{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "118aecca-61e6-4692-8eec-742ce56b90c3", "code": "86674-63-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=86674-63-7", "code_system": "CAS", "references": [ "31c8a3c3-1512-44fa-90d2-5d9cbf354122", "31840714-29a4-44c6-a776-c0e804a40b5b" ] }, { "uuid": "f2883121-5f17-43c2-adef-51e21ece9710", "code": "71587319", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587319", "code_system": "PUBCHEM", "references": [ "31c8a3c3-1512-44fa-90d2-5d9cbf354122" ] }, { "uuid": "f60892e1-76b5-2975-2c05-36b3485b087d", "code": "DTXSID20235756", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20235756", "code_system": "EPA CompTox", "references": [ "71d7aab0-5b6b-80dd-a30f-a7b7e3199249" ] }, { "uuid": "4fbf8d73-398c-4fd0-b999-a5766a0ab6db", "code": "DF85J9S55Z", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "adbc5713-971e-4cd0-b628-729c41eca920", "name": "STIGMAST", "stdName": "STIGMAST", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "5a45c9a2-4854-4907-b366-e1f4872d2556", "54899c78-1018-40bb-b916-b5ce8ba82bcf" ], "display_name": false }, { "uuid": "b4f25ecf-9896-4a87-ac21-89ae302adb34", "name": "STIGMASTA-5,22-DIEN-3-OL, 3-(HYDROGEN BUTANEDIOATE), (3.BETA.,22E)-", "stdName": "STIGMASTA-5,22-DIEN-3-OL, 3-(HYDROGEN BUTANEDIOATE), (3.BETA.,22E)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5a45c9a2-4854-4907-b366-e1f4872d2556", "54899c78-1018-40bb-b916-b5ce8ba82bcf" ], "display_name": false }, { "uuid": "9adeadfd-c1c4-46d0-86ec-e1653572c9dc", "name": "STIGMASTA-5,22-DIEN-3-OL, HYDROGEN BUTANEDIOATE, (3.BETA.,22E)-", "stdName": "STIGMASTA-5,22-DIEN-3-OL, HYDROGEN BUTANEDIOATE, (3.BETA.,22E)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "54899c78-1018-40bb-b916-b5ce8ba82bcf", "89735dc3-3f51-4201-a6d2-c90545f2b7fd" ], "display_name": false }, { "uuid": "44ff138c-10ca-4021-b1f8-b967e7f48c73", "name": "STIGMASTEROL HEMISUCCINATE", "stdName": "STIGMASTEROL HEMISUCCINATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "54899c78-1018-40bb-b916-b5ce8ba82bcf", "89735dc3-3f51-4201-a6d2-c90545f2b7fd" ], "display_name": false }, { "uuid": "ec8dc36b-05b2-4531-bd68-52d12c7f45d7", "name": "STIGMASTERYL SUCCINATE", "stdName": "STIGMASTERYL SUCCINATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "cf16c9e4-abeb-4655-8bec-b6ce05761028", "5a45c9a2-4854-4907-b366-e1f4872d2556", "54899c78-1018-40bb-b916-b5ce8ba82bcf" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "39d5efa5-54bd-4dd7-b4cc-3914d09396fd", "name_org": "INCI" } ] } ], "references": [ { "uuid": "5a45c9a2-4854-4907-b366-e1f4872d2556", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "54899c78-1018-40bb-b916-b5ce8ba82bcf", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "89735dc3-3f51-4201-a6d2-c90545f2b7fd", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "31c8a3c3-1512-44fa-90d2-5d9cbf354122", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391594000, "tags": [ "NOMEN" ] }, { "uuid": "b7bfc831-0435-4a5b-b63b-384d07de3e81", "citation": "SRS import [DF85J9S55Z]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=DF85J9S55Z", "doc_type": "SRS", "public_domain": true, "document_date": 1493391594000, "tags": [ "NOMEN" ] }, { "uuid": "cf16c9e4-abeb-4655-8bec-b6ce05761028", "citation": "STIGMASTERYL SUCCINATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "71d7aab0-5b6b-80dd-a30f-a7b7e3199249", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=86674-63-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "31840714-29a4-44c6-a776-c0e804a40b5b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "569814a8-97ba-482b-ad7b-7f2e1c9a9c6c", "id": "569814a8-97ba-482b-ad7b-7f2e1c9a9c6c", "molfile": "\n Marvin 01132104302D \n\n 37 40 0 0 1 0 999 V2000\n 14.2676 -2.8537 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 14.2589 -2.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9677 -1.6133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5588 -3.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8441 -2.8566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1295 -3.2692 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 11.4150 -2.8596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1324 -4.0941 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 12.6089 -4.7710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1092 -5.4333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3277 -5.1690 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 10.6073 -5.5698 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 10.6073 -6.3949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8927 -6.8045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1781 -6.3891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4663 -6.7958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7604 -6.3891 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 7.7604 -5.5641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4663 -5.1429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1809 -5.5641 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 9.1781 -4.7419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8955 -5.1515 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 9.9043 -4.3178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6306 -3.9169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3452 -4.3382 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 11.3423 -3.5160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0429 -6.7929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3283 -6.3804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3253 -5.5583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6136 -6.7929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6135 -7.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8989 -8.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1848 -7.6180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8988 -8.8555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9822 -3.2662 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.9735 -4.0883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6911 -2.8479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 4 1 0 0 0 0\n 1 35 1 1 0 0 0\n 3 2 1 0 0 0 0\n 4 5 2 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 6 0 0 0\n 6 8 1 0 0 0 0\n 8 9 1 1 0 0 0\n 8 25 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 1 1 0 0 0\n 11 12 1 0 0 0 0\n 25 11 1 0 0 0 0\n 12 13 1 6 0 0 0\n 12 22 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 2 0 0 0 0\n 16 15 1 0 0 0 0\n 20 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 27 1 1 0 0 0\n 18 19 1 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 1 0 0 0\n 22 20 1 0 0 0 0\n 22 23 1 1 0 0 0\n 23 24 1 0 0 0 0\n 25 24 1 0 0 0 0\n 25 26 1 1 0 0 0\n 28 27 1 0 0 0 0\n 29 28 2 0 0 0 0\n 30 28 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 32 34 2 0 0 0 0\n 36 35 1 0 0 0 0\n 37 35 1 0 0 0 0\nM END", "smiles": "CC[C@H](/C=C/[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(=O)CCC(=O)O)C(C)C", "formula": "C33H52O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a2cc3436-8de5-43cb-81cf-9b536eaf7c3e" }, "defined_stereo": 9, "ez_centers": 1, "molecular_weight": "512.7648", "optical_activity": "UNSPECIFIED", "stereo_centers": 9 } ], "definition_level": "COMPLETE", "uuid": "551af3e8-f81f-4f60-aaaf-920d5e059f52", "version": "4", "structure": { "id": "c39570b2-76cd-40b3-8eb6-6974ac0af84d", "molfile": "\n Marvin 01132110072D \n\n 41 44 0 0 1 0 999 V2000\n 11.3452 -4.3382 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.1324 -4.0941 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.1295 -3.2692 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.2676 -2.8537 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.3277 -5.1690 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.6073 -5.5698 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.7604 -6.3891 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.1809 -5.5641 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.8955 -5.1515 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.3423 -3.5160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8471 -3.6788 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4150 -2.8596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8441 -2.8566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5588 -3.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2589 -2.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9677 -1.6133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9822 -3.2662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9735 -4.0883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6911 -2.8479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6089 -4.7710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1092 -5.4333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3191 -5.9911 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6045 -4.7449 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6073 -6.3949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8927 -6.8045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1781 -6.3891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4663 -6.7958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7604 -5.5641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4663 -5.1429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1781 -4.7419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9043 -4.3178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6306 -3.9169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8927 -5.9737 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0429 -6.7929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3283 -6.3804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6136 -6.7929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6135 -7.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8989 -8.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1848 -7.6180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8988 -8.8555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3253 -5.5583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 5 1 1 0 0 0 0\n 6 5 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 6 1 0 0 0 0\n 1 10 1 1 0 0 0\n 2 11 1 6 0 0 0\n 3 12 1 6 0 0 0\n 13 3 1 0 0 0 0\n 4 14 1 0 0 0 0\n 14 13 2 0 0 0 0\n 4 15 1 1 0 0 0\n 16 15 1 0 0 0 0\n 17 4 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 17 1 0 0 0 0\n 20 2 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 5 1 0 0 0 0\n 5 22 1 6 0 0 0\n 6 23 1 1 0 0 0\n 24 6 1 0 0 0 0\n 25 24 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 8 1 0 0 0 0\n 7 27 1 0 0 0 0\n 27 26 1 0 0 0 0\n 7 28 1 0 0 0 0\n 29 8 1 0 0 0 0\n 28 29 1 0 0 0 0\n 8 30 1 1 0 0 0\n 31 9 1 0 0 0 0\n 32 1 1 0 0 0 0\n 31 32 1 0 0 0 0\n 9 33 1 6 0 0 0\n 7 34 1 1 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 2 0 0 0 0\n 38 40 1 0 0 0 0\n 41 35 2 0 0 0 0\nM END", "smiles": "CC[C@H](/C=C/[C@@H](C)[C@@]1([H])CC[C@@]2([H])[C@]3([H])CC=C4C[C@H](CC[C@]4(C)[C@@]3([H])CC[C@]12C)OC(=O)CCC(=O)O)C(C)C", "formula": "C33H52O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 9, "ez_centers": 1, "molecular_weight": "512.7648", "optical_activity": "UNSPECIFIED", "references": [ "b7bfc831-0435-4a5b-b63b-384d07de3e81", "89735dc3-3f51-4201-a6d2-c90545f2b7fd" ], "stereo_centers": 9 }, "unii": "DF85J9S55Z" } ] }