{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "645f5391-57e8-4351-8fd1-bcad65a8388b", "code": "41556-26-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=41556-26-7", "code_system": "CAS", "references": [ "801012de-7663-4c10-a61d-775a67ebfdd8", "9b437d41-4619-40de-8a66-d0a454f27c53" ] }, { "uuid": "8f085cf9-0c8e-4d2a-899f-831a91b0a5b1", "code": "255-437-1", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.050.380", "code_system": "ECHA (EC/EINECS)", "references": [ "801012de-7663-4c10-a61d-775a67ebfdd8" ] }, { "uuid": "3f6f1a3c-8fb0-444c-9500-66abd40430c1", "code": "586744", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/586744", "code_system": "PUBCHEM", "references": [ "801012de-7663-4c10-a61d-775a67ebfdd8" ] }, { "uuid": "56a4f78e-c1d9-41fd-855d-3b28e51940a5", "code": "DHJ5QK3K4J", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "9b437d41-4619-40de-8a66-d0a454f27c53" ] }, { "uuid": "375bb701-7179-773f-996f-ec889bb6690d", "code": "DTXSID0036479", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0036479", "code_system": "EPA CompTox", "references": [ "e2aafde0-7f88-d3d6-32d1-5e5a49fa5b11" ] } ], "substance_class": "chemical", "names": [ { "uuid": "3d92d315-b2b8-4827-9d15-63448cf4e454", "name": "Bis(1,2,2,6,6-pentamethyl-4-piperidyl) sebacate", "stdName": "BIS(1,2,2,6,6-PENTAMETHYL-4-PIPERIDYL) SEBACATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9b437d41-4619-40de-8a66-d0a454f27c53" ], "display_name": true }, { "uuid": "df3c311b-2012-4a76-92f7-ab09ecb4ce8c", "name": "Decanedioic acid, 1,10-bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester", "stdName": "DECANEDIOIC ACID, 1,10-BIS(1,2,2,6,6-PENTAMETHYL-4-PIPERIDINYL) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9b437d41-4619-40de-8a66-d0a454f27c53" ], "display_name": false }, { "uuid": "69b7727a-7943-4ba5-8c79-16f8bb2eb700", "name": "Decanedioic acid, bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester", "stdName": "DECANEDIOIC ACID, BIS(1,2,2,6,6-PENTAMETHYL-4-PIPERIDINYL) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "0bd2d3f4-b792-428c-92ad-bbb14e6bc537" ], "display_name": false } ], "references": [ { "uuid": "0bd2d3f4-b792-428c-92ad-bbb14e6bc537", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "801012de-7663-4c10-a61d-775a67ebfdd8", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392160000, "tags": [ "NOMEN" ] }, { "uuid": "e2aafde0-7f88-d3d6-32d1-5e5a49fa5b11", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=41556-26-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "9b437d41-4619-40de-8a66-d0a454f27c53", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "68e676a1-97be-46f4-9b7e-407341df5b9c", "id": "68e676a1-97be-46f4-9b7e-407341df5b9c", "molfile": "\n Marvin 01132105272D \n\n 36 37 0 0 0 0 999 V2000\n 0.1109 -0.7067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8314 -1.1362 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5519 -0.7067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1224 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9537 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2724 -1.1362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2724 -1.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5519 -2.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8314 -1.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4157 -2.6743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9791 -2.3694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6997 -1.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6997 -1.1362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4064 -2.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1269 -1.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8474 -2.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5679 -1.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2885 -2.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0090 -1.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7295 -2.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4500 -1.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1568 -2.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1568 -3.2008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8773 -1.9676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5840 -2.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5840 -3.2008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3045 -3.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7340 -4.3370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9027 -4.3370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0250 -3.2008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7455 -3.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0250 -2.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8564 -2.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4407 -1.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3045 -1.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 9 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 5 1 0 0 0 0\n 3 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 12 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 2 0 0 0 0\n 13 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 23 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 27 26 1 0 0 0 0\n 36 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 28 29 1 0 0 0 0\n 28 30 1 0 0 0 0\n 31 28 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 33 35 1 0 0 0 0\n 33 36 1 0 0 0 0\nM END", "smiles": "CC1(C)CC(CC(C)(C)N1C)OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)N(C)C(C)(C)C2", "formula": "C30H56N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "8348b677-f82f-4bb6-9330-4256e2dd2995" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "508.7778", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "c9166507-4148-495e-bcd7-981c33018d1a", "version": "5", "structure": { "id": "517db490-3232-481a-8c1c-2a9c6031d0e8", "molfile": "\n Marvin 01132104152D \n\n 36 37 0 0 0 0 999 V2000\n 3.6997 -1.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4064 -2.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1269 -1.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8474 -2.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5679 -1.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2885 -2.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0090 -1.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7295 -2.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4500 -1.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1568 -2.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6997 -1.1362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9791 -2.3694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1568 -3.2008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8773 -1.9676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8314 -1.1362 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5519 -0.7067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8314 -1.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2724 -1.1362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5519 -2.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2724 -1.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1109 -0.7067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1224 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9537 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4157 -2.6743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0250 -3.2008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3045 -3.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0250 -2.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5840 -3.2008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3045 -1.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5840 -2.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7455 -3.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7340 -4.3370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9027 -4.3370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8564 -2.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4407 -1.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 12 1 0 0 0 0\n 1 11 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 14 1 0 0 0 0\n 10 13 2 0 0 0 0\n 12 20 1 0 0 0 0\n 14 31 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 15 21 1 0 0 0 0\n 16 18 1 0 0 0 0\n 16 22 1 0 0 0 0\n 16 23 1 0 0 0 0\n 17 19 1 0 0 0 0\n 17 24 1 0 0 0 0\n 17 25 1 0 0 0 0\n 18 20 1 0 0 0 0\n 19 20 1 0 0 0 0\n 26 27 1 0 0 0 0\n 26 28 1 0 0 0 0\n 26 32 1 0 0 0 0\n 27 29 1 0 0 0 0\n 27 33 1 0 0 0 0\n 27 34 1 0 0 0 0\n 28 30 1 0 0 0 0\n 28 35 1 0 0 0 0\n 28 36 1 0 0 0 0\n 29 31 1 0 0 0 0\n 30 31 1 0 0 0 0\nM END", "smiles": "CC1(C)CC(CC(C)(C)N1C)OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)N(C)C(C)(C)C2", "formula": "C30H56N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "508.7778", "optical_activity": "NONE", "references": [ "0bd2d3f4-b792-428c-92ad-bbb14e6bc537" ], "stereo_centers": 0 }, "unii": "DHJ5QK3K4J" } ] }