{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7a1869eb-b638-4a47-9226-d57005f3b966",
          "code": "134-04-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=134-04-3",
          "code_system": "CAS",
          "references": [
            "960d57ae-443b-44d3-b49c-e3d7ab5c23a6",
            "ebf73722-0d58-4efd-aa50-576fd2eb596b"
          ]
        },
        {
          "uuid": "b6313009-0f1a-427a-b6a6-0edf4312a088",
          "code": "PELARGONIDIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pelargonidin",
          "code_system": "WIKIPEDIA",
          "references": [
            "960d57ae-443b-44d3-b49c-e3d7ab5c23a6"
          ]
        },
        {
          "uuid": "32944efb-3b90-438c-aee0-4d7c93077e97",
          "code": "205-127-7",
          "type": "PRIMARY",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "960d57ae-443b-44d3-b49c-e3d7ab5c23a6"
          ]
        },
        {
          "uuid": "feeaff7b-a019-4489-91db-71bee7d5ec6a",
          "code": "m8450",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8450?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "960d57ae-443b-44d3-b49c-e3d7ab5c23a6"
          ]
        },
        {
          "uuid": "b1ad71a2-a404-45b9-a8ba-c45e7f232abc",
          "code": "67249",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/67249",
          "code_system": "PUBCHEM",
          "references": [
            "960d57ae-443b-44d3-b49c-e3d7ab5c23a6"
          ]
        },
        {
          "uuid": "e6d57c12-a474-464a-839c-798e241c18f5",
          "code": "DFL6200791",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d2bf36a6-ea03-b452-16d9-d72bd3360b20",
          "code": "144777",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:144777",
          "code_system": "CHEBI"
        },
        {
          "uuid": "89e07dea-c417-37b4-775b-56b3fee5dfa0",
          "code": "25863",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:25863",
          "code_system": "CHEBI"
        },
        {
          "uuid": "197344bf-7fb4-6d01-c705-8ed65096efa5",
          "code": "28510",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28510",
          "code_system": "CHEBI"
        },
        {
          "uuid": "f4edd6cd-71af-ccac-0362-58cca0270840",
          "code": "DTXSID001020859",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID001020859",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a8a3c06a-d53b-44ef-a16b-9611604b1a86",
          "name": "3,4',5,7-TETRAHYDROXY-2-PHENYLBENZOPYRYLIUM CHLORIDE",
          "stdName": "3,4',5,7-TETRAHYDROXY-2-PHENYLBENZOPYRYLIUM CHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8711fa5-98a9-48c6-a96d-1f7d82f2f6f1",
            "85c40f88-ea05-436b-9c45-85c220ea9615"
          ],
          "display_name": false
        },
        {
          "uuid": "d7ab1eeb-74aa-4f5b-b09c-428ad66d2f78",
          "name": "3,4',5,7-TETRAHYDROXYFLAVYLIUM CHLORIDE",
          "stdName": "3,4',5,7-TETRAHYDROXYFLAVYLIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8711fa5-98a9-48c6-a96d-1f7d82f2f6f1",
            "85c40f88-ea05-436b-9c45-85c220ea9615"
          ],
          "display_name": false
        },
        {
          "uuid": "5b8ca4fa-8bb8-4a17-a951-3f77d81c7b0d",
          "name": "3,5,7-TRIHYDROXY-2-(4-HYDROXYPHENYL)-1-BENZOPYRYLIUM CHLORIDE",
          "stdName": "3,5,7-TRIHYDROXY-2-(4-HYDROXYPHENYL)-1-BENZOPYRYLIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8711fa5-98a9-48c6-a96d-1f7d82f2f6f1",
            "85c40f88-ea05-436b-9c45-85c220ea9615"
          ],
          "display_name": false
        },
        {
          "uuid": "d07d73a5-c454-42f2-b06f-a5c4c224e7e5",
          "name": "PELARGONIDIN",
          "stdName": "PELARGONIDIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8711fa5-98a9-48c6-a96d-1f7d82f2f6f1",
            "9f35647d-c298-4e4b-a3f0-8a8bbfae5ab1",
            "85c40f88-ea05-436b-9c45-85c220ea9615",
            "ef5da810-c25e-4191-abd2-4684d725264d"
          ],
          "display_name": false
        },
        {
          "uuid": "8862bec4-422b-435b-ba94-d84a5ef74705",
          "name": "PELARGONIDIN CHLORIDE",
          "stdName": "PELARGONIDIN CHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2cad4bd-2d2f-491e-8d2e-1e979b36ed62"
          ],
          "display_name": true
        },
        {
          "uuid": "45724906-3329-4511-9200-7edc4d406e5b",
          "name": "PELARGONIDIN [MI]",
          "stdName": "PELARGONIDIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8711fa5-98a9-48c6-a96d-1f7d82f2f6f1",
            "9f35647d-c298-4e4b-a3f0-8a8bbfae5ab1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a2cad4bd-2d2f-491e-8d2e-1e979b36ed62",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9f35647d-c298-4e4b-a3f0-8a8bbfae5ab1",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8711fa5-98a9-48c6-a96d-1f7d82f2f6f1",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85c40f88-ea05-436b-9c45-85c220ea9615",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "960d57ae-443b-44d3-b49c-e3d7ab5c23a6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391030000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0925837a-7d17-4a9b-9d20-71c0a3849d2e",
          "citation": "SRS import [DFL6200791]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=DFL6200791",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391030000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "405d7099-8a56-4a5e-b5bf-d2502c093842",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef5da810-c25e-4191-abd2-4684d725264d",
          "citation": "PELARGONIDIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ebf73722-0d58-4efd-aa50-576fd2eb596b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9cc7f95f-576f-4a51-8628-f0166c2331a6",
          "id": "9cc7f95f-576f-4a51-8628-f0166c2331a6",
          "molfile": "\n  Marvin  01132108092D          \n\n  1  0  0  0  0  0            999 V2000\n    6.3086   -7.0055    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "47254ddd-6690-4c0f-a602-b53365b5cb8d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "f5e30c49-098b-469a-8b6f-b5578d1c7465",
          "id": "f5e30c49-098b-469a-8b6f-b5578d1c7465",
          "molfile": "\n  Marvin  01132112452D          \n\n 20 22  0  0  0  0            999 V2000\n    3.8089   -5.9627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5085   -5.5329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5085   -4.7102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1743   -4.2763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1743   -3.4535    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9166   -4.6699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6183   -4.2361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3519   -4.6274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0582   -4.1936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3519   -5.4503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6858   -5.8842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9166   -5.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2507   -5.9265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1298   -5.8439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8315   -5.4100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6097   -5.8037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6097   -6.6265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3430   -7.0179    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9032   -7.0604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1298   -6.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 13  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  4  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 12  2  0  0  0  0\n  8  7  2  3  0  0  0\n  9  8  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 14 10  2  3  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 20 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  2  3  0  0  0\nM  END",
          "smiles": "C1=CC(=O)C=CC1=C2C(=Cc3c(cc(cc3O2)O)O)O",
          "formula": "C15H10O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9502ce33-1e0b-40d3-b742-7256a6a1d229"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "270.2375",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d68f6953-c385-494b-97af-31121e36b7c7",
      "version": "8",
      "structure": {
        "id": "c133a658-406a-4051-a27c-b6e3df6e4ea8",
        "molfile": "\n  Marvin  01132109592D          \n\n 21 22  0  0  0  0            999 V2000\n    6.3086   -7.0055    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n    6.6858   -5.8842    0.0000 O   0  3  0  0  0  0  0  0  0  0  0  0\n    5.9166   -5.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9166   -4.6699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6183   -4.2361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3519   -4.6274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3519   -5.4503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1298   -5.8439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8315   -5.4100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6097   -5.8037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6097   -6.6265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9032   -7.0604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1298   -6.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3430   -7.0179    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0582   -4.1936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1743   -4.2763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1743   -3.4535    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5085   -4.7102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5085   -5.5329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2507   -5.9265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8089   -5.9627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  2  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13  8  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15  6  1  0  0  0  0\n 16  4  2  0  0  0  0\n 17 16  1  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20  3  2  0  0  0  0\n 21 19  1  0  0  0  0\nM  CHG  2   1  -1   2   1\nM  END",
        "smiles": "c1cc(ccc1-c2c(cc3c(cc(cc3[o+]2)O)O)O)O.[Cl-]",
        "formula": "C15H11O5.Cl",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "306.6983",
        "optical_activity": "NONE",
        "references": [
          "405d7099-8a56-4a5e-b5bf-d2502c093842",
          "0925837a-7d17-4a9b-9d20-71c0a3849d2e"
        ],
        "stereo_centers": 0
      },
      "unii": "DFL6200791"
    }
  ]
}