{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9d51ac34-409d-4aa5-b116-c3040b98703d",
          "code": "175013-18-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=175013-18-0",
          "code_system": "CAS",
          "references": [
            "92a74fd8-4518-4661-a891-dbd7342c6d26",
            "13ff08b3-c7c0-4e64-aa90-a3c235e02d7a"
          ]
        },
        {
          "uuid": "d29d3631-6847-4437-9e14-41c4c88978cd",
          "code": "99100",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3649",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "92a74fd8-4518-4661-a891-dbd7342c6d26"
          ]
        },
        {
          "uuid": "475c68b7-8e4d-4554-94be-bfb72353d647",
          "code": "m9334",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9334?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "92a74fd8-4518-4661-a891-dbd7342c6d26"
          ]
        },
        {
          "uuid": "5f09a69f-f9ce-4655-bdb4-5c177bfa06d8",
          "code": "6422843",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6422843",
          "code_system": "PUBCHEM",
          "references": [
            "92a74fd8-4518-4661-a891-dbd7342c6d26"
          ]
        },
        {
          "uuid": "127de4ab-7940-bcdf-9a86-d7e5834051a7",
          "code": "7497",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7497",
          "code_system": "HSDB",
          "references": [
            "97d7cb3c-e34a-0409-9a32-97808e60333c"
          ]
        },
        {
          "uuid": "3c25fbed-221a-b927-b88b-6e110a03b950",
          "code": "DTXSID7032638",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7032638",
          "code_system": "EPA CompTox",
          "references": [
            "8ddcb6fd-225f-0e9e-2a16-43a9cc9f174b"
          ]
        },
        {
          "uuid": "2808470e-f5fb-4443-bd7d-57e0f0b226ee",
          "code": "DJW8M9OX1H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8e808dc4-4152-d866-7d44-e00f633de8fb",
          "code": "Pyraclostrobin",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pyraclostrobin",
          "code_system": "WIKIPEDIA",
          "references": [
            "df902709-7034-408f-e1ff-85503baa8708"
          ]
        },
        {
          "uuid": "5ef4142c-c97f-a825-416e-2e843189f651",
          "code": "pyraclostrobin",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/pyraclostrobin.html",
          "code_system": "ALANWOOD",
          "references": [
            "ebb1035b-dcb6-0132-899f-ef8e8601c789"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4348ba06-6094-4559-abe1-b732abb59ec4",
          "name": "BAS-500F",
          "stdName": "BAS-500F",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b859fe6-bb8e-45b3-9c5c-e1516e60fe6c",
            "8f6ef383-5553-437f-a65e-72fff6380d07"
          ],
          "display_name": false
        },
        {
          "uuid": "27970fa2-1c0e-46bb-a23c-f435a9eeac38",
          "name": "CABRIO",
          "stdName": "CABRIO",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b859fe6-bb8e-45b3-9c5c-e1516e60fe6c",
            "8f6ef383-5553-437f-a65e-72fff6380d07"
          ],
          "display_name": false
        },
        {
          "uuid": "a1e4d002-7fdb-4ff9-b7d1-207d2ad19c06",
          "name": "COMET",
          "stdName": "COMET",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b859fe6-bb8e-45b3-9c5c-e1516e60fe6c",
            "8f6ef383-5553-437f-a65e-72fff6380d07"
          ],
          "display_name": false
        },
        {
          "uuid": "5841a146-227f-467a-8b34-4c3370b7b7f7",
          "name": "HEADLINE",
          "stdName": "HEADLINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b859fe6-bb8e-45b3-9c5c-e1516e60fe6c",
            "8f6ef383-5553-437f-a65e-72fff6380d07"
          ],
          "display_name": false
        },
        {
          "uuid": "4f6e157a-f023-46a6-ae30-e87f05870053",
          "name": "METHYL 2-(1-(4-CHLOROPHENYL)PYRAZOL-3-YLOXYMETHYL)-N-METHOXYCARBANILATE",
          "stdName": "METHYL 2-(1-(4-CHLOROPHENYL)PYRAZOL-3-YLOXYMETHYL)-N-METHOXYCARBANILATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2df55d6-f7b9-4bfc-915d-873d097234cf",
            "5a2c808b-9453-41e9-8efc-f781cf5834e5"
          ],
          "display_name": false
        },
        {
          "uuid": "18664da2-cce8-4861-992b-bda6748cd510",
          "name": "METHYL N-(2-(((1-(4-CHLOROPHENYL)-1H-PYRAZOL-3-YL)OXY)METHYL)PHENYL)-N-METHOXYCARBAMATE",
          "stdName": "METHYL N-(2-(((1-(4-CHLOROPHENYL)-1H-PYRAZOL-3-YL)OXY)METHYL)PHENYL)-N-METHOXYCARBAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2df55d6-f7b9-4bfc-915d-873d097234cf",
            "866735e9-4d4c-40c1-80b4-ad0172a2dbee"
          ],
          "display_name": false
        },
        {
          "uuid": "9ee46389-7104-40ea-b5bb-80881b614b81",
          "name": "PYRACLOSTROBIN",
          "stdName": "PYRACLOSTROBIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a306f5fe-6276-42f2-9d12-7c283a1968dd",
            "63a9d95d-5554-40b2-a1f0-d8f8bbe780f4",
            "95434581-d75f-4e46-9f1f-5d9f7890f872",
            "618eb2f9-778a-4eef-bafc-64693b211862",
            "c0baf992-ed35-4f56-b16d-d3ac61f3c157",
            "2b859fe6-bb8e-45b3-9c5c-e1516e60fe6c",
            "6218314d-1f4b-484c-8722-64d6d0e45213",
            "9df825ce-3e0c-4f70-a047-6d22225a1a1c"
          ],
          "display_name": true
        },
        {
          "uuid": "5107dcd6-d16f-4596-9c34-575e2d95f4f8",
          "name": "PYRACLOSTROBIN [HSDB]",
          "stdName": "PYRACLOSTROBIN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b859fe6-bb8e-45b3-9c5c-e1516e60fe6c",
            "6218314d-1f4b-484c-8722-64d6d0e45213"
          ],
          "display_name": false
        },
        {
          "uuid": "c3b3898f-3be7-4a94-8164-23bf933e9e95",
          "name": "PYRACLOSTROBIN [ISO]",
          "stdName": "PYRACLOSTROBIN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0baf992-ed35-4f56-b16d-d3ac61f3c157",
            "2b859fe6-bb8e-45b3-9c5c-e1516e60fe6c"
          ],
          "display_name": false
        },
        {
          "uuid": "d252679c-0d71-4f67-90e1-856d7ce74d43",
          "name": "PYRACLOSTROBIN [MI]",
          "stdName": "PYRACLOSTROBIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "63a9d95d-5554-40b2-a1f0-d8f8bbe780f4",
            "2b859fe6-bb8e-45b3-9c5c-e1516e60fe6c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a306f5fe-6276-42f2-9d12-7c283a1968dd",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c2df55d6-f7b9-4bfc-915d-873d097234cf",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a2c808b-9453-41e9-8efc-f781cf5834e5",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "866735e9-4d4c-40c1-80b4-ad0172a2dbee",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "63a9d95d-5554-40b2-a1f0-d8f8bbe780f4",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b859fe6-bb8e-45b3-9c5c-e1516e60fe6c",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f6ef383-5553-437f-a65e-72fff6380d07",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6218314d-1f4b-484c-8722-64d6d0e45213",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c0baf992-ed35-4f56-b16d-d3ac61f3c157",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92a74fd8-4518-4661-a891-dbd7342c6d26",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a0d3fcd-16d6-4978-94ca-ffe9311065a2",
          "citation": "SRS import [DJW8M9OX1H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=DJW8M9OX1H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99d91cda-16f7-4723-8f75-9366a99a81f4",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95434581-d75f-4e46-9f1f-5d9f7890f872",
          "citation": "PYRACLOSTROBIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9df825ce-3e0c-4f70-a047-6d22225a1a1c",
          "citation": "PYRACLOSTROBIN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "618eb2f9-778a-4eef-bafc-64693b211862",
          "citation": "PYRACLOSTROBIN [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "97d7cb3c-e34a-0409-9a32-97808e60333c",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+175013-18-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8ddcb6fd-225f-0e9e-2a16-43a9cc9f174b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=175013-18-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "df902709-7034-408f-e1ff-85503baa8708",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "ebb1035b-dcb6-0132-899f-ef8e8601c789",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "13ff08b3-c7c0-4e64-aa90-a3c235e02d7a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "083c5fee-b88b-4367-a79f-b07c676b01d8",
          "id": "083c5fee-b88b-4367-a79f-b07c676b01d8",
          "molfile": "\n  Marvin  01132100422D          \n\n 27 29  0  0  0  0            999 V2000\n    9.3647   -6.5973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2757   -5.7785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9420   -5.2886    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6970   -5.6224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3632   -5.1372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7859   -6.4458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5410   -6.7795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8531   -4.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5223   -3.9839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4318   -3.1595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6705   -2.8284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0095   -3.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1032   -4.1346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4383   -4.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6824   -4.2894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0174   -4.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0174   -5.6049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2343   -5.8645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7530   -5.2028    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2276   -4.5295    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9288   -5.2028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5178   -5.9193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6885   -5.9193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2739   -5.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4497   -5.2072    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.6855   -4.4853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5086   -4.4853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  8  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 13  8  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 16 20  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 19  1  0  0  0  0\n 22 21  1  0  0  0  0\n 21 27  2  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 24 25  1  0  0  0  0\n 26 24  2  0  0  0  0\n 27 26  1  0  0  0  0\nM  END",
          "smiles": "COC(=O)N(c1ccccc1COc2ccn(-c3ccc(cc3)Cl)n2)OC",
          "formula": "C19H18ClN3O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4fad5fb2-a805-47a3-9176-1af0cb99c7c7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "387.8176",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "59cb792e-0c84-4ddb-9051-525fc3bab06d",
      "version": "7",
      "structure": {
        "id": "2ca11d14-fa09-40d9-9f81-4d4fa807b291",
        "molfile": "\n  Marvin  01132102242D          \n\n 27 29  0  0  0  0            999 V2000\n    3.2739   -5.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6885   -5.9193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5178   -5.9193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9288   -5.2028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7530   -5.2028    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2343   -5.8645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0174   -5.6049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0174   -4.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6824   -4.2894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4383   -4.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1032   -4.1346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8531   -4.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5223   -3.9839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4318   -3.1595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6705   -2.8284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0095   -3.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9420   -5.2886    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2757   -5.7785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3647   -6.5973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6970   -5.6224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7859   -6.4458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5410   -6.7795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3632   -5.1372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2276   -4.5295    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5086   -4.4853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6855   -4.4853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4497   -5.2072    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 11  1  0  0  0  0\n 12 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 20 23  2  0  0  0  0\n  8 24  2  0  0  0  0\n 24  5  1  0  0  0  0\n  4 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26  1  1  0  0  0  0\n  1 27  1  0  0  0  0\nM  END",
        "smiles": "COC(=O)N(c1ccccc1COc2ccn(-c3ccc(cc3)Cl)n2)OC",
        "formula": "C19H18ClN3O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "387.8176",
        "optical_activity": "NONE",
        "references": [
          "1a0d3fcd-16d6-4978-94ca-ffe9311065a2",
          "99d91cda-16f7-4723-8f75-9366a99a81f4"
        ],
        "stereo_centers": 0
      },
      "unii": "DJW8M9OX1H"
    }
  ]
}