{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f0f32169-d56b-40b7-a8aa-257442d28d69",
          "code": "161326-34-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=161326-34-7",
          "code_system": "CAS",
          "references": [
            "42b4415e-3ae1-4eab-9696-243e6a9cfc9e",
            "01800bd6-8f84-4176-8ba9-2afac2499142"
          ]
        },
        {
          "uuid": "2639f8aa-3e6e-49ce-876f-d041ed9cea5f",
          "code": "C540355",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67540355",
          "code_system": "MESH",
          "references": [
            "42b4415e-3ae1-4eab-9696-243e6a9cfc9e"
          ]
        },
        {
          "uuid": "33efd4cd-532a-4808-9063-469bacd4880f",
          "code": "FENAMIDONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Fenamidone",
          "code_system": "WIKIPEDIA",
          "references": [
            "42b4415e-3ae1-4eab-9696-243e6a9cfc9e"
          ]
        },
        {
          "uuid": "570b96a1-65f7-4d93-9edb-873e33c1bcd2",
          "code": "46679",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2346",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "42b4415e-3ae1-4eab-9696-243e6a9cfc9e"
          ]
        },
        {
          "uuid": "6431a2a7-3da7-4f11-a936-a01c50d58207",
          "code": "m5260",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5260?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "42b4415e-3ae1-4eab-9696-243e6a9cfc9e"
          ]
        },
        {
          "uuid": "474f5449-f96b-41ec-98d2-325ead74e41f",
          "code": "10403199",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10403199",
          "code_system": "PUBCHEM",
          "references": [
            "42b4415e-3ae1-4eab-9696-243e6a9cfc9e"
          ]
        },
        {
          "uuid": "cd54547b-6851-326c-251b-8cf397fcbed3",
          "code": "DTXSID2034590",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2034590",
          "code_system": "EPA CompTox",
          "references": [
            "3978edb6-73f7-f640-fc80-53af4024a5a7"
          ]
        },
        {
          "uuid": "f83542b6-5aeb-4512-86f7-6296d334e076",
          "code": "DN24MG2Z5E",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b2dd4ee3-5871-f74e-3895-e3f8ed6e86ff",
          "code": "83258",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:83258",
          "code_system": "CHEBI",
          "references": [
            "2d4a1ca6-3f46-c161-5368-66cdb67970a9"
          ]
        },
        {
          "uuid": "90db24e1-aa36-9525-da56-77dddc300fa9",
          "code": "fenamidone",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/fenamidone.html",
          "code_system": "ALANWOOD",
          "references": [
            "d08c9c89-162f-045a-77f9-83583ecbbfc3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "969633d9-b0d4-4429-96c3-0cf09c632fa3",
          "name": "(5S)-3,5-DIHYDRO-5-METHYL-2-(METHYLTHIO)-5-PHENYL-3-(PHENYLAMINO)-4H-IMIDAZOL-4-ONE",
          "stdName": "(5S)-3,5-DIHYDRO-5-METHYL-2-(METHYLTHIO)-5-PHENYL-3-(PHENYLAMINO)-4H-IMIDAZOL-4-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f34c90e-e1f4-45d7-83ff-e95f96477d36",
            "c217f038-621a-4430-a1c2-cd58057d1e80"
          ],
          "display_name": false
        },
        {
          "uuid": "ba90175f-6044-47f8-b6b3-626a336931ab",
          "name": "(S)-1-ANILINO-4-METHYL-2-METHYLTHIO-4-PHENYLIMIDAZOLIN-5-ONE",
          "stdName": "(S)-1-ANILINO-4-METHYL-2-METHYLTHIO-4-PHENYLIMIDAZOLIN-5-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c19c3fd2-eef0-406a-918c-3e6cecab1747",
            "c217f038-621a-4430-a1c2-cd58057d1e80"
          ],
          "display_name": false
        },
        {
          "uuid": "cdb5c094-9052-4851-ac0e-bf219fed41de",
          "name": "FENAMIDONE",
          "stdName": "FENAMIDONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "337aa9b6-3428-4fb7-b944-cd5d1c1190d9",
            "0f379f83-c1bb-4af0-b4a7-21ef14e26851",
            "9ab61992-11b3-4989-bd6e-dbefb69a35b6",
            "bdea95db-c48f-4fcb-940a-20944e35c674",
            "311ef796-e9fc-4070-bcb4-e9f31d349178",
            "128d2fc2-278e-43c2-9e35-6614e42188e2"
          ],
          "display_name": true
        },
        {
          "uuid": "3f3d9664-891c-4f47-b74b-9ecd9a6e4b19",
          "name": "FENAMIDONE [ISO]",
          "stdName": "FENAMIDONE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "337aa9b6-3428-4fb7-b944-cd5d1c1190d9",
            "128d2fc2-278e-43c2-9e35-6614e42188e2"
          ],
          "display_name": false
        },
        {
          "uuid": "45eb9285-c6b7-48c6-bb21-9b757099c8b4",
          "name": "FENAMIDONE [MI]",
          "stdName": "FENAMIDONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "337aa9b6-3428-4fb7-b944-cd5d1c1190d9",
            "bdea95db-c48f-4fcb-940a-20944e35c674"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c217f038-621a-4430-a1c2-cd58057d1e80",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3f34c90e-e1f4-45d7-83ff-e95f96477d36",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c19c3fd2-eef0-406a-918c-3e6cecab1747",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ab61992-11b3-4989-bd6e-dbefb69a35b6",
          "citation": "ALANWOOD.NET 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bdea95db-c48f-4fcb-940a-20944e35c674",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "337aa9b6-3428-4fb7-b944-cd5d1c1190d9",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "128d2fc2-278e-43c2-9e35-6614e42188e2",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42b4415e-3ae1-4eab-9696-243e6a9cfc9e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390986000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ecdbcd7-0f2c-435e-9980-73a105d595f7",
          "citation": "SRS import [DN24MG2Z5E]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=DN24MG2Z5E",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390986000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42724174-dc6c-47ad-8ba7-cc53daadaa87",
          "citation": "CHEMID  2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "311ef796-e9fc-4070-bcb4-e9f31d349178",
          "citation": "FENAMIDONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0f379f83-c1bb-4af0-b4a7-21ef14e26851",
          "citation": "FENAMIDONE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3978edb6-73f7-f640-fc80-53af4024a5a7",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=161326-34-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d08c9c89-162f-045a-77f9-83583ecbbfc3",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "2d4a1ca6-3f46-c161-5368-66cdb67970a9",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "01800bd6-8f84-4176-8ba9-2afac2499142",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fc46fe98-c98a-421c-90d8-28c316875633",
          "id": "fc46fe98-c98a-421c-90d8-28c316875633",
          "molfile": "\n  Marvin  01132113042D          \n\n 22 24  0  0  1  0            999 V2000\n    8.0622   -5.9314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3454   -5.5206    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6369   -5.9405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9686   -5.4582    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3006   -5.9405    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.5870   -6.3468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5485   -6.7261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9661   -7.3078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3843   -6.7261    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0909   -7.1417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9170   -7.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3276   -6.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1535   -6.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5641   -7.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1535   -7.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3276   -7.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5870   -5.5258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8652   -5.9345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1540   -5.5223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1540   -4.7033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8692   -4.2911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5870   -4.7100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  9  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  5 17  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 16  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 22  2  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
          "smiles": "C[C@]1(c2ccccc2)C(=O)N(C(=N1)SC)Nc3ccccc3",
          "formula": "C17H17N3OS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "01454189-4ef0-4378-8859-06da0601b8d0"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "311.4031",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d4a82faf-79f0-4974-9da4-56d5231c5d58",
      "version": "5",
      "structure": {
        "id": "0520d9cc-0de4-488d-8cff-bc6df6df42fb",
        "molfile": "\n  Marvin  01132100342D          \n\n 22 24  0  0  1  0            999 V2000\n    6.3843   -6.7261    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6369   -5.9405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3454   -5.5206    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0622   -5.9314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9686   -5.4582    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3006   -5.9405    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.5870   -6.3468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5870   -5.5258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8652   -5.9345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1540   -5.5223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1540   -4.7033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8692   -4.2911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5870   -4.7100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5485   -6.7261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9661   -7.3078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0909   -7.1417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9170   -7.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3276   -6.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1535   -6.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5641   -7.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1535   -7.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3276   -7.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  2  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  1  0  0  0\n  6  8  1  6  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n  8 13  2  0  0  0  0\n  6 14  1  0  0  0  0\n 14  1  1  0  0  0  0\n 14 15  2  0  0  0  0\n  1 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 17 22  1  0  0  0  0\nM  END",
        "smiles": "C[C@]1(c2ccccc2)C(=O)N(C(=N1)SC)Nc3ccccc3",
        "formula": "C17H17N3OS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "311.4031",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "0ecdbcd7-0f2c-435e-9980-73a105d595f7",
          "42724174-dc6c-47ad-8ba7-cc53daadaa87"
        ],
        "stereo_centers": 1
      },
      "unii": "DN24MG2Z5E"
    }
  ]
}