{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c56f36d5-eca9-4f50-abac-ca7d911694b8",
          "code": "120928-09-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=120928-09-8",
          "code_system": "CAS",
          "references": [
            "83c9cd46-cfac-414d-886d-770862feeeb5",
            "1b0cc68e-2f95-4934-a0ca-5a32a3c66198"
          ]
        },
        {
          "uuid": "d425b57d-fdba-4414-bbec-63ffac09bb7d",
          "code": "C087876",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67087876",
          "code_system": "MESH",
          "references": [
            "83c9cd46-cfac-414d-886d-770862feeeb5"
          ]
        },
        {
          "uuid": "5c08059a-a616-408c-8ed0-0ffe694b5d39",
          "code": "44501",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2350",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "83c9cd46-cfac-414d-886d-770862feeeb5"
          ]
        },
        {
          "uuid": "f6e48b62-278e-4553-b3d3-68f2e75eaba6",
          "code": "m5263",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5263?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "83c9cd46-cfac-414d-886d-770862feeeb5"
          ]
        },
        {
          "uuid": "9d66da14-51ac-4d39-b843-54f1f922231f",
          "code": "86356",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/86356",
          "code_system": "PUBCHEM",
          "references": [
            "83c9cd46-cfac-414d-886d-770862feeeb5"
          ]
        },
        {
          "uuid": "a02983f1-16a1-aabe-c75a-5bd24728e988",
          "code": "7948",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7948",
          "code_system": "HSDB",
          "references": [
            "9a4497a9-e3ea-d507-6de1-1676975fd1f0"
          ]
        },
        {
          "uuid": "5fcf1230-1798-b533-1bac-d0da1ae69b06",
          "code": "DTXSID4040476",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4040476",
          "code_system": "EPA CompTox",
          "references": [
            "fb744164-7482-f14d-e597-2a6971405d58"
          ]
        },
        {
          "uuid": "88e94c36-8e17-4d9d-8f96-7d8ce988b724",
          "code": "DK5Q534WEE",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "33551faf-2b32-07fd-c343-4649a44a1570",
          "code": "38593",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:38593",
          "code_system": "CHEBI",
          "references": [
            "7a50df0a-44e3-c6c9-48bd-1f970279147f"
          ]
        },
        {
          "uuid": "c33151a9-79a7-6803-e5bd-49ace8781eab",
          "code": "fenazaquin",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/fenazaquin.html",
          "code_system": "ALANWOOD",
          "references": [
            "4d9ff7e4-0498-ae10-b557-cf9dc18d1275"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "69b3f81c-6875-405f-a1c7-bf35d089152d",
          "name": "4-(2-(4-(1,1-DIMETHYLETHYL)PHENYL)ETHOXY)QUINAZOLINE",
          "stdName": "4-(2-(4-(1,1-DIMETHYLETHYL)PHENYL)ETHOXY)QUINAZOLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3856d839-b244-41ad-a8e5-940a88105240",
            "1709aa15-fd86-4e63-91b5-55c3f52e5fb3"
          ],
          "display_name": false
        },
        {
          "uuid": "701f0af3-438c-4a47-be6a-d67db206ec05",
          "name": "4-(2-(4-(TERT-BUTYL)PHENYL)ETHOXY)QUINAZOLINE",
          "stdName": "4-(2-(4-(TERT-BUTYL)PHENYL)ETHOXY)QUINAZOLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5eb078e-7131-4caf-8480-29a5b50dc0df",
            "501b2579-dbed-4ae9-abfd-283f98293f4b"
          ],
          "display_name": false
        },
        {
          "uuid": "78438c7b-c785-4995-9c25-d98f8f8efe16",
          "name": "4-TERT-BUTYLPHENETHYL QUINAZOLIN-4-YL ETHER",
          "stdName": "4-TERT-BUTYLPHENETHYL QUINAZOLIN-4-YL ETHER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3856d839-b244-41ad-a8e5-940a88105240",
            "b0ec2302-605a-408d-bcb4-3d719cbe3c53"
          ],
          "display_name": false
        },
        {
          "uuid": "076ff927-5f8d-4c93-b8cb-8a68f9ecf0fa",
          "name": "DE-436",
          "stdName": "DE-436",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5eb078e-7131-4caf-8480-29a5b50dc0df",
            "501b2579-dbed-4ae9-abfd-283f98293f4b"
          ],
          "display_name": false
        },
        {
          "uuid": "a52ac7a7-d2f8-4fa0-ba76-408099e94058",
          "name": "EL-436",
          "stdName": "EL-436",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5eb078e-7131-4caf-8480-29a5b50dc0df",
            "501b2579-dbed-4ae9-abfd-283f98293f4b"
          ],
          "display_name": false
        },
        {
          "uuid": "546005f1-e8e7-444e-9a59-4e0dddc448a7",
          "name": "FENAZAQUIN",
          "stdName": "FENAZAQUIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8246f7c0-9ec6-4b36-a793-c9cb62ea5862",
            "b229f08b-8426-49df-b018-218a826a4472",
            "005d1886-87a5-4110-8ec5-b0ef145bd683",
            "89bfc820-9488-473b-b3b9-954c9e315481",
            "6f3005d1-6b24-414c-9ab6-cde6d27c17f6",
            "501b2579-dbed-4ae9-abfd-283f98293f4b"
          ],
          "display_name": true
        },
        {
          "uuid": "2df692c0-4f39-4e91-9975-ce99cd99648f",
          "name": "FENAZAQUIN [ISO]",
          "stdName": "FENAZAQUIN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b229f08b-8426-49df-b018-218a826a4472",
            "501b2579-dbed-4ae9-abfd-283f98293f4b"
          ],
          "display_name": false
        },
        {
          "uuid": "a8e75cec-2b3b-4ac6-af10-eef5dba2f71a",
          "name": "FENAZAQUIN [MI]",
          "stdName": "FENAZAQUIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "005d1886-87a5-4110-8ec5-b0ef145bd683",
            "501b2579-dbed-4ae9-abfd-283f98293f4b"
          ],
          "display_name": false
        },
        {
          "uuid": "ec0c2a17-0585-4c4f-b567-88db0d3b7c63",
          "name": "MAGISTER",
          "stdName": "MAGISTER",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8622365b-7861-4f2a-b12c-ca635a7311bb",
            "501b2579-dbed-4ae9-abfd-283f98293f4b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6f3005d1-6b24-414c-9ab6-cde6d27c17f6",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3856d839-b244-41ad-a8e5-940a88105240",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0ec2302-605a-408d-bcb4-3d719cbe3c53",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1709aa15-fd86-4e63-91b5-55c3f52e5fb3",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "005d1886-87a5-4110-8ec5-b0ef145bd683",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "501b2579-dbed-4ae9-abfd-283f98293f4b",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5eb078e-7131-4caf-8480-29a5b50dc0df",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8622365b-7861-4f2a-b12c-ca635a7311bb",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b229f08b-8426-49df-b018-218a826a4472",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "83c9cd46-cfac-414d-886d-770862feeeb5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f118cb19-ce42-4ca5-89c5-52edaed04359",
          "citation": "SRS import [DK5Q534WEE]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=DK5Q534WEE",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0072457a-c5c8-4b3f-9e95-d51d30bf6f91",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8246f7c0-9ec6-4b36-a793-c9cb62ea5862",
          "citation": "FENAZAQUIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "89bfc820-9488-473b-b3b9-954c9e315481",
          "citation": "FENAZAQUIN [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9a4497a9-e3ea-d507-6de1-1676975fd1f0",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+120928-09-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fb744164-7482-f14d-e597-2a6971405d58",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=120928-09-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4d9ff7e4-0498-ae10-b557-cf9dc18d1275",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "1b0cc68e-2f95-4934-a0ca-5a32a3c66198",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7a50df0a-44e3-c6c9-48bd-1f970279147f",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c0cd45b4-4708-4dc7-a405-acd31ad4c81a",
          "id": "c0cd45b4-4708-4dc7-a405-acd31ad4c81a",
          "molfile": "\n  Marvin  01132109582D          \n\n 23 25  0  0  0  0            999 V2000\n    9.2793   -6.9318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4542   -6.9318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6291   -6.9318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4542   -7.7568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4542   -6.1067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7419   -5.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7419   -4.8720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4602   -4.4585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4602   -3.6335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7541   -3.2219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0359   -3.6353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3176   -3.2219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3176   -2.3968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6034   -1.9842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8911   -2.3968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8911   -3.2219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1724   -3.6343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1724   -4.4594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8911   -4.8720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6034   -4.4594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6034   -3.6343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1719   -4.8740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1719   -5.7027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 23  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 22  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 21 12  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 21 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 23 22  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)c1ccc(cc1)CCOc2c3ccccc3ncn2",
          "formula": "C20H22N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e278343a-fada-4920-8ccd-2d66056abea2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "306.4022",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "dad0bc0d-4de4-468f-843d-5b988d0f849f",
      "version": "7",
      "structure": {
        "id": "9b33677f-25ad-4d8b-8333-1cc2fafe3e1e",
        "molfile": "\n  Marvin  01132108042D          \n\n 23 25  0  0  0  0            999 V2000\n    6.3176   -2.3968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6034   -1.9842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8911   -2.3968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8911   -3.2219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1724   -3.6343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1724   -4.4594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8911   -4.8720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6034   -4.4594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6034   -3.6343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3176   -3.2219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0359   -3.6353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7541   -3.2219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4602   -3.6335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4602   -4.4585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7419   -4.8720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7419   -5.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4542   -6.1067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4542   -6.9318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2793   -6.9318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6291   -6.9318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4542   -7.7568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1719   -5.7027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1719   -4.8740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9  4  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10  1  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 18 21  1  0  0  0  0\n 17 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 14  2  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)c1ccc(cc1)CCOc2c3ccccc3ncn2",
        "formula": "C20H22N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "306.4022",
        "optical_activity": "NONE",
        "references": [
          "0072457a-c5c8-4b3f-9e95-d51d30bf6f91",
          "f118cb19-ce42-4ca5-89c5-52edaed04359"
        ],
        "stereo_centers": 0
      },
      "unii": "DK5Q534WEE"
    }
  ]
}