{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "17f925a1-3a36-4a75-b238-f4abf58b4020", "code": "2497-59-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2497-59-8", "code_system": "CAS", "references": [ "af64823a-1c81-4969-b0d0-c3c93fba2a4f", "c65e05ef-116a-479c-99b1-3d2b9ba248d1" ] }, { "uuid": "79f27af2-d373-4ca6-a134-60341421742c", "code": "219-682-8", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.017.894", "code_system": "ECHA (EC/EINECS)", "references": [ "af64823a-1c81-4969-b0d0-c3c93fba2a4f" ] }, { "uuid": "eff9cff9-30ee-4c5c-ba35-4366ae87c407", "code": "75622", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/75622", "code_system": "PUBCHEM", "references": [ "af64823a-1c81-4969-b0d0-c3c93fba2a4f" ] }, { "uuid": "53c61c86-e7b5-82ec-e9f9-6276490fc206", "code": "DTXSID60179685", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60179685", "code_system": "EPA CompTox", "references": [ "a8c1191a-39dc-99d0-d815-97775ed18e41" ] }, { "uuid": "45a666b0-9dee-4860-94d3-b7037ef280c8", "code": "DGW88559XL", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "c65e05ef-116a-479c-99b1-3d2b9ba248d1" ] } ], "substance_class": "chemical", "names": [ { "uuid": "b8937e3e-0bf6-4bb1-a5c0-7a1e5198f910", "name": "2-[2-[2-[2-[2-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol", "stdName": "2-(2-(2-(2-(2-(2-(2-(4-(2,4,4-TRIMETHYLPENTAN-2-YL)PHENOXY)ETHOXY)ETHOXY)ETHOXY)ETHOXY)ETHOXY)ETHOXY)ETHANOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c65e05ef-116a-479c-99b1-3d2b9ba248d1" ], "display_name": false }, { "uuid": "7edd27db-eb81-4aa7-b6d7-a538b6ae8517", "name": "20-(4-(1,1,3,3-TETRAMETHYLBUTYL)PHENOXY)-3,6,9,12,15,18-HEXAOXAICOSAN-1-OL", "stdName": "20-(4-(1,1,3,3-TETRAMETHYLBUTYL)PHENOXY)-3,6,9,12,15,18-HEXAOXAICOSAN-1-OL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "05b38696-3187-4f0f-811b-c103c66a11e9", "472fb9a4-394c-4453-9077-6458dd695cbb" ], "display_name": false }, { "uuid": "1e774ee7-e143-4a16-9bf0-9957960047ef", "name": "20-(4-(2,4,4-Trimethylpentan-2-yl)phenoxy)-3,6,9,12,15,18-hexaoxaicosan-1-ol", "stdName": "20-(4-(2,4,4-TRIMETHYLPENTAN-2-YL)PHENOXY)-3,6,9,12,15,18-HEXAOXAICOSAN-1-OL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c65e05ef-116a-479c-99b1-3d2b9ba248d1" ], "display_name": true }, { "uuid": "52257985-788d-4522-8ffe-809d35496ac1", "name": "3,6,9,12,15,18-HEXAOXAEICOSAN-1-OL, 20-(4-(1,1,3,3-TETRAMETHYLBUTYL)PHENOXY)-", "stdName": "3,6,9,12,15,18-HEXAOXAEICOSAN-1-OL, 20-(4-(1,1,3,3-TETRAMETHYLBUTYL)PHENOXY)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "05b38696-3187-4f0f-811b-c103c66a11e9", "cb087717-cf83-41d9-b95a-f2cb1dde7d71" ], "display_name": false }, { "uuid": "0552b8dd-ff77-4e32-b871-0e598ebf8888", "name": "3,6,9,12,15,18-HEXAOXAEICOSAN-1-OL, 20-(P-(1,1,3,3-TETRAMETHYLBUTYL)PHENOXY)-", "stdName": "3,6,9,12,15,18-HEXAOXAEICOSAN-1-OL, 20-(P-(1,1,3,3-TETRAMETHYLBUTYL)PHENOXY)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "05b38696-3187-4f0f-811b-c103c66a11e9", "cb087717-cf83-41d9-b95a-f2cb1dde7d71" ], "display_name": false }, { "uuid": "caef635f-4827-47d4-93cd-ae2414033900", "name": "HEPTAETHYLENE GLYCOL P-TERT-OCTYLPHENYL ETHER", "stdName": "HEPTAETHYLENE GLYCOL P-TERT-OCTYLPHENYL ETHER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "05b38696-3187-4f0f-811b-c103c66a11e9", "cb087717-cf83-41d9-b95a-f2cb1dde7d71" ], "display_name": false }, { "uuid": "4429ba23-83b5-4c82-bc3f-22c1c46647bd", "name": "Tergitol NO 7", "stdName": "TERGITOL NO 7", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c65e05ef-116a-479c-99b1-3d2b9ba248d1" ], "display_name": false }, { "uuid": "60b7cf56-bc3a-400c-aa45-93aac924ab4a", "name": "Triton(TM) X-114", "stdName": "TRITON(TM) X-114", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c65e05ef-116a-479c-99b1-3d2b9ba248d1" ], "display_name": false } ], "references": [ { "uuid": "472fb9a4-394c-4453-9077-6458dd695cbb", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "05b38696-3187-4f0f-811b-c103c66a11e9", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "cb087717-cf83-41d9-b95a-f2cb1dde7d71", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "af64823a-1c81-4969-b0d0-c3c93fba2a4f", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392569000, "tags": [ "NOMEN" ] }, { "uuid": "a8c1191a-39dc-99d0-d815-97775ed18e41", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2497-59-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "33775bd8-0590-36bd-26c2-19b54ec4f9a1", "citation": "STARI", "doc_type": "CFSAN", "public_domain": true }, { "uuid": "c65e05ef-116a-479c-99b1-3d2b9ba248d1", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "47d74aa3-c7f4-4667-9867-52ba0b4dcd58", "id": "47d74aa3-c7f4-4667-9867-52ba0b4dcd58", "molfile": "\n Marvin 01132103462D \n\n 36 36 0 0 0 0 999 V2000\n 10.9551 -14.1788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6663 -13.7605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3774 -13.3423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0846 -14.4670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2480 -13.0494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6663 -12.3384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0846 -11.6272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3774 -12.7566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9551 -11.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9551 -11.0836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2441 -10.6699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5330 -11.0836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8265 -10.6699 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8265 -9.8332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1155 -9.4150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1155 -8.5783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4043 -8.1602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4043 -7.3235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6933 -6.9098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6933 -6.0733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9823 -5.6550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9823 -4.8137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2711 -4.3954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2711 -3.5636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5600 -3.1453 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5600 -2.3087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8536 -1.8904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8536 -1.0539 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1378 -0.6355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1378 0.1964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4267 0.6147 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4267 1.4513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7203 1.8695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7203 2.7062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5330 -11.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2441 -12.3384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 2 1 0 0 0 0\n 2 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 6 1 0 0 0 0\n 9 6 1 0 0 0 0\n 10 9 1 0 0 0 0\n 36 9 2 0 0 0 0\n 11 10 2 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 12 35 2 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 36 1 0 0 0 0\nM END", "smiles": "CC(C)(C)CC(C)(C)c1ccc(cc1)OCCOCCOCCOCCOCCOCCOCCO", "formula": "C28H50O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c1d72573-a170-40b9-8f3e-ff475d9bde6f" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "514.6929", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "1e221509-f8c5-412e-9e9f-b3e8528eca9d", "version": "7", "structure": { "id": "ae1643f9-e7ca-4ed6-9c96-514c24ef84a3", "molfile": "\n Marvin 01132109022D \n\n 36 36 0 0 0 0 999 V2000\n 11.6663 -12.3384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9551 -11.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9551 -11.0836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2441 -10.6699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5330 -11.0836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5330 -11.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2441 -12.3384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8265 -10.6699 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8265 -9.8332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1155 -9.4150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1155 -8.5783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4043 -8.1602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4043 -7.3235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6933 -6.9098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6933 -6.0733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9823 -5.6550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9823 -4.8137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2711 -4.3954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2711 -3.5636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5600 -3.1453 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5600 -2.3087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8536 -1.8904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8536 -1.0539 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1378 -0.6355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1378 0.1964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4267 0.6147 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4267 1.4513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7203 1.8695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7203 2.7062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2480 -13.0494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6663 -13.7605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9551 -14.1788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3774 -13.3423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0846 -14.4670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0846 -11.6272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3774 -12.7566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 2 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 2 1 0 0 0 0\n 8 5 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 1 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 31 1 0 0 0 0\n 34 31 1 0 0 0 0\n 35 1 1 0 0 0 0\n 36 1 1 0 0 0 0\nM END", "smiles": "CC(C)(C)CC(C)(C)c1ccc(cc1)OCCOCCOCCOCCOCCOCCOCCO", "formula": "C28H50O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "514.6929", "optical_activity": "NONE", "references": [ "472fb9a4-394c-4453-9077-6458dd695cbb", "c65e05ef-116a-479c-99b1-3d2b9ba248d1" ], "stereo_centers": 0 }, "unii": "DGW88559XL" } ] }