            "7f4776ec-cd6c-4592-bb12-bf1b1c14869b"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f1b76ed7-17ac-473c-b75b-2c8209c62a59",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "b8b3878e-88cf-459b-8453-3fff6bfa8d31",
          "name": "CYATHUSAL C, (±)-",
          "stdName": "CYATHUSAL C, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fafea7cf-c0ae-4500-9874-5c2792f0f5ff",
            "7306b9bd-073c-4327-8bc0-1fdd19df8d76"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3788b33b-7abf-4f79-9d67-19a2c03bd281",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fafea7cf-c0ae-4500-9874-5c2792f0f5ff",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "771c2fd9-cba7-4063-92d6-0bf0e0421e97",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7306b9bd-073c-4327-8bc0-1fdd19df8d76",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba42858a-09d3-4283-ae0c-9346aa12da96",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390701000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2654ec70-f780-4329-8c0f-c3f5e27ea4a0",
          "citation": "SRS import [DV9X6303MC]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=DV9X6303MC",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390701000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f4776ec-cd6c-4592-bb12-bf1b1c14869b",
          "citation": "CYATHUSAL C [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e32e6c99-2eb9-4815-82cd-6d9d59c5a11a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9de6189c-0541-408e-b988-44b9d55e505e",
          "id": "9de6189c-0541-408e-b988-44b9d55e505e",
          "molfile": "\n  Marvin  01132108122D          \n\n 28 30  0  0  0  0            999 V2000\n    4.1778   -5.6424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8924   -6.0547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6070   -5.6424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6070   -4.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8924   -4.4055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3216   -4.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3216   -3.5810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0363   -4.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0363   -5.6424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7234   -6.0547    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.7234   -6.8792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4380   -7.2915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1526   -6.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4380   -8.1161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4380   -5.6424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4380   -4.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1526   -4.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1526   -3.5810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8672   -3.1687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5819   -3.5810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2965   -3.1687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4380   -3.1687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7509   -3.5810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0363   -3.1687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7509   -4.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3216   -6.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3216   -6.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6070   -7.2915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 26  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  2  0  0  0  0\n 25  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 26  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 15  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 25  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 18 22  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  2  0  0  0  0\n 25 23  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  2  0  0  0  0\nM  END",
          "smiles": "C/C=C/c1cc2c(-c3c(c(C=O)c(c(c3O)O)OC)C(OC(C)C)O2)c(=O)o1",
          "formula": "C20H20O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ddf74a4a-80f2-4113-a6a9-11105475d942"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "388.3688",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e483efdc-d7f4-4e6b-9593-bea8210dee65",
      "version": "3",
      "structure": {
        "id": "cc8621e9-fbd0-4051-8a19-1748aaac2f53",
        "molfile": "\n  Marvin  01132110342D          \n\n 28 30  0  0  0  0            999 V2000\n    8.4380   -4.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7509   -4.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0363   -4.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0363   -5.6424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7234   -6.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4380   -5.6424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7234   -6.8792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4380   -7.2915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1526   -6.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4380   -8.1161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3216   -6.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6070   -5.6424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6070   -4.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3216   -4.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3216   -3.5810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8924   -4.4055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8924   -6.0547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1778   -5.6424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3216   -6.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6070   -7.2915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7509   -3.5810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4380   -3.1687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1526   -3.5810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1526   -4.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8672   -3.1687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5819   -3.5810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2965   -3.1687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0363   -3.1687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  1  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  4 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n  3 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 12 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 11 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n  2 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  2  0  0  0  0\n  1 24  1  0  0  0  0\n 23 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 21 28  2  0  0  0  0\nM  END",
        "smiles": "C/C=C/c1cc2c(-c3c(c(C=O)c(c(c3O)O)OC)C(OC(C)C)O2)c(=O)o1",
        "formula": "C20H20O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "388.3688",
        "optical_activity": "( + / - )",
        "references": [
          "771c2fd9-cba7-4063-92d6-0bf0e0421e97",
          "2654ec70-f780-4329-8c0f-c3f5e27ea4a0"
        ],
        "stereo_centers": 1
      },
      "unii": "DV9X6303MC"
    }
  ]
}