{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a5ce82bd-1e85-4f81-84a7-d2809bcdda13",
          "code": "3567-69-9",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3567-69-9",
          "code_system": "CAS",
          "references": [
            "7f5d5c6f-908f-496a-ae6d-1ebf02a549b0",
            "b5215ec3-3605-4f7f-b6ba-ddec199c2c94"
          ]
        },
        {
          "uuid": "5bfbff50-4204-4ccd-8e07-af41360e52b7",
          "code": "AZORUBINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Azorubine",
          "code_system": "WIKIPEDIA",
          "references": [
            "7f5d5c6f-908f-496a-ae6d-1ebf02a549b0"
          ]
        },
        {
          "uuid": "9d5225e0-a3b4-4a05-ba2c-4c461687a053",
          "code": "SUB88089",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "7f5d5c6f-908f-496a-ae6d-1ebf02a549b0"
          ]
        },
        {
          "uuid": "d490c7c0-01f9-4c8d-8da2-81df52d18178",
          "code": "E-122",
          "comments": "Codex Alimentarius|Functional Classification|Colour",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=91",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "7f5d5c6f-908f-496a-ae6d-1ebf02a549b0"
          ]
        },
        {
          "uuid": "fdb18033-c03d-4e2b-b263-f6944fd23963",
          "code": "E122",
          "type": "PRIMARY",
          "url": "http://www.food-info.net/uk/e/e122.htm",
          "code_system": "EU FOOD ADDITIVES",
          "references": [
            "7f5d5c6f-908f-496a-ae6d-1ebf02a549b0"
          ]
        },
        {
          "uuid": "df15805c-607f-4d72-a5e4-1888e67543f9",
          "code": "E-122",
          "comments": "JECTFA|Functional Classification|Colour",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=122",
          "code_system": "JECFA EVALUATION",
          "references": [
            "7f5d5c6f-908f-496a-ae6d-1ebf02a549b0"
          ]
        },
        {
          "uuid": "f799a76d-b82e-41ab-a6e4-d36ce06018f7",
          "code": "222-657-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.598",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7f5d5c6f-908f-496a-ae6d-1ebf02a549b0"
          ]
        },
        {
          "uuid": "3e156d4c-51d4-4180-9457-8ee6271b6fd5",
          "code": "1363916",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1363916/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7f5d5c6f-908f-496a-ae6d-1ebf02a549b0"
          ]
        },
        {
          "uuid": "2fe61e46-cc44-420f-857c-68b0dc91b3d9",
          "code": "SUB29042",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "7f5d5c6f-908f-496a-ae6d-1ebf02a549b0"
          ]
        },
        {
          "uuid": "6397610e-15f0-92c8-2899-37f757547ef1",
          "code": "3567-69-9",
          "type": "PRIMARY",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+3567-69-9",
          "code_system": "HSDB",
          "references": [
            "40dd3159-cdb6-41f7-aafc-69afc556454f"
          ]
        },
        {
          "uuid": "6e084eb8-4936-4021-bc73-0b45a01f35de",
          "code": "m11773",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11773",
          "code_system": "MERCK INDEX",
          "references": [
            "5d663482-8534-438f-d7bc-1b611bb2215c"
          ]
        },
        {
          "uuid": "b8d5f36b-7616-ee3f-16fc-e23160e50626",
          "code": "1046125",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1046125",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "6c18e35f-cbb6-f99a-5590-7615f6252c94"
          ]
        },
        {
          "uuid": "cccfb2f2-ed23-42ea-89e0-53f743fdba7b",
          "code": "DR4641L47F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1c2cc1e5-d7ed-241d-4db8-7ad6bfef13c0",
          "code": "100000093138",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8cf04d96-642b-e3ee-ec3e-046c186a4c60"
          ]
        },
        {
          "uuid": "7436634e-077d-f103-1e74-b9659f0743c3",
          "code": "DTXSID3021225",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3021225",
          "code_system": "EPA CompTox",
          "references": [
            "00918e69-7dbc-b81c-386d-7bbd3147cc46"
          ]
        },
        {
          "uuid": "bad8048d-a665-5e65-ad72-1fac00c18a63",
          "code": "7807",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=7807",
          "code_system": "NSC",
          "references": [
            "26612128-8c0d-b6a0-0efb-e85cb4c31102"
          ]
        },
        {
          "uuid": "d7fedb33-73de-aabb-7dc1-b8723214f574",
          "code": "DR4641L47F",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=DR4641L47F",
          "code_system": "DAILYMED",
          "references": [
            "c6966927-b529-46f2-c01d-cd5350eba821"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "26ce8099-42d4-4b5d-96e6-638dc5e8a205",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "0c4f239d-b216-4902-8dea-86fa6af3add4",
            "refuuid": "db1eb193-c101-4c89-a7d3-30dae005e12f",
            "name": "2-(4-SULFO-1-NAPHTHYLAZO)-1-NAPHTHOL-4-SULFONIC ACID",
            "unii": "83344C2N7U",
            "linking_id": "83344C2N7U",
            "ref_pname": "2-(4-SULFO-1-NAPHTHYLAZO)-1-NAPHTHOL-4-SULFONIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e5f677bf-0bfa-4db3-95e6-ea8fa6e81fd7",
          "name": "1-NAPHTHALENESULFONIC ACID, 4-HYDROXY-3-((4-SULFO-1-NAPHTHALENYL)AZO)-, DISODIUM SALT",
          "stdName": "1-NAPHTHALENESULFONIC ACID, 4-HYDROXY-3-((4-SULFO-1-NAPHTHALENYL)AZO)-, DISODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a34903f3-e644-4d85-8b13-9301769e0676"
          ],
          "display_name": false
        },
        {
          "uuid": "c07eaea5-8458-4f0d-af43-2075114720ea",
          "name": "1-NAPHTHALENESULFONIC ACID, 4-HYDROXY-3-(2-(4-SULFO-1-NAPHTHALENYL)DIAZENYL)-, SODIUM SALT (1:2)",
          "stdName": "1-NAPHTHALENESULFONIC ACID, 4-HYDROXY-3-(2-(4-SULFO-1-NAPHTHALENYL)DIAZENYL)-, SODIUM SALT (1:2)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a34903f3-e644-4d85-8b13-9301769e0676"
          ],
          "display_name": false
        },
        {
          "uuid": "4f3e5770-749d-40c0-aae9-882fd1c2f27a",
          "name": "ACID RED 14",
          "stdName": "ACID RED 14",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "faea6967-7a3b-470a-bf33-06c0658b3f28",
            "f85bd357-6027-4899-9072-49435f5b6979",
            "39e9bd67-e360-48d9-b60b-ce354d8f3ce8"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4f047e60-9ca3-44a0-a0a9-f917c502486e",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "b84dc6b1-fbe6-4f4b-bc91-9e0a799d516f",
          "name": "ACID RUBINE",
          "stdName": "ACID RUBINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1186f59-8dab-4edb-a1ac-7ea2963cd085"
          ],
          "display_name": false
        },
        {
          "uuid": "ddea3d2b-1f66-4413-a3a6-70b57c128fac",
          "name": "AZORUBIN S",
          "stdName": "AZORUBIN S",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f85bd357-6027-4899-9072-49435f5b6979"
          ],
          "display_name": false
        },
        {
          "uuid": "12802918-c68c-40b0-aad5-ecf00f87bc56",
          "name": "AZORUBINE",
          "stdName": "AZORUBINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f85bd357-6027-4899-9072-49435f5b6979"
          ],
          "display_name": false
        },
        {
          "uuid": "b17c599d-f725-2c5b-da2e-95597f95ef70",
          "name": "AZORUBINE [MI]",
          "stdName": "AZORUBINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5d663482-8534-438f-d7bc-1b611bb2215c"
          ],
          "display_name": false
        },
        {
          "uuid": "57a77764-dca4-215f-a997-1765889b7b7a",
          "name": "AZORUBINE [USP-RS]",
          "stdName": "AZORUBINE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a82d4118-3a9c-8e59-264b-4678fea9b58a"
          ],
          "display_name": false
        },
        {
          "uuid": "4eb9b42c-e78f-4883-96f5-730a0d6631cf",
          "name": "C.I. 14720",
          "stdName": "C.I. 14720",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f85bd357-6027-4899-9072-49435f5b6979"
          ],
          "display_name": false
        },
        {
          "uuid": "7e5c9d12-c87f-4898-a9a3-4ba251acf496",
          "name": "C.I. ACID RED 14",
          "stdName": "C.I. ACID RED 14",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bf8bce3f-26aa-44c2-9323-757eb28135d2",
            "6f131359-09f5-4ca1-aeac-88f55dec512d",
            "8a603470-b24d-4797-a40d-25fc3afc6123"
          ],
          "display_name": false
        },
        {
          "uuid": "29b0b494-8c01-4b10-a167-99af69323a64",
          "name": "C.I. ACID RED 14 [HSDB]",
          "stdName": "C.I. ACID RED 14 [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f131359-09f5-4ca1-aeac-88f55dec512d"
          ],
          "display_name": false
        },
        {
          "uuid": "5baafae4-c6a4-4698-8a6b-56d28114c5f7",
          "name": "CARMOISINE",
          "stdName": "CARMOISINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f85bd357-6027-4899-9072-49435f5b6979",
            "6529b3e0-35d5-4dc9-a296-360289843577",
            "6b55233e-856e-46b7-a192-7c75b81ae14a"
          ],
          "display_name": true
        },
        {
          "uuid": "13323f0c-06e9-42de-814d-a21569ec1389",
          "name": "CARMOISINE (E122)",
          "stdName": "CARMOISINE (E122)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "265777bf-8ff4-4f66-a27a-738abe53574a"
          ],
          "display_name": false
        },
        {
          "uuid": "d0dd2826-39f8-410e-9d69-1ad7e7805769",
          "name": "CARMOISINE E122",
          "stdName": "CARMOISINE E122",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "265777bf-8ff4-4f66-a27a-738abe53574a"
          ],
          "display_name": false
        },
        {
          "uuid": "18491ae7-5f2a-6422-d23a-2383654bab6a",
          "name": "CARMOISINE [IARC]",
          "stdName": "CARMOISINE [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de13d214-d099-d901-c8d6-cbcbc4c9f059"
          ],
          "display_name": false
        },
        {
          "uuid": "3b6ce636-9cae-4de0-9791-bfab24262dab",
          "name": "CARMOISINE [MART.]",
          "stdName": "CARMOISINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b55233e-856e-46b7-a192-7c75b81ae14a"
          ],
          "display_name": false
        },
        {
          "uuid": "020de1c7-727e-4768-8801-d4358a6d8881",
          "name": "CI 14720",
          "stdName": "CI 14720",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "b1186f59-8dab-4edb-a1ac-7ea2963cd085",
            "39e9bd67-e360-48d9-b60b-ce354d8f3ce8",
            "f84a165d-611e-4242-8e29-26f5690e7c35"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ef4cdce8-d5c3-46ce-b4f6-12ce803999fb",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "6f8b6a86-4616-4cbf-808c-7da064fb2d7e",
          "name": "CI ACID RED 14",
          "stdName": "CI ACID RED 14",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75f97ff9-27ee-4eaa-ae88-983831d4e357"
          ],
          "display_name": false
        },
        {
          "uuid": "8f083794-d214-454d-a5ce-e6eae29ec76d",
          "name": "CI-(1975)NO.14720",
          "stdName": "CI-(1975)NO.14720",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f5aa5c9-5be6-4183-9d65-b3afc5217f9c"
          ],
          "display_name": false
        },
        {
          "uuid": "ecf9cef6-3d38-40fc-9090-29b70f226dbe",
          "name": "CI-FOOD RED 3",
          "stdName": "CI-FOOD RED 3",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f5aa5c9-5be6-4183-9d65-b3afc5217f9c"
          ],
          "display_name": false
        },
        {
          "uuid": "b06f5d70-10dc-4934-b632-d1e1525e2463",
          "name": "E-122",
          "stdName": "E-122",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6af6389e-04f6-4e21-ad77-5b34e3ec8eaa"
          ],
          "display_name": false
        },
        {
          "uuid": "ffcd3fcd-d367-471a-9b52-f151f8f04540",
          "name": "E122",
          "stdName": "E122",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6af6389e-04f6-4e21-ad77-5b34e3ec8eaa"
          ],
          "display_name": false
        },
        {
          "uuid": "24cdd086-0f42-44f0-bd8e-1cdddf28d058",
          "name": "FOOD RED 3",
          "stdName": "FOOD RED 3",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1186f59-8dab-4edb-a1ac-7ea2963cd085"
          ],
          "display_name": false
        },
        {
          "uuid": "fad61317-b92c-4b22-a2c1-91db130b81e7",
          "name": "INS NO.122",
          "stdName": "INS NO.122",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f5aa5c9-5be6-4183-9d65-b3afc5217f9c"
          ],
          "display_name": false
        },
        {
          "uuid": "dc372cea-55ed-4f4d-831e-26441d828581",
          "name": "INS-122",
          "stdName": "INS-122",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f5aa5c9-5be6-4183-9d65-b3afc5217f9c"
          ],
          "display_name": false
        },
        {
          "uuid": "f1bc1d60-9555-44a3-9e4e-1373ad59e432",
          "name": "NSC-7807",
          "stdName": "NSC-7807",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "29afefb6-4f67-446b-a910-de3c363c88b4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f85bd357-6027-4899-9072-49435f5b6979",
          "citation": "wikipedia",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6af6389e-04f6-4e21-ad77-5b34e3ec8eaa",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b55233e-856e-46b7-a192-7c75b81ae14a",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "39e9bd67-e360-48d9-b60b-ce354d8f3ce8",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6f131359-09f5-4ca1-aeac-88f55dec512d",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1186f59-8dab-4edb-a1ac-7ea2963cd085",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a34903f3-e644-4d85-8b13-9301769e0676",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "75f97ff9-27ee-4eaa-ae88-983831d4e357",
          "citation": "ICSAS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6f5aa5c9-5be6-4183-9d65-b3afc5217f9c",
          "citation": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=91",
          "url": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=91",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "265777bf-8ff4-4f66-a27a-738abe53574a",
          "citation": "evmpd",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a603470-b24d-4797-a40d-25fc3afc6123",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "29afefb6-4f67-446b-a910-de3c363c88b4",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f5d5c6f-908f-496a-ae6d-1ebf02a549b0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390881000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c80778cb-5188-4c96-8f6d-fbe3c16db442",
          "citation": "SRS import [DR4641L47F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=DR4641L47F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390881000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6529b3e0-35d5-4dc9-a296-360289843577",
          "citation": "CARMOISINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "faea6967-7a3b-470a-bf33-06c0658b3f28",
          "citation": "ACID RED 14 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bf8bce3f-26aa-44c2-9323-757eb28135d2",
          "citation": "C.I. ACID RED 14 [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f84a165d-611e-4242-8e29-26f5690e7c35",
          "citation": "CI 14720 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "40dd3159-cdb6-41f7-aafc-69afc556454f",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+3567-69-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "250a9914-261b-3f37-a6d6-43044b657f7d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3567-69-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5d663482-8534-438f-d7bc-1b611bb2215c",
          "citation": "MI",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "de13d214-d099-d901-c8d6-cbcbc4c9f059",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "a82d4118-3a9c-8e59-264b-4678fea9b58a",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "b5215ec3-3605-4f7f-b6ba-ddec199c2c94",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6c18e35f-cbb6-f99a-5590-7615f6252c94",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "26612128-8c0d-b6a0-0efb-e85cb4c31102",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c6966927-b529-46f2-c01d-cd5350eba821",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "00918e69-7dbc-b81c-386d-7bbd3147cc46",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "8cf04d96-642b-e3ee-ec3e-046c186a4c60",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8ffb78cd-c056-4c68-8468-5be0e4f95c19",
          "id": "8ffb78cd-c056-4c68-8468-5be0e4f95c19",
          "molfile": "\n  Marvin  01132107282D          \n\n  1  0  0  0  0  0            999 V2000\n    3.8781   -5.0553    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "9659391b-49c6-47cf-a5ae-122bbcc72fbc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "4219351a-904e-4ad9-a21b-79355bd9c872",
          "id": "4219351a-904e-4ad9-a21b-79355bd9c872",
          "molfile": "\n  Marvin  01132103292D          \n\n 31 34  0  0  0  0            999 V2000\n    2.3117   -2.5954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7285   -2.0123    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1997   -2.6448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0566   -1.5376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1404   -1.2974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9687   -1.2974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3807   -0.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2043   -0.5826    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6162   -1.2974    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4399   -1.2974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8519   -0.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6756   -0.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0874   -1.2974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6756   -2.0123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0874   -2.7272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6756   -3.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8519   -3.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4399   -2.7272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8519   -2.0123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9158   -1.2974    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1252   -0.5003    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.7256   -1.4425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8407   -2.1176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9687    0.1323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3807    0.8425    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.1404    0.1323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7285    0.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9048    0.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4930    0.1323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9048   -0.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7285   -0.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 31  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n 24  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 19 10  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 20  1  0  0  0  0\n 14 15  1  0  0  0  0\n 19 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  2  0  0  0  0\n 20 23  2  0  0  0  0\n 24 25  1  0  0  0  0\n 26 24  2  0  0  0  0\n 27 26  1  0  0  0  0\n 26 31  1  0  0  0  0\n 28 27  2  0  0  0  0\n 29 28  1  0  0  0  0\n 30 29  2  0  0  0  0\n 31 30  1  0  0  0  0\nM  CHG  2  21  -1  25  -1\nM  END",
          "smiles": "c1ccc2c(c1)c(ccc2S(=O)(=O)[O-])/N=N/c3cc(c4ccccc4c3[O-])S(=O)(=O)O",
          "formula": "C20H12N2O7S2",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "21e19988-c07b-42ff-b16b-c2b5917ee2cd"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "456.4514",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d206a6b5-9d0d-4f52-a01f-f2729fc8119e",
      "version": "21",
      "structure": {
        "id": "332cf406-835d-4f6c-845d-2a65c663ea3c",
        "molfile": "\n  Marvin  01132102442D          \n\n 33 34  0  0  0  0            999 V2000\n    8.7256   -1.4425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9158   -1.2974    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8407   -2.1176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1252   -0.5003    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.0874   -1.2974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6756   -2.0123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0874   -2.7272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6756   -3.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8519   -3.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4399   -2.7272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8519   -2.0123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4399   -1.2974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6162   -1.2974    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2043   -0.5826    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3807   -0.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9687    0.1323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3807    0.8425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1404    0.1323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7285    0.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9048    0.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4930    0.1323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9048   -0.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7285   -0.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1404   -1.2974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7285   -2.0123    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1997   -2.6448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0566   -1.5376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3117   -2.5954    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.9687   -1.2974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8519   -0.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6756   -0.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8781   -5.0553    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    3.8781   -5.0553    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 16  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 18 23  1  0  0  0  0\n 24 23  2  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 25 27  2  0  0  0  0\n 25 28  1  0  0  0  0\n 29 24  1  0  0  0  0\n 15 29  2  0  0  0  0\n 12 30  1  0  0  0  0\n 30 31  2  0  0  0  0\n 31  5  1  0  0  0  0\n 11  6  1  0  0  0  0\n  2  1  2  0  0  0  0\nM  CHG  4   4  -1  28  -1  32   1  33   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  32  33\nM  SPA   1  1  32\nM  SDI   1  4    3.4581   -5.4753    3.4581   -4.6353\nM  SDI   1  4    4.2981   -4.6353    4.2981   -5.4753\nM  SMT   1 2\nM  END",
        "smiles": "c1ccc2c(c1)c(ccc2S(=O)(=O)[O-])/N=N/c3cc(c4ccccc4c3O)S(=O)(=O)[O-].[Na+].[Na+]",
        "formula": "C20H12N2O7S2.2Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "502.431",
        "optical_activity": "NONE",
        "references": [
          "c80778cb-5188-4c96-8f6d-fbe3c16db442",
          "a34903f3-e644-4d85-8b13-9301769e0676"
        ],
        "stereo_centers": 0
      },
      "unii": "DR4641L47F"
    }
  ]
}