{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "a67340e5-f21c-4e6c-813a-26ed33abb5c1", "code": "31582-45-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=31582-45-3", "code_system": "CAS", "references": [ "9b9d4dae-4bb2-40bb-a512-806e4f943edd", "2a637054-099a-495b-abd9-9ccb9c2befed" ] }, { "uuid": "f1c68a23-f956-4f09-b4a0-282197f659e5", "code": "250-718-5", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.046.092", "code_system": "ECHA (EC/EINECS)", "references": [ "9b9d4dae-4bb2-40bb-a512-806e4f943edd" ] }, { "uuid": "489bf6d2-1e86-4116-a84b-e434859b3fd2", "code": "9815965", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9815965", "code_system": "PUBCHEM", "references": [ "9b9d4dae-4bb2-40bb-a512-806e4f943edd" ] }, { "uuid": "76ad1cd4-4396-ced0-ccd4-99f270f50fa7", "code": "DTXSID70185474", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70185474", "code_system": "EPA CompTox", "references": [ "9bcaaabe-a642-ed16-52fd-1cc1183471a5" ] }, { "uuid": "30121107-85bd-46ce-abad-4999d517850c", "code": "DLW4LHP964", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "8e23647d-bfc4-4cb7-8abd-710a667774bb", "name": "2,2,6,6-TETRAMETHYL-4-PIPERIDYL METHACRYLATE", "stdName": "2,2,6,6-TETRAMETHYL-4-PIPERIDYL METHACRYLATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "727b32aa-af91-4476-afd9-7bdb8bf10862", "6a6c2956-8d55-4644-ae01-952dbef3d6fb" ], "display_name": true } ], "references": [ { "uuid": "6a6c2956-8d55-4644-ae01-952dbef3d6fb", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "727b32aa-af91-4476-afd9-7bdb8bf10862", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9b9d4dae-4bb2-40bb-a512-806e4f943edd", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393787000, "tags": [ "NOMEN" ] }, { "uuid": "9bcaaabe-a642-ed16-52fd-1cc1183471a5", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=31582-45-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "2a637054-099a-495b-abd9-9ccb9c2befed", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "1ef8e800-41c9-4cfa-a695-4a7bb8282f9d", "id": "1ef8e800-41c9-4cfa-a695-4a7bb8282f9d", "molfile": "\n Marvin 01132101462D \n\n 16 16 0 0 0 0 999 V2000\n 3.0974 0.0283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8119 -0.3842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5263 0.0283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8119 -1.2092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5263 -1.6217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0974 -1.6217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3830 -1.2092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6685 -1.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9540 -1.2092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6719 -1.9844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1416 -1.0659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9540 -0.3842 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6685 0.0283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1382 0.6603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1988 0.6603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3830 -0.3842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 4 2 1 0 0 0 0\n 4 5 2 0 0 0 0\n 4 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 16 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 12 9 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 13 16 1 0 0 0 0\nM END", "smiles": "C=C(C)C(=O)OC1CC(C)(C)NC(C)(C)C1", "formula": "C13H23NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "440fb90d-74cb-4cf3-8d2e-4ace7006772a" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "225.3277", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "413ca2cc-78a3-4fcd-a0c8-27cbf20b44fa", "version": "5", "structure": { "id": "e8b10911-626a-4084-b552-920d5cb31949", "molfile": "\n Marvin 01132112022D \n\n 16 16 0 0 0 0 999 V2000\n 3.8119 -1.2092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8119 -0.3842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0974 0.0283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5263 0.0283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5263 -1.6217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0974 -1.6217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9540 -0.3842 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6685 0.0283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3830 -0.3842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3830 -1.2092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6685 -1.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9540 -1.2092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6719 -1.9844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1416 -1.0659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1382 0.6603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1988 0.6603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 2 0 0 0 0\n 1 5 2 0 0 0 0\n 1 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 7 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 8 15 1 0 0 0 0\n 8 16 1 0 0 0 0\n 6 10 1 0 0 0 0\nM END", "smiles": "C=C(C)C(=O)OC1CC(C)(C)NC(C)(C)C1", "formula": "C13H23NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "225.3277", "optical_activity": "NONE", "references": [ "6a6c2956-8d55-4644-ae01-952dbef3d6fb" ], "stereo_centers": 0 }, "unii": "DLW4LHP964" } ] }