{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "80fb4b1d-21bc-46d8-ad4c-adf3978b365a",
          "code": "C1113",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1113",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b049c835-b47e-4111-a8e9-e04e36fc7c93"
          ]
        },
        {
          "uuid": "b28eafb4-be81-497c-8e3b-4c838bec35f5",
          "code": "446-72-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=446-72-0",
          "code_system": "CAS",
          "references": [
            "b049c835-b47e-4111-a8e9-e04e36fc7c93",
            "5ba7bbb5-e841-4750-b588-82d4d0096098"
          ]
        },
        {
          "uuid": "3e7440cd-8743-4b98-8a55-dfa3e40cfadc",
          "code": "D019833",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68019833",
          "code_system": "MESH",
          "references": [
            "b049c835-b47e-4111-a8e9-e04e36fc7c93"
          ]
        },
        {
          "uuid": "37722ab6-9a34-49b9-af43-e6a7c4428333",
          "code": "GENISTEIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Genistein",
          "code_system": "WIKIPEDIA",
          "references": [
            "b049c835-b47e-4111-a8e9-e04e36fc7c93"
          ]
        },
        {
          "uuid": "62fd453c-0673-4043-be81-d5f8647de4a8",
          "code": "207-174-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.524",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b049c835-b47e-4111-a8e9-e04e36fc7c93"
          ]
        },
        {
          "uuid": "f14c52d2-e8e2-404c-8def-d2e6dc23539c",
          "code": "25696",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/25696/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "b049c835-b47e-4111-a8e9-e04e36fc7c93"
          ]
        },
        {
          "uuid": "287897d1-5706-4a09-9321-647c3ea5a66e",
          "code": "m5696",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5696?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b049c835-b47e-4111-a8e9-e04e36fc7c93"
          ]
        },
        {
          "uuid": "9251294e-2488-41ea-b2a0-d9b015c70205",
          "code": "SUB13958MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "b049c835-b47e-4111-a8e9-e04e36fc7c93"
          ]
        },
        {
          "uuid": "8b96d606-8cff-4ffd-bd1d-3e8b4f70f8d0",
          "code": "5280961",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5280961",
          "code_system": "PUBCHEM",
          "references": [
            "b049c835-b47e-4111-a8e9-e04e36fc7c93"
          ]
        },
        {
          "uuid": "aeee150c-49c7-852e-425e-4624dc1138f0",
          "code": "7475",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7475",
          "code_system": "HSDB",
          "references": [
            "709fdf19-07db-3009-b2e9-30854a724ce2"
          ]
        },
        {
          "uuid": "b8a8eb7e-8ca2-6219-011f-991346e311a6",
          "code": "DTXSID5022308",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5022308",
          "code_system": "EPA CompTox",
          "references": [
            "8d697db8-a02f-4ccc-f5d7-ccb88dad9531"
          ]
        },
        {
          "uuid": "88f5d62f-3c35-fe07-555d-1ba8d6ce9d5c",
          "code": "241107",
          "comments": "ORPHAN DRUG|Designated|Prevention of acute radiation syndrome",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=241107",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "e47b268b-3569-ae3f-f231-9661b87c1a46",
          "code": "C1742",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Angiogenesis Inhibitor",
          "codeText": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Angiogenesis Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1742",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3119dfea-e81d-c265-398e-afe3328943aa"
          ]
        },
        {
          "uuid": "676a40f6-4348-fb51-be80-c3bfa6fb0fef",
          "code": "C1821",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Antineoplastic Hormonal/Endocrine Agent[C129818]|Antiestrogen[C481]|Selective Estrogen Receptor Modulator",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1821",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3119dfea-e81d-c265-398e-afe3328943aa"
          ]
        },
        {
          "uuid": "242b0b01-d09a-d664-5866-83a09b7d226b",
          "code": "C1967",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor[C471]|Protein Kinase Inhibitor[C1404]|Tyrosine Kinase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1967",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3119dfea-e81d-c265-398e-afe3328943aa"
          ]
        },
        {
          "uuid": "cf623e69-53d1-4943-d9a7-8cff6ba8d2f0",
          "code": "C599",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Dietary Polyphenol[C70553]|Dietary Flavonoid[C70554]|Flavone[C68464]|Isoflavone",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C599",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3119dfea-e81d-c265-398e-afe3328943aa"
          ]
        },
        {
          "uuid": "9e41d5b0-af27-4c3a-8096-34ca25deaf67",
          "code": "11073",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=11073",
          "code_system": "INN",
          "references": [
            "26c64891-8f92-22bb-b26d-77f0d2b470d8"
          ]
        },
        {
          "uuid": "804f2136-f4f4-4a7c-bd50-c59a55a6ee2d",
          "code": "DH2M523P0H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d26b9b51-f20c-d7db-f614-90e24d0b5894",
          "code": "1584 (Number of products:80)",
          "comments": "Dietary Supplement Label Database|Botanical|Genistein",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1584&item=Genistein",
          "code_system": "DSLD",
          "references": [
            "3119dfea-e81d-c265-398e-afe3328943aa"
          ]
        },
        {
          "uuid": "3a55fe51-fa13-1c83-ade4-29fae1f37025",
          "code": "DB01645",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB01645",
          "code_system": "DRUG BANK",
          "references": [
            "3119dfea-e81d-c265-398e-afe3328943aa"
          ]
        },
        {
          "uuid": "111ed46e-f906-eed3-ec1a-5b77cfdbf57f",
          "code": "1288816",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1288816",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "3119dfea-e81d-c265-398e-afe3328943aa"
          ]
        },
        {
          "uuid": "f65bff73-ad37-663a-b247-7b7c93a6e4c4",
          "code": "74224",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:74224",
          "code_system": "CHEBI",
          "references": [
            "3119dfea-e81d-c265-398e-afe3328943aa"
          ]
        },
        {
          "uuid": "aca3cb8e-1e8e-1ce9-2c04-78566ef0bba5",
          "code": "27514",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:27514",
          "code_system": "CHEBI",
          "references": [
            "3119dfea-e81d-c265-398e-afe3328943aa"
          ]
        },
        {
          "uuid": "27f495a8-34b5-39cd-e7fc-bb5e3d664ee0",
          "code": "28088",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28088",
          "code_system": "CHEBI",
          "references": [
            "3119dfea-e81d-c265-398e-afe3328943aa"
          ]
        },
        {
          "uuid": "c15cc663-bc94-eb29-a97c-8e859c01eced",
          "code": "FG-12",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/FG-12/relevant/1/",
          "code_system": "USAN",
          "references": [
            "3db75a56-c495-f805-bf82-baef35647604"
          ]
        },
        {
          "uuid": "98e6656d-42cd-6d5a-1364-91117ed3736b",
          "code": "100000078160",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "81b168ac-662d-aa92-9736-d2a6fdb01f80"
          ]
        },
        {
          "uuid": "50c37955-da66-49e6-45b1-e382a9e5ccf0",
          "code": "36586",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=36586",
          "code_system": "NSC",
          "references": [
            "8573d192-d8f8-420e-bdfd-7873b063a547"
          ]
        },
        {
          "uuid": "6392efe4-cb37-a479-3278-12fb00dbed04",
          "code": "DH2M523P0H",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=DH2M523P0H",
          "code_system": "DAILYMED",
          "references": [
            "e6154127-62e5-141f-deac-4d1eb69983bf"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "83e4fc5c-6993-4580-a50e-10fa9c3a950d",
          "amount": {
            "uuid": "e5d368e7-e41f-4591-8ff5-f5cdce0534bd"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "54dcebb7-364f-4707-8186-78c080177503",
            "refuuid": "7b458395-4aa1-46ba-94bd-95eef84b12e3",
            "name": "GENISTEIN",
            "unii": "DH2M523P0H",
            "linking_id": "DH2M523P0H",
            "ref_pname": "GENISTEIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "73ff8ff1-8bad-46e3-8367-aded176b8739",
          "amount": {
            "uuid": "f9952c49-f103-446d-91ce-0c5d5cc594de"
          },
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "f01f130a-9e1d-42b7-89cd-3ebb9c443824"
          ],
          "related_substance": {
            "uuid": "8285770a-6719-4797-967c-d527b75ed187",
            "refuuid": "08bef3b5-f639-432a-922b-4876ec5f3617",
            "name": "RED CLOVER",
            "unii": "L9153EKV2Y",
            "linking_id": "L9153EKV2Y",
            "ref_pname": "RED CLOVER",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d471f03e-4320-46ea-8e5d-52b3f871a990",
          "amount": {
            "uuid": "04603b88-cc05-46b7-b687-a5f5ed33f4ff"
          },
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "f01f130a-9e1d-42b7-89cd-3ebb9c443824"
          ],
          "related_substance": {
            "uuid": "bff7bd46-defa-4805-93d7-5e9234726af6",
            "refuuid": "eb56b2ed-61f5-4c8a-999b-e31ad1c11371",
            "name": "SOY ISOFLAVONES",
            "unii": "71B37NR06D",
            "linking_id": "71B37NR06D",
            "ref_pname": "SOY ISOFLAVONES",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1cecf4ca-d6f8-4d17-a962-446740484aac",
          "amount": {
            "uuid": "9adc4700-82df-4f22-a2ba-c7f4ea02e5f3"
          },
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "d0dc3ff9-d7e6-4229-b12f-ce5e16f21b48"
          ],
          "related_substance": {
            "uuid": "df64879a-ae25-4517-9f5c-163290b2b0ba",
            "refuuid": "0031fcdf-5484-4514-b957-0eaa62aa418d",
            "name": "MEDICAGO SATIVA WHOLE",
            "unii": "DJO934BRBD",
            "linking_id": "DJO934BRBD",
            "ref_pname": "MEDICAGO SATIVA WHOLE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "bbf05a7a-e045-4e47-9432-adfc2e5cf983",
          "amount": {
            "uuid": "af4e8e69-8283-436e-a00d-25c5d030cef6"
          },
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "related_substance": {
            "uuid": "a6a5f040-b3ce-47e0-8232-e92a99e8985d",
            "refuuid": "e15f01d6-026b-4779-a98e-b5f7d3d8532e",
            "name": "TRIFOLIUM PRATENSE FLOWER",
            "unii": "4JS0838828",
            "linking_id": "4JS0838828",
            "ref_pname": "TRIFOLIUM PRATENSE FLOWER",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d82566d7-00c4-49f2-a5fc-d53dfb1afafd",
          "amount": {
            "uuid": "8139a849-a87e-41fe-8648-43465a5ced9b"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "33fda58f-6ac0-42cc-8e53-8632f1edbf8d"
          ],
          "related_substance": {
            "uuid": "f4c4d47d-532d-4eb8-9edd-8187b2f57d03",
            "refuuid": "4d06209f-2933-3a2e-9f18-c3f31068b239",
            "name": "GENISTEIN SODIUM DIHYDRATE",
            "unii": "Z6D785B7J3",
            "linking_id": "Z6D785B7J3",
            "ref_pname": "GENISTEIN SODIUM DIHYDRATE"
          }
        },
        {
          "uuid": "8a0f5727-5e6a-4808-9bb4-fb36ed50ef26",
          "amount": {
            "uuid": "e869a97d-8f3f-4480-871c-14574bc25401"
          },
          "type": "TARGET->INHIBITOR",
          "references": [
            "b804faf7-1428-4f23-85c4-2a3970326ae2"
          ],
          "related_substance": {
            "uuid": "4037c505-ff86-4948-92fc-b495a6c8372d",
            "refuuid": "52fcf38a-92c2-40b9-b525-86c7d7039413",
            "name": "SERINE/THREONINE-PROTEIN KINASE PLK1",
            "unii": "LRQ0Y7262H",
            "linking_id": "LRQ0Y7262H",
            "ref_pname": "SERINE/THREONINE-PROTEIN KINASE PLK1",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "81c0b247-3413-4832-8bcd-f11494840dee",
          "name": "4',5,7-TRIHYDROXYISOFLAVONE",
          "stdName": "4',5,7-TRIHYDROXYISOFLAVONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f94995e7-da77-484e-abea-587c05ac82ad",
            "660d672d-76c6-4eb3-993d-ec5fe48ef384"
          ],
          "display_name": false
        },
        {
          "uuid": "08272d7a-0644-d0ab-cbdc-c1db6f9ff197",
          "name": "4H-1-BENZOPYRAN-4-ONE, 5,7-DIHYDROXY-3-(4-HYDROXYPHENYL)-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 5,7-DIHYDROXY-3-(4-HYDROXYPHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ba7bbb5-e841-4750-b588-82d4d0096098"
          ],
          "display_name": false
        },
        {
          "uuid": "a1877ee7-1b7d-45c6-bd0b-55136f5f6671",
          "name": "5,7-DIHYDROXY-3-(4-HYDROXYPHENYL)-4H-1-BENZOPYRAN-4-ONE",
          "stdName": "5,7-DIHYDROXY-3-(4-HYDROXYPHENYL)-4H-1-BENZOPYRAN-4-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f94995e7-da77-484e-abea-587c05ac82ad"
          ],
          "display_name": false
        },
        {
          "uuid": "f5cc6be5-45c1-432d-b78a-ad7c6f726f54",
          "name": "5,7-DIHYDROXY-3-(4-HYDROXYPHENYL)-CHROMEN-4-ONE",
          "stdName": "5,7-DIHYDROXY-3-(4-HYDROXYPHENYL)-CHROMEN-4-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "655a5eba-ca1e-41f2-8f51-93b52fe243b2",
            "660d672d-76c6-4eb3-993d-ec5fe48ef384"
          ],
          "display_name": false
        },
        {
          "uuid": "3a66b34c-fa57-e5cb-e237-a94293eee4aa",
          "name": "BIO-300",
          "stdName": "BIO-300",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26c64891-8f92-22bb-b26d-77f0d2b470d8"
          ],
          "display_name": false
        },
        {
          "uuid": "f1b06b9b-4efb-405b-aec3-dfa0abc13b54",
          "name": "FW-635I-2",
          "stdName": "FW-635I-2",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d110d14d-fa90-4642-b630-15a2a624b33f",
            "660d672d-76c6-4eb3-993d-ec5fe48ef384"
          ],
          "display_name": false
        },
        {
          "uuid": "722cef53-658f-4cc0-874d-612fd94474a6",
          "name": "GENISTEIN",
          "stdName": "GENISTEIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae3c12a8-08c3-4336-b7e3-989afdaf91b0",
            "f8a32e8e-3dbe-438d-b00d-34472ebe3716",
            "d302fba1-784a-46c5-b932-fb417ea29b80",
            "c8b8e5f4-2c2e-45c7-a8b3-eb8c2049ceec",
            "f1673469-6b7c-4b42-be0c-9ea7219e0230",
            "57fcc4f9-abe9-4933-8c2a-3e66840d72c0",
            "c4b32209-0425-435e-b273-848ec911f437",
            "25a99d24-fc4b-45c6-9150-03cd6934b91c",
            "ef4ce606-9c9f-430d-9990-27257c562565",
            "847603ed-72db-48cd-8911-91f2e75969eb",
            "8f932911-19ce-4719-a1a1-06d0645c9ab2",
            "121493fd-ac8b-4c6e-8728-d515b87857a0",
            "f94995e7-da77-484e-abea-587c05ac82ad",
            "660d672d-76c6-4eb3-993d-ec5fe48ef384",
            "1c61c244-0ea9-1706-19a1-c5f2b3e0202d"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "9774f6fa-3a10-4ffb-9380-cdf7310f04d1",
              "name_org": "INN"
            },
            {
              "uuid": "f91a7c48-6187-44be-80b7-64e230281fa9",
              "name_org": "USAN"
            },
            {
              "uuid": "5b35301e-d3e9-4f78-b425-ff5495ff5efc",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "6326580b-55f2-4e8b-a6e1-e4d5b0e9999f",
          "name": "GENISTEIN (CONSTITUENT OF RED CLOVER) [DSC]",
          "stdName": "GENISTEIN (CONSTITUENT OF RED CLOVER) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c58ad79c-0f1d-4232-8708-c6d436992ac8",
            "660d672d-76c6-4eb3-993d-ec5fe48ef384"
          ],
          "display_name": false
        },
        {
          "uuid": "b1b8af10-95d8-4fe9-a0f2-4dafbd4c3bb8",
          "name": "GENISTEIN (CONSTITUENT OF SOY ISOFLAVONES) [DSC]",
          "stdName": "GENISTEIN (CONSTITUENT OF SOY ISOFLAVONES) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c58ad79c-0f1d-4232-8708-c6d436992ac8",
            "660d672d-76c6-4eb3-993d-ec5fe48ef384"
          ],
          "display_name": false
        },
        {
          "uuid": "40185b4d-99d1-4ba0-9a28-772ecdbb5d17",
          "name": "GENISTEIN [HSDB]",
          "stdName": "GENISTEIN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "847603ed-72db-48cd-8911-91f2e75969eb",
            "660d672d-76c6-4eb3-993d-ec5fe48ef384"
          ],
          "display_name": false
        },
        {
          "uuid": "4774c4a3-7fda-4cb2-9f85-00a9343ddfaf",
          "name": "GENISTEIN [MART.]",
          "stdName": "GENISTEIN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef4ce606-9c9f-430d-9990-27257c562565"
          ],
          "display_name": false
        },
        {
          "uuid": "8c367480-d51c-4abb-bce1-e9f6f42ce3f6",
          "name": "GENISTEIN [MI]",
          "stdName": "GENISTEIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8a32e8e-3dbe-438d-b00d-34472ebe3716",
            "660d672d-76c6-4eb3-993d-ec5fe48ef384"
          ],
          "display_name": false
        },
        {
          "uuid": "d4f53906-ca0e-9b63-5752-6504beb559c6",
          "name": "GENISTEIN [USAN]",
          "stdName": "GENISTEIN [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26c64891-8f92-22bb-b26d-77f0d2b470d8"
          ],
          "display_name": false
        },
        {
          "uuid": "d520befb-948e-46e7-9087-9b1e3f59e64c",
          "name": "GENISTEIN [USP-RS]",
          "stdName": "GENISTEIN [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d302fba1-784a-46c5-b932-fb417ea29b80",
            "660d672d-76c6-4eb3-993d-ec5fe48ef384"
          ],
          "display_name": false
        },
        {
          "uuid": "996248d4-3fe7-adbf-80da-87478679a1b1",
          "name": "Genistein [WHO-DD]",
          "stdName": "GENISTEIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6498977c-91a4-4013-267e-aa23f730ad86"
          ],
          "display_name": false
        },
        {
          "uuid": "fac37bc3-7416-48c4-8fa5-ec473d529c1c",
          "name": "NPI-031L",
          "stdName": "NPI-031L",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d110d14d-fa90-4642-b630-15a2a624b33f",
            "660d672d-76c6-4eb3-993d-ec5fe48ef384"
          ],
          "display_name": false
        },
        {
          "uuid": "8bf4195a-370b-4021-8d86-55e7ac8fc6ee",
          "name": "NSC-36586",
          "stdName": "NSC-36586",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d110d14d-fa90-4642-b630-15a2a624b33f",
            "660d672d-76c6-4eb3-993d-ec5fe48ef384"
          ],
          "display_name": false
        },
        {
          "uuid": "f9a47c59-446b-406c-947f-8e979c73b367",
          "name": "SIPI-807-1",
          "stdName": "SIPI-807-1",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d110d14d-fa90-4642-b630-15a2a624b33f",
            "660d672d-76c6-4eb3-993d-ec5fe48ef384"
          ],
          "display_name": false
        },
        {
          "uuid": "4714d8f6-8586-43dc-aa77-6eb9da14309b",
          "name": "SOPHORICOL",
          "stdName": "SOPHORICOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "29e4ca69-1135-450a-b247-204a805c591e",
            "660d672d-76c6-4eb3-993d-ec5fe48ef384"
          ],
          "display_name": false
        },
        {
          "uuid": "6141adf7-1831-1a3c-7b98-e77a4a890c6b",
          "name": "genistein [INN]",
          "stdName": "GENISTEIN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c61c244-0ea9-1706-19a1-c5f2b3e0202d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f94995e7-da77-484e-abea-587c05ac82ad",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "660d672d-76c6-4eb3-993d-ec5fe48ef384",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef4ce606-9c9f-430d-9990-27257c562565",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8a32e8e-3dbe-438d-b00d-34472ebe3716",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c4b32209-0425-435e-b273-848ec911f437",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "847603ed-72db-48cd-8911-91f2e75969eb",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d302fba1-784a-46c5-b932-fb417ea29b80",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8b8e5f4-2c2e-45c7-a8b3-eb8c2049ceec",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "29e4ca69-1135-450a-b247-204a805c591e",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d110d14d-fa90-4642-b630-15a2a624b33f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c58ad79c-0f1d-4232-8708-c6d436992ac8",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "655a5eba-ca1e-41f2-8f51-93b52fe243b2",
          "citation": "ORPHAN DRUG",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b049c835-b47e-4111-a8e9-e04e36fc7c93",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390175000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f01f130a-9e1d-42b7-89cd-3ebb9c443824",
          "citation": "USP-DSC",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0dc3ff9-d7e6-4229-b12f-ce5e16f21b48",
          "citation": "HERBAL MEDICINES 3RD ED 2007",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2114038c-6c9b-4840-b6b7-8fd09e915a69",
          "citation": "SRS import [DH2M523P0H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=DH2M523P0H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390175000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25a99d24-fc4b-45c6-9150-03cd6934b91c",
          "citation": "GENISTEIN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "121493fd-ac8b-4c6e-8728-d515b87857a0",
          "citation": "GENISTEIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "57fcc4f9-abe9-4933-8c2a-3e66840d72c0",
          "citation": "GENISTEIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8f932911-19ce-4719-a1a1-06d0645c9ab2",
          "citation": "GENISTEIN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ae3c12a8-08c3-4336-b7e3-989afdaf91b0",
          "citation": "GENISTEIN [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f1673469-6b7c-4b42-be0c-9ea7219e0230",
          "citation": "GENISTEIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "709fdf19-07db-3009-b2e9-30854a724ce2",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+446-72-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8d697db8-a02f-4ccc-f5d7-ccb88dad9531",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=446-72-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3119dfea-e81d-c265-398e-afe3328943aa",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "26c64891-8f92-22bb-b26d-77f0d2b470d8",
          "citation": "USAN COUN 2019",
          "doc_type": "USANCOUN",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2099cdb2-1af1-4569-87b1-c3995a14cc41",
          "citation": "EU/3/12/980",
          "doc_type": "ORPHAN DRUG",
          "public_domain": true
        },
        {
          "uuid": "5ba7bbb5-e841-4750-b588-82d4d0096098",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1c61c244-0ea9-1706-19a1-c5f2b3e0202d",
          "citation": "INN Proposed List 122",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL122.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3db75a56-c495-f805-bf82-baef35647604",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "33fda58f-6ac0-42cc-8e53-8632f1edbf8d",
          "citation": "EU/3/12/980",
          "doc_type": "ORPHAN DRUG",
          "public_domain": true
        },
        {
          "uuid": "b804faf7-1428-4f23-85c4-2a3970326ae2",
          "citation": "https://www.ncbi.nlm.nih.gov/pmc/articles/PMC6566427/pdf/ijms-20-02420.pdf",
          "url": "https://www.ncbi.nlm.nih.gov/pmc/articles/PMC6566427/pdf/ijms-20-02420.pdf",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8573d192-d8f8-420e-bdfd-7873b063a547",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e6154127-62e5-141f-deac-4d1eb69983bf",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "6498977c-91a4-4013-267e-aa23f730ad86",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "81b168ac-662d-aa92-9736-d2a6fdb01f80",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b9c488ff-096c-4b54-9d7d-ff5df0963778",
          "id": "b9c488ff-096c-4b54-9d7d-ff5df0963778",
          "molfile": "\n  Marvin  01132109372D          \n\n 20 22  0  0  0  0            999 V2000\n    3.1787   -3.4850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4761   -3.0886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4761   -2.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7502   -1.8558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0476   -2.2882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0630   -3.0886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7708   -3.5159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2290   -2.2882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2290   -3.1144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4967   -3.5159    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2072   -3.1144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9098   -3.5159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6125   -3.1144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3331   -3.5442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6125   -2.2882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9098   -1.8866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9098   -1.0579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2072   -2.2882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4967   -1.8866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4967   -1.0579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  7  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5  8  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 19  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 18  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 16  1  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  2  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1-c2coc3cc(cc(c3c2=O)O)O)O",
          "formula": "C15H10O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d63287f0-f82b-48d9-9086-55cc7752ee9f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "270.2375",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7b458395-4aa1-46ba-94bd-95eef84b12e3",
      "version": "44",
      "structure": {
        "id": "a3e14677-cf3a-4719-9f08-d88798fe6af6",
        "molfile": "GENISTEIN\n  Marvin  01132108312D          \n\n 20 22  0  0  0  0            999 V2000\n   14.9086   -3.8518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1895   -4.2561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1800   -5.0810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4609   -5.4854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7512   -5.0647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7606   -4.2397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4797   -3.8354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4893   -3.0105    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0320   -5.4690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8896   -5.5016    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6088   -5.0973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6183   -4.2724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3374   -3.8682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0471   -4.2887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7664   -3.8845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7757   -3.0596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0660   -2.6389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3469   -3.0432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4948   -2.6552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9180   -3.0269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  2  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  3  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12  1  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 13  1  0  0  0  0\n 19 16  1  0  0  0  0\n 20  1  2  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1-c2coc3cc(cc(c3c2=O)O)O)O",
        "formula": "C15H10O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "270.2375",
        "optical_activity": "NONE",
        "references": [
          "f94995e7-da77-484e-abea-587c05ac82ad",
          "2114038c-6c9b-4840-b6b7-8fd09e915a69",
          "1c61c244-0ea9-1706-19a1-c5f2b3e0202d"
        ],
        "stereo_centers": 0
      },
      "unii": "DH2M523P0H"
    }
  ]
}