{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6058b315-d8e3-4ee7-8e09-dfd62e0fa823",
          "code": "208535-04-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=208535-04-0",
          "code_system": "CAS",
          "references": [
            "09ba906d-0e72-4cd3-a2c3-90313f7f5d79",
            "ab780e15-1511-4f85-a17e-b0d3b9ada6d6"
          ]
        },
        {
          "uuid": "3591b191-9b26-4fc1-a197-47ebe79a0953",
          "code": "9794442",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9794442",
          "code_system": "PUBCHEM",
          "references": [
            "09ba906d-0e72-4cd3-a2c3-90313f7f5d79"
          ]
        },
        {
          "uuid": "22a2a071-881d-5e11-bc94-bb0ffd3c75a1",
          "code": "DTXSID001335002",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID001335002",
          "code_system": "EPA CompTox",
          "references": [
            "73f5f223-4a6c-ecd0-90a4-f1761bc8268d"
          ]
        },
        {
          "uuid": "28fac730-6c71-a710-3a41-2a70d349c147",
          "code": "2912 (Number of products:45)",
          "comments": "Dietary Supplement Label Database|chemical|Creatine Pyruvate",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2912&item=Creatine Pyruvate",
          "code_system": "DSLD",
          "references": [
            "5716fd81-3d5a-ca49-3b90-d4baa95dec94"
          ]
        },
        {
          "uuid": "0423145b-b54f-41b4-bfd1-cbf6589b161c",
          "code": "DPM6MX7AJD",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "5f8be09e-82ca-480a-adb4-72c41fd84a1c",
          "type": "PARENT->SALT/SOLVATE",
          "references": [
            "e52ff299-a855-ab15-0641-34654cede9f1"
          ],
          "related_substance": {
            "uuid": "1d783672-49f5-47f0-a7de-c39ae741409c",
            "refuuid": "c645510d-569f-42e8-b450-24c453339c9c",
            "name": "PYRUVATE ION",
            "unii": "HO43T60JMG",
            "linking_id": "HO43T60JMG",
            "ref_pname": "PYRUVATE ION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5a71faf1-d70f-4d59-942b-808b776b284f",
          "name": "CREATINE PYRUVATE",
          "stdName": "CREATINE PYRUVATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e52ff299-a855-ab15-0641-34654cede9f1",
            "e77f9f1b-e5b5-42bb-bd77-3a991d6b0bf7"
          ],
          "display_name": true
        },
        {
          "uuid": "86018c81-358b-245b-8d16-4ee2a6c09dc7",
          "name": "GLYCINE, N-(AMINOIMINOMETHYL)-N-METHYL-, 2-OXOPROPANOATE (1:1)",
          "stdName": "GLYCINE, N-(AMINOIMINOMETHYL)-N-METHYL-, 2-OXOPROPANOATE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e52ff299-a855-ab15-0641-34654cede9f1"
          ],
          "display_name": false
        },
        {
          "uuid": "75cd3812-8531-5b00-d50d-f8f8d5dd6242",
          "name": "PROPANOIC ACID, 2-OXO-, COMPD. WITH N-(AMINOIMINOMETHYL)-N-METHYLGLYCINE (1:1)",
          "stdName": "PROPANOIC ACID, 2-OXO-, COMPD. WITH N-(AMINOIMINOMETHYL)-N-METHYLGLYCINE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e52ff299-a855-ab15-0641-34654cede9f1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e77f9f1b-e5b5-42bb-bd77-3a991d6b0bf7",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3035ee33-8a86-48de-bbd5-25c9ce5e7a10",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09ba906d-0e72-4cd3-a2c3-90313f7f5d79",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392886000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca291cd1-25bf-47ea-835b-d3adbcbf29df",
          "citation": "CHEMID RECORD 208535-04-0",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e52ff299-a855-ab15-0641-34654cede9f1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5716fd81-3d5a-ca49-3b90-d4baa95dec94",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ab780e15-1511-4f85-a17e-b0d3b9ada6d6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "73f5f223-4a6c-ecd0-90a4-f1761bc8268d",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0845db47-a4bc-4930-a32f-4d71819426d7",
          "id": "0845db47-a4bc-4930-a32f-4d71819426d7",
          "molfile": "\n  Marvin  01132100422D          \n\n  6  5  0  0  0  0            999 V2000\n   -3.2855   -1.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5710   -2.3013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5710   -3.1263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8566   -1.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1421   -2.3013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8566   -1.0638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)C(=O)O",
          "formula": "C3H4O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5b30dd67-ba72-45ea-bbbe-14f382c8befc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "88.0622",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "509b66cb-d294-48f7-adfe-78ced181bbce",
          "id": "509b66cb-d294-48f7-adfe-78ced181bbce",
          "molfile": "\n  Marvin  01132104122D          \n\n  9  8  0  0  0  0            999 V2000\n   -3.1380    1.2552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1380    0.4302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4236    0.0177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7091    0.4302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9946    0.0177    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7091    1.2552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.8525    0.0177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.5670    0.4302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.8525   -0.8073    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  7  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  2  0  0  0  0\nM  END",
          "smiles": "CN(CC(=O)O)C(=N)N",
          "formula": "C4H9N3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1039bbb5-7710-479e-867d-197532d789ff"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "131.1333",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "742169c7-a2ab-41e5-bba6-7477d97ab750",
      "version": "7",
      "structure": {
        "id": "b3f150dc-0123-450e-b256-41936cf81cae",
        "molfile": "\n  Marvin  01132109192D          \n\n 15 13  0  0  0  0            999 V2000\n   -4.5670    0.4302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.8525    0.0177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1380    0.4302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4236    0.0177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7091    0.4302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9946    0.0177    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.8525   -0.8073    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1380    1.2552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7091    1.2552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2855   -1.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5710   -2.3013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8566   -1.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1421   -2.3013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8566   -1.0638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5710   -3.1263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  5  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 11 15  2  0  0  0  0\nM  END",
        "smiles": "CN(CC(=O)O)C(=N)N.CC(=O)C(=O)O",
        "formula": "C4H9N3O2.C3H4O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "219.1955",
        "optical_activity": "NONE",
        "references": [
          "e52ff299-a855-ab15-0641-34654cede9f1"
        ],
        "stereo_centers": 0
      },
      "unii": "DPM6MX7AJD"
    }
  ]
}