{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3174fcb0-e2ae-4ee3-823e-f4ff7438eb1b",
          "code": "C864",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C864",
          "code_system": "NCI_THESAURUS",
          "references": [
            "146ad383-4a33-4030-96da-c0b11249f19e"
          ]
        },
        {
          "uuid": "99879526-6a52-4781-88ce-765a3cc16c11",
          "code": "1746-01-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1746-01-6",
          "code_system": "CAS",
          "references": [
            "146ad383-4a33-4030-96da-c0b11249f19e",
            "8e52ccea-b606-482a-b299-29f9fe3a33f2"
          ]
        },
        {
          "uuid": "8ace9f57-3a91-436c-8c6a-05411b4fcb18",
          "code": "600000",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2088",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "146ad383-4a33-4030-96da-c0b11249f19e"
          ]
        },
        {
          "uuid": "d895e03a-1b2b-4292-ad7e-53c233d71df1",
          "code": "217-122-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.015.566",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "146ad383-4a33-4030-96da-c0b11249f19e"
          ]
        },
        {
          "uuid": "3a86b4e9-7a1d-4257-8370-51d5cf2e331e",
          "code": "m10491",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10491?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "146ad383-4a33-4030-96da-c0b11249f19e"
          ]
        },
        {
          "uuid": "6027b649-56de-4327-9ad7-cb31dcc29316",
          "code": "SUB33620",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "146ad383-4a33-4030-96da-c0b11249f19e"
          ]
        },
        {
          "uuid": "00c815e7-cf19-4f0e-a1bb-e472c6fd2541",
          "code": "15625",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15625",
          "code_system": "PUBCHEM",
          "references": [
            "146ad383-4a33-4030-96da-c0b11249f19e"
          ]
        },
        {
          "uuid": "ad240242-bb1e-4b4b-3db2-c476cb263a9a",
          "code": "4151",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/4151",
          "code_system": "HSDB",
          "references": [
            "18331c70-c7dc-703a-279c-5bbf73b0b693"
          ]
        },
        {
          "uuid": "3eefd48f-db54-eb70-0edb-a5e6dcebf6b7",
          "code": "DTXSID2021315",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2021315",
          "code_system": "EPA CompTox",
          "references": [
            "334a6f66-f1c7-6f77-f8f5-034c1968ae71"
          ]
        },
        {
          "uuid": "76145ff9-0faa-4f6e-ae74-5f2ec496354e",
          "code": "DO80M48B6O",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5216ce59-0e4d-d23d-8628-a481c7367d16",
          "code": "36682",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:36682",
          "code_system": "CHEBI",
          "references": [
            "aa4a05e6-5dd8-68e4-aca1-d5f63045c95d"
          ]
        },
        {
          "uuid": "574b7f0e-3a4f-1c00-589a-f158ab124321",
          "code": "134044",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:134044",
          "code_system": "CHEBI",
          "references": [
            "aa4a05e6-5dd8-68e4-aca1-d5f63045c95d"
          ]
        },
        {
          "uuid": "56ac1b98-d459-e33f-f029-c7abac7099fb",
          "code": "28119",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28119",
          "code_system": "CHEBI",
          "references": [
            "aa4a05e6-5dd8-68e4-aca1-d5f63045c95d"
          ]
        },
        {
          "uuid": "4a18910b-f2fa-00c4-64f6-85df7e206750",
          "code": "2,3,7,8-Tetrachlorodibenzodioxin",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/2,3,7,8-Tetrachlorodibenzodioxin",
          "code_system": "WIKIPEDIA",
          "references": [
            "02796709-15b4-df3e-d286-63246e11be68"
          ]
        },
        {
          "uuid": "fcc27419-9845-857f-260c-edce03ecfb37",
          "code": "100000127538",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "73fe28ac-2cf8-4bdb-dc99-d730f26755be"
          ]
        },
        {
          "uuid": "0bd29bbd-361f-6342-bbc1-7e73ced71fe2",
          "code": "DO80M48B6O",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=DO80M48B6O",
          "code_system": "DAILYMED",
          "references": [
            "344b7749-a035-1306-246d-c539c5f74cd9"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "97bae41d-ad27-4b24-989f-a5594c44fb2f",
          "amount": {
            "uuid": "0495d28d-16f1-4523-8d0e-3b3c03a8c316"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "9b840b87-719f-4db5-9d30-971e86728a59"
          ],
          "related_substance": {
            "uuid": "8781b47f-c485-4a47-9f86-3c579205ca33",
            "refuuid": "92ee7da2-0121-48d1-8c2a-b3236009757a",
            "name": "2,8-DICHLORODIBENZO-P-DIOXIN",
            "unii": "JPA391PZI1",
            "linking_id": "JPA391PZI1",
            "ref_pname": "2,8-DICHLORODIBENZO-P-DIOXIN"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7ac34295-1022-4f2d-9c98-c46303243426",
          "name": "2,3,7,8-TCDD",
          "stdName": "2,3,7,8-TCDD",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57862e38-5a48-4f8d-ad39-bcfb238711d6",
            "95c61aef-6435-48e7-9c87-66a120f9812a"
          ],
          "display_name": false
        },
        {
          "uuid": "5eb66777-8888-4c39-8c0f-73849041b958",
          "name": "2,3,7,8-TETRACHLORODIBENZO(B,E)(1,4)DIOXIN",
          "stdName": "2,3,7,8-TETRACHLORODIBENZO(B,E)(1,4)DIOXIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57862e38-5a48-4f8d-ad39-bcfb238711d6",
            "bb6bc6f0-84bb-44e2-ad94-645e7cbce85f"
          ],
          "display_name": false
        },
        {
          "uuid": "1572761f-f339-49b2-8bee-795a0de1bb4e",
          "name": "2,3,7,8-TETRACHLORODIBENZO-P-DIOXIN",
          "stdName": "2,3,7,8-TETRACHLORODIBENZO-P-DIOXIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b911f4c4-380b-4032-b347-b13ee41f7a6c",
            "57862e38-5a48-4f8d-ad39-bcfb238711d6",
            "bc9f0bb5-de94-4369-9faa-5753fa07a24c",
            "c6f88088-1aed-4eb0-b521-443f5734867c"
          ],
          "display_name": true
        },
        {
          "uuid": "07fc7022-282d-4544-81b7-c7bd3b1b9371",
          "name": "2,3,7,8-TETRACHLORODIBENZO-P-DIOXIN [HSDB]",
          "stdName": "2,3,7,8-TETRACHLORODIBENZO-P-DIOXIN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc9f0bb5-de94-4369-9faa-5753fa07a24c",
            "57862e38-5a48-4f8d-ad39-bcfb238711d6"
          ],
          "display_name": false
        },
        {
          "uuid": "45ba3677-93a4-4ec1-bc5d-dfa6d15b5801",
          "name": "D 48",
          "stdName": "D 48",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57862e38-5a48-4f8d-ad39-bcfb238711d6",
            "95c61aef-6435-48e7-9c87-66a120f9812a"
          ],
          "display_name": false
        },
        {
          "uuid": "02a7e9be-018e-441c-89d0-5d3eacc761bf",
          "name": "DIBENZO(B,E)(1,4)DIOXIN, 2,3,7,8-TETRACHLORO-",
          "stdName": "DIBENZO(B,E)(1,4)DIOXIN, 2,3,7,8-TETRACHLORO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b911f4c4-380b-4032-b347-b13ee41f7a6c",
            "57862e38-5a48-4f8d-ad39-bcfb238711d6"
          ],
          "display_name": false
        },
        {
          "uuid": "fb8a6089-5f0f-4c45-b09a-0d789a9eb2e4",
          "name": "DIOXIN",
          "stdName": "DIOXIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57862e38-5a48-4f8d-ad39-bcfb238711d6",
            "bb6bc6f0-84bb-44e2-ad94-645e7cbce85f"
          ],
          "display_name": false
        },
        {
          "uuid": "e6ccc5c0-51e9-4162-9cc9-81db097e05e5",
          "name": "NCI-C03714",
          "stdName": "NCI-C03714",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b911f4c4-380b-4032-b347-b13ee41f7a6c",
            "57862e38-5a48-4f8d-ad39-bcfb238711d6"
          ],
          "display_name": false
        },
        {
          "uuid": "5604ddc6-c919-452c-8a77-0a2476389308",
          "name": "PCDD 48",
          "stdName": "PCDD 48",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57862e38-5a48-4f8d-ad39-bcfb238711d6",
            "95c61aef-6435-48e7-9c87-66a120f9812a"
          ],
          "display_name": false
        },
        {
          "uuid": "cb4e824f-349d-43f3-9325-ef595d23dd83",
          "name": "TCDBD",
          "stdName": "TCDBD",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57862e38-5a48-4f8d-ad39-bcfb238711d6",
            "bb6bc6f0-84bb-44e2-ad94-645e7cbce85f"
          ],
          "display_name": false
        },
        {
          "uuid": "fd312ded-7c7c-4d73-b6a1-93c0c306642d",
          "name": "TCDD",
          "stdName": "TCDD",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ece62924-4647-4f3a-9e73-636c72162f3b",
            "57862e38-5a48-4f8d-ad39-bcfb238711d6",
            "bb6bc6f0-84bb-44e2-ad94-645e7cbce85f",
            "d8d1b911-b36c-41df-abf9-8a0df3e9da6d"
          ],
          "display_name": false
        },
        {
          "uuid": "931074bf-9715-4050-a148-24546465f245",
          "name": "TCDD [MI]",
          "stdName": "TCDD [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ece62924-4647-4f3a-9e73-636c72162f3b",
            "57862e38-5a48-4f8d-ad39-bcfb238711d6"
          ],
          "display_name": false
        },
        {
          "uuid": "3200b2e9-0ddb-4e3a-a525-41449c8c50be",
          "name": "TETRACHLORODIBENZO-P-DIOXIN, 2,3,7,8-",
          "stdName": "TETRACHLORODIBENZO-P-DIOXIN, 2,3,7,8-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2e0408d-4cd3-4a80-8048-1c8f77d18e9c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e2e0408d-4cd3-4a80-8048-1c8f77d18e9c",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ece62924-4647-4f3a-9e73-636c72162f3b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57862e38-5a48-4f8d-ad39-bcfb238711d6",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb6bc6f0-84bb-44e2-ad94-645e7cbce85f",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b911f4c4-380b-4032-b347-b13ee41f7a6c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95c61aef-6435-48e7-9c87-66a120f9812a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc9f0bb5-de94-4369-9faa-5753fa07a24c",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "146ad383-4a33-4030-96da-c0b11249f19e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390877000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "616a5293-71fe-4269-a016-e6e978cf7fb6",
          "citation": "SRS import [DO80M48B6O]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=DO80M48B6O",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390877000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e7b7528-dcea-43b1-a58d-9d1ce9779af8",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8d1b911-b36c-41df-abf9-8a0df3e9da6d",
          "citation": "TCDD [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c6f88088-1aed-4eb0-b521-443f5734867c",
          "citation": "2,3,7,8-TETRACHLORODIBENZO-P-DIOXIN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "334a6f66-f1c7-6f77-f8f5-034c1968ae71",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1746-01-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "18331c70-c7dc-703a-279c-5bbf73b0b693",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+1746-01-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "02796709-15b4-df3e-d286-63246e11be68",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "8e52ccea-b606-482a-b299-29f9fe3a33f2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9b840b87-719f-4db5-9d30-971e86728a59",
          "citation": "Biochem Pharmacol 1991;41(12):1931",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "aa4a05e6-5dd8-68e4-aca1-d5f63045c95d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "344b7749-a035-1306-246d-c539c5f74cd9",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "73fe28ac-2cf8-4bdb-dc99-d730f26755be",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "afd2f9a8-d52a-42e6-aa0a-2e5ea8f2eb38",
          "id": "afd2f9a8-d52a-42e6-aa0a-2e5ea8f2eb38",
          "molfile": "\n  Marvin  01132109072D          \n\n 18 20  0  0  0  0            999 V2000\n    3.8656   -5.7897    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.5801   -5.3772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2946   -5.7897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0091   -5.3772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7236   -5.7897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4382   -5.3772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1527   -5.7897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8672   -5.3772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5817   -5.7897    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.8672   -4.5522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5817   -4.1397    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.1527   -4.1397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4382   -4.5522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7236   -4.1397    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0091   -4.5522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2946   -4.1397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5801   -4.5522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8656   -4.1397    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 17  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4 15  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 13  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "c1c(c(cc2c1Oc3cc(c(cc3O2)Cl)Cl)Cl)Cl",
          "formula": "C12H4Cl4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2f92259c-fbfc-4150-a0b8-7c20f2279894"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "321.9712",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "85b2f759-3672-4725-9e60-7ceddcfd2f98",
      "version": "12",
      "structure": {
        "id": "05cd41b2-848f-40cc-a0b1-158bbc24f484",
        "molfile": "\n  Marvin  01132100352D          \n\n 18 20  0  0  0  0            999 V2000\n    8.8672   -5.3772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8672   -4.5522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1527   -4.1397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4382   -4.5522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4382   -5.3772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1527   -5.7897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7236   -5.7897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0091   -5.3772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0091   -4.5522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7236   -4.1397    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2946   -4.1397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5801   -4.5522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5801   -5.3772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2946   -5.7897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8656   -5.7897    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.8656   -4.1397    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.5817   -4.1397    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.5817   -5.7897    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  1  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n  4 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14  8  1  0  0  0  0\n 13 15  1  0  0  0  0\n 12 16  1  0  0  0  0\n  2 17  1  0  0  0  0\n  1 18  1  0  0  0  0\nM  END",
        "smiles": "c1c(c(cc2c1Oc3cc(c(cc3O2)Cl)Cl)Cl)Cl",
        "formula": "C12H4Cl4O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "321.9712",
        "optical_activity": "NONE",
        "references": [
          "3e7b7528-dcea-43b1-a58d-9d1ce9779af8",
          "616a5293-71fe-4269-a016-e6e978cf7fb6"
        ],
        "stereo_centers": 0
      },
      "unii": "DO80M48B6O"
    }
  ]
}