{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "456f1ee2-48cc-417c-84b7-1e6604b55543",
          "code": "141-18-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=141-18-4",
          "code_system": "CAS",
          "references": [
            "0e8d2398-94cf-4b68-8a11-a7bdce704d76",
            "50292f26-4fc3-497b-acc4-31e646a94986"
          ]
        },
        {
          "uuid": "871af234-6824-4412-b291-150ea76e90fd",
          "code": "205-466-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.970",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0e8d2398-94cf-4b68-8a11-a7bdce704d76"
          ]
        },
        {
          "uuid": "993c516e-062e-4d68-989c-42714b2e03a7",
          "code": "8837",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8837",
          "code_system": "PUBCHEM",
          "references": [
            "0e8d2398-94cf-4b68-8a11-a7bdce704d76"
          ]
        },
        {
          "uuid": "0ef9595f-5796-2e58-50db-d512e1ea7f34",
          "code": "DTXSID2051712",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2051712",
          "code_system": "EPA CompTox",
          "references": [
            "8179f760-e8f8-0787-17fa-ee328cd4688b"
          ]
        },
        {
          "uuid": "352f13b3-57f1-93fb-e76f-b01bb5c521fb",
          "code": "4813",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=4813",
          "code_system": "NSC",
          "references": [
            "5d6bd508-6941-533f-ce8f-269b8f2d42ad"
          ]
        },
        {
          "uuid": "ada14dec-ae44-4e1e-bf22-d3cee820f4e7",
          "code": "DQT9MJU6BL",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1a97f012-bd43-41c1-9634-5627c3d044f5",
          "name": "Adipol BCA",
          "stdName": "ADIPOL BCA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50292f26-4fc3-497b-acc4-31e646a94986"
          ],
          "display_name": false
        },
        {
          "uuid": "76fa546d-8457-4776-92d1-13b029a73bf1",
          "name": "D-931",
          "stdName": "D-931",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50292f26-4fc3-497b-acc4-31e646a94986"
          ],
          "display_name": false
        },
        {
          "uuid": "d10de182-6a5b-4c7a-9cef-e9891019512f",
          "name": "Di(butoxyethyl) adipate",
          "stdName": "DI(BUTOXYETHYL) ADIPATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50292f26-4fc3-497b-acc4-31e646a94986"
          ],
          "display_name": true
        },
        {
          "uuid": "82af2af0-2c22-4407-a9f1-fda412ca3177",
          "name": "Hexanedioic acid, 1,6-bis(2-butoxyethyl) ester",
          "stdName": "HEXANEDIOIC ACID, 1,6-BIS(2-BUTOXYETHYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50292f26-4fc3-497b-acc4-31e646a94986"
          ],
          "display_name": false
        },
        {
          "uuid": "3ac60dbd-2580-498b-a5a7-318d18509dcc",
          "name": "Hexanedioic acid, bis(2-butoxyethyl) ester",
          "stdName": "HEXANEDIOIC ACID, BIS(2-BUTOXYETHYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50292f26-4fc3-497b-acc4-31e646a94986"
          ],
          "display_name": false
        },
        {
          "uuid": "d97f77f6-7fdd-4eb3-8bc6-df688a8da6e4",
          "name": "NSC-4813",
          "stdName": "NSC-4813",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f613497-ee8b-4689-8965-88aff8d318c4",
            "d7d357e3-cb43-4112-8bec-db7fe3fe565a"
          ],
          "display_name": false
        },
        {
          "uuid": "89b47292-6322-4d93-92f7-455cf5293fe3",
          "name": "Plasthall 203",
          "stdName": "PLASTHALL 203",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50292f26-4fc3-497b-acc4-31e646a94986"
          ],
          "display_name": false
        },
        {
          "uuid": "6e702f17-a44e-4d65-96a1-e12c90e96a85",
          "name": "SDX-3789",
          "stdName": "SDX-3789",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50292f26-4fc3-497b-acc4-31e646a94986"
          ],
          "display_name": false
        },
        {
          "uuid": "c0c65028-2a86-4188-b02c-d6cafd4b2f46",
          "name": "Staflex DBEA",
          "stdName": "STAFLEX DBEA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50292f26-4fc3-497b-acc4-31e646a94986"
          ],
          "display_name": false
        },
        {
          "uuid": "7afa8c72-12e4-4701-879b-774116e64019",
          "name": "Sunkonol 0862-0",
          "stdName": "SUNKONOL 0862-0",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50292f26-4fc3-497b-acc4-31e646a94986"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d7d357e3-cb43-4112-8bec-db7fe3fe565a",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f613497-ee8b-4689-8965-88aff8d318c4",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e8d2398-94cf-4b68-8a11-a7bdce704d76",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392810000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7287c36d-6ba3-4bf4-bc27-b2ddf744732b",
          "citation": "CHEMID RECORD 141-18-4",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8179f760-e8f8-0787-17fa-ee328cd4688b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=141-18-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5d6bd508-6941-533f-ce8f-269b8f2d42ad",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "50292f26-4fc3-497b-acc4-31e646a94986",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5237dbff-b1ca-4ef3-ab4b-00f24d54071e",
          "id": "5237dbff-b1ca-4ef3-ab4b-00f24d54071e",
          "molfile": "\n  Marvin  01132104172D          \n\n 24 23  0  0  0  0            999 V2000\n    6.5452    0.2463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8498    0.2463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4658   -0.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6617   -0.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2415    0.2426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3722    0.2426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9737   -0.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1117   -0.4817    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6842    0.2426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1117    0.9707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8150    0.2426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3949   -0.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4782   -0.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8729    0.2426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7242    0.2426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1479    0.9707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1733   -0.4817    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0317   -0.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4266    0.2426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.2742    0.2426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.6943   -0.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.4441   -0.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.6071    0.2209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -6.3496    0.2209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "CCCCOCCOC(=O)CCCCC(=O)OCCOCCCC",
          "formula": "C18H34O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8e0af624-103b-447f-95ce-407e483008f8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "346.4597",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7f7bbacf-9dbb-4d12-83b3-4de33936ab4a",
      "version": "8",
      "structure": {
        "id": "7f01c5c4-645e-49df-830c-c8f0fb79fec2",
        "molfile": "\n   JSDraw205152318532D\n\n 24 23  0  0  0  0              0 V2000\n   28.5557   -7.9834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1818   -7.2447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8551   -8.0653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4811   -7.3266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1543   -8.1472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7803   -7.4085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4536   -8.2291    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.0796   -7.4905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7528   -8.3110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3788   -7.5724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0521   -8.3930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6781   -7.6543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3514   -8.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9774   -7.7362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7330   -5.8493    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   29.8824   -7.1628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   31.2564   -7.9015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   32.5832   -7.0809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   33.9572   -7.8196    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   35.2839   -6.9990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   36.6579   -7.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   37.9846   -6.9171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   39.3586   -7.6558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.6030   -9.5427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  6 15  2  0  0  0  0\n  1 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n  1 24  2  0  0  0  0\nM  END",
        "smiles": "CCCCOCCOC(=O)CCCCC(=O)OCCOCCCC",
        "formula": "C18H34O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "346.4597",
        "optical_activity": "NONE",
        "references": [
          "7287c36d-6ba3-4bf4-bc27-b2ddf744732b",
          "50292f26-4fc3-497b-acc4-31e646a94986"
        ],
        "stereo_centers": 0
      },
      "unii": "DQT9MJU6BL"
    }
  ]
}